NZ526699A - 8-amino derivatives and their use in treating migraine - Google Patents
8-amino derivatives and their use in treating migraineInfo
- Publication number
- NZ526699A NZ526699A NZ526699A NZ52669902A NZ526699A NZ 526699 A NZ526699 A NZ 526699A NZ 526699 A NZ526699 A NZ 526699A NZ 52669902 A NZ52669902 A NZ 52669902A NZ 526699 A NZ526699 A NZ 526699A
- Authority
- NZ
- New Zealand
- Prior art keywords
- optionally substituted
- piperazin
- methyl
- oxo
- compound
- Prior art date
Links
- 208000019695 Migraine disease Diseases 0.000 title claims abstract description 7
- 206010027599 migraine Diseases 0.000 title claims abstract description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 245
- 238000000034 method Methods 0.000 claims abstract description 88
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 50
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 48
- 238000002360 preparation method Methods 0.000 claims abstract description 48
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 37
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 32
- 150000002367 halogens Chemical class 0.000 claims abstract description 32
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 25
- 125000003118 aryl group Chemical group 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 24
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 19
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 16
- 230000008569 process Effects 0.000 claims abstract description 16
- 125000002619 bicyclic group Chemical group 0.000 claims abstract description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 14
- 230000004927 fusion Effects 0.000 claims abstract description 14
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 12
- 125000001424 substituent group Chemical group 0.000 claims abstract description 12
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 11
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims abstract description 7
- 125000002950 monocyclic group Chemical group 0.000 claims abstract description 7
- 125000004426 substituted alkynyl group Chemical group 0.000 claims abstract description 7
- 125000005017 substituted alkenyl group Chemical group 0.000 claims abstract description 6
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims abstract description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims abstract description 5
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims abstract description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract 11
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims abstract 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 214
- 239000007787 solid Substances 0.000 claims description 170
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 105
- 239000000203 mixture Substances 0.000 claims description 101
- -1 propionyl-piperazin-l-yl Chemical group 0.000 claims description 93
- 238000006243 chemical reaction Methods 0.000 claims description 84
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 claims description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 51
- 229910001868 water Inorganic materials 0.000 claims description 49
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 46
- PHNDZBFLOPIMSM-UHFFFAOYSA-N 4-morpholin-4-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCOCC1 PHNDZBFLOPIMSM-UHFFFAOYSA-N 0.000 claims description 45
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 40
- 238000004949 mass spectrometry Methods 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 37
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 36
- 238000010992 reflux Methods 0.000 claims description 31
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 25
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 20
- 238000001914 filtration Methods 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 16
- 238000003756 stirring Methods 0.000 claims description 15
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 claims description 14
- 238000004587 chromatography analysis Methods 0.000 claims description 13
- 238000003818 flash chromatography Methods 0.000 claims description 13
- 239000000463 material Substances 0.000 claims description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 10
- 239000012044 organic layer Substances 0.000 claims description 9
- 241001465754 Metazoa Species 0.000 claims description 8
- 239000000741 silica gel Substances 0.000 claims description 8
- 229910002027 silica gel Inorganic materials 0.000 claims description 8
- 239000003480 eluent Substances 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 229910052763 palladium Inorganic materials 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 150000007942 carboxylates Chemical group 0.000 claims description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 2
- QOPVNWQGBQYBBP-UHFFFAOYSA-N chloroethyl chloroformate Chemical compound CC(Cl)OC(Cl)=O QOPVNWQGBQYBBP-UHFFFAOYSA-N 0.000 claims description 2
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 238000002560 therapeutic procedure Methods 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 2
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 claims 1
- 239000012317 TBTU Substances 0.000 claims 1
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 claims 1
- 238000007429 general method Methods 0.000 claims 1
- 238000003760 magnetic stirring Methods 0.000 claims 1
- DASZTFGYDXJWBT-UHFFFAOYSA-N quinoline-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=CC2=NC(C(=O)O)=CC=C21 DASZTFGYDXJWBT-UHFFFAOYSA-N 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 29
- 229910006074 SO2NH2 Inorganic materials 0.000 abstract 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 92
- 239000000243 solution Substances 0.000 description 82
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 72
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 66
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 60
- IBOJSHOMWQIFPZ-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CN(C)CCN1C1=CC=CC2=C1OC(C(O)=O)=CC2=O IBOJSHOMWQIFPZ-UHFFFAOYSA-N 0.000 description 56
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 52
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 51
- 239000000047 product Substances 0.000 description 50
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 46
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 39
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- 229910052757 nitrogen Inorganic materials 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- 235000019439 ethyl acetate Nutrition 0.000 description 31
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 30
- 150000002500 ions Chemical class 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 230000015572 biosynthetic process Effects 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 24
- 239000002585 base Substances 0.000 description 23
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 23
- UWFUUJFNWZLZIA-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C=12OC(C(O)=O)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 UWFUUJFNWZLZIA-UHFFFAOYSA-N 0.000 description 22
- 238000003786 synthesis reaction Methods 0.000 description 22
- 229940086542 triethylamine Drugs 0.000 description 22
- OTCAWDMXJIBVTK-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxo-n-(4-piperazin-1-ylphenyl)chromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCNCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 OTCAWDMXJIBVTK-UHFFFAOYSA-N 0.000 description 21
- 238000003556 assay Methods 0.000 description 21
