PL45056B1 - - Google Patents
Download PDFInfo
- Publication number
- PL45056B1 PL45056B1 PL45056A PL4505659A PL45056B1 PL 45056 B1 PL45056 B1 PL 45056B1 PL 45056 A PL45056 A PL 45056A PL 4505659 A PL4505659 A PL 4505659A PL 45056 B1 PL45056 B1 PL 45056B1
- Authority
- PL
- Poland
- Prior art keywords
- sulfamidophenyl
- aminophenol
- monoazo
- dyes
- dye
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 7
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 6
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 claims description 3
- 239000000987 azo dye Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 claims description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 239000004952 Polyamide Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WXHJBJSTOBNTJC-UHFFFAOYSA-I C(C=1C(O)=CC=CC1)(=O)[O-].[Cr+3].[K+].[Na+].C(C=1C(O)=CC=CC1)(=O)[O-].C(C=1C(O)=CC=CC1)(=O)[O-].C(C=1C(O)=CC=CC1)(=O)[O-].C(C=1C(O)=CC=CC1)(=O)[O-] Chemical compound C(C=1C(O)=CC=CC1)(=O)[O-].[Cr+3].[K+].[Na+].C(C=1C(O)=CC=CC1)(=O)[O-].C(C=1C(O)=CC=CC1)(=O)[O-].C(C=1C(O)=CC=CC1)(=O)[O-].C(C=1C(O)=CC=CC1)(=O)[O-] WXHJBJSTOBNTJC-UHFFFAOYSA-I 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL45056B1 true PL45056B1 (Direct) | 1961-08-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1956142A1 (de) | Neue Azofarbstoffe und Verfahren zu deren Herstellung | |
| JPS5851925B2 (ja) | 人間の毛髪染色剤 | |
| PL45056B1 (Direct) | ||
| US3062806A (en) | 1:2-metal complexes of monoazo dyes containing a 1, 2-diphenyl-3, 5-diketopyrazolidine coupling component | |
| EP0005207B1 (de) | Bis-1:2-chrom-disazo-bisazomethinfarbstoffe, deren Herstellung und deren Verwendung zum Färben von Leder | |
| US2080191A (en) | Complex metal compounds of disazo dyestuffs | |
| GB875946A (en) | Water-soluble azo dyestuffs containing ethene sulphonic acid amide groups | |
| DE2201030A1 (de) | Azofarbstoffe,deren Herstellung und Verwendung | |
| US3933785A (en) | Azo compounds | |
| CH661276A5 (de) | Chrom- oder kobaltkomplexe und deren herstellung. | |
| US4029643A (en) | Chromium containing azo dyes | |
| CH656140A5 (de) | Faserreaktive chromkomplexe und deren herstellung. | |
| CH656142A5 (de) | Faserreaktive chromkomplexe und deren herstellung. | |
| GB1039379A (en) | Reactive dyestuffs containing a quinoxaline nucleus | |
| CA1077927A (en) | Heavy metal complex dyes, process for their manufacture and use thereof | |
| CH662357A5 (de) | Faserreaktive chrom- oder kobaltkomplexe und deren herstellung. | |
| DE2343115A1 (de) | Neue anthrachinonfarbstoffe, deren herstellung und verwendung | |
| JPH0239543B2 (Direct) | ||
| DE1136037B (de) | Verfahren zur Herstellung metallhaltiger Azofarbstoffe | |
| DE610625C (de) | Verfahren zur Herstellung faerbender Umwandlungsprodukte von Azofarbstoffen | |
| JPS6249908B2 (Direct) | ||
| DE731755C (de) | Verfahren zur Herstellung von Azofarbstoffen auf tierischen Fasern und natuerlichen oder kuenstlichen Cellulosefasern sowie auf Mischungen von tierischen Fasern mit Cellulosefasern | |
| DE1644076A1 (de) | Verfahren zur Herstellung von faserreaktiven Farbstoffen | |
| CH355240A (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| JPH02261864A (ja) | 非対称1:2型金属錯塩染料の製造方法 |