NO842467L - Fremgangsmaate ved fremstilling av 2-sulfamoylbenzo(b)thiofenderivater - Google Patents
Fremgangsmaate ved fremstilling av 2-sulfamoylbenzo(b)thiofenderivaterInfo
- Publication number
- NO842467L NO842467L NO842467A NO842467A NO842467L NO 842467 L NO842467 L NO 842467L NO 842467 A NO842467 A NO 842467A NO 842467 A NO842467 A NO 842467A NO 842467 L NO842467 L NO 842467L
- Authority
- NO
- Norway
- Prior art keywords
- thiophene
- sulfamoylbenzo
- alkyl
- compound
- hydroxy
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 60
- 238000000034 method Methods 0.000 title claims description 42
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 225
- 229930192474 thiophene Natural products 0.000 claims description 116
- 150000001875 compounds Chemical class 0.000 claims description 61
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 239000011734 sodium Substances 0.000 claims description 35
- -1 methylenedioxy Chemical group 0.000 claims description 29
- 229910052757 nitrogen Inorganic materials 0.000 claims description 28
- 239000000460 chlorine Substances 0.000 claims description 27
- 230000002829 reductive effect Effects 0.000 claims description 26
- XRZYWSVMYHEQPN-UHFFFAOYSA-N 6-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 XRZYWSVMYHEQPN-UHFFFAOYSA-N 0.000 claims description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 21
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 14
- 229910052794 bromium Inorganic materials 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 12
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- 150000002431 hydrogen Chemical group 0.000 claims description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical group CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 239000002585 base Substances 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 229960003495 thiamine Drugs 0.000 claims description 4
- 235000019157 thiamine Nutrition 0.000 claims description 4
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 claims description 4
- 239000011721 thiamine Substances 0.000 claims description 4
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical group CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 2
- 229940077388 benzenesulfonate Drugs 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical group [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 4
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 claims 1
- 125000006698 (C1-C3) dialkylamino group Chemical group 0.000 claims 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims 1
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 229940125797 compound 12 Drugs 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229910017464 nitrogen compound Inorganic materials 0.000 claims 1
- 150000002830 nitrogen compounds Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 215
- 239000000243 solution Substances 0.000 description 149
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 133
- 239000000203 mixture Substances 0.000 description 123
- 229910001868 water Inorganic materials 0.000 description 121
- 239000000047 product Substances 0.000 description 99
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 96
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 89
- 235000019439 ethyl acetate Nutrition 0.000 description 72
- 239000007787 solid Substances 0.000 description 64
- 239000002904 solvent Substances 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 55
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 54
- 239000011541 reaction mixture Substances 0.000 description 48
- 238000002844 melting Methods 0.000 description 47
- 230000008018 melting Effects 0.000 description 47
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 46
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 46
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 43
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 41
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 40
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 38
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 36
- 238000001953 recrystallisation Methods 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- 238000004458 analytical method Methods 0.000 description 33
- 239000000284 extract Substances 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 31
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 29
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 29
- 238000010992 reflux Methods 0.000 description 29
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 28
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 28
- 239000011343 solid material Substances 0.000 description 25
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 24
- 238000003756 stirring Methods 0.000 description 23
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 235000002639 sodium chloride Nutrition 0.000 description 21
- 239000000725 suspension Substances 0.000 description 21
- 239000000706 filtrate Substances 0.000 description 20
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 18
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 16
- 229910052799 carbon Inorganic materials 0.000 description 16
- 239000000463 material Substances 0.000 description 15
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 15
- 239000012267 brine Substances 0.000 description 14
- 239000010410 layer Substances 0.000 description 14
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 229920006395 saturated elastomer Polymers 0.000 description 14
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 13
- 229940079593 drug Drugs 0.000 description 13
- 239000003814 drug Substances 0.000 description 13
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 12
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 239000000538 analytical sample Substances 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 238000001035 drying Methods 0.000 description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 229940124530 sulfonamide Drugs 0.000 description 9
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 150000003456 sulfonamides Chemical class 0.000 description 8
- IGYDWQWQYFXSNN-UHFFFAOYSA-N 5-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 IGYDWQWQYFXSNN-UHFFFAOYSA-N 0.000 description 7
- 208000010412 Glaucoma Diseases 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- 239000003489 carbonate dehydratase inhibitor Substances 0.000 description 7