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 19
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 18
- 150000001412 amines Chemical class 0.000 description 17
- 239000011541 reaction mixture Substances 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- PHAKLXIGVONDDJ-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(O)=O)=CC2=O PHAKLXIGVONDDJ-UHFFFAOYSA-N 0.000 description 16
- 229910052799 carbon Inorganic materials 0.000 description 16
- LJCVQZKMKTWSLM-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid Chemical compound C=12OC(C(O)=O)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 LJCVQZKMKTWSLM-UHFFFAOYSA-N 0.000 description 15
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 15
- 238000004458 analytical method Methods 0.000 description 15
- MDHBHFJQFPHMCH-UHFFFAOYSA-N methyl 8-bromo-6-methoxy-4-(2-trimethylsilylethoxymethoxy)quinoline-2-carboxylate Chemical compound C1=C(OC)C=C(Br)C2=NC(C(=O)OC)=CC(OCOCC[Si](C)(C)C)=C21 MDHBHFJQFPHMCH-UHFFFAOYSA-N 0.000 description 15
- QBOUWRKFJKMBRE-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(O)=O)=CC2=O QBOUWRKFJKMBRE-UHFFFAOYSA-N 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- GUWNNHQLQTXJKF-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(O)=O)=CC2=O GUWNNHQLQTXJKF-UHFFFAOYSA-N 0.000 description 13
- 238000005481 NMR spectroscopy Methods 0.000 description 13
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 12
- UIVDCKFQBZPAEB-UHFFFAOYSA-N 2h-chromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=C2C=CC(C(=O)O)OC2=C1 UIVDCKFQBZPAEB-UHFFFAOYSA-N 0.000 description 12
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 12
- WJUOUHSBDDDFDL-UHFFFAOYSA-N 5-amino-2-morpholin-4-ylbenzonitrile Chemical compound N#CC1=CC(N)=CC=C1N1CCOCC1 WJUOUHSBDDDFDL-UHFFFAOYSA-N 0.000 description 11
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 11
- 229910000024 caesium carbonate Inorganic materials 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 229920006395 saturated elastomer Polymers 0.000 description 11
- FQGIBHQUVCGEAC-UHFFFAOYSA-N 3-Fluoro-4-morpholinoaniline Chemical compound FC1=CC(N)=CC=C1N1CCOCC1 FQGIBHQUVCGEAC-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- 229910052801 chlorine Inorganic materials 0.000 description 10
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 10
- 230000006698 induction Effects 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- 239000000377 silicon dioxide Substances 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- WEHVQIQNGXWTME-UHFFFAOYSA-N (4-aminophenyl)-morpholin-4-ylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)N1CCOCC1 WEHVQIQNGXWTME-UHFFFAOYSA-N 0.000 description 9
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 208000035475 disorder Diseases 0.000 description 9
- 102000005962 receptors Human genes 0.000 description 9
- 108020003175 receptors Proteins 0.000 description 9
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 8
- YONINMPUXDRPJV-UHFFFAOYSA-N 6-methyl-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CN(C)CCN1C1=CC(C)=CC2=C1OC(C(O)=O)=CC2=O YONINMPUXDRPJV-UHFFFAOYSA-N 0.000 description 8
- VESSYLOQFSHMQS-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-3,4-dihydro-2h-chromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCOCC1)CC2 VESSYLOQFSHMQS-UHFFFAOYSA-N 0.000 description 8
- ARJQCAOTEZXQSD-UHFFFAOYSA-N 8-bromo-6-methoxy-4-oxo-1h-quinoline-2-carboxylic acid Chemical compound N1C(C(O)=O)=CC(=O)C2=CC(OC)=CC(Br)=C21 ARJQCAOTEZXQSD-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 8
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 8
- 125000001589 carboacyl group Chemical group 0.000 description 8
- 230000008878 coupling Effects 0.000 description 8
- 238000010168 coupling process Methods 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- RXFHRKPNLPBDGE-UHFFFAOYSA-N tert-butyl 4-(4-aminophenyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1=CC=C(N)C=C1 RXFHRKPNLPBDGE-UHFFFAOYSA-N 0.000 description 8
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical group CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 7
- HCDBHFCQLBZAAZ-UHFFFAOYSA-N 2-[4-(4-aminophenyl)piperazin-1-yl]ethanol Chemical compound C1=CC(N)=CC=C1N1CCN(CCO)CC1 HCDBHFCQLBZAAZ-UHFFFAOYSA-N 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- RQXQMUUSQGCLPL-UHFFFAOYSA-N 4-thiomorpholin-4-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCSCC1 RQXQMUUSQGCLPL-UHFFFAOYSA-N 0.000 description 7
- 229910052786 argon Inorganic materials 0.000 description 7
- 230000003197 catalytic effect Effects 0.000 description 7
- 229910052731 fluorine Inorganic materials 0.000 description 7
- 239000011737 fluorine Substances 0.000 description 7
- 239000012528 membrane Substances 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 239000002243 precursor Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 230000003595 spectral effect Effects 0.000 description 7
- 238000012549 training Methods 0.000 description 7
- HGKMBDIMUDDXFR-UHFFFAOYSA-N 1-[4-(4-aminophenyl)piperazin-1-yl]propan-1-one Chemical compound C1CN(C(=O)CC)CCN1C1=CC=C(N)C=C1 HGKMBDIMUDDXFR-UHFFFAOYSA-N 0.000 description 6
- WWWQCGABIADKJH-UHFFFAOYSA-N 2-chloro-5-piperazin-1-ylbenzonitrile Chemical compound C1=C(C#N)C(Cl)=CC=C1N1CCNCC1 WWWQCGABIADKJH-UHFFFAOYSA-N 0.000 description 6
- GUHAESDUWKZLSR-UHFFFAOYSA-N 6-chloro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1CN(C)CCN1C1=CC(Cl)=CC2=C1OC(C(O)=O)=CC2=O GUHAESDUWKZLSR-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000000556 agonist Substances 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 230000035939 shock Effects 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 5
- VAVOYRCCWLRTMS-UHFFFAOYSA-N 4-piperazin-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCNCC1 VAVOYRCCWLRTMS-UHFFFAOYSA-N 0.000 description 5
- WCFKSHDZKWZMTG-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-4-oxo-2,3-dihydrochromene-2-carboxylic acid Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(O)=O)CC2=O WCFKSHDZKWZMTG-UHFFFAOYSA-N 0.000 description 5
- YIJAIKBZFMHNEE-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)chromen-4-one Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC=CC2=O YIJAIKBZFMHNEE-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- 230000027455 binding Effects 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical group IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 235000015320 potassium carbonate Nutrition 0.000 description 5
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 239000003981 vehicle Substances 0.000 description 5
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 4
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 4
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 4
- ULKCUYKEDPHGBA-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxo-n-(4-piperazin-1-ylphenyl)chromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCNCC1)=CC2=O ULKCUYKEDPHGBA-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- XNSFDKWUTGIHOI-UHFFFAOYSA-N 8-bromo-6-methoxy-4-(2-trimethylsilylethoxymethoxy)quinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=C(OCOCC[Si](C)(C)C)C2=CC(OC)=CC(Br)=C21 XNSFDKWUTGIHOI-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- 239000007983 Tris buffer Substances 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- 125000005236 alkanoylamino group Chemical group 0.000 description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 230000001430 anti-depressive effect Effects 0.000 description 4
