NO833681L - 3-aryl-7-klor-3,4-dihydro-akridin-1,9,(2h,10h)-dion-1-oksimer og -1-hydrazonderivater, deres salter, fremgangsmaate til deres fremstilling, midler som inneholder de og deres anvendelse - Google Patents
3-aryl-7-klor-3,4-dihydro-akridin-1,9,(2h,10h)-dion-1-oksimer og -1-hydrazonderivater, deres salter, fremgangsmaate til deres fremstilling, midler som inneholder de og deres anvendelseInfo
- Publication number
- NO833681L NO833681L NO833681A NO833681A NO833681L NO 833681 L NO833681 L NO 833681L NO 833681 A NO833681 A NO 833681A NO 833681 A NO833681 A NO 833681A NO 833681 L NO833681 L NO 833681L
- Authority
- NO
- Norway
- Prior art keywords
- chloro
- acridine
- dihydro
- gives
- dione
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 6
- 150000003839 salts Chemical class 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 19
- 239000002253 acid Substances 0.000 claims abstract description 9
- 150000003863 ammonium salts Chemical class 0.000 claims abstract description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 7
- 239000000460 chlorine Substances 0.000 claims abstract description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004193 piperazinyl group Chemical group 0.000 claims abstract description 3
- -1 C 1 -C 4 -alkoxy Chemical group 0.000 claims description 55
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 125000002947 alkylene group Chemical group 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000005146 naphthylsulfonyl group Chemical group C1(=CC=CC2=CC=CC=C12)S(=O)(=O)* 0.000 claims description 3
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 3
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims description 2
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000002246 antineoplastic agent Substances 0.000 claims 1
- 229940127089 cytotoxic agent Drugs 0.000 claims 1
- 125000005029 naphthylthio group Chemical group C1(=CC=CC2=CC=CC=C12)S* 0.000 claims 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 201000004792 malaria Diseases 0.000 abstract description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- IYPZRUYMFDWKSS-UHFFFAOYSA-N piperazin-1-amine Chemical compound NN1CCNCC1 IYPZRUYMFDWKSS-UHFFFAOYSA-N 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 9
- RJWLLQWLBMJCFD-UHFFFAOYSA-N 4-methylpiperazin-1-amine Chemical compound CN1CCN(N)CC1 RJWLLQWLBMJCFD-UHFFFAOYSA-N 0.000 description 8
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 6
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical compound NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 5
- DJTIANXYHUNHQV-UHFFFAOYSA-N 1,1-dibutylhydrazine Chemical compound CCCCN(N)CCCC DJTIANXYHUNHQV-UHFFFAOYSA-N 0.000 description 5
- AWHZKKVSUJJVNL-UHFFFAOYSA-N 7-chloro-10-hydroxy-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2h-acridine-1,9-dione Chemical compound C1C(=O)C=2C(=O)C3=CC(Cl)=CC=C3N(O)C=2CC1C1=CC=C(C(F)(F)F)C=C1 AWHZKKVSUJJVNL-UHFFFAOYSA-N 0.000 description 5
- PZRVZMZUBQJOQW-UHFFFAOYSA-N 7-chloro-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridine-1,9-dione Chemical compound C1=CC(C(F)(F)F)=CC=C1C1CC(NC=2C(=CC(Cl)=CC=2)C2=O)=C2C(=O)C1 PZRVZMZUBQJOQW-UHFFFAOYSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- SBMSLRMNBSMKQC-UHFFFAOYSA-N pyrrolidin-1-amine Chemical compound NN1CCCC1 SBMSLRMNBSMKQC-UHFFFAOYSA-N 0.000 description 5