- 230000004406 elevated intraocular pressure Effects 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 239000012442 inert solvent Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000012258 stirred mixture Substances 0.000 description 7
- 150000003455 sulfinic acids Chemical class 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 6
- JRTUPGWOWBPJAF-UHFFFAOYSA-N 3-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2C(O)=C(S(=O)(=O)N)SC2=C1 JRTUPGWOWBPJAF-UHFFFAOYSA-N 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- WGDVDMKNSDCNGB-UHFFFAOYSA-N 6-methoxy-1-benzothiophene Chemical compound COC1=CC=C2C=CSC2=C1 WGDVDMKNSDCNGB-UHFFFAOYSA-N 0.000 description 6
- PNLRJPAUMHTMEL-UHFFFAOYSA-N 7-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1 PNLRJPAUMHTMEL-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 150000002170 ethers Chemical class 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 235000017281 sodium acetate Nutrition 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 238000005160 1H NMR spectroscopy Methods 0.000 description 5
- XQQVPVSVESNUHO-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 XQQVPVSVESNUHO-UHFFFAOYSA-N 0.000 description 5
- 102000003846 Carbonic anhydrases Human genes 0.000 description 5
- 108090000209 Carbonic anhydrases Proteins 0.000 description 5
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 5
- 229940006133 antiglaucoma drug and miotics carbonic anhydrase inhibitors Drugs 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 5
- 239000002024 ethyl acetate extract Substances 0.000 description 5
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 5
- 239000012467 final product Substances 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 5
- 230000004410 intraocular pressure Effects 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 239000000825 pharmaceutical preparation Substances 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- DXMQCYBZTUPOFT-UHFFFAOYSA-N 1-(2,2-diethoxyethylsulfanyl)-3-methoxybenzene Chemical compound CCOC(OCC)CSC1=CC=CC(OC)=C1 DXMQCYBZTUPOFT-UHFFFAOYSA-N 0.000 description 4
- JOKNIUYQJUUYLU-UHFFFAOYSA-N 5-(bromomethyl)-1-benzothiophene-2-sulfonamide Chemical compound BrCC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 JOKNIUYQJUUYLU-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 4
- 239000012346 acetyl chloride Substances 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 150000003863 ammonium salts Chemical class 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 230000001954 sterilising effect Effects 0.000 description 4
- 150000003577 thiophenes Chemical class 0.000 description 4
- QCHFTSOMWOSFHM-WPRPVWTQSA-N (+)-Pilocarpine Chemical compound C1OC(=O)[C@@H](CC)[C@H]1CC1=CN=CN1C QCHFTSOMWOSFHM-WPRPVWTQSA-N 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- DQUZFPKUMCZPQD-UHFFFAOYSA-N 1-benzothiophen-6-ol Chemical compound OC1=CC=C2C=CSC2=C1 DQUZFPKUMCZPQD-UHFFFAOYSA-N 0.000 description 3
- DSZAQLDIEKUEMB-UHFFFAOYSA-N 2-(1-benzothiophen-5-yl)ethanol Chemical compound OCCC1=CC=C2SC=CC2=C1 DSZAQLDIEKUEMB-UHFFFAOYSA-N 0.000 description 3
- SFHBRQGOVNCNDR-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethenesulfonamide Chemical compound COC1=CC=C(C=CS(N)(=O)=O)C=C1 SFHBRQGOVNCNDR-UHFFFAOYSA-N 0.000 description 3
- XQHJVVACNIPHNW-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethynesulfonyl chloride Chemical compound COC1=CC=C(C#CS(Cl)(=O)=O)C=C1 XQHJVVACNIPHNW-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 3
- FPQDJHOZZCKJAC-UHFFFAOYSA-N 5-(2-methoxyethyl)-1-benzothiophene-2-sulfonamide Chemical compound COCCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 FPQDJHOZZCKJAC-UHFFFAOYSA-N 0.000 description 3
- RDSIMGKJEYNNLF-UHFFFAOYSA-N 5-bromo-1-benzothiophene Chemical compound BrC1=CC=C2SC=CC2=C1 RDSIMGKJEYNNLF-UHFFFAOYSA-N 0.000 description 3
- BAXDQXBRPAMCRX-UHFFFAOYSA-N 6-amino-1-benzothiophene-2-sulfonamide Chemical compound NC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 BAXDQXBRPAMCRX-UHFFFAOYSA-N 0.000 description 3
- VKBYBFQLYBTNOI-UHFFFAOYSA-N 6-hydroxy-1-benzothiophene-2-sulfonic acid Chemical compound OC1=CC=C2C=C(S(O)(=O)=O)SC2=C1 VKBYBFQLYBTNOI-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- QCHFTSOMWOSFHM-UHFFFAOYSA-N SJ000285536 Natural products C1OC(=O)C(CC)C1CC1=CN=CN1C QCHFTSOMWOSFHM-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- 239000000674 adrenergic antagonist Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000001099 ammonium carbonate Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000004042 decolorization Methods 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 125000001033 ether group Chemical group 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 150000002440 hydroxy compounds Chemical class 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- ZYISMPMPLDLSBP-UHFFFAOYSA-N n,n-dibenzyl-1-benzothiophen-5-amine Chemical compound C=1C=CC=CC=1CN(C=1C=C2C=CSC2=CC=1)CC1=CC=CC=C1 ZYISMPMPLDLSBP-UHFFFAOYSA-N 0.000 description 3
- BVKSZCWERUSTDZ-UHFFFAOYSA-N n,n-dimethyl-1-benzothiophen-5-amine Chemical compound CN(C)C1=CC=C2SC=CC2=C1 BVKSZCWERUSTDZ-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 229960001416 pilocarpine Drugs 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- SUKKOWZFPQZCMY-UHFFFAOYSA-N (2,2-dimethyl-1,3-dioxolan-4-yl)methanol;methanesulfonic acid Chemical compound CS(O)(=O)=O.CC1(C)OCC(CO)O1 SUKKOWZFPQZCMY-UHFFFAOYSA-N 0.000 description 2
- JPSSAXLGXLTVNR-UHFFFAOYSA-N (2-sulfamoyl-1-benzothiophen-5-yl)methyl acetate Chemical compound CC(=O)OCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 JPSSAXLGXLTVNR-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- ZUPYTANKWDPRDP-UHFFFAOYSA-N 1-benzothiophen-5-amine Chemical compound NC1=CC=C2SC=CC2=C1 ZUPYTANKWDPRDP-UHFFFAOYSA-N 0.000 description 2
- KBIAVTUACPKPFJ-UHFFFAOYSA-N 1-ethynyl-4-methoxybenzene Chemical group COC1=CC=C(C#C)C=C1 KBIAVTUACPKPFJ-UHFFFAOYSA-N 0.000 description 2
- KMVWWKPQGQWJFC-UHFFFAOYSA-N 2-(4-hydroxyphenyl)ethenesulfonamide Chemical compound NS(=O)(=O)C=CC1=CC=C(O)C=C1 KMVWWKPQGQWJFC-UHFFFAOYSA-N 0.000 description 2
- FXHIODPNVOWMIT-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethynesulfonamide Chemical compound COC1=CC=C(C#CS(N)(=O)=O)C=C1 FXHIODPNVOWMIT-UHFFFAOYSA-N 0.000 description 2
- ZXAHMLCCWDRTAO-UHFFFAOYSA-N 2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetamide Chemical compound NC(=O)COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 ZXAHMLCCWDRTAO-UHFFFAOYSA-N 0.000 description 2
