NZ203519A - 2(1h)-pyridinone derivatives and pharmaceutical compositions - Google Patents
2(1h)-pyridinone derivatives and pharmaceutical compositionsInfo
- Publication number
- NZ203519A NZ203519A NZ203519A NZ20351983A NZ203519A NZ 203519 A NZ203519 A NZ 203519A NZ 203519 A NZ203519 A NZ 203519A NZ 20351983 A NZ20351983 A NZ 20351983A NZ 203519 A NZ203519 A NZ 203519A
- Authority
- NZ
- New Zealand
- Prior art keywords
- methyl
- compound
- ethyl
- pyridinone
- hydrogen
- Prior art date
Links
- 150000005300 2(1H)-pyridinones Chemical class 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 51
- 239000000203 mixture Substances 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 30
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 claims description 10
- 230000003177 cardiotonic effect Effects 0.000 claims description 9
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 claims description 9
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical class OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims description 7
- 230000000747 cardiac effect Effects 0.000 claims description 7
- IMEZBBSLGKURNZ-UHFFFAOYSA-N 5-acetyl-6-ethyl-1h-pyridin-2-one Chemical compound CCC=1NC(=O)C=CC=1C(C)=O IMEZBBSLGKURNZ-UHFFFAOYSA-N 0.000 claims description 6
- FMVJYQGSRWVMQV-UHFFFAOYSA-N ethyl propiolate Chemical compound CCOC(=O)C#C FMVJYQGSRWVMQV-UHFFFAOYSA-N 0.000 claims description 6
- GWCNLYWJTUWLAR-UHFFFAOYSA-N 6-methyl-5-propanoyl-1h-pyridin-2-one Chemical compound CCC(=O)C=1C=CC(=O)NC=1C GWCNLYWJTUWLAR-UHFFFAOYSA-N 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 5
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 claims description 4
- JMDUPPQVQZVCFS-UHFFFAOYSA-N 6-ethyl-5-propanoyl-1h-pyridin-2-one Chemical compound CCC(=O)C=1C=CC(=O)NC=1CC JMDUPPQVQZVCFS-UHFFFAOYSA-N 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- JTJBNFASMDKBCE-UHFFFAOYSA-N 4-aminohex-3-en-2-one Chemical compound CCC(N)=CC(C)=O JTJBNFASMDKBCE-UHFFFAOYSA-N 0.000 claims description 3
- CAVGDVLMRCBPRF-UHFFFAOYSA-N 5-aminohex-4-en-3-one Chemical compound CCC(=O)C=C(C)N CAVGDVLMRCBPRF-UHFFFAOYSA-N 0.000 claims description 3
- LUEHNHVFDCZTGL-UHFFFAOYSA-M Butynoate Chemical compound CC#CC([O-])=O LUEHNHVFDCZTGL-UHFFFAOYSA-M 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 239000011664 nicotinic acid Substances 0.000 claims description 3
- 229960003512 nicotinic acid Drugs 0.000 claims description 3
- 235000001968 nicotinic acid Nutrition 0.000 claims description 3
- BGONXEWVJNGIOF-UHFFFAOYSA-N 2-aminohept-2-en-4-one Chemical compound CCCC(=O)C=C(C)N BGONXEWVJNGIOF-UHFFFAOYSA-N 0.000 claims description 2
- MSXMPMNVVDJBHQ-UHFFFAOYSA-N 5-butanoyl-6-methyl-1h-pyridin-2-one Chemical compound CCCC(=O)C=1C=CC(=O)NC=1C MSXMPMNVVDJBHQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 238000001640 fractional crystallisation Methods 0.000 claims description 2
- 150000005299 pyridinones Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 4
- XWSPOKFDHCLBAV-UHFFFAOYSA-N 5-aminohept-4-en-3-one Chemical compound CCC(N)=CC(=O)CC XWSPOKFDHCLBAV-UHFFFAOYSA-N 0.000 claims 1
- 230000000911 decarboxylating effect Effects 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 37
