PH10117A - Dibenzo(b,e)thiepine derivatives - Google Patents
Dibenzo(b,e)thiepine derivativesInfo
- Publication number
- PH10117A PH10117A PH15646*A PH15646A PH10117A PH 10117 A PH10117 A PH 10117A PH 15646 A PH15646 A PH 15646A PH 10117 A PH10117 A PH 10117A
- Authority
- PH
- Philippines
- Prior art keywords
- dibenzo
- thiepine
- derivatives
- thiepine derivatives
- Prior art date
Links
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 title 1
- 150000003551 thiepines Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
- C07D451/06—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D337/00—Heterocyclic compounds containing rings of more than six members having one sulfur atom as the only ring hetero atom
- C07D337/02—Seven-membered rings
- C07D337/06—Seven-membered rings condensed with carbocyclic rings or ring systems
- C07D337/10—Seven-membered rings condensed with carbocyclic rings or ring systems condensed with two six-membered rings
- C07D337/12—[b,e]-condensed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH433573A CH582699A5 (member.php) | 1973-03-26 | 1973-03-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH10117A true PH10117A (en) | 1976-08-26 |
Family
ID=4274168
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH15646*A PH10117A (en) | 1973-03-26 | 1974-03-21 | Dibenzo(b,e)thiepine derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4237296A (member.php) |
| JP (1) | JPS5024430A (member.php) |
| AT (1) | AT346500B (member.php) |
| BE (1) | BE812799A (member.php) |
| CA (1) | CA1029378A (member.php) |
| CH (1) | CH582699A5 (member.php) |
| DD (1) | DD110880A5 (member.php) |
| DE (1) | DE2414093A1 (member.php) |
| DK (1) | DK138453B (member.php) |
| ES (1) | ES424608A1 (member.php) |
| FR (1) | FR2223021B1 (member.php) |
| GB (1) | GB1449938A (member.php) |
| HU (1) | HU166774B (member.php) |
| IE (1) | IE39103B1 (member.php) |
| IL (1) | IL44489A (member.php) |
| NL (1) | NL7403891A (member.php) |
| PH (1) | PH10117A (member.php) |
| PL (1) | PL90661B1 (member.php) |
| SU (1) | SU506297A3 (member.php) |
| ZA (1) | ZA741941B (member.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5565731U (member.php) * | 1978-10-30 | 1980-05-07 | ||
| JPS5646939U (member.php) * | 1979-09-20 | 1981-04-25 | ||
| DE3211185A1 (de) * | 1982-03-26 | 1983-09-29 | Boehringer Ingelheim KG, 6507 Ingelheim | Neue quartaere 6,11-dihydro-dibenzo-(b,e)-thiepin-11-n-alkyl- norscopinether und verfahren zu deren herstellung |
| JPS58172833A (ja) * | 1982-04-01 | 1983-10-11 | 富士金属株式会社 | 速動サ−モスタツト |
| US4656173A (en) * | 1985-04-24 | 1987-04-07 | Bristol-Myers Company | Antipsychotic benzisothiazole S-oxide compound |
| SE9600408L (sv) * | 1996-02-05 | 1997-08-06 | Skf Ab | Rullningslager |
| US6221897B1 (en) | 1998-06-10 | 2001-04-24 | Aventis Pharma Deutschland Gmbh | Benzothiepine 1,1-dioxide derivatives, a process for their preparation, pharmaceuticals comprising these compounds, and their use |
| EP1937230A4 (en) * | 2005-08-02 | 2009-08-26 | Glaxo Group Ltd | M3-MUSCARIN ACETYLCHOLIN RECEPTOR ANTAGONISTS |
| KR102051031B1 (ko) | 2011-10-28 | 2019-12-02 | 루메나 파마수티컬즈, 인코포레이티드 | 고담혈증 및 담즙 정체성 간 질환 치료용 담즙산 재순환 억제제 |
| EP2771003B1 (en) | 2011-10-28 | 2017-04-19 | Lumena Pharmaceuticals LLC | Bile acid recycling inhibitors for treatment of pediatric cholestatic liver diseases |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH482719A (de) * | 1965-06-28 | 1969-12-15 | Sandoz Ag | Verfahren zur Herstellung neuer Tropanäther |
| GB1273823A (en) * | 1968-10-22 | 1972-05-10 | Soc Ind Fab Antibiotiques Sifa | New tropane derivatives their salts and process for preparation thereof |
| NL7109301A (member.php) * | 1970-07-15 | 1972-01-18 |
