NO823506L - Fremgangsmaate for fremstilling av terapeutisk aktive triazinderivater. - Google Patents
Fremgangsmaate for fremstilling av terapeutisk aktive triazinderivater.Info
- Publication number
- NO823506L NO823506L NO823506A NO823506A NO823506L NO 823506 L NO823506 L NO 823506L NO 823506 A NO823506 A NO 823506A NO 823506 A NO823506 A NO 823506A NO 823506 L NO823506 L NO 823506L
- Authority
- NO
- Norway
- Prior art keywords
- lower alkyl
- methyl
- compound
- general formula
- triazine
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 35
- 150000003918 triazines Chemical class 0.000 title description 4
- 238000002360 preparation method Methods 0.000 title description 2
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 131
- -1 1,3,4,5-tetrahydro-2H-1-benzazepinyl Chemical group 0.000 claims description 123
- 125000000217 alkyl group Chemical group 0.000 claims description 107
- 150000003839 salts Chemical class 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 239000001257 hydrogen Substances 0.000 claims description 24
- 125000002252 acyl group Chemical group 0.000 claims description 21
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 claims description 20
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 125000004043 oxo group Chemical group O=* 0.000 claims description 16
- 230000009467 reduction Effects 0.000 claims description 16
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 150000002431 hydrogen Chemical class 0.000 claims description 13
- 125000004414 alkyl thio group Chemical group 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001118 alkylidene group Chemical group 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- 238000003379 elimination reaction Methods 0.000 claims description 7
- 238000007363 ring formation reaction Methods 0.000 claims description 7
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 230000029936 alkylation Effects 0.000 claims description 4
- 238000005804 alkylation reaction Methods 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000004685 alkoxythiocarbonyl group Chemical group 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000003106 haloaryl group Chemical group 0.000 claims description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims 2
- 230000008030 elimination Effects 0.000 claims 2
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical class C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 249
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 189
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 186
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 165
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 118
- 239000000203 mixture Substances 0.000 description 113
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 110
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 110
- 239000000243 solution Substances 0.000 description 103
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 62
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 59
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- 238000003756 stirring Methods 0.000 description 50
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 49
- 238000004458 analytical method Methods 0.000 description 47
- 230000002829 reductive effect Effects 0.000 description 46
- 238000001816 cooling Methods 0.000 description 41
- 239000011541 reaction mixture Substances 0.000 description 39
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 38
- 238000001914 filtration Methods 0.000 description 38
- 239000013078 crystal Substances 0.000 description 36
- 238000002329 infrared spectrum Methods 0.000 description 31
- 239000002244 precipitate Substances 0.000 description 31
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 30
- 239000000741 silica gel Substances 0.000 description 30
- 229910002027 silica gel Inorganic materials 0.000 description 30
- 239000012279 sodium borohydride Substances 0.000 description 30
- 229910000033 sodium borohydride Inorganic materials 0.000 description 30
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 28
- 239000000706 filtrate Substances 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 239000003480 eluent Substances 0.000 description 24
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 239000007787 solid Substances 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 239000007864 aqueous solution Substances 0.000 description 18
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 17
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 17
- 229910052938 sodium sulfate Inorganic materials 0.000 description 17
- 235000011152 sodium sulphate Nutrition 0.000 description 17
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 16
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 16
- 238000006722 reduction reaction Methods 0.000 description 16
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 14
- 235000019341 magnesium sulphate Nutrition 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- 235000011181 potassium carbonates Nutrition 0.000 description 12
- 239000012267 brine Substances 0.000 description 11
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 11
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 10
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 235000019198 oils Nutrition 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 7
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 7
- GNSZGUQQIIMCFD-UHFFFAOYSA-N (5-methyl-6-phenyl-1,2,4-triazin-3-yl)hydrazine Chemical compound CC1=NC(NN)=NN=C1C1=CC=CC=C1 GNSZGUQQIIMCFD-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002168 alkylating agent Substances 0.000 description 6