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 22
- 239000003921 oil Substances 0.000 description 20
- 235000019198 oils Nutrition 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 239000007787 solid Substances 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 10
- 230000000875 corresponding effect Effects 0.000 description 10
- 210000003540 papillary muscle Anatomy 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 230000001746 atrial effect Effects 0.000 description 7
- -1 substituted-nicotinic acid Chemical class 0.000 description 7
- 241000700199 Cavia porcellus Species 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000000496 cardiotonic agent Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000012452 mother liquor Substances 0.000 description 5
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 4
- JTLWXFRVOPSNEH-UHFFFAOYSA-N 5-acetyl-6-methyl-1h-pyridin-2-one Chemical compound CC(=O)C=1C=CC(=O)NC=1C JTLWXFRVOPSNEH-UHFFFAOYSA-N 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 210000002837 heart atrium Anatomy 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZNLSCQLJYHJABW-UHFFFAOYSA-N 5-acetyl-4,6-dimethyl-1h-pyridin-2-one Chemical compound CC(=O)C=1C(C)=CC(=O)NC=1C ZNLSCQLJYHJABW-UHFFFAOYSA-N 0.000 description 3
- KUYKGMRKPCKXAP-UHFFFAOYSA-N 6-methyl-2-oxo-5-propanoyl-1h-pyridine-3-carbonitrile Chemical compound CCC(=O)C=1C=C(C#N)C(=O)NC=1C KUYKGMRKPCKXAP-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 125000005594 diketone group Chemical group 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- NDOGLIPWGGRQCO-UHFFFAOYSA-N hexane-2,4-dione Chemical compound CCC(=O)CC(C)=O NDOGLIPWGGRQCO-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- OSLAYKKXCYSJSF-ARJAWSKDSA-N (Z)-4-aminopent-3-en-2-one Chemical compound C\C(N)=C\C(C)=O OSLAYKKXCYSJSF-ARJAWSKDSA-N 0.000 description 2
- KOIAGXAXVITXID-UHFFFAOYSA-N 3-(dimethylaminomethylidene)hexane-2,4-dione Chemical compound CCC(=O)C(C(C)=O)=CN(C)C KOIAGXAXVITXID-UHFFFAOYSA-N 0.000 description 2
- YRRNMPHVJUDOEB-UHFFFAOYSA-N 3-(dimethylaminomethylidene)pentane-2,4-dione Chemical compound CN(C)C=C(C(C)=O)C(C)=O YRRNMPHVJUDOEB-UHFFFAOYSA-N 0.000 description 2
- ZKTUHSWKCCHIPY-UHFFFAOYSA-N 3-methyl-5-propyl-1,2-oxazole Chemical compound CCCC1=CC(C)=NO1 ZKTUHSWKCCHIPY-UHFFFAOYSA-N 0.000 description 2
- OSLAYKKXCYSJSF-UHFFFAOYSA-N 4-aminopent-3-en-2-one Chemical compound CC(N)=CC(C)=O OSLAYKKXCYSJSF-UHFFFAOYSA-N 0.000 description 2
- HOSMSJUGKUGGDS-UHFFFAOYSA-N 5-acetyl-6-methyl-2-oxo-1h-pyridine-3-carboxylic acid Chemical compound CC(=O)C=1C=C(C(O)=O)C(=O)NC=1C HOSMSJUGKUGGDS-UHFFFAOYSA-N 0.000 description 2
- REHIUJIQVNHXPH-UHFFFAOYSA-N 5-butanoyl-2-oxo-6-propyl-1h-pyridine-3-carbonitrile Chemical compound CCCC(=O)C=1C=C(C#N)C(=O)NC=1CCC REHIUJIQVNHXPH-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002084 enol ethers Chemical class 0.000 description 2
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- AREIDJIWHZKLGL-UHFFFAOYSA-N methyl 4-acetyl-5-aminohexa-2,4-dienoate Chemical compound COC(=O)C=CC(=C(C)N)C(C)=O AREIDJIWHZKLGL-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- FBZVZUSVGKOWHG-UHFFFAOYSA-N 1,1-dimethoxy-n,n-dimethylethanamine Chemical compound COC(C)(OC)N(C)C FBZVZUSVGKOWHG-UHFFFAOYSA-N 0.000 description 1
