PL35627B1 - - Google Patents
Download PDFInfo
- Publication number
- PL35627B1 PL35627B1 PL35627A PL3562751A PL35627B1 PL 35627 B1 PL35627 B1 PL 35627B1 PL 35627 A PL35627 A PL 35627A PL 3562751 A PL3562751 A PL 3562751A PL 35627 B1 PL35627 B1 PL 35627B1
- Authority
- PL
- Poland
- Prior art keywords
- sulfonic acid
- dye
- naphthylamino
- ethoxy
- acids
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 7
- -1 alkali metal salts Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 4
- 150000001989 diazonium salts Chemical class 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims description 2
- 238000010168 coupling process Methods 0.000 claims description 2
- 238000005859 coupling reaction Methods 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- RUFPHBVGCFYCNW-UHFFFAOYSA-N alpha-aminonaphthalene Natural products C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 235000002639 sodium chloride Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QEZZCWMQXHXAFG-UHFFFAOYSA-N 8-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1 QEZZCWMQXHXAFG-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000001046 green dye Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- CHZLVSBMXZSPNN-UHFFFAOYSA-N 2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(C)=C1 CHZLVSBMXZSPNN-UHFFFAOYSA-N 0.000 description 1
- TUOWYJFPLMIKCX-UHFFFAOYSA-N 2-ethoxynaphthalen-1-amine Chemical compound C1=CC=CC2=C(N)C(OCC)=CC=C21 TUOWYJFPLMIKCX-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- QYFYIOWLBSPSDM-UHFFFAOYSA-N 6-aminonaphthalen-1-ol Chemical compound OC1=CC=CC2=CC(N)=CC=C21 QYFYIOWLBSPSDM-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- YNZVGELMVWVCDF-UHFFFAOYSA-N NC=1C=C(C(=O)C2=C(C3=CC(=CC(=C3C=C2)O)S(=O)(=O)O)N)C=CC1 Chemical compound NC=1C=C(C(=O)C2=C(C3=CC(=CC(=C3C=C2)O)S(=O)(=O)O)N)C=CC1 YNZVGELMVWVCDF-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 239000001056 green pigment Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- RFZGGOLLJIVIOZ-UHFFFAOYSA-M potassium;2,5-dimethylbenzenesulfonate Chemical compound [K+].CC1=CC=C(C)C(S([O-])(=O)=O)=C1 RFZGGOLLJIVIOZ-UHFFFAOYSA-M 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL35627B1 true PL35627B1 (enExample) | 1952-12-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20190010330A1 (en) | An improved process for the preparation of isosulfan blue | |
| US2141893A (en) | Trifluoromethyl-aryl-sulphonic acids and a process of preparing them | |
| US2094224A (en) | Pyrene 3, 5, 8, 10-tetra-sulphonic acid and derivatives thereof | |
| PL35627B1 (enExample) | ||
| US1882562A (en) | Alcing cojcktond | |
| US2865908A (en) | Stilbene azo dyes | |
| US1159386A (en) | Yellow azo dye. | |
| Heertjes et al. | The preparation of some amino‐1, 4‐Benzodioxanes and AZO dyes derived therefrom | |
| DE2617062C2 (de) | Wasserlösliche Hydrazone der Phthalocyaninreihe, ihre Herstellung und Verwendung | |
| US2816884A (en) | Process for the production of aromatic o-hydroxydiazo compounds | |
| EP0574799B1 (de) | Verfahren zur Herstellung von faserreaktiven Formazanfarbstoffen sowie Aminophenole | |
| US1936721A (en) | Manufacture of ortho-nitro-phenyl-sulphones | |
| US2175815A (en) | Copper complex compounds of disazo dyestuffs of the stilbene series | |
| EP0213485B1 (de) | Verfahren zur Herstellung von Arylamino-nitro-phenyl-oxethylsulfonen | |
| US1935712A (en) | Ketone hydrazones, and process of making the same | |
| EP0402318B1 (de) | Verfahren zur Herstellung von faserreaktiven Formazanverbindungen | |
| US1003293A (en) | Monoazo dye for wool. | |
| US1931826A (en) | Compound of the carbazole-3.6-disulphonic acids series | |
| US2712005A (en) | Diazoamino compound | |
| DE2617087C3 (de) | Verfahren zur Herstellung von Phthalocyanin-Azofarbstoffen und ihre Verwendung zum Färben und Bedrucken von Zellulosematerialien, zellulosehaltigen Materialien, sowie natürlichen und synthetischen Polyamidmaterialien | |
| US1990018A (en) | Hydroxy fluoranthenes | |
| US2018801A (en) | Azo dyestuffs | |
| US2025170A (en) | 2-amino-3-bromo-anthraquinone-sulphonic acid and the alkali metal salts thereof and a process of preparing them | |
| DE2118494B2 (de) | Verfahren zur Herstellung von Diarylverbindungen | |
| US2093113A (en) | Amino-chrysene-sulphonic acids and a process of preparing them |