- 239000000935 antidepressant agent Substances 0.000 description 4
- 229940005513 antidepressants Drugs 0.000 description 4
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 4
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical compound COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 4
- 239000006196 drop Substances 0.000 description 4
- 125000001072 heteroaryl group Chemical group 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 229940076279 serotonin Drugs 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- PVACYTXIZCNKCX-UITAMQMPSA-N (z)-2-(2-bromo-4-methoxyphenoxy)but-2-enedioic acid Chemical compound COC1=CC=C(O\C(=C/C(O)=O)C(O)=O)C(Br)=C1 PVACYTXIZCNKCX-UITAMQMPSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- QUZMCJMGHMRZHA-UHFFFAOYSA-N 1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCN1C1=CC=C([N+]([O-])=O)C=C1 QUZMCJMGHMRZHA-UHFFFAOYSA-N 0.000 description 3
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 3
- FXHRAKUEZPSMLJ-UHFFFAOYSA-N 1-methyl-1,4-diazepane Chemical compound CN1CCCNCC1 FXHRAKUEZPSMLJ-UHFFFAOYSA-N 0.000 description 3
- VIIQBVNBFQUOTO-UHFFFAOYSA-N 1-methylsulfonyl-4-(4-nitrophenyl)piperazine Chemical compound C1CN(S(=O)(=O)C)CCN1C1=CC=C([N+]([O-])=O)C=C1 VIIQBVNBFQUOTO-UHFFFAOYSA-N 0.000 description 3
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 3
- ZJWLMZURLIHVHE-UHFFFAOYSA-N 3-morpholin-4-ylaniline Chemical compound NC1=CC=CC(N2CCOCC2)=C1 ZJWLMZURLIHVHE-UHFFFAOYSA-N 0.000 description 3
- DFLQDPGZILSRHW-UHFFFAOYSA-N 4-(4-methylsulfonylpiperazin-1-yl)aniline Chemical compound C1CN(S(=O)(=O)C)CCN1C1=CC=C(N)C=C1 DFLQDPGZILSRHW-UHFFFAOYSA-N 0.000 description 3
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 3
- SIGUQEKSFHISJA-UHFFFAOYSA-N 6-methyl-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid Chemical compound C1CN(C)CCN1C1=CC(C)=CC2=C1OC(C(O)=O)=CC2=O SIGUQEKSFHISJA-UHFFFAOYSA-N 0.000 description 3
- IMTPTJSFHZIEIX-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxo-2,3-dihydrochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCOCC1)CC2=O IMTPTJSFHZIEIX-UHFFFAOYSA-N 0.000 description 3
- YBDJBKGYPPJOFX-UHFFFAOYSA-N 8-bromo-4-chloro-6-methoxy-n-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide Chemical compound C1=C(Cl)C2=CC(OC)=CC(Br)=C2N=C1C(=O)NC(C=C1)=CC=C1N1CCOCC1 YBDJBKGYPPJOFX-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- 101100087528 Mus musculus Rhoj gene Proteins 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000012131 assay buffer Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Substances N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical class C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 238000006900 dealkylation reaction Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- YFHSRFBEAXPIFU-UHFFFAOYSA-N ethyl 8-(4-methylpiperazin-1-yl)-4-oxo-2,3-dihydrochromene-2-carboxylate Chemical compound C=12OC(C(=O)OCC)CC(=O)C2=CC=CC=1N1CCN(C)CC1 YFHSRFBEAXPIFU-UHFFFAOYSA-N 0.000 description 3
- CTZQDUNDLLYSFG-UHFFFAOYSA-N ethyl 8-bromo-4-oxochromene-2-carboxylate Chemical compound C1=CC(Br)=C2OC(C(=O)OCC)=CC(=O)C2=C1 CTZQDUNDLLYSFG-UHFFFAOYSA-N 0.000 description 3
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 3
- AQDMZIQDJNENRB-UHFFFAOYSA-N methyl 8-bromo-6-fluoro-4-methoxyquinoline-2-carboxylate Chemical compound C1=C(F)C=C(Br)C2=NC(C(=O)OC)=CC(OC)=C21 AQDMZIQDJNENRB-UHFFFAOYSA-N 0.000 description 3
- 239000002808 molecular sieve Substances 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000010183 spectrum analysis Methods 0.000 description 3
- 230000000638 stimulation Effects 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 2
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 2
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 2
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 2
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 2
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 2
- AWNXKZVIZARMME-UHFFFAOYSA-N 1-[[5-[2-[(2-chloropyridin-4-yl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-yl]amino]-2-methylpropan-2-ol Chemical compound N=1C(NCC(C)(O)C)=NC=C(C=2N=C(NC=3C=C(Cl)N=CC=3)N=CC=2)C=1CC1CC1 AWNXKZVIZARMME-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- SRQHYGVENNTRQB-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenoxy)but-2-enedioic acid Chemical compound OC(=O)C=C(C(O)=O)OC1=CC=C(F)C=C1Br SRQHYGVENNTRQB-UHFFFAOYSA-N 0.000 description 2
- SFXKFYFQUSRBID-UHFFFAOYSA-N 2-amino-5-morpholin-4-ylphenol Chemical compound C1=C(O)C(N)=CC=C1N1CCOCC1 SFXKFYFQUSRBID-UHFFFAOYSA-N 0.000 description 2
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- BQTMHUUWYHEPNQ-UHFFFAOYSA-N 2-methoxy-4-morpholin-4-ylaniline Chemical compound C1=C(N)C(OC)=CC(N2CCOCC2)=C1 BQTMHUUWYHEPNQ-UHFFFAOYSA-N 0.000 description 2
- DKECFAGKGYRYAT-UHFFFAOYSA-N 4-(3-nitrophenyl)morpholine Chemical compound [O-][N+](=O)C1=CC=CC(N2CCOCC2)=C1 DKECFAGKGYRYAT-UHFFFAOYSA-N 0.000 description 2
- IBLSFJWKZUWPEO-UHFFFAOYSA-N 4-(4-aminophenyl)piperazine-1-carboxylic acid Chemical compound C1=CC(N)=CC=C1N1CCN(C(O)=O)CC1 IBLSFJWKZUWPEO-UHFFFAOYSA-N 0.000 description 2
- MNIJKXKMAORFPF-UHFFFAOYSA-N 4-(4-nitrophenyl)piperazine-1-carboxylic acid Chemical compound C1CN(C(=O)O)CCN1C1=CC=C([N+]([O-])=O)C=C1 MNIJKXKMAORFPF-UHFFFAOYSA-N 0.000 description 2
- IRHIMRCEUXJBGP-UHFFFAOYSA-N 4-(4-nitrophenyl)thiomorpholine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCSCC1 IRHIMRCEUXJBGP-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- JCIDEANDDNSHQC-UHFFFAOYSA-N 4H-chromene Chemical compound C1=CC=C2CC=COC2=C1 JCIDEANDDNSHQC-UHFFFAOYSA-N 0.000 description 2
- VVDIMAMYKUTSCL-UHFFFAOYSA-N 5-amino-2-chlorobenzonitrile Chemical compound NC1=CC=C(Cl)C(C#N)=C1 VVDIMAMYKUTSCL-UHFFFAOYSA-N 0.000 description 2
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 2
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 2
- IXZBMAVJNJWLBA-UHFFFAOYSA-N 6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide Chemical compound C1=C(F)C=C2C(OC)=CC(C(=O)NC=3C=CC(=CC=3)N3CCOCC3)=NC2=C1N1CCN(C)CC1 IXZBMAVJNJWLBA-UHFFFAOYSA-N 0.000 description 2
- DCLJCEMLLBKMNJ-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxo-1h-quinoline-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1NC(C(=O)NC=1C=CC(=CC=1)N1CCOCC1)=CC2=O DCLJCEMLLBKMNJ-UHFFFAOYSA-N 0.000 description 2
- XFRKJVFIKNDCPI-UHFFFAOYSA-N 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxo-1h-quinoline-2-carboxamide Chemical compound C=12NC(C(=O)NC=3C=CC(=CC=3)N3CCOCC3)=CC(=O)C2=CC(OC)=CC=1N1CCCN(C)CC1 XFRKJVFIKNDCPI-UHFFFAOYSA-N 0.000 description 2
- PSAOLCBZHAWXPR-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxo-1h-quinoline-2-carboxamide Chemical compound C=12NC(C(=O)NC=3C=CC(=CC=3)N3CCOCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 PSAOLCBZHAWXPR-UHFFFAOYSA-N 0.000 description 2
- VJOXUHHWNWYSJM-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-n-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)S(C)(=O)=O)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 VJOXUHHWNWYSJM-UHFFFAOYSA-N 0.000 description 2
- NQEIDYFNDDTEMC-UHFFFAOYSA-N 8-bromo-4-(dimethylamino)-6-methoxyquinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)C=C(N(C)C)C2=CC(OC)=CC(Br)=C21 NQEIDYFNDDTEMC-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- RLJFTICUTYVZDG-UHFFFAOYSA-N Methiothepine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2CC1N1CCN(C)CC1 RLJFTICUTYVZDG-UHFFFAOYSA-N 0.000 description 2