- QBFIGURZQOIEBK-UHFFFAOYSA-N 1-aminohex-3-en-2-one Chemical class CCC=CC(=O)CN QBFIGURZQOIEBK-UHFFFAOYSA-N 0.000 description 1
- FJPGAMCQJNLTJC-UHFFFAOYSA-N 2,3-Heptanedione Chemical compound CCCCC(=O)C(C)=O FJPGAMCQJNLTJC-UHFFFAOYSA-N 0.000 description 1
- FMDLEUPBHMCPQV-GQCTYLIASA-N 2-Octen-4-one Chemical compound CCCCC(=O)\C=C\C FMDLEUPBHMCPQV-GQCTYLIASA-N 0.000 description 1
- MFPOQTZAXXVFNO-UHFFFAOYSA-N 2-aminohexa-2,4-dienoic acid Chemical compound CC=CC=C(N)C(O)=O MFPOQTZAXXVFNO-UHFFFAOYSA-N 0.000 description 1
- DERAACKMMNJAFU-UHFFFAOYSA-N 2-ethoxy-1,3-dioxane-4,6-dione Chemical compound CCOC1OC(=O)CC(=O)O1 DERAACKMMNJAFU-UHFFFAOYSA-N 0.000 description 1
- KHWGRLRCZSYJNT-UHFFFAOYSA-N 2-oxo-3h-pyridine-3-carboxylic acid Chemical compound OC(=O)C1C=CC=NC1=O KHWGRLRCZSYJNT-UHFFFAOYSA-N 0.000 description 1
- VDSFEBWCJVSAJR-UHFFFAOYSA-N 3-acetyl-6-methyl-5-nitro-1h-pyridin-2-one Chemical compound CC(=O)C1=CC([N+]([O-])=O)=C(C)NC1=O VDSFEBWCJVSAJR-UHFFFAOYSA-N 0.000 description 1
- HOUYLTUYPPSVIN-UHFFFAOYSA-N 3-methyl-5-propan-2-yl-1,2-oxazole Chemical compound CC(C)C1=CC(C)=NO1 HOUYLTUYPPSVIN-UHFFFAOYSA-N 0.000 description 1
- DCBLNROLRJPFLT-UHFFFAOYSA-N 5-acetyl-1-methylpyridin-2-one Chemical compound CC(=O)C=1C=CC(=O)N(C)C=1 DCBLNROLRJPFLT-UHFFFAOYSA-N 0.000 description 1
- SRAYJEGBOXYWMK-UHFFFAOYSA-N 5-acetyl-4,6-dimethyl-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC(=O)C1=C(C)NC(=O)C(C#N)=C1C SRAYJEGBOXYWMK-UHFFFAOYSA-N 0.000 description 1
- BPHCKZKXAHIRPD-UHFFFAOYSA-N 5-acetyl-6-methyl-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC(=O)C=1C=C(C#N)C(=O)NC=1C BPHCKZKXAHIRPD-UHFFFAOYSA-N 0.000 description 1
- ZYRYXEYNFDAQCY-UHFFFAOYSA-N 5-acetyl-6-methyl-3,4-dihydro-1h-pyridin-2-one Chemical compound CC(=O)C1=C(C)NC(=O)CC1 ZYRYXEYNFDAQCY-UHFFFAOYSA-N 0.000 description 1
- PZEKGFBWTAFPDA-UHFFFAOYSA-N 5-butanoyl-6-propyl-1h-pyridin-2-one Chemical compound CCCC(=O)C=1C=CC(=O)NC=1CCC PZEKGFBWTAFPDA-UHFFFAOYSA-N 0.000 description 1
- IMSGRTCQAWWVPK-UHFFFAOYSA-N 6-chloro-3-(1-chloroethenyl)-2-methylpyridine Chemical compound CC1=NC(Cl)=CC=C1C(Cl)=C IMSGRTCQAWWVPK-UHFFFAOYSA-N 0.000 description 1
- AYPTWBRWECHFJM-UHFFFAOYSA-N 6-chloro-3-ethynyl-2-methylpyridine Chemical compound CC1=NC(Cl)=CC=C1C#C AYPTWBRWECHFJM-UHFFFAOYSA-N 0.000 description 1
- CCZMLHPMPMJRPT-UHFFFAOYSA-N 6-ethyl-2-oxo-5-propanoyl-1h-pyridine-3-carbonitrile Chemical compound CCC(=O)C=1C=C(C#N)C(=O)NC=1CC CCZMLHPMPMJRPT-UHFFFAOYSA-N 0.000 description 1
- FIMGYEKEYXUTGD-UHFFFAOYSA-N 6-methyl-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC=C(C#N)C(O)=N1 FIMGYEKEYXUTGD-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- CCYJPTBHDGJTDS-UHFFFAOYSA-N ethyl 2-acetyl-5-aminopenta-2,4-dienoate Chemical class CCOC(=O)C(C(C)=O)=CC=CN CCYJPTBHDGJTDS-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- DGCTVLNZTFDPDJ-UHFFFAOYSA-N heptane-3,5-dione Chemical compound CCC(=O)CC(=O)CC DGCTVLNZTFDPDJ-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- UJQCANQILFWSDJ-UHFFFAOYSA-N methyl but-2-ynoate Chemical compound