PL40649B1 - - Google Patents
Download PDFInfo
- Publication number
- PL40649B1 PL40649B1 PL40649A PL4064957A PL40649B1 PL 40649 B1 PL40649 B1 PL 40649B1 PL 40649 A PL40649 A PL 40649A PL 4064957 A PL4064957 A PL 4064957A PL 40649 B1 PL40649 B1 PL 40649B1
- Authority
- PL
- Poland
- Prior art keywords
- temperature
- dust
- firelight
- mixture
- nitrocellulose
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 8
- 239000000020 Nitrocellulose Substances 0.000 claims description 7
- 229920001220 nitrocellulos Polymers 0.000 claims description 7
- 239000000428 dust Substances 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- -1 ~ M * aphthalene * Substances 0.000 claims description 5
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical compound [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 claims description 4
- 239000002817 coal dust Substances 0.000 claims description 3
- 239000003721 gunpowder Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 239000004615 ingredient Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 6
- 229940079938 nitrocellulose Drugs 0.000 description 6
- 238000002485 combustion reaction Methods 0.000 description 5
- 239000003245 coal Substances 0.000 description 3
- DYSXLQBUUOPLBB-UHFFFAOYSA-N 2,3-dinitrotoluene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O DYSXLQBUUOPLBB-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- MAPJAZTUEHDPCT-UHFFFAOYSA-N aluminum sodium tetranitrate Chemical compound [N+](=O)([O-])[O-].[Na+].[Al+3].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] MAPJAZTUEHDPCT-UHFFFAOYSA-N 0.000 description 1
- 125000005577 anthracene group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL40649B1 true PL40649B1 (enExample) | 1957-10-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Thorpe | A dictionary of applied chemistry | |
| US4437862A (en) | Water-proof briquette and method for production thereof | |
| US3485599A (en) | Rapid ignition charcoal briquette | |
| US5320691A (en) | Charcoal-free black powder type granules and method of production | |
| PL40649B1 (enExample) | ||
| WO1995020699A2 (en) | Gas generation composition and method of making same | |
| US2423427A (en) | Deflagrating compositions | |
| US907007A (en) | Safety-explosive. | |
| EP0108111A1 (en) | METHOD FOR PRODUCING BRIKETT FROM STRAW OR SIMILAR MATERIAL. | |
| US20040088912A1 (en) | Solid agent for eliminating soot and in particular tars, and method for making same and uses thereof | |
| US1743941A (en) | Explosive powder | |
| US1820567A (en) | Explosive | |
| US2136205A (en) | Blasting powder | |
| US2471851A (en) | Manufacture of high-explosive compositions or charges | |
| US2128576A (en) | Blasting explosive cartridge or borehole charge | |
| RU2237083C1 (ru) | Топливное средство | |
| US2147540A (en) | Fuel composition | |
| US26602A (en) | Improvement in the manufacture of gunpowder | |
| DE899642C (de) | Verfahren zur Veredelung von Steinkohlen | |
| US1875932A (en) | Fuse composition | |
| US1820568A (en) | Explosive | |
| SU377315A1 (ru) | Термитная смесь | |
| US1444594A (en) | Process of impregnating plant tissues with ammonium nitrate for explosive purposes | |
| US1819456A (en) | Process op impregnating- plant tissues with sodium nitrate for explosive | |
| US541358A (en) | Composition of matter for kindling fires |