PH26849A - Longitudinal support sling - Google Patents
Longitudinal support sling Download PDFInfo
- Publication number
- PH26849A PH26849A PH39370A PH39370A PH26849A PH 26849 A PH26849 A PH 26849A PH 39370 A PH39370 A PH 39370A PH 39370 A PH39370 A PH 39370A PH 26849 A PH26849 A PH 26849A
- Authority
- PH
- Philippines
- Prior art keywords
- strap
- foot
- support structure
- outsole
- sling
- Prior art date
Links
- 210000002683 foot Anatomy 0.000 claims description 71
- 210000001872 metatarsal bone Anatomy 0.000 claims description 14
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 claims description 7
- 210000004744 fore-foot Anatomy 0.000 claims description 7
- 210000003195 fascia Anatomy 0.000 claims description 5
- 229920000728 polyester Polymers 0.000 claims description 5
- 210000003371 toe Anatomy 0.000 claims description 5
- 210000003041 ligament Anatomy 0.000 claims description 4
- 230000037396 body weight Effects 0.000 claims description 3
- 239000013589 supplement Substances 0.000 claims description 3
- 210000002435 tendon Anatomy 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 2
- 239000004814 polyurethane Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims 4
- ZMRUPTIKESYGQW-UHFFFAOYSA-N propranolol hydrochloride Chemical compound [H+].[Cl-].C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 ZMRUPTIKESYGQW-UHFFFAOYSA-N 0.000 claims 1
- 210000000474 heel Anatomy 0.000 description 27
- 238000000034 method Methods 0.000 description 7
- 238000010276 construction Methods 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- 210000003423 ankle Anatomy 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 210000000988 bone and bone Anatomy 0.000 description 4
- 210000004233 talus Anatomy 0.000 description 4
- 238000004873 anchoring Methods 0.000 description 3
- 210000000459 calcaneus Anatomy 0.000 description 3
- 230000005021 gait Effects 0.000 description 3
- 238000011068 loading method Methods 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000004026 adhesive bonding Methods 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 210000000549 articulatio subtalaris Anatomy 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000000452 mid-foot Anatomy 0.000 description 1
- 210000000450 navicular bone Anatomy 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A43—FOOTWEAR
- A43B—CHARACTERISTIC FEATURES OF FOOTWEAR; PARTS OF FOOTWEAR
- A43B23/00—Uppers; Boot legs; Stiffeners; Other single parts of footwear
- A43B23/02—Uppers; Boot legs
-
- A—HUMAN NECESSITIES
- A43—FOOTWEAR
- A43B—CHARACTERISTIC FEATURES OF FOOTWEAR; PARTS OF FOOTWEAR
- A43B3/00—Footwear characterised by the shape or the use
- A43B3/12—Sandals; Strap guides thereon
- A43B3/126—Sandals; Strap guides thereon characterised by the shape or layout of the straps
Landscapes
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
- Finger-Pressure Massage (AREA)
- Orthopedics, Nursing, And Contraception (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/264,618 US4920664A (en) | 1988-10-31 | 1988-10-31 | Longitudinal support sling |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH26849A true PH26849A (en) | 1992-11-05 |
Family
ID=23006878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH39370A PH26849A (en) | 1988-10-31 | 1989-10-16 | Longitudinal support sling |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4920664A (de) |
