PH12677A - Ring substituted 4-exe-and 4-thioxo-hexahydro-4h-pyrazino-(2,1-a)isoquinoline derivatives - Google Patents
Ring substituted 4-exe-and 4-thioxo-hexahydro-4h-pyrazino-(2,1-a)isoquinoline derivativesInfo
- Publication number
- PH12677A PH12677A PH17513A PH17513A PH12677A PH 12677 A PH12677 A PH 12677A PH 17513 A PH17513 A PH 17513A PH 17513 A PH17513 A PH 17513A PH 12677 A PH12677 A PH 12677A
- Authority
- PH
- Philippines
- Prior art keywords
- pyrazino
- exe
- thioxo
- hexahydro
- ring substituted
- Prior art date
Links
- OBXQPUZQZNBUIQ-UHFFFAOYSA-N 1,2,3,6,7,7a-hexahydropyrazino[2,1-a]isoquinoline-4-thione Chemical class C1=CC=CC2CCN3C(=S)CNCC3=C21 OBXQPUZQZNBUIQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2441261A DE2441261A1 (de) | 1974-08-28 | 1974-08-28 | Ringsubstituierte pyrazino-isochinolin-derivat und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH12677A true PH12677A (en) | 1979-07-11 |
Family
ID=5924323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH17513A PH12677A (en) | 1974-08-28 | 1975-08-28 | Ring substituted 4-exe-and 4-thioxo-hexahydro-4h-pyrazino-(2,1-a)isoquinoline derivatives |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4051243A (enExample) |
| JP (1) | JPS5168595A (enExample) |
| AT (1) | AT350055B (enExample) |
| BE (1) | BE832735A (enExample) |
| CH (3) | CH617934A5 (enExample) |
| DD (1) | DD121789A5 (enExample) |
| DE (1) | DE2441261A1 (enExample) |
| DK (1) | DK386175A (enExample) |
| EG (1) | EG12384A (enExample) |
| ES (1) | ES440509A1 (enExample) |
| FI (1) | FI752411A7 (enExample) |
| FR (1) | FR2282891A1 (enExample) |
| GB (1) | GB1479235A (enExample) |
| IE (1) | IE42218B1 (enExample) |
| IL (1) | IL47975A (enExample) |
| LU (1) | LU73263A1 (enExample) |
| NL (1) | NL7510173A (enExample) |
| NO (1) | NO752939L (enExample) |
| OA (1) | OA05094A (enExample) |
| PH (1) | PH12677A (enExample) |
| SE (1) | SE7509473L (enExample) |
| ZA (1) | ZA755480B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4141978A (en) * | 1973-12-17 | 1979-02-27 | Merck Patent Gesellschaft Mit Beschrankter Haftung | 2-Acyl-4-oxo-pyrazino-isoquinoline derivatives and process for the preparation thereof |
| US4196291A (en) * | 1973-12-17 | 1980-04-01 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | 2-Acyl-4-oxo-pyrazino-isoquinoline derivatives and process for the preparation thereof |
| US4120961A (en) * | 1974-08-28 | 1978-10-17 | E. Merck | Ring substituted pyrazino-isoquinoline derivatives and their preparation |
| FR2520740A1 (fr) * | 1982-01-29 | 1983-08-05 | Sanofi Sa | Procede pour la preparation d'acyl-2-hexahydro-1,3,4,6,7,11b-2h-pyrazino (2,1-a) isoquinoleinones-4 et intermediaires |
| US4517187A (en) * | 1982-10-18 | 1985-05-14 | Pennwalt Corporation | 1,3,4,6,7-11b-Hexahydro-7-phenyl-2H-pyrazino[2,1-a]isoquinolines methods of preparation, and use as antidepressants |
| EP0134984B1 (en) * | 1983-07-16 | 1988-07-13 | Beecham Group Plc | Benzazepine and benzoxazepine derivatives |
| US4772705A (en) * | 1985-07-25 | 1988-09-20 | Pennwalt Corporation | Processes for the preparation of trans 1,3,4,6,7,11b-hexahydro-7-aryl-2H-pyrazinol[2,1-a]isoquinolines |
| US20040131560A1 (en) * | 2002-10-04 | 2004-07-08 | The Procter & Gamble Company | Oral compositions and use thereof |
| UA95093C2 (uk) | 2005-12-07 | 2011-07-11 | Нікомед Фарма Ас | Спосіб одержання кальцієвмісної сполуки |
| TWI574941B (zh) * | 2007-06-12 | 2017-03-21 | Achaogen Inc | 抗菌劑 |
| CN101691367B (zh) * | 2009-08-31 | 2013-07-24 | 中国人民解放军第二军医大学 | 具有抗真菌活性的哌嗪并[2,1-a]异喹啉类化合物或其盐类 |
| WO2021041539A2 (en) * | 2019-08-28 | 2021-03-04 | Ferro Therapeutics, Inc. | Compounds and methods of use |
| AU2021335500A1 (en) | 2020-09-04 | 2023-05-04 | Elanco Us Inc. | Palatable formulations |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2362539C2 (de) * | 1973-12-17 | 1986-05-07 | Merck Patent Gmbh, 6100 Darmstadt | 2-Acyl-4-oxo-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isochinoline, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
-
1974
- 1974-08-28 DE DE2441261A patent/DE2441261A1/de not_active Withdrawn