- NGOKQNUZHYIRGL-UHFFFAOYSA-N NC(C=C1)=CC=C1N1CCNCC1.OC(C(F)(F)F)=O.OC(C(F)(F)F)=O Chemical compound NC(C=C1)=CC=C1N1CCNCC1.OC(C(F)(F)F)=O.OC(C(F)(F)F)=O NGOKQNUZHYIRGL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920002873 Polyethylenimine Polymers 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 125000005233 alkylalcohol group Chemical group 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 238000000540 analysis of variance Methods 0.000 description 2
- 239000002249 anxiolytic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical class 0.000 description 2
- 150000003857 carboxamides Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 230000001143 conditioned effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- BNMOONUYSLLMEM-LCYFTJDESA-N diethyl (z)-2-(2-bromo-4-methoxyphenoxy)but-2-enedioate Chemical compound CCOC(=O)\C=C(C(=O)OCC)/OC1=CC=C(OC)C=C1Br BNMOONUYSLLMEM-LCYFTJDESA-N 0.000 description 2
- STRNXFOUBFLVIN-UHFFFAOYSA-N diethyl but-2-ynedioate Chemical compound CCOC(=O)C#CC(=O)OCC STRNXFOUBFLVIN-UHFFFAOYSA-N 0.000 description 2
- ADCGBUJOCVCANI-UHFFFAOYSA-N dimethyl 2-(2-bromo-4-methoxyanilino)but-2-enedioate Chemical compound COC(=O)C=C(C(=O)OC)NC1=CC=C(OC)C=C1Br ADCGBUJOCVCANI-UHFFFAOYSA-N 0.000 description 2
- 239000012039 electrophile Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 2
- SKRLBAXWVCMQGQ-UHFFFAOYSA-N ethyl 6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylate Chemical compound C=12OC(C(=O)OCC)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 SKRLBAXWVCMQGQ-UHFFFAOYSA-N 0.000 description 2
- WCFUHGUOMFSIMA-UHFFFAOYSA-N ethyl 6-methyl-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylate Chemical compound C=12OC(C(=O)OCC)=CC(=O)C2=CC(C)=CC=1N1CCN(C)CC1 WCFUHGUOMFSIMA-UHFFFAOYSA-N 0.000 description 2
- JTUAWXYIMUHBRD-UHFFFAOYSA-N ethyl 8-bromo-5-methoxy-4-oxochromene-2-carboxylate Chemical compound C1=CC(Br)=C2OC(C(=O)OCC)=CC(=O)C2=C1OC JTUAWXYIMUHBRD-UHFFFAOYSA-N 0.000 description 2
- NIYBSDSIFPBWGM-UHFFFAOYSA-N ethyl 8-bromo-6-fluoro-4-oxochromene-2-carboxylate Chemical compound FC1=CC(Br)=C2OC(C(=O)OCC)=CC(=O)C2=C1 NIYBSDSIFPBWGM-UHFFFAOYSA-N 0.000 description 2
- RCVPYVWCNLJBMO-UHFFFAOYSA-N ethyl 8-bromo-6-methoxy-4-oxochromene-2-carboxylate Chemical compound COC1=CC(Br)=C2OC(C(=O)OCC)=CC(=O)C2=C1 RCVPYVWCNLJBMO-UHFFFAOYSA-N 0.000 description 2
- QMWCBNYGYPWUEO-UHFFFAOYSA-N ethyl 8-bromo-6-methyl-4-oxochromene-2-carboxylate Chemical compound CC1=CC(Br)=C2OC(C(=O)OCC)=CC(=O)C2=C1 QMWCBNYGYPWUEO-UHFFFAOYSA-N 0.000 description 2
- UQGSGJYFGJVLJU-UHFFFAOYSA-N ethyl 8-chloro-5-methyl-4-oxochromene-2-carboxylate Chemical compound C1=CC(Cl)=C2OC(C(=O)OCC)=CC(=O)C2=C1C UQGSGJYFGJVLJU-UHFFFAOYSA-N 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 2
- 229960004801 imipramine Drugs 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- LCEDQNDDFOCWGG-UHFFFAOYSA-N morpholine-4-carbaldehyde Chemical compound O=CN1CCOCC1 LCEDQNDDFOCWGG-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- BEESXOQCOHCEIK-UHFFFAOYSA-N n-(3-chloro-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=C(Cl)C(N3CCOCC3)=CC=1)=CC2=O BEESXOQCOHCEIK-UHFFFAOYSA-N 0.000 description 2
- WXZJZCJULFLLFW-UHFFFAOYSA-N n-(5-ethoxy-1,3-benzothiazol-2-yl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound N=1C2=CC(OCC)=CC=C2SC=1NC(=O)C(OC1=2)=CC(=O)C1=CC=CC=2N1CCN(C)CC1 WXZJZCJULFLLFW-UHFFFAOYSA-N 0.000 description 2
- PQVZDMNFIUORJR-UHFFFAOYSA-N n-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(S(=O)(=O)CC)CCN1C(C=C1)=CC=C1NC(=O)C1=CC(=O)C2=CC(OC)=CC(N3CCN(C)CC3)=C2O1 PQVZDMNFIUORJR-UHFFFAOYSA-N 0.000 description 2
- DYQTVVOUEIMKTI-UHFFFAOYSA-N n-[4-(cyanomethyl)phenyl]-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(CC#N)=CC=1)=CC2=O DYQTVVOUEIMKTI-UHFFFAOYSA-N 0.000 description 2
- VZTLTQYBIHRJPV-UHFFFAOYSA-N n-[4-[4-(dimethylsulfamoyl)piperazin-1-yl]phenyl]-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)S(=O)(=O)N(C)C)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 VZTLTQYBIHRJPV-UHFFFAOYSA-N 0.000 description 2
- GNOXPYACARZYMW-BHTRQJOGSA-N n-[4-methoxy-3-[4-(tritritiomethyl)piperazin-1-yl]phenyl]-3-methyl-4-pyridin-4-ylbenzamide Chemical compound C1CN(C([3H])([3H])[3H])CCN1C1=CC(NC(=O)C=2C=C(C)C(=CC=2)C=2C=CN=CC=2)=CC=C1OC GNOXPYACARZYMW-BHTRQJOGSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 238000000159 protein binding assay Methods 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000007660 quinolones Chemical class 0.000 description 2
- 239000002287 radioligand Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004434 sulfur atom Chemical class 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- AVAWMINJNRAQFS-ZCFIWIBFSA-N (3r)-n,n-dimethylpyrrolidin-3-amine Chemical compound CN(C)[C@@H]1CCNC1 AVAWMINJNRAQFS-ZCFIWIBFSA-N 0.000 description 1
- AVAWMINJNRAQFS-LURJTMIESA-N (3s)-n,n-dimethylpyrrolidin-3-amine Chemical compound CN(C)[C@H]1CCNC1 AVAWMINJNRAQFS-LURJTMIESA-N 0.000 description 1
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 1
- ZUKHOVWXUVAVEU-UITAMQMPSA-N (Z)-2-(2-chloro-5-methylphenoxy)but-2-enedioic acid Chemical compound CC1=CC=C(Cl)C(O\C(=C/C(O)=O)C(O)=O)=C1 ZUKHOVWXUVAVEU-UITAMQMPSA-N 0.000 description 1
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical compound C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- AVGHIQUXSVAJBC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.1]heptane Chemical compound C1C2CCN1NC2 AVGHIQUXSVAJBC-UHFFFAOYSA-N 0.000 description 1
- RUBQQRMAWLSCCJ-UHFFFAOYSA-N 1,2-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1 RUBQQRMAWLSCCJ-UHFFFAOYSA-N 0.000 description 1
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- CZLMRJZAHXYRIX-UHFFFAOYSA-N 1,3-dioxepane Chemical compound C1CCOCOC1 CZLMRJZAHXYRIX-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- QRAIXSHHSMHLNM-UHFFFAOYSA-N 1,4-dihydroquinoline-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CCC2=C1 QRAIXSHHSMHLNM-UHFFFAOYSA-N 0.000 description 1
- VWOJSRICSKDKAW-UHFFFAOYSA-N 1-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCNCC1 VWOJSRICSKDKAW-UHFFFAOYSA-N 0.000 description 1
- LNRCAHQXXTWOGC-UHFFFAOYSA-N 1-(6-piperazin-1-yl-2,3-dihydroindol-1-yl)ethanone Chemical compound C1=C2N(C(=O)C)CCC2=CC=C1N1CCNCC1 LNRCAHQXXTWOGC-UHFFFAOYSA-N 0.000 description 1
- AFVUJJNEILZYJQ-UHFFFAOYSA-N 1-[4-(4-aminophenyl)-1-piperazinyl]ethanone Chemical compound C1CN(C(=O)C)CCN1C1=CC=C(N)C=C1 AFVUJJNEILZYJQ-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- WMASLRCNNKMRFP-UHFFFAOYSA-N 1-fluoro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(F)=C1 WMASLRCNNKMRFP-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- ZCBIFHNDZBSCEP-UHFFFAOYSA-N 1H-indol-5-amine Chemical compound NC1=CC=C2NC=CC2=C1 ZCBIFHNDZBSCEP-UHFFFAOYSA-N 0.000 description 1
- OZIJESHLNXSUNE-UHFFFAOYSA-N 2,3-dihydrofuran;thiolane 1,1-dioxide Chemical compound C1CC=CO1.O=S1(=O)CCCC1 OZIJESHLNXSUNE-UHFFFAOYSA-N 0.000 description 1
- DDCBPJKVWMBNCC-UHFFFAOYSA-N 2,5-diethoxy-4-morpholin-4-ylaniline Chemical compound C1=C(N)C(OCC)=CC(N2CCOCC2)=C1OCC DDCBPJKVWMBNCC-UHFFFAOYSA-N 0.000 description 1
- GSUPYHWEFVSXBA-UHFFFAOYSA-N 2,5-dihydrofuran;oxolane Chemical compound C1CCOC1.C1OCC=C1 GSUPYHWEFVSXBA-UHFFFAOYSA-N 0.000 description 1
- ZEMZPXWZVTUONV-UHFFFAOYSA-N 2-(2-dicyclohexylphosphanylphenyl)-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 ZEMZPXWZVTUONV-UHFFFAOYSA-N 0.000 description 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 description 1
- LXCOJLYZRDMXFG-UHFFFAOYSA-N 2-(2h-chromen-2-yl)benzamide Chemical class NC(=O)C1=CC=CC=C1C1C=CC2=CC=CC=C2O1 LXCOJLYZRDMXFG-UHFFFAOYSA-N 0.000 description 1
