NZ188657A - 9-thia-11-oxo-12-azaprostanoic acid derivatives and pharmaceutical compositions - Google Patents
9-thia-11-oxo-12-azaprostanoic acid derivatives and pharmaceutical compositionsInfo
- Publication number
- NZ188657A NZ188657A NZ18865778A NZ18865778A NZ188657A NZ 188657 A NZ188657 A NZ 188657A NZ 18865778 A NZ18865778 A NZ 18865778A NZ 18865778 A NZ18865778 A NZ 18865778A NZ 188657 A NZ188657 A NZ 188657A
- Authority
- NZ
- New Zealand
- Prior art keywords
- thia
- oxo
- pharmaceutical compositions
- acid derivatives
- azaprostanoic acid
- Prior art date
Links
- UXCXMOOXJYBVKI-QGZVFWFLSA-N 7-[(2R)-3-octyl-4-oxo-1,3-thiazolidin-2-yl]heptanoic acid Chemical class O=C1CS[C@H](CCCCCCC(=O)O)N1CCCCCCCC UXCXMOOXJYBVKI-QGZVFWFLSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US84606577A | 1977-10-27 | 1977-10-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ188657A true NZ188657A (en) | 1981-04-24 |
Family
ID=25296844
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ18865778A NZ188657A (en) | 1977-10-27 | 1978-10-16 | 9-thia-11-oxo-12-azaprostanoic acid derivatives and pharmaceutical compositions |
Country Status (18)
| Country | Link |
|---|---|
| DD (1) | DD139714A5 (de) |
| DE (1) | DE2861721D1 (de) |
| DK (1) | DK476378A (de) |
| ES (1) | ES474584A1 (de) |
| FI (1) | FI783194A7 (de) |
| GR (1) | GR65204B (de) |
| HU (1) | HU181912B (de) |
| IE (1) | IE47410B1 (de) |
| IL (1) | IL55749A (de) |
| IT (1) | IT1106075B (de) |
| NO (1) | NO151413C (de) |
| NZ (1) | NZ188657A (de) |
| PH (1) | PH15502A (de) |
| PL (4) | PL124857B1 (de) |
| PT (1) | PT68685A (de) |
| SU (1) | SU952104A3 (de) |
| YU (1) | YU251178A (de) |
| ZA (1) | ZA786035B (de) |
-
1978
- 1978-10-06 SU SU782678806A patent/SU952104A3/ru active
- 1978-10-16 NZ NZ18865778A patent/NZ188657A/xx unknown
- 1978-10-18 IL IL55749A patent/IL55749A/xx unknown
- 1978-10-20 PT PT6868578A patent/PT68685A/pt unknown
- 1978-10-20 FI FI783194A patent/FI783194A7/fi not_active Application Discontinuation
- 1978-10-20 GR GR57477A patent/GR65204B/el unknown
- 1978-10-24 DE DE7878300536T patent/DE2861721D1/de not_active Expired
- 1978-10-26 NO NO783616A patent/NO151413C/no unknown
- 1978-10-26 IE IE211978A patent/IE47410B1/en unknown
- 1978-10-26 PL PL21052078A patent/PL124857B1/pl unknown
- 1978-10-26 PL PL22406978A patent/PL126488B1/pl unknown
- 1978-10-26 ES ES474584A patent/ES474584A1/es not_active Expired
- 1978-10-26 DK DK476378A patent/DK476378A/da not_active Application Discontinuation
- 1978-10-26 ZA ZA786035A patent/ZA786035B/xx unknown
- 1978-10-26 PL PL22406878A patent/PL224068A1/xx unknown
- 1978-10-26 IT IT51657/78A patent/IT1106075B/it active
- 1978-10-26 DD DD20869378A patent/DD139714A5/de unknown
- 1978-10-27 YU YU251178A patent/YU251178A/xx unknown
- 1978-10-27 HU HUME002221 patent/HU181912B/hu unknown
- 1978-10-30 PH PH21746A patent/PH15502A/en unknown
-
1979
- 1979-05-28 PL PL21591679A patent/PL215916A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PT68685A (en) | 1978-11-01 |
| PL224068A1 (de) | 1981-01-30 |
| ES474584A1 (es) | 1980-01-16 |
| PL224069A1 (de) | 1981-01-30 |
| IT7851657A0 (it) | 1978-10-26 |
