PL42548B1 - - Google Patents
Download PDFInfo
- Publication number
- PL42548B1 PL42548B1 PL42548A PL4254858A PL42548B1 PL 42548 B1 PL42548 B1 PL 42548B1 PL 42548 A PL42548 A PL 42548A PL 4254858 A PL4254858 A PL 4254858A PL 42548 B1 PL42548 B1 PL 42548B1
- Authority
- PL
- Poland
- Prior art keywords
- solvent
- benzyl
- esters
- benzyl alcohol
- benzyl chloride
- Prior art date
Links
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 235000019445 benzyl alcohol Nutrition 0.000 claims description 4
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims description 4
- 229940073608 benzyl chloride Drugs 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- -1 alkali metal salt Chemical class 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- ZCTQGTTXIYCGGC-UHFFFAOYSA-N Benzyl salicylate Chemical compound OC1=CC=CC=C1C(=O)OCC1=CC=CC=C1 ZCTQGTTXIYCGGC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- ABBQHOQBGMUPJH-UHFFFAOYSA-M Sodium salicylate Chemical compound [Na+].OC1=CC=CC=C1C([O-])=O ABBQHOQBGMUPJH-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940007550 benzyl acetate Drugs 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229960004025 sodium salicylate Drugs 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL42548B1 true PL42548B1 (enrdf_load_stackoverflow) | 1959-10-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2383581A (en) | Process for preparing fatty materials | |
| GB777609A (en) | Process for the production of terephthalic acid and of alkali metal salts and other derivatives thereof | |
| PL42548B1 (enrdf_load_stackoverflow) | ||
| DE3261136D1 (en) | Process for preparing alkanoic acids or esters thereof by rearrangement of alpha-halo-ketones in protic medium and in the presence of a non-noble metal salt | |
| US2305663A (en) | Method for preparing methacrylic acid esters | |
| US2836601A (en) | Decarboxylation treatment | |
| US2399959A (en) | Process of producing esters | |
| US3031501A (en) | Preparation of 2, 5-diarylamino-tereph-thalic acid and salts thereof | |
| US3746757A (en) | Process for manufacturing 6-nitro-2-oximinohexanoic acid derivatives | |
| SU566825A1 (ru) | Способ получени моноэфиров глицерина и одноосновной карбоновой кислоты | |
| US2791607A (en) | Preparation of dicarboxylic acids | |
| US2830077A (en) | 12 carboxamido-12 hydroxystearic acid and esters thereof | |
| US2441865A (en) | Process for the preparation of acid alkyl sulphates | |
| ES415912A1 (es) | Procedimiento de produccion de composisiones estables de sulfonatos metalicos solubles en aceites. | |
| US2443118A (en) | Preparation of trichloro acids | |
| DE3771673D1 (de) | Esterherstellung. | |
| ATE98213T1 (de) | Verfahren zur herstellung von 8hydroxyoktans|ure. | |
| SU128383A1 (ru) | Способ получени (-оксимоноэтилового эфира терефталевой кислоты | |
| SU85792A1 (ru) | Способ получени сложных эфиров путем этерификации | |
| SU105135A1 (ru) | Способ получени карбоновых кислот жирного и жирно-ароматического р дов | |
| SU128459A1 (ru) | Способ получени альфа-фтор-альфа, бета-дигалоидпропионовых кислот | |
| US2031037A (en) | Process for the manufacture of benzimidazoles having higher alkylgroups at the u-carbon atom | |
| SU123154A1 (ru) | Способ получени омега, омега1-диоксидиалкиловых эфиров двуосновных алифатических кислот | |
| SU132212A1 (ru) | Способ получени фторированных гликолей | |
| SU97002A1 (ru) | Способ получени производных омега-цианоацетофенона |