- URJZMRYOVLWXHO-UHFFFAOYSA-N 1,1-bis(methylamino)guanidine Chemical compound CNN(NC)C(N)=N URJZMRYOVLWXHO-UHFFFAOYSA-N 0.000 description 4
- DALNXMAZDJRTPB-UHFFFAOYSA-N 2-(dimethylamino)acetohydrazide Chemical compound CN(C)CC(=O)NN DALNXMAZDJRTPB-UHFFFAOYSA-N 0.000 description 4
- YCEXZVLTZDWEFH-UHFFFAOYSA-N 2-morpholin-4-ylacetohydrazide Chemical compound NNC(=O)CN1CCOCC1 YCEXZVLTZDWEFH-UHFFFAOYSA-N 0.000 description 4
- REMFSEADKDMHBG-UHFFFAOYSA-N 2-morpholin-4-ylethyl n-aminocarbamate Chemical compound NNC(=O)OCCN1CCOCC1 REMFSEADKDMHBG-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- UYRUJOSOEXZYLW-UHFFFAOYSA-N acetohydrazide;hydrochloride Chemical compound Cl.CC(=O)NN UYRUJOSOEXZYLW-UHFFFAOYSA-N 0.000 description 4
- PVUJTISUCSKKBS-UHFFFAOYSA-N dimethylaminothiourea Chemical compound CN(C)NC(N)=S PVUJTISUCSKKBS-UHFFFAOYSA-N 0.000 description 4
- SVZFWZRCMLRFOM-UHFFFAOYSA-N dimethylaminourea Chemical compound CN(C)NC(N)=O SVZFWZRCMLRFOM-UHFFFAOYSA-N 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- COSDEZTULDESEV-UHFFFAOYSA-N 1-aminooxy-3-morpholin-4-ylpropan-2-ol Chemical compound NOCC(O)CN1CCOCC1 COSDEZTULDESEV-UHFFFAOYSA-N 0.000 description 3
- QENGROZZUNALCE-UHFFFAOYSA-N 2-morpholin-4-ylpropanehydrazide Chemical compound NNC(=O)C(C)N1CCOCC1 QENGROZZUNALCE-UHFFFAOYSA-N 0.000 description 3
- NGBWMHAGQMAIMH-UHFFFAOYSA-N 2-piperidin-1-ylethylhydrazine Chemical compound NNCCN1CCCCC1 NGBWMHAGQMAIMH-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- MXWHMTNPTTVWDM-NXOFHUPFSA-N mitoguazone Chemical compound NC(N)=N\N=C(/C)\C=N\N=C(N)N MXWHMTNPTTVWDM-NXOFHUPFSA-N 0.000 description 3
- SUUAFMDPHOXPLM-UHFFFAOYSA-N n-amino-n-(diethylamino)acetamide Chemical compound CCN(CC)N(N)C(C)=O SUUAFMDPHOXPLM-UHFFFAOYSA-N 0.000 description 3
- YOUVHXQKCSEVSP-UHFFFAOYSA-N o-(2-piperidin-1-ylethyl)hydroxylamine Chemical compound NOCCN1CCCCC1 YOUVHXQKCSEVSP-UHFFFAOYSA-N 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 2
- XAOHWSFGKCJOGT-UHFFFAOYSA-N 2-(4-aminopiperazin-1-yl)ethanol Chemical compound NN1CCN(CCO)CC1 XAOHWSFGKCJOGT-UHFFFAOYSA-N 0.000 description 2
- TUXFLPICTVEGND-UHFFFAOYSA-N 4-methylpiperazine-1-carbohydrazide Chemical compound CN1CCN(C(=O)NN)CC1 TUXFLPICTVEGND-UHFFFAOYSA-N 0.000 description 2
- JNGXJKJTJUBQSH-UHFFFAOYSA-N 4-methylpiperazine-1-carbothiohydrazide Chemical compound CN1CCN(C(=S)NN)CC1 JNGXJKJTJUBQSH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- AHAMDCHRUKAGDP-UHFFFAOYSA-N [2-(dimethylamino)ethylamino]urea Chemical compound CN(C)CCNNC(N)=O AHAMDCHRUKAGDP-UHFFFAOYSA-N 0.000 description 2
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- VGHOWOWLIXPTOA-UHFFFAOYSA-N cyclohexane;toluene Chemical compound C1CCCCC1.CC1=CC=CC=C1 VGHOWOWLIXPTOA-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- IDTLZAUXLORZJQ-UHFFFAOYSA-N o-(2-thiomorpholin-4-ylethyl)hydroxylamine Chemical compound NOCCN1CCSCC1 IDTLZAUXLORZJQ-UHFFFAOYSA-N 0.000 description 2
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- SRVJKTDHMYAMHA-WUXMJOGZSA-N thioacetazone Chemical compound CC(=O)NC1=CC=C(\C=N\NC(N)=S)C=C1 SRVJKTDHMYAMHA-WUXMJOGZSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ROFVGYAMRSGUSQ-UHFFFAOYSA-N 1-(2-bromoethyl)piperazine;hydrobromide Chemical compound Br.BrCCN1CCNCC1 ROFVGYAMRSGUSQ-UHFFFAOYSA-N 0.000 description 1