COC(=O)C#CC UJQCANQILFWSDJ-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002814 niacins Chemical class 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- ZDYWPVCQPUPOJV-UHFFFAOYSA-N nonane-4,6-dione Chemical compound CCCC(=O)CC(=O)CCC ZDYWPVCQPUPOJV-UHFFFAOYSA-N 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical compound C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-M propynoate Chemical compound [O-]C(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-M 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/357,872 US4412077A (en) | 1982-03-15 | 1982-03-15 | Process for preparing 5-(lower-alkanoyl)-6-(lower-alkyl)-2(1H)-pyridinone |
| US06/464,690 US4524149A (en) | 1982-03-15 | 1983-02-07 | 5-Alkanoyl-6-alkyl-2(1H)-pyridinones, their preparation and their cardiotonic use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ203519A true NZ203519A (en) | 1986-03-14 |
Family
ID=26999827
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ203519A NZ203519A (en) | 1982-03-15 | 1983-03-09 | 2(1h)-pyridinone derivatives and pharmaceutical compositions |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4524149A (enExample) |
| EP (1) | EP0089022A3 (enExample) |
| AU (1) | AU1239583A (enExample) |
| DK (1) | DK119083A (enExample) |
| GR (1) | GR77903B (enExample) |
| NZ (1) | NZ203519A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4568751A (en) * | 1983-04-29 | 1986-02-04 | Merrell Dow Pharmaceuticals Inc. | 5-Acyl-2-(1H)-pyridinones |
| US5212314A (en) * | 1983-11-03 | 1993-05-18 | Merrell Dow Pharmaceuticals Inc. | Alkoxyimino ether derivatives of 5-acyl-2(1H)-pyridinones |
| US4849522A (en) * | 1983-11-03 | 1989-07-18 | Merrell Dow Pharmaceuticals | Novel alkoxyimino ether derivatives of 5-acyl-2(1H)-pyridinones |
| ZA848428B (en) * | 1983-11-03 | 1985-06-26 | Merrell Pharma Inc | Novel alkoxyimino ether derivatives of 5-acyl-2(1h)-pyridiones |
| DE3723070A1 (de) * | 1987-07-11 | 1989-01-19 | Bayer Ag | Verfahren zur herstellung von substituierten pyridylalkylketonen |
| PT2660239T (pt) | 2008-07-25 | 2017-02-24 | Shionogi & Co | Compostos químicos como intermediários sintéticos |
| MX351942B (es) | 2008-12-11 | 2017-11-03 | Shionogi & Co | Sintesis de inhibidores de integrasa de vih de carbamoil-piridona e intermediarios. |
| EP2376453B1 (en) | 2008-12-11 | 2019-11-20 | VIIV Healthcare Company | Intermediates for carbamoylpyridone hiv integrase inhibitors |
| TWI518084B (zh) | 2009-03-26 | 2016-01-21 | 鹽野義製藥股份有限公司 | 哌喃酮與吡啶酮衍生物之製造方法 |
| TWI582097B (zh) | 2010-03-23 | 2017-05-11 | Viiv醫療保健公司 | 製備胺甲醯吡啶酮衍生物及中間體之方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE758759A (fr) * | 1969-11-12 | 1971-05-10 | Merck & Co Inc | Pyridones anti-inflammatoires |
| IL65278A0 (en) * | 1981-03-30 | 1982-05-31 | Sterling Drug Inc | 3-amino-5-(substituted)-2(1h)-pyridinones and corresponding 3-cyano compounds,their preparation and pharmaceutical compositions containing them |
| US4412077A (en) * | 1982-03-15 | 1983-10-25 | Sterling Drug Inc. | Process for preparing 5-(lower-alkanoyl)-6-(lower-alkyl)-2(1H)-pyridinone |
-
1983
- 1983-02-07 US US06/464,690 patent/US4524149A/en not_active Expired - Fee Related