- YCWRFIYBUQBHJI-UHFFFAOYSA-N 2-(4-aminophenyl)acetonitrile Chemical compound NC1=CC=C(CC#N)C=C1 YCWRFIYBUQBHJI-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- DDFYJUQMGHWQJC-UHFFFAOYSA-N 2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-8-(4-methylpiperazin-1-yl)chromen-4-one Chemical compound C1=CC(OC)=CC=C1N1CCN(C(=O)C=2OC3=C(N4CCN(C)CC4)C=CC=C3C(=O)C=2)CC1 DDFYJUQMGHWQJC-UHFFFAOYSA-N 0.000 description 1
- ZIYRDJLAJYTELF-UHFFFAOYSA-N 2-bromo-4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1Br ZIYRDJLAJYTELF-UHFFFAOYSA-N 0.000 description 1
- MEYRABVEYCFHHB-UHFFFAOYSA-N 2-bromo-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Br MEYRABVEYCFHHB-UHFFFAOYSA-N 0.000 description 1
- YBAGMTVKDRIMTB-UHFFFAOYSA-N 2-bromo-4-methoxyaniline Chemical compound COC1=CC=C(N)C(Br)=C1 YBAGMTVKDRIMTB-UHFFFAOYSA-N 0.000 description 1
- LTMSUXSPKZRMAB-UHFFFAOYSA-N 2-bromo-4-methoxyphenol Chemical compound COC1=CC=C(O)C(Br)=C1 LTMSUXSPKZRMAB-UHFFFAOYSA-N 0.000 description 1
- KHGMUWBYGFWGCZ-UHFFFAOYSA-N 2-bromo-5-methoxyphenol Chemical compound COC1=CC=C(Br)C(O)=C1 KHGMUWBYGFWGCZ-UHFFFAOYSA-N 0.000 description 1
- VADKRMSMGWJZCF-UHFFFAOYSA-N 2-bromophenol Chemical compound OC1=CC=CC=C1Br VADKRMSMGWJZCF-UHFFFAOYSA-N 0.000 description 1
- SMFHPCZZAAMJJO-UHFFFAOYSA-N 2-chloro-5-methylphenol Chemical compound CC1=CC=C(Cl)C(O)=C1 SMFHPCZZAAMJJO-UHFFFAOYSA-N 0.000 description 1
- ZGILLTVEEBNDOB-UHFFFAOYSA-N 2-chloro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C#N)=C1 ZGILLTVEEBNDOB-UHFFFAOYSA-N 0.000 description 1
- YMDZDFSUDFLGMX-UHFFFAOYSA-N 2-chloro-n-(2-chloroethyl)ethanamine;hydron;chloride Chemical compound [Cl-].ClCC[NH2+]CCCl YMDZDFSUDFLGMX-UHFFFAOYSA-N 0.000 description 1
- YLACBMHBZVYOAP-UHFFFAOYSA-N 2-fluoro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(F)C(C#N)=C1 YLACBMHBZVYOAP-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- RWMGFZRJYLSGJW-UHFFFAOYSA-N 2-morpholin-4-yl-5-nitrobenzonitrile Chemical compound N#CC1=CC([N+](=O)[O-])=CC=C1N1CCOCC1 RWMGFZRJYLSGJW-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- VMUXSMXIQBNMGZ-UHFFFAOYSA-N 3,4-dihydrocoumarin Chemical compound C1=CC=C2OC(=O)CCC2=C1 VMUXSMXIQBNMGZ-UHFFFAOYSA-N 0.000 description 1
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- BBUAXVLPFRRBQR-UHFFFAOYSA-N 3-chloro-4-morpholin-4-ylaniline Chemical compound ClC1=CC(N)=CC=C1N1CCOCC1 BBUAXVLPFRRBQR-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- SMOGUURTGJUNNJ-UHFFFAOYSA-N 4-(2,6-dimethylmorpholin-4-yl)aniline Chemical compound C1C(C)OC(C)CN1C1=CC=C(N)C=C1 SMOGUURTGJUNNJ-UHFFFAOYSA-N 0.000 description 1
- ZEQCFSSBZPZEFJ-UHFFFAOYSA-N 4-(2-fluoro-4-nitrophenyl)morpholine Chemical compound FC1=CC([N+](=O)[O-])=CC=C1N1CCOCC1 ZEQCFSSBZPZEFJ-UHFFFAOYSA-N 0.000 description 1
- IAJDSUYFELYZCS-UHFFFAOYSA-N 4-(4-nitrophenyl)morpholine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCOCC1 IAJDSUYFELYZCS-UHFFFAOYSA-N 0.000 description 1
- TVVMFPCZWFJVGN-UHFFFAOYSA-N 4-(dimethylamino)-6-methoxy-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide Chemical compound C=12N=C(C(=O)NC=3C=CC(=CC=3)N3CCOCC3)C=C(N(C)C)C2=CC(OC)=CC=1N1CCN(C)CC1 TVVMFPCZWFJVGN-UHFFFAOYSA-N 0.000 description 1
- RYDHKKHIFKWLMX-UHFFFAOYSA-N 4-(dimethylamino)-6-methoxy-8-(4-methylpiperazin-1-yl)quinoline-2-carboxylic acid Chemical compound C=12N=C(C(O)=O)C=C(N(C)C)C2=CC(OC)=CC=1N1CCN(C)CC1 RYDHKKHIFKWLMX-UHFFFAOYSA-N 0.000 description 1
- VJUKMTLBSFMMRH-UHFFFAOYSA-N 4-(thiadiazol-5-yl)aniline Chemical compound C1=CC(N)=CC=C1C1=CN=NS1 VJUKMTLBSFMMRH-UHFFFAOYSA-N 0.000 description 1
- ATMWWIZLBFRNGE-UHFFFAOYSA-N 4-[4-[[6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]-n,n-dimethylpiperazine-1-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)C(=O)N(C)C)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 ATMWWIZLBFRNGE-UHFFFAOYSA-N 0.000 description 1
- NDNQPOAHADMDQJ-UHFFFAOYSA-N 4-[4-[[8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxylic acid Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCN(CC1)C(O)=O)=CC2=O NDNQPOAHADMDQJ-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- KXFBGXZEKANBLZ-UHFFFAOYSA-M 4-ethoxy-4-oxobut-2-ynoate Chemical compound CCOC(=O)C#CC([O-])=O KXFBGXZEKANBLZ-UHFFFAOYSA-M 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- RVMGXWBCQGAWBR-UHFFFAOYSA-N 4-oxo-1-benzopyran-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)=CC(=O)C2=C1 RVMGXWBCQGAWBR-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- XJNZHICOWTVWOX-UHFFFAOYSA-N 5-(furan-2-yl)-1h-pyrazol-3-amine Chemical compound N1N=C(N)C=C1C1=CC=CO1 XJNZHICOWTVWOX-UHFFFAOYSA-N 0.000 description 1
- IAZMTRIOQHLMBC-UHFFFAOYSA-N 5-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid Chemical compound C1=2OC(C(O)=O)=CC(=O)C=2C(OC)=CC=C1N1CCN(C)CC1 IAZMTRIOQHLMBC-UHFFFAOYSA-N 0.000 description 1
- ZECBLTAUELLIGI-UHFFFAOYSA-N 5-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1=2OC(C(O)=O)=CC(=O)C=2C(OC)=CC=C1N1CCN(C)CC1 ZECBLTAUELLIGI-UHFFFAOYSA-N 0.000 description 1
- JKPWOPNZKYPRPZ-UHFFFAOYSA-N 5-methyl-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=C(C)C2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCOCC1)=CC2=O JKPWOPNZKYPRPZ-UHFFFAOYSA-N 0.000 description 1
- UOKKYJHDVFCDHJ-UHFFFAOYSA-N 6-chloro-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(Cl)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCOCC1)=CC2=O UOKKYJHDVFCDHJ-UHFFFAOYSA-N 0.000 description 1
- KSHNCDGHNYMUEZ-UHFFFAOYSA-N 6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)quinoline-2-carboxylic acid Chemical compound C1=C(F)C=C2C(OC)=CC(C(O)=O)=NC2=C1N1CCN(C)CC1 KSHNCDGHNYMUEZ-UHFFFAOYSA-N 0.000 description 1
- CKBARMWSFIJZTL-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxo-n-[4-(4-propanoylpiperazin-1-yl)phenyl]chromene-2-carboxamide Chemical compound C1CN(C(=O)CC)CCN1C(C=C1)=CC=C1NC(=O)C1=CC(=O)C2=CC(F)=CC(N3CCN(C)CC3)=C2O1 CKBARMWSFIJZTL-UHFFFAOYSA-N 0.000 description 1
- NQQADYHVPQOXBG-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCOCC1)=CC2=O NQQADYHVPQOXBG-UHFFFAOYSA-N 0.000 description 1
- RVCPHLYYKMGUHA-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-n-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCN(CC1)S(C)(=O)=O)=CC2=O RVCPHLYYKMGUHA-UHFFFAOYSA-N 0.000 description 1
- ZKCLCPGLCVROGN-UHFFFAOYSA-N 6-fluoro-8-(4-methylpiperazin-1-yl)-n-[4-(morpholine-4-carbonyl)phenyl]-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)C(=O)N1CCOCC1)=CC2=O ZKCLCPGLCVROGN-UHFFFAOYSA-N 0.000 description 1
- UNNMVNFLYJIILF-UHFFFAOYSA-N 6-fluoro-n-(3-fluoro-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=C(F)C(N3CCOCC3)=CC=1)=CC2=O UNNMVNFLYJIILF-UHFFFAOYSA-N 0.000 description 1
- NCGLHYIKYZIDOO-UHFFFAOYSA-N 6-fluoro-n-[4-[4-(3-hydroxypropanoyl)piperazin-1-yl]phenyl]-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCN(CC1)C(=O)CCO)=CC2=O NCGLHYIKYZIDOO-UHFFFAOYSA-N 0.000 description 1
- SLPCESKZSKOAHD-UHFFFAOYSA-N 6-methoxy-4-(methylamino)-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide Chemical compound C1=C(OC)C=C2C(NC)=CC(C(=O)NC=3C=CC(=CC=3)N3CCOCC3)=NC2=C1N1CCN(C)CC1 SLPCESKZSKOAHD-UHFFFAOYSA-N 0.000 description 1
- UZXPBWSXJDEFRY-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-1H-quinolin-4-one Chemical compound COC=1C=C2C(C=CNC2=C(C1)N1CCN(CC1)C)=O UZXPBWSXJDEFRY-UHFFFAOYSA-N 0.000 description 1
- UUXODKOFYSEECO-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxo-n-(4-thiomorpholin-4-ylphenyl)chromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCSCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 UUXODKOFYSEECO-UHFFFAOYSA-N 0.000 description 1