- SROMBPBDBFVWDN-UHFFFAOYSA-N 2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetic acid Chemical compound OC(=O)COC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 SROMBPBDBFVWDN-UHFFFAOYSA-N 0.000 description 2
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- LQAHMHGUCXRYFL-UHFFFAOYSA-N 4-(1-benzothiophen-5-yl)morpholine Chemical compound C1COCCN1C1=CC=C(SC=C2)C2=C1 LQAHMHGUCXRYFL-UHFFFAOYSA-N 0.000 description 2
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 2
- XSHKFYGDAYFRCI-UHFFFAOYSA-N 4-chloro-5-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1Cl XSHKFYGDAYFRCI-UHFFFAOYSA-N 0.000 description 2
- CETZEYFOCPZOKD-UHFFFAOYSA-N 4-chloro-5-morpholin-4-yl-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=C(Cl)C=1N1CCOCC1 CETZEYFOCPZOKD-UHFFFAOYSA-N 0.000 description 2
- KWNKEEZVYAHKNV-UHFFFAOYSA-N 4-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2SC(S(=O)(=O)N)=CC2=C1O KWNKEEZVYAHKNV-UHFFFAOYSA-N 0.000 description 2
- YPOBRGLUEDOCKJ-UHFFFAOYSA-N 4-methoxy-1-benzothiophene Chemical compound COC1=CC=CC2=C1C=CS2 YPOBRGLUEDOCKJ-UHFFFAOYSA-N 0.000 description 2
- MRIXVKKOHPQOFK-UHFFFAOYSA-N 4-methoxysalicylic acid Chemical compound COC1=CC=C(C(O)=O)C(O)=C1 MRIXVKKOHPQOFK-UHFFFAOYSA-N 0.000 description 2
- QFOUMNMBMUBSFP-UHFFFAOYSA-N 5,6-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 QFOUMNMBMUBSFP-UHFFFAOYSA-N 0.000 description 2
- OCAMSTDZHIWOSJ-UHFFFAOYSA-N 5-(2,3-dihydroxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound OCC(O)COC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 OCAMSTDZHIWOSJ-UHFFFAOYSA-N 0.000 description 2
- RSPGAMGRZURHHP-UHFFFAOYSA-N 5-(2-phenylmethoxyethyl)-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1CCOCC1=CC=CC=C1 RSPGAMGRZURHHP-UHFFFAOYSA-N 0.000 description 2
- LOYLGQBOOPLJAJ-UHFFFAOYSA-N 5-[2-(dimethylamino)ethylsulfanylmethyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCSCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 LOYLGQBOOPLJAJ-UHFFFAOYSA-N 0.000 description 2
- UQEZXYPVQGPICM-UHFFFAOYSA-N 5-bromo-1-benzothiophene-2-sulfonamide Chemical compound BrC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 UQEZXYPVQGPICM-UHFFFAOYSA-N 0.000 description 2
- SPHFFWSPWNZWSL-UHFFFAOYSA-N 5-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 SPHFFWSPWNZWSL-UHFFFAOYSA-N 0.000 description 2
- DOHZWDWNQFZIKH-UHFFFAOYSA-N 5-methyl-1-benzothiophene Chemical compound CC1=CC=C2SC=CC2=C1 DOHZWDWNQFZIKH-UHFFFAOYSA-N 0.000 description 2
- PKXFWRSOBUMXMT-UHFFFAOYSA-N 5-morpholin-4-yl-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1N1CCOCC1 PKXFWRSOBUMXMT-UHFFFAOYSA-N 0.000 description 2
- RTTDJPYUGSTFIA-UHFFFAOYSA-N 6-(2,3-dihydroxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound C1=C(OCC(O)CO)C=C2SC(S(=O)(=O)N)=CC2=C1 RTTDJPYUGSTFIA-UHFFFAOYSA-N 0.000 description 2
- JMRANYLGDBTEFX-UHFFFAOYSA-N 6-(oxiran-2-ylmethoxy)-1-benzothiophene-2-sulfonamide Chemical compound C1=C2SC(S(=O)(=O)N)=CC2=CC=C1OCC1CO1 JMRANYLGDBTEFX-UHFFFAOYSA-N 0.000 description 2
- GNLCMXPOUCBOTH-LLVKDONJSA-N 6-[(5S)-3-tert-butyl-2-oxo-1,3-oxazolidin-5-yl]-3-methoxy-1-benzothiophene-2-sulfonamide Chemical compound CC(C)(C)N1C(O[C@H](C1)C=1C=CC2=C(SC(=C2OC)S(N)(=O)=O)C=1)=O GNLCMXPOUCBOTH-LLVKDONJSA-N 0.000 description 2
- FITAEYJEKBYERX-UHFFFAOYSA-N 6-acetyl-1-benzothiophene-2-sulfonamide Chemical compound CC(=O)C1=CC=C2C=C(S(N)(=O)=O)SC2=C1 FITAEYJEKBYERX-UHFFFAOYSA-N 0.000 description 2
- ISKVAXQBNMMJEM-UHFFFAOYSA-N 6-hydroxy-5-methoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 ISKVAXQBNMMJEM-UHFFFAOYSA-N 0.000 description 2
- IAZFVHUTOZUOMP-UHFFFAOYSA-N 7-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 IAZFVHUTOZUOMP-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 229940122072 Carbonic anhydrase inhibitor Drugs 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 239000004264 Petrolatum Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PIJVFDBKTWXHHD-UHFFFAOYSA-N Physostigmine Natural products C12=CC(OC(=O)NC)=CC=C2N(C)C2C1(C)CCN2C PIJVFDBKTWXHHD-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 150000008065 acid anhydrides Chemical group 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 238000005576 amination reaction Methods 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- 229960000686 benzalkonium chloride Drugs 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 239000006184 cosolvent Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000469 ethanolic extract Substances 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- KQDJZZWCYTXUDE-UHFFFAOYSA-N hydron;thiophene;chloride Chemical compound Cl.C=1C=CSC=1 KQDJZZWCYTXUDE-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- LQFZXWQIQHYQEZ-UHFFFAOYSA-N n-(2-sulfamoyl-1-benzothiophen-6-yl)acetamide Chemical compound CC(=O)NC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 LQFZXWQIQHYQEZ-UHFFFAOYSA-N 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 229940066842 petrolatum Drugs 0.000 description 2
- 235000019271 petrolatum Nutrition 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 229960001697 physostigmine Drugs 0.000 description 2
- PIJVFDBKTWXHHD-HIFRSBDPSA-N physostigmine Chemical compound C12=CC(OC(=O)NC)=CC=C2N(C)[C@@H]2[C@@]1(C)CCN2C PIJVFDBKTWXHHD-HIFRSBDPSA-N 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- JBKPUQTUERUYQE-UHFFFAOYSA-O pralidoxime Chemical compound C[N+]1=CC=CC=C1\C=N\O JBKPUQTUERUYQE-UHFFFAOYSA-O 0.000 description 2
- 229960003370 pralidoxime Drugs 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- WILBTFWIBAOWLN-UHFFFAOYSA-N triethyl(triethylsilyloxy)silane Chemical compound CC[Si](CC)(CC)O[Si](CC)(CC)CC WILBTFWIBAOWLN-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 2
- REJKBSVCQAIWGE-PPHPATTJSA-N (2-sulfamoyl-1-benzothiophen-5-yl) (2s)-pyrrolidine-2-carboxylate;hydrochloride Chemical compound Cl.C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1OC(=O)[C@@H]1CCCN1 REJKBSVCQAIWGE-PPHPATTJSA-N 0.000 description 1
- BAJBNSPDSMFRQC-UHFFFAOYSA-N (2-sulfamoyl-1-benzothiophen-5-yl) 2-aminoacetate;hydrochloride Chemical compound Cl.NCC(=O)OC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 BAJBNSPDSMFRQC-UHFFFAOYSA-N 0.000 description 1
- XCFHKUMSCZELBW-UHFFFAOYSA-N (2-sulfamoyl-1-benzothiophen-5-yl) acetate Chemical compound CC(=O)OC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 XCFHKUMSCZELBW-UHFFFAOYSA-N 0.000 description 1
- XOFVNNKNKJTRRS-UHFFFAOYSA-N (2-sulfamoyl-1-benzothiophen-6-yl) acetate Chemical compound CC(=O)OC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 XOFVNNKNKJTRRS-UHFFFAOYSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- DYIOSHGVFJTOAR-JGWLITMVSA-N (2r,3r,4s,5r)-6-sulfanylhexane-1,2,3,4,5-pentol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CS DYIOSHGVFJTOAR-JGWLITMVSA-N 0.000 description 1