- 1983-03-09 NZ NZ203519A patent/NZ203519A/en unknown
- 1983-03-10 EP EP83102374A patent/EP0089022A3/en not_active Withdrawn
- 1983-03-11 AU AU12395/83A patent/AU1239583A/en not_active Abandoned
- 1983-03-14 DK DK119083A patent/DK119083A/da not_active Application Discontinuation
- 1983-03-15 GR GR70790A patent/GR77903B/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4524149A (en) | 1985-06-18 |
| GR77903B (enExample) | 1984-09-25 |
| EP0089022A2 (en) | 1983-09-21 |
| EP0089022A3 (en) | 1984-06-20 |
| AU1239583A (en) | 1983-09-22 |
| DK119083A (da) | 1983-09-16 |
| DK119083D0 (da) | 1983-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE50632B1 (en) | 5-(pyridinyl)-2-(1h)-pyridinones,useful as cardiotonic agents and their preparation | |
| US4465686A (en) | 5-(Hydroxy- and/or amino-phenyl)-6-(lower-alkyl)-2-(1H)-pyridinones, their cardiotonic use and preparation | |
| NZ203519A (en) | 2(1h)-pyridinone derivatives and pharmaceutical compositions | |
| US4415580A (en) | Certain 2-(1H)-pyridinones cardiotonic compositions containing same and method of using same | |
| US4412077A (en) | Process for preparing 5-(lower-alkanoyl)-6-(lower-alkyl)-2(1H)-pyridinone | |
| US4560691A (en) | 5-(Phenyl)-1,6-naphthyridin-2(1H)-ones, their cardiotonic use and preparation | |
| US4432981A (en) | 2-(Pyridinyl or hydroxyphenyl)-8-substituted pyrido[2,3-d]pyrimidin-5(8H)-ones | |
| US4599423A (en) | Preparation of 5-(hydroxy- and/or aminophenyl-6-lower-alkyl)-2(1H)-pyridinones | |
| EP0180834A1 (de) | 4-Alkoxy-pyrido[2,3-d]pyrimidin-Derivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| NO821046L (no) | 3-amino-5-(substituert)-2-(1h)-pyridinoner og fremgangsmaate for deres fremstilling | |
| US4431651A (en) | 2-Pyridinones and their use as cardiotonic agents | |
| EP0109628A1 (en) | 2(1H)-pyridinones and preparation, useful as cardiotonics | |
| US4346221A (en) | Preparation of 4-amino-6-(pyridinyl)-3(2H)-pyridazinones from 6-(pyridinyl)-3(2H)-pyridazinones | |
| US4473571A (en) | 8-Substituted-2-(4-pyridinyl)-9H-purin-6-amines and their cardiotonic use | |
| US4032523A (en) | 4-amino (or halo or hydroxy or hydrazino)-2-(pyridinyl)pyrimidines | |
| US4532247A (en) | 5-(Hydroxyalkyl or alkanoyloxymethyl)-1,6-naphthyridin-2(1H)-one and cardiotonic use thereof | |
| US4515797A (en) | 3-Amino-5-(hydroxy- and/or aminophenyl)-6-(lower-alkyl)-2(1H)-pyridinones and cardiotonic use thereof | |
| US4559352A (en) | 1,2-Dihydro-2-oxo-5-(hydroxy-and/or amino-phenyl)-nicotinonitriles and cardiotonic use thereof | |
| US4451469A (en) | Selected 6-alkyl-and 4,6-dialkyl-2(1H)-pyridinones as cardiotonics | |
| NO834084L (no) | Pyridinderivater med kardiotonisk virkning og fremgangsmaate for deres fremstilling | |
| US4559347A (en) | 3-Substituted-5-alkyl-1,6-naphthyridin-2(1H)-ones, cardiotonic use and preparation thereof | |
| US4517190A (en) | 5-Alkyl-1,6-naphthyridin-2(1H)-ones and cardiotonic use thereof | |
| JPS6159625B2 (enExample) | ||
| US4469699A (en) | 5-(4-Thiazolyl)-6-alkyl-2(1H)-pyridinones and their cardiotonic use | |
| US4604399A (en) | 5-methyl(or ethyl)-1,6-naphthyridin-2(1H)-one 6-oxides, their preparation and the cardiotonic use thereof |