-
1975
- 1975-08-21 IL IL47975A patent/IL47975A/xx unknown
- 1975-08-25 BE BE7000698A patent/BE832735A/xx unknown
- 1975-08-26 FR FR7526267A patent/FR2282891A1/fr active Granted
- 1975-08-26 SE SE7509473A patent/SE7509473L/xx unknown
- 1975-08-26 EG EG511/75A patent/EG12384A/xx active
- 1975-08-26 US US05/607,810 patent/US4051243A/en not_active Expired - Lifetime
- 1975-08-26 DD DD188026A patent/DD121789A5/xx unknown
- 1975-08-27 ZA ZA00755480A patent/ZA755480B/xx unknown
- 1975-08-27 AT AT663375A patent/AT350055B/de not_active IP Right Cessation
- 1975-08-27 DK DK386175A patent/DK386175A/da not_active Application Discontinuation
- 1975-08-27 LU LU73263A patent/LU73263A1/xx unknown
- 1975-08-27 ES ES440509A patent/ES440509A1/es not_active Expired
- 1975-08-27 NO NO752939A patent/NO752939L/no unknown
- 1975-08-27 FI FI752411A patent/FI752411A7/fi not_active Application Discontinuation
- 1975-08-27 CH CH1110675A patent/CH617934A5/de not_active IP Right Cessation
- 1975-08-27 IE IE1871/75A patent/IE42218B1/en unknown
- 1975-08-27 GB GB35342/75A patent/GB1479235A/en not_active Expired
- 1975-08-27 OA OA55595A patent/OA05094A/xx unknown
- 1975-08-28 NL NL7510173A patent/NL7510173A/xx not_active Application Discontinuation
- 1975-08-28 PH PH17513A patent/PH12677A/en unknown
- 1975-08-28 JP JP50104845A patent/JPS5168595A/ja active Pending
-
1979
- 1979-09-10 CH CH817079A patent/CH623584A5/de not_active IP Right Cessation
- 1979-09-10 CH CH817179A patent/CH624113A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE42218B1 (en) | 1980-07-02 |
| BE832735A (nl) | 1976-02-25 |
| CH617934A5 (enExample) | 1980-06-30 |
| DE2441261A1 (de) | 1976-03-18 |
| FI752411A7 (enExample) | 1976-02-29 |
| DD121789A5 (enExample) | 1976-08-20 |
| LU73263A1 (enExample) | 1977-04-15 |
| AT350055B (de) | 1979-05-10 |
| IL47975A0 (en) | 1975-11-25 |
| OA05094A (fr) | 1981-01-31 |
| NO752939L (enExample) | 1976-03-02 |
| CH623584A5 (enExample) | 1981-06-15 |
| IE42218L (en) | 1976-02-28 |
| IL47975A (en) | 1980-05-30 |
| AU8410675A (en) | 1977-02-24 |
| JPS5168595A (en) | 1976-06-14 |
| NL7510173A (nl) | 1976-03-02 |
| GB1479235A (en) | 1977-07-06 |
| CH624113A5 (enExample) | 1981-07-15 |
| SE7509473L (sv) | 1976-03-01 |
| ES440509A1 (es) | 1977-06-01 |
| US4051243A (en) | 1977-09-27 |
| EG12384A (en) | 1980-03-31 |
| ATA663375A (de) | 1978-10-15 |
| DK386175A (da) | 1976-02-29 |
| FR2282891A1 (fr) | 1976-03-26 |
| ZA755480B (en) | 1976-07-28 |
| FR2282891B1 (enExample) | 1980-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL53485A0 (en) | 2,3-dioxypiperazine derivatives | |
| ZA751986B (en) | 1,1-diaryl-1-oxadiazol-alkylamines | |
| IL46341A (en) | -aryl-4-substituted piperidino-alkanol derivatives | |
| PH12677A (en) | Ring substituted 4-exe-and 4-thioxo-hexahydro-4h-pyrazino-(2,1-a)isoquinoline derivatives | |
| GB1519811A (en) | Thienothaiazine derivatives | |
| AU1038176A (en) | 4-arylpiperidine derivatives | |
| AU7921975A (en) | Hexahydro-alpha-carboline derivatives | |
| GB1484049A (en) | 3-alkoxy-pyrazine-2-carboxamide derivatives | |
| GB1521320A (en) | Quinolisidine derivatives | |
| ZA753315B (en) | Oxacyclohexane derivatives | |
| ATA392274A (de) | Einrichtung zum antrieb einer durchbiegungsausgleichwalze | |
| GB1487457A (en) | 5,7-dihydroxy-tetraisoquinoline derivatives | |
| AU8332175A (en) | New hydroxyphenyl-butazone derivatives | |
| HK26379A (en) | 2,3-dioxopiperazine derivatives | |
| IL48002A0 (en) | 5-cyanoalkyl-1,3,4-thiadiazole-2-ylureas | |
| ZA75954B (en) | 1,2,4-triazolidin-3-ones | |
| GB1516534A (en) | Basically substituted 3,4-dihydro-2h-isoquinolin-1-thione | |
| ZA756191B (en) | 1,4-oxazepines | |
| GB1486646A (en) | Thieno-pyridine derivatives | |
| GR60361B (en) | New isoquinoline derivatives | |
| AU8273475A (en) | Isoquinoline derivatives | |
| PH11939A (en) | 5,6-dibenzyloxy-2-aminotetralol derivatives | |
| AU7683474A (en) | Substituted 4,4#@-dicyclohexylmethane derivatives | |
| ZM12174A1 (en) | 7h-indolizino (5,6,7-ij) isoquinoline derivatives | |
| IE41250B1 (en) | 2,2-bis-hydroxymethylalkanesulphonates |