- KEUPLGRNURQXAR-UHFFFAOYSA-N (4-chlorophenyl) acetate Chemical compound CC(=O)OC1=CC=C(Cl)C=C1 KEUPLGRNURQXAR-UHFFFAOYSA-N 0.000 description 1
- AJTVNSRYHDVWLA-RGMNGODLSA-N (5s)-3-tert-butyl-5-(hydroxymethyl)-1,3-oxazolidin-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.CC(C)(C)N1C[C@@H](CO)OC1=O AJTVNSRYHDVWLA-RGMNGODLSA-N 0.000 description 1
- WXKZUGIMAGOYQL-NTFVMDSBSA-N (5z)-5-[[4-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound C=1C=CC=CC=1C(=O)C1=CN=C2C(C(F)(F)F)=CC=CC2=C1C(C=1)=CC=CC=1NCC(C=C1)=CC=C1\C=C1/SC(=S)NC1=O WXKZUGIMAGOYQL-NTFVMDSBSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000006619 (C1-C6) dialkylamino group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- HXFVJCBIRYKDRY-UHFFFAOYSA-N 1,2-dichloroethane;hexane Chemical compound ClCCCl.CCCCCC HXFVJCBIRYKDRY-UHFFFAOYSA-N 0.000 description 1
- RYUKSOMAQSVSMH-UHFFFAOYSA-N 1,3-benzodioxole-5-thiol Chemical compound SC1=CC=C2OCOC2=C1 RYUKSOMAQSVSMH-UHFFFAOYSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- DFLLZALUYPNFOR-UHFFFAOYSA-N 1-(1-benzothiophen-6-yl)ethanone Chemical compound CC(=O)C1=CC=C2C=CSC2=C1 DFLLZALUYPNFOR-UHFFFAOYSA-N 0.000 description 1
- KPCCJQXVAJZZHS-UHFFFAOYSA-N 1-(2,3-dibromo-1-benzothiophen-6-yl)ethanone Chemical compound CC(=O)C1=CC=C2C(Br)=C(Br)SC2=C1 KPCCJQXVAJZZHS-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- KZEVSDGEBAJOTK-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[5-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CC=1OC(=NN=1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O KZEVSDGEBAJOTK-UHFFFAOYSA-N 0.000 description 1
- WFCLWJHOKCQYOQ-UHFFFAOYSA-N 1-acetylpiperidine-4-carboxylic acid Chemical compound CC(=O)N1CCC(C(O)=O)CC1 WFCLWJHOKCQYOQ-UHFFFAOYSA-N 0.000 description 1
- NJHJGTUTXHKGKM-UHFFFAOYSA-N 1-benzothiophen-5-amine;hydrochloride Chemical compound Cl.NC1=CC=C2SC=CC2=C1 NJHJGTUTXHKGKM-UHFFFAOYSA-N 0.000 description 1
- JSYSQUAJOCDMJW-UHFFFAOYSA-N 1-benzothiophen-5-ylmethanol Chemical compound OCC1=CC=C2SC=CC2=C1 JSYSQUAJOCDMJW-UHFFFAOYSA-N 0.000 description 1
- UZMQSZBTFGHLAH-UHFFFAOYSA-N 1-benzothiophene-2-sulfonamide Chemical class C1=CC=C2SC(S(=O)(=O)N)=CC2=C1 UZMQSZBTFGHLAH-UHFFFAOYSA-N 0.000 description 1
- QHHRWAPVYHRAJA-UHFFFAOYSA-N 1-benzothiophene-5-carbaldehyde Chemical compound O=CC1=CC=C2SC=CC2=C1 QHHRWAPVYHRAJA-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- YZBOZNXACBQJHI-UHFFFAOYSA-N 1-dichlorophosphoryloxyethane Chemical compound CCOP(Cl)(Cl)=O YZBOZNXACBQJHI-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- XYPISWUKQGWYGX-UHFFFAOYSA-N 2,2,2-trifluoroethaneperoxoic acid Chemical compound OOC(=O)C(F)(F)F XYPISWUKQGWYGX-UHFFFAOYSA-N 0.000 description 1
- PGZVFRAEAAXREB-UHFFFAOYSA-N 2,2-dimethylpropanoyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC(=O)C(C)(C)C PGZVFRAEAAXREB-UHFFFAOYSA-N 0.000 description 1
- FZHTUELUUNCLRZ-UHFFFAOYSA-N 2,4-dimethoxybenzenethiol Chemical compound COC1=CC=C(S)C(OC)=C1 FZHTUELUUNCLRZ-UHFFFAOYSA-N 0.000 description 1
- SESUUAOAUZDHHP-UHFFFAOYSA-N 2,5-dimethoxybenzenethiol Chemical compound COC1=CC=C(OC)C(S)=C1 SESUUAOAUZDHHP-UHFFFAOYSA-N 0.000 description 1
- CZFQLAGBLPKGSX-UHFFFAOYSA-N 2-(1-benzothiophen-5-yl)-1,3-dioxolane Chemical compound O1CCOC1C1=CC=C(SC=C2)C2=C1 CZFQLAGBLPKGSX-UHFFFAOYSA-N 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- OQOZUXUGCIGGNG-UHFFFAOYSA-N 2-(2-sulfamoyl-1-benzothiophen-5-yl)ethyl acetate Chemical compound CC(=O)OCCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 OQOZUXUGCIGGNG-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical group ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- DSCJETUEDFKYGN-UHFFFAOYSA-N 2-Methoxybenzenethiol Chemical compound COC1=CC=CC=C1S DSCJETUEDFKYGN-UHFFFAOYSA-N 0.000 description 1
- KTFDYVNEGTXQCV-UHFFFAOYSA-N 2-Thiophenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CS1 KTFDYVNEGTXQCV-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- JVKRKMWZYMKVTQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JVKRKMWZYMKVTQ-UHFFFAOYSA-N 0.000 description 1
- JKRXLQVWEGDCNI-UHFFFAOYSA-N 2-aminosulfanyl-1-benzothiophen-6-ol Chemical compound C1=C(O)C=C2SC(SN)=CC2=C1 JKRXLQVWEGDCNI-UHFFFAOYSA-N 0.000 description 1
- BKBZFJRHYSCZQA-UHFFFAOYSA-N 2-methoxy-2-methylpropanoic acid Chemical compound COC(C)(C)C(O)=O BKBZFJRHYSCZQA-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- MBNVSWHUJDDZRH-UHFFFAOYSA-N 2-methylthiirane Chemical compound CC1CS1 MBNVSWHUJDDZRH-UHFFFAOYSA-N 0.000 description 1
- GATAOJICMOPURT-UHFFFAOYSA-N 2-pentan-3-yl-1-propylbenzimidazole Chemical compound C1=CC=C2N(CCC)C(C(CC)CC)=NC2=C1 GATAOJICMOPURT-UHFFFAOYSA-N 0.000 description 1
- AZYTZQYCOBXDGY-UHFFFAOYSA-N 2-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=CC=N1 AZYTZQYCOBXDGY-UHFFFAOYSA-N 0.000 description 1
- MTKAJLNGIVXZIS-UHFFFAOYSA-N 3,4-dimethoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1OC MTKAJLNGIVXZIS-UHFFFAOYSA-N 0.000 description 1
- MUQCDEGKKWQCAO-UHFFFAOYSA-N 3-(4-ethylphenyl)propanoic acid Chemical compound CCC1=CC=C(CCC(O)=O)C=C1 MUQCDEGKKWQCAO-UHFFFAOYSA-N 0.000 description 1
- QZPYQRRHHPFSPL-UHFFFAOYSA-N 3-(4-hydroxy-3-methoxyphenyl)-2-sulfanylprop-2-enoic acid Chemical compound COC1=CC(C=C(S)C(O)=O)=CC=C1O QZPYQRRHHPFSPL-UHFFFAOYSA-N 0.000 description 1
- SWFRUSQUOVBPRQ-UHFFFAOYSA-N 3-(dimethylamino)-2,2-dimethylpropanoic acid Chemical compound CN(C)CC(C)(C)C(O)=O SWFRUSQUOVBPRQ-UHFFFAOYSA-N 0.000 description 1
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 1
- YBJGQSNSAWZZHL-UHFFFAOYSA-N 3-chloro-2,2-dimethylpropanoic acid Chemical compound ClCC(C)(C)C(O)=O YBJGQSNSAWZZHL-UHFFFAOYSA-N 0.000 description 1
- RDFQSFOGKVZWKF-UHFFFAOYSA-N 3-hydroxy-2,2-dimethylpropanoic acid Chemical compound OCC(C)(C)C(O)=O RDFQSFOGKVZWKF-UHFFFAOYSA-N 0.000 description 1
- QVWFQOUCYDJPHH-UHFFFAOYSA-N 3-methoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2C(OC)=C(S(N)(=O)=O)SC2=C1 QVWFQOUCYDJPHH-UHFFFAOYSA-N 0.000 description 1
- LTKKWYIAUXMKRY-UHFFFAOYSA-N 3-methoxy-4-methylbenzenethiol Chemical compound COC1=CC(S)=CC=C1C LTKKWYIAUXMKRY-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- KFFJRQIEECCAQS-UHFFFAOYSA-N 4,4-dimethylcyclohexane-1-carboxylic acid Chemical compound CC1(C)CCC(C(O)=O)CC1 KFFJRQIEECCAQS-UHFFFAOYSA-N 0.000 description 1
- AWAVPNGXIOESIV-UHFFFAOYSA-N 4,5-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1O AWAVPNGXIOESIV-UHFFFAOYSA-N 0.000 description 1