- ONEYFZXGNFNRJH-UHFFFAOYSA-N 1-(4-methylphenyl)piperazine Chemical compound C1=CC(C)=CC=C1N1CCNCC1 ONEYFZXGNFNRJH-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- ZEBFPAXSQXIPNF-UHFFFAOYSA-N 2,5-dimethylpyrrolidine Chemical compound CC1CCC(C)N1 ZEBFPAXSQXIPNF-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- CPHXLFKIUVVIOQ-UHFFFAOYSA-N 2-(trifluoromethoxy)benzaldehyde Chemical group FC(F)(F)OC1=CC=CC=C1C=O CPHXLFKIUVVIOQ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NNWUEBIEOFQMSS-UHFFFAOYSA-N 2-Methylpiperidine Chemical compound CC1CCCCN1 NNWUEBIEOFQMSS-UHFFFAOYSA-N 0.000 description 1
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical class NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- NHCNLGHWNHJXBY-UHFFFAOYSA-N 2-methylpropanehydrazide;hydrochloride Chemical compound Cl.CC(C)C(=O)NN NHCNLGHWNHJXBY-UHFFFAOYSA-N 0.000 description 1
- RGHPCLZJAFCTIK-UHFFFAOYSA-N 2-methylpyrrolidine Chemical compound CC1CCCN1 RGHPCLZJAFCTIK-UHFFFAOYSA-N 0.000 description 1
- WEJKUVSYIGOBAR-UHFFFAOYSA-N 2-morpholin-4-ium-4-ylpropanoate Chemical compound OC(=O)C(C)N1CCOCC1 WEJKUVSYIGOBAR-UHFFFAOYSA-N 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- SJMJMGVFFRSXOG-UHFFFAOYSA-N 4-benzylpiperazin-1-amine Chemical compound C1CN(N)CCN1CC1=CC=CC=C1 SJMJMGVFFRSXOG-UHFFFAOYSA-N 0.000 description 1
- AHAPEYABSDOBIP-UHFFFAOYSA-N 4-ethylpiperazin-1-amine Chemical compound CCN1CCN(N)CC1 AHAPEYABSDOBIP-UHFFFAOYSA-N 0.000 description 1
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 1
- DAURIJZNKHAJSE-UHFFFAOYSA-N 4-phenylpiperazin-1-amine Chemical compound C1CN(N)CCN1C1=CC=CC=C1 DAURIJZNKHAJSE-UHFFFAOYSA-N 0.000 description 1
- JQEOUMNFAUUDKU-UHFFFAOYSA-N 7-chloro-2,3,4,10-tetrahydroacridine-1,9-dione Chemical compound C1CCC(=O)C2=C1NC1=CC=C(Cl)C=C1C2=O JQEOUMNFAUUDKU-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 208000003495 Coccidiosis Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 206010023076 Isosporiasis Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 206010034133 Pathogen resistance Diseases 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000231697 Zelus means Species 0.000 description 1
- FLMCNCMHXSWZNT-UHFFFAOYSA-N [2-(diethylamino)ethylamino]thiourea Chemical compound CCN(CC)CCNNC(N)=S FLMCNCMHXSWZNT-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940058934 aminoquinoline antimalarials Drugs 0.000 description 1
- 150000005010 aminoquinolines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- NRYJIKFQAFBQJF-UHFFFAOYSA-N o-(2-morpholin-4-ylethyl)hydroxylamine Chemical compound NOCCN1CCOCC1 NRYJIKFQAFBQJF-UHFFFAOYSA-N 0.000 description 1
- PYXHZSPWJIANNK-UHFFFAOYSA-N o-(2-pyrrolidin-1-ylethyl)hydroxylamine Chemical compound NOCCN1CCCC1 PYXHZSPWJIANNK-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- UNEIHNMKASENIG-UHFFFAOYSA-N para-chlorophenylpiperazine Chemical compound C1=CC(Cl)=CC=C1N1CCNCC1 UNEIHNMKASENIG-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ZAMCTDDIJFNXOH-UHFFFAOYSA-N tributylazanium;acetate Chemical compound CC(O)=O.CCCCN(CCCC)CCCC ZAMCTDDIJFNXOH-UHFFFAOYSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D219/00—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems
- C07D219/04—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the ring system
- C07D219/06—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D219/00—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems
- C07D219/04—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the ring system
- C07D219/08—Nitrogen atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823237649 DE3237649A1 (de) | 1982-10-11 | 1982-10-11 | 3-aryl-7-chlor-10-hydroxy-3,4-dihydro-acridin-1,9-(2h, 10h)-dion-1-oxime und -1-hydrazonderivate, deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
| DE19823247908 DE3247908A1 (de) | 1982-12-24 | 1982-12-24 | 3-aryl-7-chlor-3,4-dihydro-acridin-1,9-(2h,-10h)-dion-1-oxime und -1-hydrazonderivate, deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO833681L true NO833681L (no) | 1984-04-12 |
Family
ID=25805046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO833681A NO833681L (no) | 1982-10-11 | 1983-10-10 | 3-aryl-7-klor-3,4-dihydro-akridin-1,9,(2h,10h)-dion-1-oksimer og -1-hydrazonderivater, deres salter, fremgangsmaate til deres fremstilling, midler som inneholder de og deres anvendelse |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4593027A (Direct) |
| EP (1) | EP0106284B1 (Direct) |
| AU (1) | AU561449B2 (Direct) |
| CA (1) | CA1217491A (Direct) |
| DE (1) | DE3372094D1 (Direct) |
| DK (1) | DK465583A (Direct) |
| ES (1) | ES8405616A1 (Direct) |
| FI (1) | FI833651A7 (Direct) |
| GR (1) | GR78732B (Direct) |
| HU (1) | HU190854B (Direct) |
| IL (1) | IL69941A (Direct) |
| JO (1) | JO1266B1 (Direct) |
| MA (1) | MA19925A1 (Direct) |
| NO (1) | NO833681L (Direct) |
| NZ (1) | NZ205906A (Direct) |
| PH (1) | PH19108A (Direct) |
| PT (1) | PT77476B (Direct) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4626540A (en) * | 1983-11-08 | 1986-12-02 | Warner-Lambert Company | Substituted 1-amino-4-nitro-acridinones and methods of treating bacterial infections and leukemia with them |
| IN164921B (Direct) * | 1986-07-22 | 1989-07-08 | Hoechst India | |
| US5180717A (en) * | 1988-08-16 | 1993-01-19 | The Upjohn Company | Bivalent ligands effective for blocking ACAT enzyme for lowering plasma triglycerides and for elevating HDL cholesterol |
| US5268388A (en) * | 1988-12-27 | 1993-12-07 | E. I. Du Pont De Nemours And Company | Substituted semicarbazone arthropodicides |
| US5182303A (en) * | 1988-12-27 | 1993-01-26 | E. I. Du Pont De Nemours And Company | Substituted semicarbazone arthropodicides |
| US5859028A (en) * | 1997-04-28 | 1999-01-12 | Potomax Limited Partnership | Carotenoid synthesis inhibiting herbicides and fatty acid synthesis inhibiting oxime herbicides as anti-Apicomplexa protozoan parasite agents |
| US20090324580A1 (en) * | 2006-03-09 | 2009-12-31 | Cenix Bioscience Gmbh | Use of Inhibitors of Scavenger Receptor Class Proteins for the Treatment of Infectious Diseases |
| CA2673683C (en) | 2007-01-11 | 2014-07-29 | Critical Outcome Technologies, Inc. | Compounds and method for treatment of cancer |
| US8466151B2 (en) | 2007-12-26 | 2013-06-18 | Critical Outcome Technologies, Inc. | Compounds and method for treatment of cancer |