- BCRWOARSNFXIKQ-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxo-n-[4-[4-(pyrrolidine-1-carbonyl)piperazin-1-yl]phenyl]chromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)C(=O)N3CCCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 BCRWOARSNFXIKQ-UHFFFAOYSA-N 0.000 description 1
- HGONMOQJOSFAQP-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-n-(3-morpholin-4-ylphenyl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=C(C=CC=3)N3CCOCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 HGONMOQJOSFAQP-UHFFFAOYSA-N 0.000 description 1
- INHHEUBMKWEIMP-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-n-[4-(morpholine-4-carbonyl)phenyl]-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)C(=O)N3CCOCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 INHHEUBMKWEIMP-UHFFFAOYSA-N 0.000 description 1
- WLYZHIQPTLDJID-UHFFFAOYSA-N 6-methoxy-8-(4-methylpiperazin-1-yl)-n-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)C(=O)C(C)C)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 WLYZHIQPTLDJID-UHFFFAOYSA-N 0.000 description 1
- PHHGFYZUPLQVFP-UHFFFAOYSA-N 6-methoxy-8-[methyl-(1-methylpyrrolidin-3-yl)amino]-4-oxo-1h-quinoline-2-carboxylic acid Chemical compound C=12NC(C(O)=O)=CC(=O)C2=CC(OC)=CC=1N(C)C1CCN(C)C1 PHHGFYZUPLQVFP-UHFFFAOYSA-N 0.000 description 1
- KINCMVVLSPLAFW-UHFFFAOYSA-N 6-methoxy-n-(2-methoxy-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C(=CC(=CC=3)N3CCOCC3)OC)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 KINCMVVLSPLAFW-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- UAEVNALMPWFLMW-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-4-oxo-n-(4-piperazin-1-ylphenyl)chromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCNCC1)=CC2=O UAEVNALMPWFLMW-UHFFFAOYSA-N 0.000 description 1
- PWSBSIGMVBHVSW-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-4-oxo-n-(4-thiomorpholin-4-ylphenyl)chromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCSCC1)=CC2=O PWSBSIGMVBHVSW-UHFFFAOYSA-N 0.000 description 1
- IOTWKYQNMFTPDO-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-4-oxo-n-[4-(thiadiazol-5-yl)phenyl]chromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)C=1SN=NC=1)=CC2=O IOTWKYQNMFTPDO-UHFFFAOYSA-N 0.000 description 1
- JOTVIMKEWFDOKU-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-n-(3-morpholin-4-ylphenyl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=C(C=CC=1)N1CCOCC1)=CC2=O JOTVIMKEWFDOKU-UHFFFAOYSA-N 0.000 description 1
- PCCGRZHBZYAMQG-UHFFFAOYSA-N 8-(4-methylpiperazin-1-yl)-n-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCN(CC1)S(C)(=O)=O)=CC2=O PCCGRZHBZYAMQG-UHFFFAOYSA-N 0.000 description 1
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 1
- AAZPRRSFBHFTRO-UHFFFAOYSA-N 8-[ethyl-(1-ethylpyrrolidin-3-yl)amino]-6-methoxy-4-oxo-1h-quinoline-2-carboxylic acid Chemical compound C=1C(OC)=CC(C(C=C(N2)C(O)=O)=O)=C2C=1N(CC)C1CCN(CC)C1 AAZPRRSFBHFTRO-UHFFFAOYSA-N 0.000 description 1
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 229910015845 BBr3 Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- BNMOONUYSLLMEM-UKTHLTGXSA-N CCOC(=O)\C=C(C(=O)OCC)\OC1=CC=C(OC)C=C1Br Chemical compound CCOC(=O)\C=C(C(=O)OCC)\OC1=CC=C(OC)C=C1Br BNMOONUYSLLMEM-UKTHLTGXSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000699802 Cricetulus griseus Species 0.000 description 1
- 206010012289 Dementia Diseases 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 208000030814 Eating disease Diseases 0.000 description 1
- 208000017701 Endocrine disease Diseases 0.000 description 1
- 208000019454 Feeding and Eating disease Diseases 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 208000019430 Motor disease Diseases 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- OEAMMTKNHYQJSC-UHFFFAOYSA-N O1C2=CC=CC=C2C=CC1C(=O)NC(C=C1)=CC=C1N1CCNCC1 Chemical compound O1C2=CC=CC=C2C=CC1C(=O)NC(C=C1)=CC=C1N1CCNCC1 OEAMMTKNHYQJSC-UHFFFAOYSA-N 0.000 description 1
- AKQUAOVPKMIFMQ-UHFFFAOYSA-N O=C(C1=CCC2=CC=CC=C2O1)NC(C=C1)=CC=C1OC(C=C1)=CC=C1F Chemical compound O=C(C1=CCC2=CC=CC=C2O1)NC(C=C1)=CC=C1OC(C=C1)=CC=C1F AKQUAOVPKMIFMQ-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 101150111584 RHOA gene Proteins 0.000 description 1
- 101150054980 Rhob gene Proteins 0.000 description 1
- 201000001880 Sexual dysfunction Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000008484 agonism Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000000049 anti-anxiety effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- BKZJXSDQOIUIIG-UHFFFAOYSA-N argon mercury Chemical compound [Ar].[Hg] BKZJXSDQOIUIIG-UHFFFAOYSA-N 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000001297 coherence probe microscopy Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 238000005100 correlation spectroscopy Methods 0.000 description 1
- 230000001054 cortical effect Effects 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012067 demethylated product Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- YNIIQPHYNPKODT-UHFFFAOYSA-N diethyl 2-(2-bromo-4-fluorophenoxy)but-2-enedioate Chemical compound CCOC(=O)C=C(C(=O)OCC)OC1=CC=C(F)C=C1Br YNIIQPHYNPKODT-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- DMSHWWDRAYHEBS-UHFFFAOYSA-N dihydrocoumarin Natural products C1CC(=O)OC2=C1C=C(OC)C(OC)=C2 DMSHWWDRAYHEBS-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 235000014632 disordered eating Nutrition 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ACYBVPDZXFLXAF-UHFFFAOYSA-N ethyl 5-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylate Chemical compound C=12OC(C(=O)OCC)=CC(=O)C2=C(OC)C=CC=1N1CCN(C)CC1 ACYBVPDZXFLXAF-UHFFFAOYSA-N 0.000 description 1
- XGPLMENWBXFBJP-UHFFFAOYSA-N ethyl 5-methyl-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylate Chemical compound C=12OC(C(=O)OCC)=CC(=O)C2=C(C)C=CC=1N1CCN(C)CC1 XGPLMENWBXFBJP-UHFFFAOYSA-N 0.000 description 1
- GPSJHDVCATZHEO-UHFFFAOYSA-N ethyl 6-chloro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxylate Chemical compound C=12OC(C(=O)OCC)=CC(=O)C2=CC(Cl)=CC=1N1CCN(C)CC1 GPSJHDVCATZHEO-UHFFFAOYSA-N 0.000 description 1
- AGEZXAMFKYGIMT-UHFFFAOYSA-N ethyl 8-bromo-6-chloro-4-oxochromene-2-carboxylate Chemical compound ClC1=CC(Br)=C2OC(C(=O)OCC)=CC(=O)C2=C1 AGEZXAMFKYGIMT-UHFFFAOYSA-N 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 208000037870 generalized anxiety Diseases 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- NSLBVFGVRFVRRY-UHFFFAOYSA-N methyl 2-bromo-6-methoxy-4-(2-trimethylsilylethoxymethoxy)-1h-quinoline-2-carboxylate Chemical compound C1=C(OC)C=C2C(OCOCC[Si](C)(C)C)=CC(C(=O)OC)(Br)NC2=C1 NSLBVFGVRFVRRY-UHFFFAOYSA-N 0.000 description 1
- SAVOWTPNSKKFIM-UHFFFAOYSA-N methyl 6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)quinoline-2-carboxylate Chemical compound C12=NC(C(=O)OC)=CC(OC)=C2C=C(F)C=C1N1CCN(C)CC1 SAVOWTPNSKKFIM-UHFFFAOYSA-N 0.000 description 1
- IJLSJWULZRVDLY-UHFFFAOYSA-N methyl 8-bromo-6-methoxy-4-oxo-1h-quinoline-2-carboxylate Chemical compound COC1=CC(Br)=C2NC(C(=O)OC)=CC(=O)C2=C1 IJLSJWULZRVDLY-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- CILJSZLWPHTUIP-UHFFFAOYSA-N methyl quinoline-2-carboxylate Chemical compound C1=CC=CC2=NC(C(=O)OC)=CC=C21 CILJSZLWPHTUIP-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- VGGZQWDRWOXJTA-UHFFFAOYSA-N morpholin-4-yl-(4-nitrophenyl)methanone Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCOCC1 VGGZQWDRWOXJTA-UHFFFAOYSA-N 0.000 description 1
- CZGIEJXGCLWRPY-UHFFFAOYSA-N n,1-dimethylpyrrolidin-3-amine Chemical compound CNC1CCN(C)C1 CZGIEJXGCLWRPY-UHFFFAOYSA-N 0.000 description 1
- HVOYZOQVDYHUPF-UHFFFAOYSA-N n,n',n'-trimethylethane-1,2-diamine Chemical compound CNCCN(C)C HVOYZOQVDYHUPF-UHFFFAOYSA-N 0.000 description 1