| IT1106075B (it) | 1985-11-11 |
| DK476378A (da) | 1979-04-28 |
| NO783616L (no) | 1979-04-30 |
| FI783194A7 (fi) | 1979-04-28 |
| DE2861721D1 (en) | 1982-05-19 |
| PL126488B1 (en) | 1983-08-31 |
| PL215916A1 (de) | 1980-12-01 |
| PH15502A (en) | 1983-02-03 |
| IL55749A (en) | 1983-05-15 |
| GR65204B (en) | 1980-07-29 |
| YU251178A (en) | 1983-01-21 |
| ZA786035B (en) | 1980-06-25 |
| IE782119L (en) | 1979-04-27 |
| IL55749A0 (en) | 1978-12-17 |
| DD139714A5 (de) | 1980-01-16 |
| HU181912B (en) | 1983-11-28 |
| NO151413B (no) | 1984-12-27 |
| PL124857B1 (en) | 1983-02-28 |
| IE47410B1 (en) | 1984-03-07 |
| NO151413C (no) | 1985-04-10 |
| SU952104A3 (ru) | 1982-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ188320A (en) | Thienothiazine derivatives preparation and pharmaceutical compositions | |
| NZ189086A (en) | Acylanilide derivatives and pharmaceutical and veterinary compositions | |
| NZ186965A (en) | Guanidino derivatives and pharmaceutical compositions | |
| NZ188140A (en) | Nitroimidazole derivatives and pharmaceutical compositions | |
| NZ183222A (en) | Azetidine pyrrolidine-orpiperidine-2-carboxylic acid derivatives and pharmaceutical compositions | |
| NZ188872A (en) | 9-(-heteroarylamino-alkylamino)-erthromycins and pharmaceutical compositions | |
| NZ187235A (en) | Aminoalkylbenzene derivatives and pharmaceutical compositions | |
| NZ188170A (en) | Propenylamines and pharmaceutical compositions | |
| NZ187849A (en) | Prostaglandin i derivatives and pharmaceutical compositions | |
| NZ187794A (en) | 1-acyl-2-cynanoaziridines and immunestimulating pharmaceutical compositions | |
| NZ189296A (en) | N-substituted-omega-aminoalkanoyl-omega-aminoalkanoic acids and pharmaceutical compositions | |
| NZ189246A (en) | 4-spectinomycylamine its salts and pharmaceutical compositions | |
| DE2862107D1 (en) | Glucosamine-peptide derivatives and their pharmaceutical compositions | |
| NZ188772A (en) | Pyrazinobenzoxazepine derivatives and pharmaceutical compositions | |
| NZ186119A (en) | 7-alkoxycarbonyl-6-alkyl/halo-17-hydoxy-3-oxo-17 -pregn-4-ene-21-carboxylic acid derivatives and pharmaceutical compositions | |
| NZ188531A (en) | W-mercapto-propionamides and pharmaceutical compositions | |
| NZ188798A (en) | 2-iminoimidazolidine derivatives and pharmaceutical compositions | |
| NZ194784A (en) | 7 -aminothiadizolylacetylamino-3-cephem-4-carboxylic acid derivatives and pharmaceutical compositions | |
| NZ187571A (en) | N-glucofuranosid-6-yl-n-nitroso-urea derivatives and pharmaceutical compositions | |
| NZ187085A (en) | 3-pyridazione derivatives and pharmaceutical compositions | |
| NZ188101A (en) | N-substituted-2-aminobenzoic acid derivatives and pharmaceutical compositions | |
| NZ191169A (en) | N-substituted aziridine-2-carboxylic acid derivatives and pharmaceutical compositions | |
| NZ186059A (en) | 3-sulphamoyl-5-pyrrolylal-kylbenzoic acid derivatives and pharmaceutical compositions | |
| NZ187195A (en) | Benzenesulphonyl-urea derivatives and pharmaceutical compositions | |
| GB2010261B (en) | Phenoxyalkanolamine derivatives the preparation thereof and pharmaceutical compositions containing them |