| EP2318406B1 (en) | 2008-07-17 | 2016-01-27 | Critical Outcome Technologies, Inc. | Thiosemicarbazone inhibitor compounds and cancer treatment methods |
| US8987272B2 (en) | 2010-04-01 | 2015-03-24 | Critical Outcome Technologies Inc. | Compounds and method for treatment of HIV |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880210A (en) * | 1959-03-31 | Acridine n-oxides | ||
| US3184452A (en) * | 1965-05-18 | New aminoalkoxy compounds and process for theik manufacture | ||
| NL278921A (Direct) * | 1961-05-26 | |||
| US3577558A (en) * | 1968-04-15 | 1971-05-04 | Sterling Drug Inc | 1-aminoalkylamino-4-alkoxymethylthioxanthene derivatives |
| DE1811409A1 (de) * | 1968-11-28 | 1970-06-18 | Bayer Ag | Mittel zur Bekaempfung von Insekten,Milben,Hasenartigen und Nagetieren |
| DE2337474C2 (de) * | 1973-07-24 | 1982-01-21 | Hoechst Ag, 6000 Frankfurt | Chemotherapeutisch wirksame Tetrahydroacridone, Verfahren zu ihrer Herstellung und sie enthaltende Mittel |
| DE2651084A1 (de) * | 1976-11-09 | 1978-12-14 | Hoechst Ag | Basisch substituirte o-(2-hydroxypropyl) -aldoxime, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE2748333A1 (de) * | 1977-10-28 | 1979-05-03 | Hoechst Ag | Mittel gegen malaria |
| US4178451A (en) * | 1978-07-13 | 1979-12-11 | E. R. Squibb & Sons, Inc. | 3-(Substituted hydrazino)benzisothiazole-1,1-dioxides |
| US4266062A (en) * | 1978-09-18 | 1981-05-05 | Mcneilab, Inc. | (1-Methyl-2-pyridinylidene) derivatives of guanidine |
| US4447427A (en) * | 1979-01-04 | 1984-05-08 | The United States Of America As Represented By The Secretary Of The Army | Method for treating bacterial infections with 2-acetyl- and 2-propionylpyridine thiosemicarbazones |
| US4291034A (en) * | 1980-03-20 | 1981-09-22 | Warner Lambert Company | 7-Chloro-3-substituted aryl-3,4-dihydro-1,9(2H,10H) and 10 hydroxy acridinedioneimines having antimalarial activity |
| US4440771A (en) * | 1982-02-12 | 1984-04-03 | The United States Of America As Represented By The Secretary Of The Army | 2-Acetyl quinoline thiosemicarbazones useful in treatment of gonorrhea, malaria or bacterial infections |
-
1983
- 1983-10-07 FI FI833651A patent/FI833651A7/fi not_active Application Discontinuation
- 1983-10-07 CA CA000438636A patent/CA1217491A/en not_active Expired
- 1983-10-07 EP EP83110035A patent/EP0106284B1/de not_active Expired
- 1983-10-07 DE DE8383110035T patent/DE3372094D1/de not_active Expired
- 1983-10-10 ES ES526354A patent/ES8405616A1/es not_active Expired
- 1983-10-10 IL IL69941A patent/IL69941A/xx unknown
- 1983-10-10 PT PT77476A patent/PT77476B/pt unknown
- 1983-10-10 NZ NZ205906A patent/NZ205906A/en unknown
- 1983-10-10 HU HU833500A patent/HU190854B/hu not_active IP Right Cessation
- 1983-10-10 MA MA20145A patent/MA19925A1/fr unknown
- 1983-10-10 GR GR72653A patent/GR78732B/el unknown
- 1983-10-10 DK DK465583A patent/DK465583A/da not_active Application Discontinuation
- 1983-10-10 PH PH29680A patent/PH19108A/en unknown
- 1983-10-10 AU AU20004/83A patent/AU561449B2/en not_active Ceased
- 1983-10-10 NO NO833681A patent/NO833681L/no unknown
- 1983-10-11 US US06/540,647 patent/US4593027A/en not_active Expired - Fee Related
- 1983-10-11 JO JO19831266A patent/JO1266B1/en active
Also Published As
| Publication number | Publication date |
|---|---|
| FI833651A7 (fi) | 1984-04-12 |
