PH10908A - Pregnanoic acid esters and the compositions thereof - Google Patents
Pregnanoic acid esters and the compositions thereofInfo
- Publication number
- PH10908A PH10908A PH15349A PH15349A PH10908A PH 10908 A PH10908 A PH 10908A PH 15349 A PH15349 A PH 15349A PH 15349 A PH15349 A PH 15349A PH 10908 A PH10908 A PH 10908A
- Authority
- PH
- Philippines
- Prior art keywords
- compositions
- acid esters
- pregnanoic acid
- pregnanoic
- esters
- Prior art date
Links
- GWZUYOSMTQIJMY-DIKHCDEOSA-N 2-[(8s,9s,10s,13r,14s,17r)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]acetic acid Chemical class C1CCC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)CC(O)=O)[C@@H]4[C@@H]3CCC21 GWZUYOSMTQIJMY-DIKHCDEOSA-N 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722264003 DE2264003C2 (de) | 1972-12-22 | 1972-12-22 | Neue Pregnansäure-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH10908A true PH10908A (en) | 1977-10-04 |
Family
ID=5865747
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH15349A PH10908A (en) | 1972-12-22 | 1973-12-20 | Pregnanoic acid esters and the compositions thereof |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE808985A (cs) |
| CS (1) | CS168467B2 (cs) |
| DE (1) | DE2264003C2 (cs) |
| HU (1) | HU171521B (cs) |
| NO (1) | NO140825C (cs) |
| PH (1) | PH10908A (cs) |
| RO (3) | RO71549A (cs) |
| SU (2) | SU555856A3 (cs) |
| ZA (1) | ZA739656B (cs) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2332663C2 (de) * | 1973-06-23 | 1986-07-31 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verwendung von Kortikoid-Wirkstoffen zur Inhalationstherapie |
| SE8506015D0 (sv) * | 1985-12-19 | 1985-12-19 | Draco Ab | Novel 16,17-acetalsubstituted pregnane 21-oic acid derivatives |
| WO1988007371A2 (en) * | 1987-03-25 | 1988-10-06 | The Rockefeller University | Prevention and treatment of the deleterious effects of exposing skin to the sun, and compositions therefor |
| US4897260A (en) * | 1987-05-22 | 1990-01-30 | The Rockefeller University | Compositions that affect suppression of cutaneous delayed hypersensitivity and products including same |
| US12410209B2 (en) * | 2021-06-29 | 2025-09-09 | Board Of Regents, The University Of Texas System | Modified glucocorticoids |
-
1972
- 1972-12-22 DE DE19722264003 patent/DE2264003C2/de not_active Expired
-
1973
- 1973-12-17 CS CS873173A patent/CS168467B2/cs unknown
- 1973-12-20 HU HU73SCHE458A patent/HU171521B/hu not_active IP Right Cessation
- 1973-12-20 PH PH15349A patent/PH10908A/en unknown
- 1973-12-21 RO RO7377073A patent/RO71549A/ro unknown
- 1973-12-21 NO NO491873A patent/NO140825C/no unknown
- 1973-12-21 RO RO7385690A patent/RO72490A/ro unknown
- 1973-12-21 BE BE139171A patent/BE808985A/xx not_active IP Right Cessation
- 1973-12-21 RO RO7385692A patent/RO75386A/ro unknown
- 1973-12-21 ZA ZA739656A patent/ZA739656B/xx unknown
-
1975
- 1975-03-21 SU SU2115267A patent/SU555856A3/ru active
- 1975-03-21 SU SU752116609A patent/SU615863A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SU555856A3 (ru) | 1977-04-25 |
| HU171521B (hu) | 1978-01-28 |
| RO75386A (ro) | 1980-11-30 |
| NO140825C (no) | 1979-11-21 |
| SU615863A3 (ru) | 1978-07-15 |
| DE2264003A1 (de) | 1974-07-04 |
| ZA739656B (en) | 1974-11-27 |
| BE808985A (fr) | 1974-06-21 |
| RO72490A (ro) | 1980-07-15 |
| DE2264003C2 (de) | 1982-11-04 |
| NO140825B (no) | 1979-08-13 |
| CS168467B2 (cs) | 1976-06-29 |
| RO71549A (ro) | 1982-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL35797A (en) | 3-propionyl-salicylic acid and the preparation of 3-methylflavone-8-carboxylic acid esters | |
| AU467716B2 (en) | Thiophophoric acid esters | |
| PH10908A (en) | Pregnanoic acid esters and the compositions thereof | |
| IE37558L (en) | Acetylsalicylic acid esters | |
| AU4278672A (en) | Aminothiophene-carboxylic acid esters | |
| GB1403550A (en) | 3-carbamoyl-3-hyeroxy-4-halobutyric acid and the preparation thereof | |
| EG10793A (en) | Indole-carboxylic acid derivatives and the preparation thereof | |
| CA988095A (en) | Perfluoroalkylalkylmonocarboxylic acid esters | |
| AU476015B2 (en) | Di-substituted-phenethylcarbamic acid esters | |
| CA854728A (en) | Stable esters | |
| PH10552A (en) | 1h-tetrazole-l-acetate esters and acids | |
| GB1400842A (en) | Oxaprostanoic acid derivatives and pharmaceutical compositions containing the same | |
| IL35471A (en) | Phosphonodithioic acid esters | |
| EG10995A (en) | Thiolphosphoric acid ester and their use as pesticides | |
| ZA732383B (en) | Novel dithio-and trithiophosphonic acid esters and their use as pesticides | |
| CA981683A (en) | Cycloalkano-quinolone-carboxylic acid esters and the preparation thereof | |
| ZA71415B (en) | New phenoxyacetic acid esters and the preparation thereof | |
| ZA703099B (en) | Halobenzoylpropionic acid esters | |
| AU2419071A (en) | Aliphatic esters | |
| IL35262A0 (en) | Novel 2-chlorethylphosphonothioic acid,its trithioic acid and esters | |
| CA848466A (en) | N-arylphthalamide acids and their manufacture | |
| CA853736A (en) | Amidothiolphosphoric acid esters and process for the preparation thereof | |
| AU465772B2 (en) | Triazolylphosphoric acid esters | |
| CA850134A (en) | Omega-fluoromethacrylic acid esters | |
| CA853227A (en) | Cyclopropanecarboxylyic acid esters |