- WQIPUSSEWROJPT-UHFFFAOYSA-N 4,5-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1OC WQIPUSSEWROJPT-UHFFFAOYSA-N 0.000 description 1
- NPGUAIJZFKGKRQ-UHFFFAOYSA-N 4,7-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1O NPGUAIJZFKGKRQ-UHFFFAOYSA-N 0.000 description 1
- NCNWCNXPSWANMM-UHFFFAOYSA-N 4,7-dimethoxy-1-benzothiophene Chemical compound COC1=CC=C(OC)C2=C1C=CS2 NCNWCNXPSWANMM-UHFFFAOYSA-N 0.000 description 1
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical compound CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 description 1
- MYMVKNAWBMSZOU-UHFFFAOYSA-N 4-[(2-sulfamoyl-1-benzothiophen-6-yl)oxy]butanoic acid Chemical compound C1=C(OCCCC(O)=O)C=C2SC(S(=O)(=O)N)=CC2=C1 MYMVKNAWBMSZOU-UHFFFAOYSA-N 0.000 description 1
- NXNBLCGRBRNZDJ-UHFFFAOYSA-N 4-[(2-sulfamoyl-1-benzothiophen-7-yl)oxy]butanoic acid Chemical class C1=CC(OCCCC(O)=O)=C2SC(S(=O)(=O)N)=CC2=C1 NXNBLCGRBRNZDJ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-M 4-chlorobenzoate Chemical compound [O-]C(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-M 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- ACJCKSYUUNLSAT-UHFFFAOYSA-N 4-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=CC2=C1C=C(S(N)(=O)=O)S2 ACJCKSYUUNLSAT-UHFFFAOYSA-N 0.000 description 1
- QAISRGJLXWPJRW-UHFFFAOYSA-N 4-methoxy-2-(sulfamoylmethylsulfanyl)benzoic acid Chemical compound COC1=CC=C(C(O)=O)C(SCS(N)(=O)=O)=C1 QAISRGJLXWPJRW-UHFFFAOYSA-N 0.000 description 1
- HZTCEOITUGFBIS-UHFFFAOYSA-N 4-methoxy-2-sulfanylbenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(S)=C1 HZTCEOITUGFBIS-UHFFFAOYSA-N 0.000 description 1
- XVITXHRHLDUBTA-UHFFFAOYSA-N 4-methoxy-3-methylbenzenethiol Chemical compound COC1=CC=C(S)C=C1C XVITXHRHLDUBTA-UHFFFAOYSA-N 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- KLQSAAONLQIKDE-UHFFFAOYSA-N 5,6-dimethoxy-1-benzothiophene Chemical compound C1=C(OC)C(OC)=CC2=C1SC=C2 KLQSAAONLQIKDE-UHFFFAOYSA-N 0.000 description 1
- IQXTXLLJSBDWKH-UHFFFAOYSA-N 5,6-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(OC)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 IQXTXLLJSBDWKH-UHFFFAOYSA-N 0.000 description 1
- QZFHRVFRHKHGSN-UHFFFAOYSA-N 5,7-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1 QZFHRVFRHKHGSN-UHFFFAOYSA-N 0.000 description 1
- CJHWGLBDSDKVIH-UHFFFAOYSA-N 5,7-dimethoxy-1-benzothiophene Chemical compound COC1=CC(OC)=C2SC=CC2=C1 CJHWGLBDSDKVIH-UHFFFAOYSA-N 0.000 description 1
- XONQNKZFMRFPIM-UHFFFAOYSA-N 5,7-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC(OC)=C2SC(S(N)(=O)=O)=CC2=C1 XONQNKZFMRFPIM-UHFFFAOYSA-N 0.000 description 1
- VQFYCKBJLHKHMU-UHFFFAOYSA-N 5-(2,2-diethoxyethylsulfanyl)-1,3-benzodioxole Chemical compound CCOC(OCC)CSC1=CC=C2OCOC2=C1 VQFYCKBJLHKHMU-UHFFFAOYSA-N 0.000 description 1
- CNPGUWWCHPUMAJ-UHFFFAOYSA-N 5-(2-aminoethoxy)-1-benzothiophene-2-sulfonamide;hydrochloride Chemical compound Cl.NCCOC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 CNPGUWWCHPUMAJ-UHFFFAOYSA-N 0.000 description 1
- RHBMMYRKSBNETF-UHFFFAOYSA-N 5-(2-aminoethyl)-1-benzothiophene-2-sulfonamide Chemical compound NCCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 RHBMMYRKSBNETF-UHFFFAOYSA-N 0.000 description 1
- PNBNNCUIBFUUMY-UHFFFAOYSA-N 5-(2-hydroxyethoxy)-1-benzothiophene-2-sulfonamide Chemical compound OCCOC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 PNBNNCUIBFUUMY-UHFFFAOYSA-N 0.000 description 1
- OZQBGSWJCOYWEX-UHFFFAOYSA-N 5-(2-methoxyethoxy)-1-benzothiophene-2-sulfonamide Chemical compound COCCOC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 OZQBGSWJCOYWEX-UHFFFAOYSA-N 0.000 description 1
- NALFZLKVEHBIGT-UHFFFAOYSA-N 5-(2-methoxyethyl)-1-benzothiophene Chemical compound COCCC1=CC=C2SC=CC2=C1 NALFZLKVEHBIGT-UHFFFAOYSA-N 0.000 description 1
- QJEJNQRVXIMNGF-UHFFFAOYSA-N 5-(2-propan-2-yloxyethoxymethyl)-1-benzothiophene-2-sulfonamide Chemical compound CC(C)OCCOCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 QJEJNQRVXIMNGF-UHFFFAOYSA-N 0.000 description 1
- JHJQEKRNDZGXDG-UHFFFAOYSA-N 5-(hydroxymethyl)-1-benzothiophene-2-sulfonamide Chemical compound OCC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 JHJQEKRNDZGXDG-UHFFFAOYSA-N 0.000 description 1
- MQLGWLTZVQVWRV-UHFFFAOYSA-N 5-(methoxymethyl)-1-benzothiophene Chemical compound COCC1=CC=C2SC=CC2=C1 MQLGWLTZVQVWRV-UHFFFAOYSA-N 0.000 description 1
- UBAJGSNHCORLER-UHFFFAOYSA-N 5-(methoxymethyl)-1-benzothiophene-2-sulfonamide Chemical compound COCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 UBAJGSNHCORLER-UHFFFAOYSA-N 0.000 description 1
- OWXPWWRBBBGOLO-UHFFFAOYSA-N 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound C1=C(O)C(OC)=CC(C=C2C(NC(=S)S2)=O)=C1 OWXPWWRBBBGOLO-UHFFFAOYSA-N 0.000 description 1
- OAUQUGVZOQCTBI-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCOC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 OAUQUGVZOQCTBI-UHFFFAOYSA-N 0.000 description 1
- SYWVDGIQIAMGDG-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 SYWVDGIQIAMGDG-UHFFFAOYSA-N 0.000 description 1
- GOMOMNRVFUXCOU-UHFFFAOYSA-N 5-[2-(dimethylamino)ethylsulfinylmethyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCS(=O)CC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 GOMOMNRVFUXCOU-UHFFFAOYSA-N 0.000 description 1
- UIUNXRQQDMTNNI-UHFFFAOYSA-N 5-[5-(trifluoromethyl)-1h-imidazol-2-yl]-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1C1=NC(C(F)(F)F)=CN1 UIUNXRQQDMTNNI-UHFFFAOYSA-N 0.000 description 1
- PFTVKRITKPMBSM-UHFFFAOYSA-N 5-chloro-1-benzothiophen-6-ol Chemical compound C1=C(Cl)C(O)=CC2=C1C=CS2 PFTVKRITKPMBSM-UHFFFAOYSA-N 0.000 description 1
- LMFBTVWJHQCPPU-UHFFFAOYSA-N 5-chloro-6-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound ClC1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 LMFBTVWJHQCPPU-UHFFFAOYSA-N 0.000 description 1
- GSPGECZEALQGLT-UHFFFAOYSA-N 5-ethenyl-1-benzothiophene-2-sulfonamide Chemical compound C=CC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 GSPGECZEALQGLT-UHFFFAOYSA-N 0.000 description 1
- NOEDAINOWFMFAS-UHFFFAOYSA-N 5-hydroxy-6-methoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(OC)=CC2=C1C=C(S(N)(=O)=O)S2 NOEDAINOWFMFAS-UHFFFAOYSA-N 0.000 description 1
- SSVLPEOHQGTJMO-UHFFFAOYSA-N 5-hydroxy-6-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(C)=CC2=C1C=C(S(N)(=O)=O)S2 SSVLPEOHQGTJMO-UHFFFAOYSA-N 0.000 description 1
- YUCSRVKBVKJMNH-UHFFFAOYSA-N 5-methoxy-1-benzothiophene Chemical compound COC1=CC=C2SC=CC2=C1 YUCSRVKBVKJMNH-UHFFFAOYSA-N 0.000 description 1