| PH19108A (en) | 1986-01-06 |
| PT77476B (de) | 1986-04-16 |
| US4593027A (en) | 1986-06-03 |
| NZ205906A (en) | 1986-06-11 |
| MA19925A1 (fr) | 1984-07-01 |
| DK465583A (da) | 1984-04-12 |
| PT77476A (de) | 1983-11-01 |
| IL69941A0 (en) | 1984-01-31 |
| AU561449B2 (en) | 1987-05-07 |
| HU190854B (en) | 1986-11-28 |
| ES526354A0 (es) | 1984-06-16 |
| GR78732B (Direct) | 1984-10-02 |
| AU2000483A (en) | 1984-04-19 |
| CA1217491A (en) | 1987-02-03 |
| EP0106284B1 (de) | 1987-06-16 |
| DE3372094D1 (en) | 1987-07-23 |
| DK465583D0 (da) | 1983-10-10 |
| JO1266B1 (en) | 1985-04-20 |
| FI833651A0 (fi) | 1983-10-07 |
| ES8405616A1 (es) | 1984-06-16 |
| IL69941A (en) | 1988-06-30 |
| EP0106284A1 (de) | 1984-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3299067A (en) | 2-[1'-(benzyl and phenyl)-4'-piperazinyl]-pyrimidine derivatives | |
| DE69111077T2 (de) | Chinazolinderivate um die antitumorwirkung zu verbessern. | |
| NO833681L (no) | 3-aryl-7-klor-3,4-dihydro-akridin-1,9,(2h,10h)-dion-1-oksimer og -1-hydrazonderivater, deres salter, fremgangsmaate til deres fremstilling, midler som inneholder de og deres anvendelse | |
| WO1994014780A1 (en) | Pyrimidine, pyridine, pteridinone and indazole derivatives as enzyme inhibitors | |
| US4232022A (en) | Heterocyclic compounds | |
| JP2018502146A (ja) | ビグアニド化合物及びその使用 | |
| US5874431A (en) | Benzazole compounds | |
| Dumas et al. | Synthesis and pharmacological characterization of a potent, orally active p38 kinase inhibitor | |
| US7582655B2 (en) | Antineoplastic compounds | |
| US3753981A (en) | 4-amino-2-styrylquinazoline compounds | |
| US5401743A (en) | Aminoalkyl-substituted 2-amino-5-mercaptothiadiazoles the preparation and use thereof | |
| HU191126B (en) | Process for producing new n-imino-pyridinium-betaine derivatives and pharmaceutical compositions containing them as active agents | |
| CZ288824B6 (cs) | Deriváty hydroximové kyseliny, farmaceutické prostředky, které je obsahují, způsob jejich přípravy a meziprodukty v tomto způsobu | |
| CS274494B2 (en) | Method of substituted styrene derivatives preparation | |
| HUP0204282A2 (hu) | Biszszulfonamidok alkalmazása hiperlipidémia kezelésére vagy megelőzésére alkalmas gyógyászati készítmények előállítására | |
| US3682933A (en) | Derivatives of benzoxazoline-2-one | |
| DE69521745T2 (de) | Diazacycloalkanalkylsulfonamid-derivat | |
| US3890323A (en) | Phenylketone derivatives | |
| US3167556A (en) | Basic derivatives of anilides | |
| DE3237649A1 (de) | 3-aryl-7-chlor-10-hydroxy-3,4-dihydro-acridin-1,9-(2h, 10h)-dion-1-oxime und -1-hydrazonderivate, deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung | |
| US2846438A (en) | Nu-(beta-diethylaminoethyl) isonicotinamide | |
| US4610991A (en) | Antihypertensive pyridylaminobenzamide compounds | |
| HUT57198A (en) | Process for producing diamine derivatives and pharmaceutical compositions containing them as active components utilizable in the onkology | |
| DE3410517A1 (de) | 1-amino-, 1hydrazino- und 1-n-hydroxylamino-3-aryl-7-chlor-1,2,3,4-tetrahydro-9(10)-acridone, ihre salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung | |
| US4772704A (en) | 2,5-disubstituted-4(3H)-pyrimidones having histamine H2 -receptor antagonist activity |