- XHOADYKJSBCVBJ-UHFFFAOYSA-N n,n-diethylpyrrolidin-3-amine Chemical compound CCN(CC)C1CCNC1 XHOADYKJSBCVBJ-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- CHGSURZOPNCKLC-UHFFFAOYSA-N n-(1h-indol-5-yl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=C3C=CNC3=CC=1)=CC2=O CHGSURZOPNCKLC-UHFFFAOYSA-N 0.000 description 1
- ZPHWQDSBSNXICL-UHFFFAOYSA-N n-(2,5-diethoxy-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound CCOC=1C=C(NC(=O)C=2OC3=C(N4CCN(C)CC4)C=CC=C3C(=O)C=2)C(OCC)=CC=1N1CCOCC1 ZPHWQDSBSNXICL-UHFFFAOYSA-N 0.000 description 1
- FAVGWSMOAZOIAG-UHFFFAOYSA-N n-(2-hydroxy-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C(=CC(=CC=1)N1CCOCC1)O)=CC2=O FAVGWSMOAZOIAG-UHFFFAOYSA-N 0.000 description 1
- LDPAAUVXDYGOGA-UHFFFAOYSA-N n-(3-chloro-4-morpholin-4-ylphenyl)-6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=C(Cl)C(N3CCOCC3)=CC=1)=CC2=O LDPAAUVXDYGOGA-UHFFFAOYSA-N 0.000 description 1
- MKTATXMBNQQEPP-UHFFFAOYSA-N n-(3-chloro-4-morpholin-4-ylphenyl)-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=C(Cl)C(N4CCOCC4)=CC=3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 MKTATXMBNQQEPP-UHFFFAOYSA-N 0.000 description 1
- GTMPIIXAEKYVMU-UHFFFAOYSA-N n-(3-cyano-4-morpholin-4-ylphenyl)-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=C(C(N4CCOCC4)=CC=3)C#N)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 GTMPIIXAEKYVMU-UHFFFAOYSA-N 0.000 description 1
- REDZYUKDGKRRLA-UHFFFAOYSA-N n-(3-cyano-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=C(C(N3CCOCC3)=CC=1)C#N)=CC2=O REDZYUKDGKRRLA-UHFFFAOYSA-N 0.000 description 1
- FUCWDBMJSDTIMM-UHFFFAOYSA-N n-(3-fluoro-4-morpholin-4-ylphenyl)-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=C(F)C(N4CCOCC4)=CC=3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 FUCWDBMJSDTIMM-UHFFFAOYSA-N 0.000 description 1
- UNEVBSYBLUIAQV-UHFFFAOYSA-N n-(3-fluoro-4-morpholin-4-ylphenyl)-6-methyl-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(C)=CC2=C1OC(C(=O)NC=1C=C(F)C(N3CCOCC3)=CC=1)=CC2=O UNEVBSYBLUIAQV-UHFFFAOYSA-N 0.000 description 1
- JLRDOVQDLZEWNC-UHFFFAOYSA-N n-(3-fluoro-4-morpholin-4-ylphenyl)-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=C(F)C(N3CCOCC3)=CC=1)=CC2=O JLRDOVQDLZEWNC-UHFFFAOYSA-N 0.000 description 1
- XFIDNCDOWIZEOF-UHFFFAOYSA-N n-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CC(C)OC(C)C3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 XFIDNCDOWIZEOF-UHFFFAOYSA-N 0.000 description 1
- RXOVDNILFGRNMD-UHFFFAOYSA-N n-[4-(4-acetylpiperazin-1-yl)phenyl]-6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC(F)=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCN(CC1)C(C)=O)=CC2=O RXOVDNILFGRNMD-UHFFFAOYSA-N 0.000 description 1
- AOJLUDBTXGQVGK-UHFFFAOYSA-N n-[4-(4-acetylpiperazin-1-yl)phenyl]-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(=CC=1)N1CCN(CC1)C(C)=O)=CC2=O AOJLUDBTXGQVGK-UHFFFAOYSA-N 0.000 description 1
- KGWXJQPUJDMSBN-UHFFFAOYSA-N n-[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]-6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(S(=O)(=O)CC)CCN1C(C=C1)=CC=C1NC(=O)C1=CC(=O)C2=CC(F)=CC(N3CCN(C)CC3)=C2O1 KGWXJQPUJDMSBN-UHFFFAOYSA-N 0.000 description 1
- ZRFKTUNZAWYCAC-UHFFFAOYSA-N n-[4-(4-fluorophenoxy)phenyl]-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC=1C=CC(OC=3C=CC(F)=CC=3)=CC=1)=CC2=O ZRFKTUNZAWYCAC-UHFFFAOYSA-N 0.000 description 1
- DNXOUXANTOCWFK-UHFFFAOYSA-N n-[4-[4-(3-hydroxypropanoyl)piperazin-1-yl]phenyl]-6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)C(=O)CCO)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 DNXOUXANTOCWFK-UHFFFAOYSA-N 0.000 description 1
- HTCNCICAHLVSIP-UHFFFAOYSA-N n-[5-(furan-2-yl)-1h-pyrazol-3-yl]-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carboxamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(C(=O)NC1=NNC(=C1)C=1OC=CC=1)=CC2=O HTCNCICAHLVSIP-UHFFFAOYSA-N 0.000 description 1
- PBGGZRBOQDJSSW-UHFFFAOYSA-N n-[8-(4-methylpiperazin-1-yl)-4-oxochromen-2-yl]-4-morpholin-4-ylbenzamide Chemical compound C1CN(C)CCN1C1=CC=CC2=C1OC(NC(=O)C=1C=CC(=CC=1)N1CCOCC1)=CC2=O PBGGZRBOQDJSSW-UHFFFAOYSA-N 0.000 description 1
- GOTQULLXGZGQMK-UHFFFAOYSA-N n-benzyl-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(C(C)C)CC1=CC=CC=C1 GOTQULLXGZGQMK-UHFFFAOYSA-N 0.000 description 1
- KKXMRVKFRRDOAY-UHFFFAOYSA-N n-cyclohexyl-4-[4-[[6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)C(=O)NC3CCCCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 KKXMRVKFRRDOAY-UHFFFAOYSA-N 0.000 description 1
- KQDIQUHYJJCHSC-UHFFFAOYSA-N n-cyclopentyl-4-[4-[[6-methoxy-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxamide Chemical compound C=12OC(C(=O)NC=3C=CC(=CC=3)N3CCN(CC3)C(=O)NC3CCCC3)=CC(=O)C2=CC(OC)=CC=1N1CCN(C)CC1 KQDIQUHYJJCHSC-UHFFFAOYSA-N 0.000 description 1
- ZDDPOOLGZOIOBD-UHFFFAOYSA-N n-ethyl-4-[4-[[6-fluoro-8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxamide Chemical compound C1CN(C(=O)NCC)CCN1C(C=C1)=CC=C1NC(=O)C1=CC(=O)C2=CC(F)=CC(N3CCN(C)CC3)=C2O1 ZDDPOOLGZOIOBD-UHFFFAOYSA-N 0.000 description 1
- ZQVLOTYXLZWYKV-UHFFFAOYSA-N n-methyl-8-(4-methylpiperazin-1-yl)-n-(4-morpholin-4-ylphenyl)-4-oxochromene-2-carboxamide Chemical compound C=1C=C(N2CCOCC2)C=CC=1N(C)C(=O)C(OC1=2)=CC(=O)C1=CC=CC=2N1CCN(C)CC1 ZQVLOTYXLZWYKV-UHFFFAOYSA-N 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- UHHKSVZZTYJVEG-UHFFFAOYSA-N oxepane Chemical compound C1CCCOCC1 UHHKSVZZTYJVEG-UHFFFAOYSA-N 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 208000019906 panic disease Diseases 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- RFIOZSIHFNEKFF-UHFFFAOYSA-N piperazine-1-carboxylic acid Chemical compound OC(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 125000004585 polycyclic heterocycle group Chemical group 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000013105 post hoc analysis Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- XACWJIQLDLUFSR-UHFFFAOYSA-N pyrrolidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCCC1 XACWJIQLDLUFSR-UHFFFAOYSA-N 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 1
- LJPZHJUSICYOIX-UHFFFAOYSA-N quinolizidine Chemical compound C1CCCC2CCCCN21 LJPZHJUSICYOIX-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 238000003653 radioligand binding assay Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 231100000872 sexual dysfunction Toxicity 0.000 description 1
- 208000019116 sleep disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- XSROQCDVUIHRSI-UHFFFAOYSA-N thietane Chemical compound C1CSC1 XSROQCDVUIHRSI-UHFFFAOYSA-N 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical group C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 239000011534 wash buffer Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/06—Antimigraine agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/22—Anxiolytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/50—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/24—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pain & Pain Management (AREA)
- Psychiatry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Pyrane Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US26210801P | 2001-01-16 | 2001-01-16 | |
| SE0103646A SE0103646D0 (sv) | 2001-11-01 | 2001-11-01 | Therapeutic chroman compounds |
| PCT/SE2002/000070 WO2002055014A2 (en) | 2001-01-16 | 2002-01-15 | Therapeutic chroman compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ526699A true NZ526699A (en) | 2005-03-24 |
Family
ID=26655581