| EP (1) | EP0367565A3 (de) |
| JP (1) | JPH02257901A (de) |
| KR (1) | KR900005915A (de) |
| AU (1) | AU625271B2 (de) |
| BR (1) | BR8905472A (de) |
| DK (1) | DK542589A (de) |
| EG (1) | EG18738A (de) |
| FI (1) | FI895150A0 (de) |
| GR (1) | GR1000596B (de) |
| IL (1) | IL91916A0 (de) |
| MX (1) | MX169389B (de) |
| NO (1) | NO173165C (de) |
| NZ (1) | NZ230845A (de) |
| PH (1) | PH26849A (de) |
| PT (1) | PT92124A (de) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5162041A (en) * | 1991-09-30 | 1992-11-10 | Simmons Patricia P | Footwear device allowing a wearer of orthopedic apparatus to go without conventional shoes |
| US5205054A (en) * | 1992-05-18 | 1993-04-27 | York Jr Harold D | Adjustable sandal |
| US5561919A (en) * | 1992-08-27 | 1996-10-08 | Gill; Yoram | Sandal having independenty adjustable straps |
| US5359789A (en) * | 1993-09-14 | 1994-11-01 | Michael Bell | Ice gripping sandal for use on other footwear |
| US5463823A (en) * | 1993-09-14 | 1995-11-07 | Bell; Michael | Sandal having heel retaining means for use on other footwear |
| US5533277A (en) * | 1994-08-26 | 1996-07-09 | Michael Bell | Footwear with adherent material release grooves |
| US5659978A (en) * | 1994-08-26 | 1997-08-26 | Michael Bell | Footwear having a sole with a toe strapping assembly |
| US5794360A (en) * | 1997-03-07 | 1998-08-18 | Michael Bell | Non-slip sandal for use on other footwear and having strapping means for enabling tightness adjustment and rapid disconnection |
| US6516538B2 (en) * | 2001-02-26 | 2003-02-11 | Spencer Kraft | Beach sandal |
| US7103993B2 (en) * | 2004-06-04 | 2006-09-12 | Deckers Outdoor Corporation | Independent adjustment for sandal single strap system |
| USD513447S1 (en) | 2005-01-05 | 2006-01-10 | Bernardo Footwear, L.L.C. | Sandal |
| US7908770B2 (en) * | 2005-08-22 | 2011-03-22 | Natalie Mallamohamad | Shoe accessory |
| US20070113424A1 (en) * | 2005-11-23 | 2007-05-24 | Michael Bell | Overshoes with raised inner surface portions and slip resistant sole portions for use on primary footwear |
| WO2009011874A2 (en) * | 2007-07-18 | 2009-01-22 | 2001 Brands, Inc. | Footwear with instep footstrap |
| US20120124860A1 (en) * | 2010-10-05 | 2012-05-24 | Waddel Lester Byron | Training sandal and method of use |
| SA114350696B1 (ar) * | 2014-08-17 | 2015-12-18 | نواب الدين غريب الدين آل نواب عبدالكافي | حذاء قابل للربط على الخصر |
| US10413013B1 (en) * | 2015-02-11 | 2019-09-17 | Angelina Bella Corona | Wrapped footwear and method of wrapping |
| US10874173B2 (en) * | 2017-09-12 | 2020-12-29 | Tina Richardson Wright | Adjustable anti-slippage shoe sling |
| US11607007B2 (en) | 2017-11-02 | 2023-03-21 | Oofos, Inc. | Insole and outsole two-piece shoe |
| US10617170B1 (en) | 2019-06-14 | 2020-04-14 | Stephen Arnold | Sandal or slip-on footwear with improved optional-use heel strap and related methods |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE545258A (de) * | ||||
| FR575736A (fr) * | 1924-01-11 | 1924-08-05 | Sandalette | |
| FR577499A (fr) * | 1924-02-20 | 1924-09-05 | Chaussure | |
| CH132292A (de) * | 1929-01-11 | 1929-04-15 | Tobler Heinrich | Fussbekleidung. |
| FR719850A (fr) * | 1931-07-08 | 1932-02-10 | Perfectionnements aux sabots à semelle rigide articulée | |
| US2190982A (en) * | 1938-02-26 | 1940-02-20 | Gilbert William Hall | Bath sandal |
| US2390685A (en) * | 1943-11-29 | 1945-12-11 | Frederick J Benson | Sandal |