-
1973
- 1973-03-26 CH CH433573A patent/CH582699A5/xx not_active IP Right Cessation
-
1974
- 1974-03-18 DK DK148174AA patent/DK138453B/da unknown
- 1974-03-21 PH PH15646*A patent/PH10117A/en unknown
- 1974-03-22 NL NL7403891A patent/NL7403891A/xx unknown
- 1974-03-23 DE DE2414093A patent/DE2414093A1/de active Pending
- 1974-03-25 DD DD177433A patent/DD110880A5/xx unknown
- 1974-03-25 BE BE142429A patent/BE812799A/xx unknown
- 1974-03-25 CA CA195,871A patent/CA1029378A/en not_active Expired
- 1974-03-25 JP JP49032695A patent/JPS5024430A/ja active Pending
- 1974-03-25 AT AT242374A patent/AT346500B/de not_active IP Right Cessation
- 1974-03-25 PL PL1974169802A patent/PL90661B1/pl unknown
- 1974-03-25 SU SU2008022A patent/SU506297A3/ru active
- 1974-03-25 ES ES424608A patent/ES424608A1/es not_active Expired
- 1974-03-25 HU HUSA2615A patent/HU166774B/hu unknown
- 1974-03-25 IE IE00652/74A patent/IE39103B1/xx unknown
- 1974-03-25 IL IL44489A patent/IL44489A/en unknown
- 1974-03-26 FR FR7410274A patent/FR2223021B1/fr not_active Expired
- 1974-03-26 ZA ZA00741941A patent/ZA741941B/xx unknown
- 1974-03-26 GB GB1324074A patent/GB1449938A/en not_active Expired
-
1979
- 1979-01-29 US US06/007,229 patent/US4237296A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE812799A (fr) | 1974-09-25 |
| NL7403891A (member.php) | 1974-09-30 |
| HU166774B (member.php) | 1975-05-28 |
| CH582699A5 (member.php) | 1976-12-15 |
| ZA741941B (en) | 1975-11-26 |
| DE2414093A1 (de) | 1974-10-17 |
| FR2223021A1 (member.php) | 1974-10-25 |
| IL44489A0 (en) | 1974-06-30 |
| JPS5024430A (member.php) | 1975-03-15 |
| IL44489A (en) | 1977-01-31 |
| DK138453C (member.php) | 1979-03-19 |
| ES424608A1 (es) | 1976-10-16 |
| AT346500B (de) | 1978-11-10 |
| IE39103L (en) | 1974-09-26 |
| FR2223021B1 (member.php) | 1978-07-21 |
| SU506297A3 (ru) | 1976-03-05 |
| ATA242374A (de) | 1978-03-15 |
| DD110880A5 (member.php) | 1975-01-12 |
| CA1029378A (en) | 1978-04-11 |
| DK138453B (da) | 1978-09-11 |
| US4237296A (en) | 1980-12-02 |
| GB1449938A (en) | 1976-09-15 |
| AU6708874A (en) | 1975-09-25 |
| IE39103B1 (en) | 1978-08-02 |
| PL90661B1 (member.php) | 1977-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH11009A (en) | Triazolyl-o,n-acetals | |
| IL45644A (en) | 3-alkyl-1,9-dihydroxyhexa-hydrodibenzo(b,d)pyran derivatives | |
| ZA744095B (en) | Aminodibenzo <b,d> pyrans | |
| MW1474A1 (en) | Coumarin derivatives | |
| PH12737A (en) | Dibenzo(6,1)thiepin derivatives | |
| PH10117A (en) | Dibenzo(b,e)thiepine derivatives | |
| IL44859A0 (en) | Hydroxycoumarin derivatives | |
| ZA744364B (en) | 4,3-dihydro-2h-naphthalin-1-one-5-oxypropyl-piperazine derivatives | |
| GB1484291A (en) | 1,3-benzo-dioxole derivatives | |
| IL45525A0 (en) | Substituted benzofurans | |
| AU499937B2 (en) | DIBENZO / b, f / THIEPIN DERIVATIVES | |
| ZA74932B (en) | 7-alkyl-delta3,5-steroids | |
| PH12320A (en) | Dibenzo(b,d)pyranone dispersions | |
| ZA743304B (en) | 17beta-hydroxy-16,16-dimethylestr-4-en-3-one | |
| AU7612874A (en) | Benzopyran derivatives | |
| PH11734A (en) | 5-bromo-5-nitro-2-alkylsubstituted-1,3-dioxane | |
| AU7365674A (en) | Coumarin derivatives | |
| CS324474A2 (en) | Zpusob mercerace pasu tkaniny, obsahujici celulozu, kapalnym amoniakem a zarizeni k provadeni tohoto zpusobu | |
| ZA747367B (en) | 3,3a-dihydro-2h,9h-isoxazolo(3,2-b) (1,3) benzoxazin-9-ones | |
| AU487715B2 (en) | Dibenz (b,f)-azepines | |
| PH11232A (en) | Dibenzo(b,e)-thiepin derivatives | |
| AU478296B2 (en) | SUBSTITUTED DIBENZO [b,f] THIEPINS | |
| AU7264574A (en) | Dibenz (b,f)-azepines | |
| ZA742900B (en) | New 6-aza-1,4-benzoiazepines | |
| AU7448274A (en) | Benzene derivatives |