- JPCWACUXSHAWEC-UHFFFAOYSA-N 5-methoxy-6-methyl-1-benzothiophene Chemical compound C1=C(C)C(OC)=CC2=C1SC=C2 JPCWACUXSHAWEC-UHFFFAOYSA-N 0.000 description 1
- FRZJACQZZZQLEU-UHFFFAOYSA-N 5-methoxy-6-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(C)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 FRZJACQZZZQLEU-UHFFFAOYSA-N 0.000 description 1
- PKWCBMGRIFNCGH-UHFFFAOYSA-N 5-methyl-1-benzothiophene-2-sulfonamide Chemical compound CC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 PKWCBMGRIFNCGH-UHFFFAOYSA-N 0.000 description 1
- IZZIWIAOVZOBLF-UHFFFAOYSA-N 5-methyloxysalicylic acid Natural products COC1=CC=C(O)C(C(O)=O)=C1 IZZIWIAOVZOBLF-UHFFFAOYSA-N 0.000 description 1
- INUDYDDLDMVJEN-UHFFFAOYSA-N 6-(1-hydroxyethyl)-1-benzothiophene-2-sulfonamide Chemical compound CC(O)C1=CC=C2C=C(S(N)(=O)=O)SC2=C1 INUDYDDLDMVJEN-UHFFFAOYSA-N 0.000 description 1
- JEMKIAVXPSNDOZ-UHFFFAOYSA-N 6-(2-methyl-1,3-dioxolan-2-yl)-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2C=C(S(N)(=O)=O)SC2=CC=1C1(C)OCCO1 JEMKIAVXPSNDOZ-UHFFFAOYSA-N 0.000 description 1
- BIRQEZHIOSQULS-UHFFFAOYSA-N 6-(2-oxopropoxy)-1-benzothiophene-2-sulfonamide Chemical compound CC(=O)COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 BIRQEZHIOSQULS-UHFFFAOYSA-N 0.000 description 1
- JMPHWIMWWNULNT-VIFPVBQESA-N 6-[[(5s)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-1-benzothiophene-2-sulfonamide Chemical compound C1=C2SC(S(=O)(=O)N)=CC2=CC=C1OC[C@@H]1CNC(=O)O1 JMPHWIMWWNULNT-VIFPVBQESA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- DISMIMAAXONKGD-UHFFFAOYSA-N 6-hydroxy-5-methoxy-1-benzothiophene-2-carboxylic acid Chemical compound C1=C(O)C(OC)=CC2=C1SC(C(O)=O)=C2 DISMIMAAXONKGD-UHFFFAOYSA-N 0.000 description 1
- GEVSDYHAXHDFKL-UHFFFAOYSA-N 6-hydroxy-5-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(C)=CC2=C1SC(S(N)(=O)=O)=C2 GEVSDYHAXHDFKL-UHFFFAOYSA-N 0.000 description 1
- OGHXQNICXQQONG-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonic acid Chemical compound COC1=CC=C2C=C(S(O)(=O)=O)SC2=C1 OGHXQNICXQQONG-UHFFFAOYSA-N 0.000 description 1
- QWAWVUNLIVQYBA-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonyl chloride Chemical compound COC1=CC=C2C=C(S(Cl)(=O)=O)SC2=C1 QWAWVUNLIVQYBA-UHFFFAOYSA-N 0.000 description 1
- PTLHTECLFJRDRX-UHFFFAOYSA-N 6-methoxy-5-methyl-1-benzothiophene Chemical compound C1=C(C)C(OC)=CC2=C1C=CS2 PTLHTECLFJRDRX-UHFFFAOYSA-N 0.000 description 1
- PXDSGQSTTDJZRV-UHFFFAOYSA-N 6-methoxy-5-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(C)C(OC)=CC2=C1C=C(S(N)(=O)=O)S2 PXDSGQSTTDJZRV-UHFFFAOYSA-N 0.000 description 1
- LQTZOLOKWURTOT-UHFFFAOYSA-N 7-(2,3-dihydroxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(OCC(O)CO)=C2SC(S(=O)(=O)N)=CC2=C1 LQTZOLOKWURTOT-UHFFFAOYSA-N 0.000 description 1
- LPLQERSCRNRALO-UHFFFAOYSA-N 7-(2-oxopropoxy)-1-benzothiophene-2-sulfonamide Chemical class CC(=O)COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 LPLQERSCRNRALO-UHFFFAOYSA-N 0.000 description 1
- CQSSNJMYZUMYBE-UHFFFAOYSA-N 7-(oxiran-2-ylmethoxy)-1-benzothiophene-2-sulfonamide Chemical class C=12SC(S(=O)(=O)N)=CC2=CC=CC=1OCC1CO1 CQSSNJMYZUMYBE-UHFFFAOYSA-N 0.000 description 1
- ZSVBFALLOFMZOP-UHFFFAOYSA-N 7-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-1-benzothiophene-2-sulfonamide Chemical compound C=12SC(S(=O)(=O)N)=CC2=CC=CC=1OCC1CNC(=O)O1 ZSVBFALLOFMZOP-UHFFFAOYSA-N 0.000 description 1
- POOUWGQVPPOLFU-UHFFFAOYSA-N 7-[3-(tert-butylamino)-2-hydroxypropoxy]-1-benzothiophene-2-sulfonamide Chemical compound CC(C)(C)NCC(O)COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 POOUWGQVPPOLFU-UHFFFAOYSA-N 0.000 description 1
- RWWDZFRDYYQTFJ-UHFFFAOYSA-N 7-methoxy-1-benzothiophene Chemical compound COC1=CC=CC2=C1SC=C2 RWWDZFRDYYQTFJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- 201000004569 Blindness Diseases 0.000 description 1
- CZPABJPSROQLBW-UHFFFAOYSA-N BrC1=CC=C(C=C1)C(CSCC(C1=CC=C(C=C1)Br)(OCC)OCC)(OCC)OCC Chemical compound BrC1=CC=C(C=C1)C(CSCC(C1=CC=C(C=C1)Br)(OCC)OCC)(OCC)OCC CZPABJPSROQLBW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000723347 Cinnamomum Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical class NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AUKDHZVMUSUMGZ-UHFFFAOYSA-N N'-[(6-hydroxy-1-benzothiophen-2-yl)sulfanyl]-N,N-dimethylmethanimidamide Chemical compound CN(C=NSC1=CC2=C(S1)C=C(C=C2)O)C AUKDHZVMUSUMGZ-UHFFFAOYSA-N 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 208000028389 Nerve injury Diseases 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 208000022873 Ocular disease Diseases 0.000 description 1
- 206010030043 Ocular hypertension Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 206010047555 Visual field defect Diseases 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N acetaldehyde dimethyl acetal Natural products COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 150000001343 alkyl silanes Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- WKNONNGLPOBGEZ-UHFFFAOYSA-N bromomethanesulfonamide Chemical compound NS(=O)(=O)CBr WKNONNGLPOBGEZ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 210000003792 cranial nerve Anatomy 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-M cyclohexanecarboxylate Chemical compound [O-]C(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-M 0.000 description 1
- JBDSSBMEKXHSJF-UHFFFAOYSA-M cyclopentanecarboxylate Chemical compound [O-]C(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-M 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 238000010520 demethylation reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- ZJULYDCRWUEPTK-UHFFFAOYSA-N dichloromethyl Chemical compound Cl[CH]Cl ZJULYDCRWUEPTK-UHFFFAOYSA-N 0.000 description 1
- ISCACRDMGTYTHJ-UHFFFAOYSA-N dichlorophosphoryloxymethylbenzene Chemical compound ClP(Cl)(=O)OCC1=CC=CC=C1 ISCACRDMGTYTHJ-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- NWYYUUCSPNYMGQ-UHFFFAOYSA-N diphenylcarbamoyl 2-methoxy-2-methylpropanoate Chemical group C=1C=CC=CC=1N(C(=O)OC(=O)C(C)(C)OC)C1=CC=CC=C1 NWYYUUCSPNYMGQ-UHFFFAOYSA-N 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- JOXWSDNHLSQKCC-UHFFFAOYSA-N ethenesulfonamide Chemical compound NS(=O)(=O)C=C JOXWSDNHLSQKCC-UHFFFAOYSA-N 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- CDNDJAJIPYYJSY-UHFFFAOYSA-N ethyl 2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetate Chemical compound CCOC(=O)COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 CDNDJAJIPYYJSY-UHFFFAOYSA-N 0.000 description 1