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ526699A NZ526699A (en) | 2001-01-16 | 2002-01-15 | 8-amino derivatives and their use in treating migraine |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP1353915A2 (OSRAM) |
| JP (1) | JP4280068B2 (OSRAM) |
| KR (1) | KR20030070917A (OSRAM) |
| CN (1) | CN100384833C (OSRAM) |
| AR (1) | AR036327A1 (OSRAM) |
| AU (1) | AU2002225551B8 (OSRAM) |
| BR (1) | BR0206514A (OSRAM) |
| CA (1) | CA2434015A1 (OSRAM) |
| IL (3) | IL156601A0 (OSRAM) |
| MX (1) | MXPA03006261A (OSRAM) |
| MY (1) | MY138263A (OSRAM) |
| NO (1) | NO20033205L (OSRAM) |
| NZ (1) | NZ526699A (OSRAM) |
| SA (1) | SA02220709B1 (OSRAM) |
| WO (1) | WO2002055014A2 (OSRAM) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1076711C (zh) | 1996-08-08 | 2001-12-26 | 日立化成工业株式会社 | 石墨颗粒、其生产方法、含该颗粒的负极和锂二次电池 |
| SE0103649D0 (sv) * | 2001-11-01 | 2001-11-01 | Astrazeneca Ab | Therapeutic quinoline compounds |
| TWI349666B (en) | 2004-03-12 | 2011-10-01 | Lundbeck & Co As H | Substituted morpholine and thiomorpholine derivatives |
| US7951805B2 (en) | 2004-09-20 | 2011-05-31 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as mediators of stearoyl-CoA desaturase |
| EP2289510A1 (en) | 2004-09-20 | 2011-03-02 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives for the treatment of diseases mediated by stearoyl-coa desaturase enzymes |
| CN101084207A (zh) | 2004-09-20 | 2007-12-05 | 泽农医药公司 | 杂环衍生物及其作为硬脂酰CoA去饱和酶抑制剂的用途 |
| JP4958786B2 (ja) | 2004-09-20 | 2012-06-20 | ゼノン・ファーマシューティカルズ・インコーポレイテッド | 複素環誘導体および治療薬としてのそれらの使用 |
| MX2007003321A (es) | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como agentes terapeuticos. |
| AU2005329423A1 (en) | 2004-09-20 | 2006-09-28 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-CoA desaturase inhibitors |
| JP5149009B2 (ja) | 2004-09-20 | 2013-02-20 | ゼノン・ファーマシューティカルズ・インコーポレイテッド | ヒトステアロイル−CoAデサチュラーゼを阻害するためのピリダジン誘導体 |
| CN101208089A (zh) | 2005-06-03 | 2008-06-25 | 泽农医药公司 | 氨基噻唑衍生物作为人硬酯酰-CoA去饱和酶抑制剂 |
| UY29892A1 (es) * | 2005-11-04 | 2007-06-29 | Astrazeneca Ab | Nuevos derivados de cromano, composiciones farmaceuticas conteniendolos, procesos de preparacion y aplicaciones |
| KR20080074220A (ko) | 2005-12-08 | 2008-08-12 | 밀레니엄 파머슈티컬스 인코퍼레이티드 | 키나아제 억제 활성을 갖는 비시클릭 화합물 |
| AR059356A1 (es) * | 2006-02-14 | 2008-03-26 | Astrazeneca Ab | Nuevos radioligandos |
| WO2007097697A1 (en) * | 2006-02-23 | 2007-08-30 | Astrazeneca Ab | Therapeutic quinoline compounds that are 5ht1b modulators |
| US7812206B2 (en) | 2006-03-21 | 2010-10-12 | Bp Corporation North America Inc. | Apparatus and process for the separation of solids and liquids |
| US8530716B2 (en) | 2008-08-14 | 2013-09-10 | Bp Corporation North America Inc. | Melt-crystallization separation and purification process |
| HUP0900281A2 (hu) * | 2009-05-05 | 2011-01-28 | Univ Szegedi | Kinurénsav-származékok, eljárás a vegyületek elõállítására, a vegyületeket tartalmazó gyógyászati készítmények és alkalmazásuk fejfájás kezelésére |
| US9630896B2 (en) | 2013-11-22 | 2017-04-25 | Tansna Therapeutics, Inc. | 2,5-dialkyl-4-H/halo/ether-phenol compounds |
| CN104262249A (zh) * | 2014-10-20 | 2015-01-07 | 云南民族大学 | 一种喹诺酮化合物的绿色高效制备方法 |
| US10774064B2 (en) | 2016-06-02 | 2020-09-15 | Cadent Therapeutics, Inc. | Potassium channel modulators |
| HRP20220079T1 (hr) | 2017-01-23 | 2022-04-15 | Cadent Therapeutics, Inc. | Modulatori kalijevih kanala |
| CA3116339A1 (en) | 2018-10-22 | 2020-04-30 | Cadent Therapeutics, Inc. | Crystalline forms of potassium channel modulators |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8515389D0 (en) * | 1985-06-18 | 1985-07-17 | Ici Plc | Heterocyclic compounds |
| US5112856A (en) * | 1986-08-15 | 1992-05-12 | Hoffmann-La Roche Inc. | Therapeutic treatment of intestinal inflammation by administration of 3,4-dihydro-2H-1-benzopyran derivatives |
| SE8904361D0 (sv) * | 1989-12-22 | 1989-12-22 | Astra Ab | New chroman and thiochroman derivatives |
| DE4140542A1 (de) * | 1991-12-09 | 1993-06-17 | Bayer Ag | Piperdylmethyl substituierte chormanderivate |
| FR2761358B1 (fr) * | 1997-03-27 | 1999-05-07 | Adir | Nouveaux composes de n-aryl piperidine, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| SE9703378D0 (sv) * | 1997-09-18 | 1997-09-18 | Astra Ab | New compounds |
| FR2782515B1 (fr) * | 1998-08-21 | 2000-09-22 | Adir | NOUVEAUX DERIVES DE L'INDANE-1-Ol, LEUR PROCEDE DE PREPARATION ET LES COMPOSITIONS PHARMACEUTIQUES QUI LES CONTIENNENT |
-
2002
- 2002-01-15 NZ NZ526699A patent/NZ526699A/en unknown
- 2002-01-15 KR KR10-2003-7009435A patent/KR20030070917A/ko not_active Ceased
- 2002-01-15 AU AU2002225551A patent/AU2002225551B8/en not_active Ceased
- 2002-01-15 EP EP02715919A patent/EP1353915A2/en not_active Withdrawn
- 2002-01-15 IL IL15660102A patent/IL156601A0/xx unknown
- 2002-01-15 JP JP2002555751A patent/JP4280068B2/ja not_active Expired - Fee Related
- 2002-01-15 WO PCT/SE2002/000070 patent/WO2002055014A2/en not_active Ceased
- 2002-01-15 BR BR0206514-2A patent/BR0206514A/pt not_active IP Right Cessation
- 2002-01-15 MX MXPA03006261A patent/MXPA03006261A/es active IP Right Grant
- 2002-01-15 CN CNB02806562XA patent/CN100384833C/zh not_active Expired - Fee Related
- 2002-01-15 CA CA002434015A patent/CA2434015A1/en not_active Abandoned
- 2002-01-16 MY MYPI20020159A patent/MY138263A/en unknown
- 2002-01-16 AR ARP020100142A patent/AR036327A1/es unknown
- 2002-03-11 SA SA02220709A patent/SA02220709B1/ar unknown
-
2003
- 2003-06-23 IL IL156601A patent/IL156601A/en not_active IP Right Cessation
- 2003-07-15 NO NO20033205A patent/NO20033205L/no not_active Application Discontinuation
-
2007
- 2007-05-14 IL IL183183A patent/IL183183A0/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JP4280068B2 (ja) | 2009-06-17 |
| CN1524077A (zh) | 2004-08-25 |
| NO20033205L (no) | 2003-09-02 |
| IL156601A (en) | 2009-06-15 |
| IL183183A0 (en) | 2007-08-19 |
| AU2002225551B8 (en) | 2008-05-29 |
| MXPA03006261A (es) | 2003-09-22 |
| KR20030070917A (ko) | 2003-09-02 |
| SA02220709B1 (ar) | 2007-01-23 |
| AU2002225551B2 (en) | 2008-04-03 |
| JP2004517130A (ja) | 2004-06-10 |
| MY138263A (en) | 2009-05-29 |
| IL156601A0 (en) | 2004-01-04 |
| WO2002055014A2 (en) | 2002-07-18 |
| AR036327A1 (es) | 2004-09-01 |
| NO20033205D0 (no) | 2003-07-15 |
| BR0206514A (pt) | 2004-01-06 |
| CN100384833C (zh) | 2008-04-30 |
| CA2434015A1 (en) | 2002-07-18 |
| WO2002055014A3 (en) | 2002-11-14 |
| EP1353915A2 (en) | 2003-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6812225B2 (en) | Therapeutic heterocyclic compounds | |
| US20050085457A1 (en) | Therapeutic quinolone compounds with 5-ht-antagonistic properties | |
| US20040087575A1 (en) | Therapeutic chromone compounds | |
| US20050096312A1 (en) | Therapeutic quinolone compounds with 5-ht-antagonistic properties | |
| NZ526699A (en) | 8-amino derivatives and their use in treating migraine | |
| AU2002217742A1 (en) | Therapeutic heterocyclic compounds | |
| AU2002225551A1 (en) | Therapeutic chroman compounds | |
| US20040110745A1 (en) | Therapeutic chroman compounds | |
| US20040082591A1 (en) | Therapeutic heterocyclic compounds | |
| NZ545374A (en) | Process for the production of therapeutic heterocyclic compounds | |
| US20060019947A1 (en) | Therapeutic chromone compounds | |
| AU2002348559A1 (en) | Therapeutic quinolone compounds with 5-HT-antagonistic properties | |
| AU2002348560A1 (en) | Therapeutic quinoline compounds with 5-HT-antagonistic properties | |
| AU2002219770A1 (en) | Therapeutic chromone compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PSEA | Patent sealed | ||
| RENW | Renewal (renewal fees accepted) |