| GB734833A (en) * | 1951-02-15 | 1955-08-10 | British Bata Shoe Co Ltd | Improvements relating to sandals and other footwear |
| US3001302A (en) * | 1959-09-23 | 1961-09-26 | Farley Aileen Benay | Broadly to wearing apparel and more particularly to footwear of the type known as a sandal or slipper |
| NL6618053A (de) * | 1966-12-22 | 1968-06-24 | ||
| DE1947245A1 (de) * | 1969-09-18 | 1971-03-25 | Scott Corser | Sandale |
| EP0176041A1 (de) * | 1984-09-20 | 1986-04-02 | Karl Lorenz Giuliani | Sandalen |
-
1988
- 1988-10-31 US US07/264,618 patent/US4920664A/en not_active Expired - Fee Related
-
1989
- 1989-09-29 NZ NZ230845A patent/NZ230845A/en unknown
- 1989-10-04 AU AU42550/89A patent/AU625271B2/en not_active Ceased
- 1989-10-06 IL IL91916A patent/IL91916A0/xx not_active IP Right Cessation
- 1989-10-16 PH PH39370A patent/PH26849A/en unknown
- 1989-10-25 MX MX018100A patent/MX169389B/es unknown
- 1989-10-26 BR BR898905472A patent/BR8905472A/pt not_active Application Discontinuation
- 1989-10-27 PT PT92124A patent/PT92124A/pt not_active Application Discontinuation
- 1989-10-27 GR GR890100698A patent/GR1000596B/el unknown
- 1989-10-29 EG EG51789A patent/EG18738A/xx active
- 1989-10-30 KR KR1019890015706A patent/KR900005915A/ko not_active Application Discontinuation
- 1989-10-30 NO NO894317A patent/NO173165C/no unknown
- 1989-10-30 FI FI895150A patent/FI895150A0/fi not_active Application Discontinuation
- 1989-10-31 EP EP19890311243 patent/EP0367565A3/de not_active Withdrawn
- 1989-10-31 DK DK542589A patent/DK542589A/da not_active Application Discontinuation
- 1989-10-31 JP JP1284656A patent/JPH02257901A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK542589A (da) | 1990-05-01 |
| EG18738A (en) | 1993-12-30 |
| US4920664A (en) | 1990-05-01 |
| NO894317D0 (no) | 1989-10-30 |
| MX169389B (es) | 1993-06-30 |
| IL91916A0 (en) | 1990-06-10 |
| DK542589D0 (da) | 1989-10-31 |
| EP0367565A2 (de) | 1990-05-09 |
| EP0367565A3 (de) | 1991-07-17 |
| AU4255089A (en) | 1990-05-03 |
| JPH02257901A (ja) | 1990-10-18 |
| NO173165B (no) | 1993-08-02 |
| AU625271B2 (en) | 1992-07-09 |
| NZ230845A (en) | 1992-09-25 |
| BR8905472A (pt) | 1990-05-29 |
| GR1000596B (el) | 1992-08-26 |
| FI895150A0 (fi) | 1989-10-30 |
| NO894317L (no) | 1990-05-02 |
| GR890100698A (en) | 1990-11-29 |
| NO173165C (no) | 1993-11-10 |
| KR900005915A (ko) | 1990-05-07 |
| PT92124A (pt) | 1990-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4860464A (en) | Transverse support sling | |
| US4920664A (en) | Longitudinal support sling | |
| US6606803B1 (en) | Footwear sole and arch strapping system | |
| US4794706A (en) | Dynamic transverse girth | |
| US4956927A (en) | Monolithic outsole | |
| US5915820A (en) | Shoe having an internal chassis | |
| EP0231118B1 (de) | Sportschuh | |
| US6311416B1 (en) | Therapeutic shoe | |
| JP3746043B2 (ja) | ブーツライナー | |
| EP0413719B1 (de) | Stützvorrichtung für fussknöchel | |
| US4817302A (en) | Sandal construction with improved strap adjustment | |
| US6393733B1 (en) | Shoe with arch support | |
| US20070261269A1 (en) | Underlay Strap System | |
| CN105286190A (zh) | 具有跟靠补足条带的鞋 | |
| US2932911A (en) | Sandals with flexible arch support | |
| US5924219A (en) | "Windlass" shoe | |
| EP1109467B1 (de) | Schuhwerk mit mittelfussriemensystem | |
| CN210445850U (zh) | 一种矫形皮鞋 | |
| JP3104939U (ja) | 足底部矯正帯 | |
| Healy et al. | Windlass" shoe |