- VFACLMGMVGKKIM-UHFFFAOYSA-N ethyl 2-[(2-sulfamoyl-1-benzothiophen-6-yl)oxy]acetate Chemical compound CCOC(=O)COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 VFACLMGMVGKKIM-UHFFFAOYSA-N 0.000 description 1
- KFKOCHQLPZSPLZ-UHFFFAOYSA-N ethyl 2-[(2-sulfamoyl-1-benzothiophen-7-yl)oxy]acetate Chemical compound CCOC(=O)COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 KFKOCHQLPZSPLZ-UHFFFAOYSA-N 0.000 description 1
- XBPOBCXHALHJFP-UHFFFAOYSA-N ethyl 4-bromobutanoate Chemical compound CCOC(=O)CCCBr XBPOBCXHALHJFP-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-M ethyl carbonate Chemical compound CCOC([O-])=O CQDGTJPVBWZJAZ-UHFFFAOYSA-M 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 1
- 238000006459 hydrosilylation reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000004941 influx Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- WTQZXWIFIDAEGQ-UHFFFAOYSA-M lithium;2-(4-methoxyphenyl)ethynesulfinate Chemical compound [Li+].COC1=CC=C(C#CS([O-])=O)C=C1 WTQZXWIFIDAEGQ-UHFFFAOYSA-M 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- NRVFDGZJTPCULU-UHFFFAOYSA-N meda Chemical compound Cl.CN(C)CCS NRVFDGZJTPCULU-UHFFFAOYSA-N 0.000 description 1
- 230000000936 membranestabilizing effect Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-M methoxyacetate Chemical compound COCC([O-])=O RMIODHQZRUFFFF-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- JDRMYOQETPMYQX-UHFFFAOYSA-N monomethyl succinate Chemical compound COC(=O)CCC(O)=O JDRMYOQETPMYQX-UHFFFAOYSA-N 0.000 description 1
- PJUIMOJAAPLTRJ-UHFFFAOYSA-N monothioglycerol Chemical compound OCC(O)CS PJUIMOJAAPLTRJ-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- PUGXRWDHZKPHCO-UHFFFAOYSA-N n,n-dimethyl-2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetamide Chemical compound CN(C)C(=O)COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 PUGXRWDHZKPHCO-UHFFFAOYSA-N 0.000 description 1
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000008764 nerve damage Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 229940054534 ophthalmic solution Drugs 0.000 description 1
- 239000002997 ophthalmic solution Substances 0.000 description 1
- 229940100654 ophthalmic suspension Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N p-hydroxybenzoic acid methyl ester Natural products COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-M p-toluate Chemical compound CC1=CC=C(C([O-])=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-M 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 229940067107 phenylethyl alcohol Drugs 0.000 description 1
- DCNLOVYDMCVNRZ-UHFFFAOYSA-N phenylmercury(.) Chemical class [Hg]C1=CC=CC=C1 DCNLOVYDMCVNRZ-UHFFFAOYSA-N 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940113115 polyethylene glycol 200 Drugs 0.000 description 1
- 229940068886 polyethylene glycol 300 Drugs 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229940057847 polyethylene glycol 600 Drugs 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- HIGSLXSBYYMVKI-UHFFFAOYSA-N pralidoxime chloride Chemical compound [Cl-].C[N+]1=CC=CC=C1\C=N\O HIGSLXSBYYMVKI-UHFFFAOYSA-N 0.000 description 1
- 229960003456 pralidoxime chloride Drugs 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-M propynoate Chemical compound [O-]C(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-M 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- BHZOKUMUHVTPBX-UHFFFAOYSA-M sodium acetic acid acetate Chemical class [Na+].CC(O)=O.CC([O-])=O BHZOKUMUHVTPBX-UHFFFAOYSA-M 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- IFWGPRUBGQSGLE-UHFFFAOYSA-M sodium;2-(4-methoxyphenyl)ethenesulfonate Chemical compound [Na+].COC1=CC=C(C=CS([O-])(=O)=O)C=C1 IFWGPRUBGQSGLE-UHFFFAOYSA-M 0.000 description 1
- RIWVXKMDMOOKPO-UHFFFAOYSA-M sodium;5-chloro-6-hydroxy-1-benzothiophene-2-sulfonate Chemical compound [Na+].C1=C(Cl)C(O)=CC2=C1C=C(S([O-])(=O)=O)S2 RIWVXKMDMOOKPO-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000012385 systemic delivery Methods 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003554 tetrahydropyrrolyl group Chemical group 0.000 description 1
- FCYXZQGDTGMGOE-UHFFFAOYSA-N thieno[2,3-f][1,3]benzodioxole Chemical compound C1=C2OCOC2=CC2=C1SC=C2 FCYXZQGDTGMGOE-UHFFFAOYSA-N 0.000 description 1
- PCUXEURMCAQJJX-UHFFFAOYSA-N thieno[2,3-f][1,3]benzodioxole-6-sulfonamide Chemical compound C1=C2SC(S(=O)(=O)N)=CC2=CC2=C1OCO2 PCUXEURMCAQJJX-UHFFFAOYSA-N 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 229940033663 thimerosal Drugs 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- QSELGEUCFNFITD-UHFFFAOYSA-N thiophene-2-carboximidamide Chemical compound NC(=N)C1=CC=CS1 QSELGEUCFNFITD-UHFFFAOYSA-N 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- BSXLLFUSNQCWJP-UHFFFAOYSA-N thiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CS1 BSXLLFUSNQCWJP-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 239000003860 topical agent Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000012384 transportation and delivery Methods 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000004382 visual function Effects 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D333/70—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms
- C07F9/655345—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms the sulfur atom being part of a five-membered ring
- C07F9/655354—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms the sulfur atom being part of a five-membered ring condensed with carbocyclic rings or carbocyclic ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50609283A | 1983-06-20 | 1983-06-20 | |
| US54719183A | 1983-10-31 | 1983-10-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO842467L true NO842467L (no) | 1985-12-21 |
Family
ID=27055356
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO842467A NO842467L (no) | 1983-06-20 | 1984-06-19 | Fremgangsmaate ved fremstilling av 2-sulfamoylbenzo(b)thiofenderivater |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP0129478B1 (index.php) |
| KR (1) | KR890000386B1 (index.php) |
| AU (1) | AU558665B2 (index.php) |
| CA (1) | CA1253151A (index.php) |
| DE (1) | DE3481057D1 (index.php) |
| DK (1) | DK298584A (index.php) |
| ES (1) | ES8600272A1 (index.php) |
| FI (1) | FI80032C (index.php) |
| GR (1) | GR82372B (index.php) |
| HU (1) | HUT37420A (index.php) |
| IE (1) | IE57601B1 (index.php) |
| IL (1) | IL72070A (index.php) |
| NO (1) | NO842467L (index.php) |
| NZ (1) | NZ208444A (index.php) |
| PT (1) | PT78762A (index.php) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0189690B1 (en) * | 1984-12-12 | 1989-03-01 | Merck & Co. Inc. | Substituted aromatic sulfonamides, their preparation and ophthalmic compositions containing them |
| US4820848A (en) * | 1984-12-12 | 1989-04-11 | Merck & Co., Inc. | Substituted aromatic sulfonamides as antiglaucoma agents |
| EP0271273A3 (en) * | 1986-12-08 | 1989-07-12 | Merck & Co. Inc. | Thieno-and furopyridine sulfonamides |
| US4731368A (en) * | 1986-12-08 | 1988-03-15 | Merck & Co., Inc. | Thienopyridine sulfonamides and their ophthalmological formulation |
| US4808595A (en) * | 1986-12-24 | 1989-02-28 | Merck & Co., Inc. | Furopyridine sulfonamides and their opthalmological compositions |
| US4894390A (en) * | 1987-08-03 | 1990-01-16 | Merck & Co., Inc. | Substituted thieno[2,3-b]thiophene-2-sulfonamides as antiglaucoma agents |
| CA1320487C (en) * | 1987-08-03 | 1993-07-20 | George D. Hartman | Substituted thieno[2,3-.beta.]thiophene-2-sulfonamides as antiglaucoma agents |
| US4751231A (en) * | 1987-09-16 | 1988-06-14 | Merck & Co., Inc. | Substituted thieno[2,3-b]pyrrole-5-sulfonamides as antiglaucoma agents |
| US4929549A (en) * | 1989-02-08 | 1990-05-29 | Merck & Co., Inc. | 5-carbamoylthieno[2,3-b]thiophene-2-sulfon-amides as topically active carbonic anhydrase inhibitors |
| WO1999051593A1 (en) * | 1998-04-02 | 1999-10-14 | Ortho-Mcneil Pharmaceutical, Inc. | 4-thionaphthyl-1h-imidazoles with alpha-2-adrenergic activity |
| US6313309B1 (en) * | 1999-04-05 | 2001-11-06 | Ortho-Mcneil Pharmaceutical, Inc. | 4-thionaphthyl—1H—imidazoles which are usefulα22-adrenoceptoR agonists/ antagonists |
| RU2397169C2 (ru) * | 2005-03-28 | 2010-08-20 | Тояма Кемикал Ко., Лтд. | Способ получения 1-(3-(2-(1-бензотиофен-5-ил)этокси) пропил)азетидин-3-ола или его солей |
| PL2248809T3 (pl) | 2005-03-28 | 2012-10-31 | Toyama Chemical Co Ltd | 3-[2-(Benzo[b]tiofen-5-ylo)-etoksy]-propaniany alkilu jako związki pośrednie w wytwarzaniu pochodnych azetydyn-3-olu |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR241136A1 (es) * | 1981-07-13 | 1991-11-29 | Merck E Co Inc | Procedimiento para preparar esteres de 6-hidroxi-2-benzotiazolsulfonamida para tratamiento topicode presion intraocular elevada" |
| US4386098A (en) * | 1981-11-03 | 1983-05-31 | Merck & Co., Inc. | 6-Hydroxy-2-benzothiazolesulfonamide for the topical treatment of elevated intraocular pressure |
| US4426388A (en) * | 1982-04-02 | 1984-01-17 | Merck & Co., Inc. | 5-Benzothiazolesulfonamide derivatives for the topical treatment of elevated intraocular pressure |
-
1984
- 1984-06-11 IL IL72070A patent/IL72070A/xx not_active IP Right Cessation
- 1984-06-11 NZ NZ208444A patent/NZ208444A/en unknown
- 1984-06-13 ES ES533390A patent/ES8600272A1/es not_active Expired
- 1984-06-14 DE DE8484401227T patent/DE3481057D1/de not_active Expired - Lifetime
- 1984-06-14 EP EP84401227A patent/EP0129478B1/en not_active Expired - Lifetime
- 1984-06-14 GR GR75021A patent/GR82372B/el unknown
- 1984-06-18 PT PT78762A patent/PT78762A/pt not_active IP Right Cessation
- 1984-06-18 CA CA000456789A patent/CA1253151A/en not_active Expired
- 1984-06-19 KR KR1019840003455A patent/KR890000386B1/ko not_active Expired
- 1984-06-19 DK DK298584A patent/DK298584A/da not_active Application Discontinuation
- 1984-06-19 AU AU29496/84A patent/AU558665B2/en not_active Ceased
- 1984-06-19 NO NO842467A patent/NO842467L/no unknown
- 1984-06-19 FI FI842478A patent/FI80032C/fi not_active IP Right Cessation
- 1984-06-19 HU HU842363A patent/HUT37420A/hu unknown
- 1984-06-19 IE IE1536/84A patent/IE57601B1/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI80032C (fi) | 1990-04-10 |
| GR82372B (index.php) | 1984-12-13 |
| IE57601B1 (en) | 1993-01-27 |
| IL72070A (en) | 1988-11-30 |
| DK298584A (da) | 1984-12-21 |
| AU558665B2 (en) | 1987-02-05 |
| FI842478A7 (fi) | 1984-12-21 |
| EP0129478A2 (en) | 1984-12-27 |
| AU2949684A (en) | 1985-06-13 |
| IL72070A0 (en) | 1984-10-31 |
| EP0129478B1 (en) | 1990-01-17 |
| IE841536L (en) | 1984-12-20 |
| DE3481057D1 (de) | 1990-02-22 |
| FI80032B (fi) | 1989-12-29 |
| ES533390A0 (es) | 1985-10-01 |
| NZ208444A (en) | 1987-08-31 |
| EP0129478A3 (en) | 1987-03-25 |
| KR890000386B1 (ko) | 1989-03-16 |
| ES8600272A1 (es) | 1985-10-01 |
| KR850000428A (ko) | 1985-02-27 |
| FI842478A0 (fi) | 1984-06-19 |
| CA1253151A (en) | 1989-04-25 |
| HUT37420A (en) | 1985-12-28 |
| PT78762A (en) | 1984-07-01 |
| DK298584D0 (da) | 1984-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4668697A (en) | Elevated intraocular pressure lowering benzo-[b]-thiophene-2-sulfonamide derivatives, compositions, and method of use therefor | |
| DK175886B1 (da) | Fremgangsmåde til fremstilling af ikke-solvatiseret krystallinsk 6-hydroxy-2-(4-hydroxyphenyl)-3-[4-(2-piperidinoethoxy)benzoyl]benzo[b]thiophenhydrochlorid | |
| NO842467L (no) | Fremgangsmaate ved fremstilling av 2-sulfamoylbenzo(b)thiofenderivater | |
| US4677115A (en) | Antiglaucoma thieno-thiopyran and thieno-thiepin sulfonamide derivatives, compositions, and method of use thereof | |
| NO844043L (no) | Benzo(b)tiofener | |
| US3070606A (en) | Xchxn | |
| CA2445010A1 (en) | Heteroaryloxy 3-substituted propanamines s serotonin and norepinephrine reuptake inhibitors | |
| EP0295049B1 (en) | Thiophene sulfonamide antiglaucoma agents | |
| EP0189690B1 (en) | Substituted aromatic sulfonamides, their preparation and ophthalmic compositions containing them | |
| EP0152340B1 (en) | 2-Sulfamoylbenzo[b]furan derivatives and ophtalmic composition for the treatment of elevated intraocular pressure | |
| US5102905A (en) | Thienyl benzothienyl and dibenzothienyl compounds as inhibitors of aldose reductase | |
| KR100322943B1 (ko) | 항염증제로서유용한디히드로벤조푸란및관련화합물 | |
| US4788192A (en) | 2-Sulfamoylbenzo(b)thiophene derivatives pharmaceutical compositions and use | |
| US4665090A (en) | Substituted thiophene-2-sulfonamide antiglaucoma agents | |
| US4820848A (en) | Substituted aromatic sulfonamides as antiglaucoma agents | |
| IT8347666A1 (it) | "Derivati del benzotiofene, loro preparazione e loro impiego come medicamenti". | |
| US4824968A (en) | Substituted aromatic sulfonamides as antiglaucoma agents | |
| JPH0219837B2 (index.php) | ||
| CA2236254A1 (en) | Process for preparing benzo¬b|thiophenes | |
| JPS61109787A (ja) | 置換チオフエン‐2‐スルホンアミド抗緑内障剤 | |
| PL145950B1 (en) | Method of obtaining 1,3-diacyl-2-ketoindoles | |
| NO771032L (no) | Dibenzotiofen-derivater. | |
| Charonnat et al. | The synthesis of four isomeric bisthienothiepinones | |
| US4672138A (en) | Phenyl substituted carbamothioic acid esters | |
| NO115439B (index.php) |