- 229940100198 alkylating agent Drugs 0.000 description 6
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 230000003276 anti-hypertensive effect Effects 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WFAFBRPCMGLXII-UHFFFAOYSA-N [6-(4-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]hydrazine Chemical compound CC1=NC(NN)=NN=C1C1=CC=C(Cl)C=C1 WFAFBRPCMGLXII-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- VDDYVHKZOGMJRI-UHFFFAOYSA-N 5-methyl-3-methylsulfanyl-6-phenyl-1,2,4-triazine Chemical compound CC1=NC(SC)=NN=C1C1=CC=CC=C1 VDDYVHKZOGMJRI-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 239000007818 Grignard reagent Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 150000004795 grignard reagents Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 210000004623 platelet-rich plasma Anatomy 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 2
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 2
- QOIBCPWMEJWUNP-UHFFFAOYSA-N 1-methyl-1-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)hydrazine Chemical compound CC1=NC(N(N)C)=NN=C1C1=CC=CC=C1 QOIBCPWMEJWUNP-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- FGYZAIRAFLGXQI-UHFFFAOYSA-N 2-[4-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)piperazin-1-yl]ethanol Chemical compound CC1=NC(N2CCN(CCO)CC2)=NN=C1C1=CC=CC=C1 FGYZAIRAFLGXQI-UHFFFAOYSA-N 0.000 description 2
- HVVGFHIROMWTHC-UHFFFAOYSA-N 2-hydroxy-n'-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)acetohydrazide Chemical compound CC1=NC(NNC(=O)CO)=NN=C1C1=CC=CC=C1 HVVGFHIROMWTHC-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- VAZQYAJGTXQZMQ-UHFFFAOYSA-N 4-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)morpholine Chemical compound CC1=NC(N2CCOCC2)=NN=C1C1=CC=CC=C1 VAZQYAJGTXQZMQ-UHFFFAOYSA-N 0.000 description 2
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 2
- ILXDORXSFUVKGV-UHFFFAOYSA-N 5-methyl-3-(4-methylpiperazin-1-yl)-6-phenyl-1,2,4-triazine Chemical compound C1CN(C)CCN1C1=NN=C(C=2C=CC=CC=2)C(C)=N1 ILXDORXSFUVKGV-UHFFFAOYSA-N 0.000 description 2
- RWTYPVKUIHGRKG-UHFFFAOYSA-N 6-(4-bromophenyl)-5-methyl-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound CC1NC(=O)NN=C1C1=CC=C(Br)C=C1 RWTYPVKUIHGRKG-UHFFFAOYSA-N 0.000 description 2
- MFWLBCXSMHAXKN-UHFFFAOYSA-N 6-(4-chlorophenyl)-5-methyl-3-methylsulfanyl-1,2,4-triazine Chemical compound CC1=NC(SC)=NN=C1C1=CC=C(Cl)C=C1 MFWLBCXSMHAXKN-UHFFFAOYSA-N 0.000 description 2
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- VPGRYOFKCNULNK-ACXQXYJUSA-N Deoxycorticosterone acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)COC(=O)C)[C@@]1(C)CC2 VPGRYOFKCNULNK-ACXQXYJUSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- 244000305267 Quercus macrolepis Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- TZLLKXQTSSCQRC-UHFFFAOYSA-N [(2-hydroxyimino-1-phenylpropylidene)amino]thiourea Chemical compound NC(=S)NN=C(C(=NO)C)C1=CC=CC=C1 TZLLKXQTSSCQRC-UHFFFAOYSA-N 0.000 description 2
- PBYCXOMULWTYTF-UHFFFAOYSA-N [[1-(2-chlorophenyl)-2-hydroxyiminopropylidene]amino]thiourea Chemical compound NC(=S)NN=C(C(=NO)C)C1=CC=CC=C1Cl PBYCXOMULWTYTF-UHFFFAOYSA-N 0.000 description 2
- IOQWNZDWPFOMKN-UHFFFAOYSA-N [[1-(4-bromophenyl)-2-hydroxyiminopropylidene]amino]thiourea Chemical compound BrC1=CC=C(C=C1)C(C(C)=NO)=NNC(=S)N IOQWNZDWPFOMKN-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001347 alkyl bromides Chemical class 0.000 description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 2
- 150000001348 alkyl chlorides Chemical class 0.000 description 2
- 150000001351 alkyl iodides Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229960004486 desoxycorticosterone acetate Drugs 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- KMFWBYWPQAVFAM-UHFFFAOYSA-N ethyl n-(1-oxo-1-phenylpropan-2-yl)carbamate Chemical compound CCOC(=O)NC(C)C(=O)C1=CC=CC=C1 KMFWBYWPQAVFAM-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- LWTJNCZNDWRSID-UHFFFAOYSA-N n'-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)benzohydrazide Chemical compound N=1N=C(C=2C=CC=CC=2)C(C)=NC=1NNC(=O)C1=CC=CC=C1 LWTJNCZNDWRSID-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229940055764 triaz Drugs 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- YPINLRNGSGGJJT-JXMROGBWSA-N (2e)-2-hydroxyimino-1-phenylpropan-1-one Chemical compound O\N=C(/C)C(=O)C1=CC=CC=C1 YPINLRNGSGGJJT-JXMROGBWSA-N 0.000 description 1
- UBBVYTDLMXZHIN-UHFFFAOYSA-N (5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)cyanamide Chemical compound CC1N=C(NC#N)NN=C1C1=CC=CC=C1 UBBVYTDLMXZHIN-UHFFFAOYSA-N 0.000 description 1
- XKKWTXDGOYKBKA-UHFFFAOYSA-N (5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)hydrazine;hydrochloride Chemical compound Cl.CC1N=C(NN)NN=C1C1=CC=CC=C1 XKKWTXDGOYKBKA-UHFFFAOYSA-N 0.000 description 1
- YSCHSPBIXVMTIH-UHFFFAOYSA-N 1-(2-chlorophenyl)-2-hydroxyiminopropan-1-one Chemical compound ON=C(C)C(=O)C1=CC=CC=C1Cl YSCHSPBIXVMTIH-UHFFFAOYSA-N 0.000 description 1
- SSNIXANZPPREMK-UHFFFAOYSA-N 1-(4-bromophenyl)-2-hydroxyiminopropan-1-one Chemical compound ON=C(C)C(=O)C1=CC=C(Br)C=C1 SSNIXANZPPREMK-UHFFFAOYSA-N 0.000 description 1
- JMQSNVPNNSGQIQ-UHFFFAOYSA-N 1-[6-(3-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]-1-methylhydrazine Chemical compound CC1=NC(N(N)C)=NN=C1C1=CC=CC(Cl)=C1 JMQSNVPNNSGQIQ-UHFFFAOYSA-N 0.000 description 1
- WJSSTKPHOQCOJO-UHFFFAOYSA-N 1-[6-(4-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]-2-(4,5-dihydro-1h-imidazol-2-yl)hydrazine Chemical compound N=1N=C(C=2C=CC(Cl)=CC=2)C(C)=NC=1NNC1=NCCN1 WJSSTKPHOQCOJO-UHFFFAOYSA-N 0.000 description 1
- VUJNVQBOFYFFEE-UHFFFAOYSA-N 1-[6-(4-chlorophenyl)-5-methyl-2,5-dihydro-1,2,4-triazin-3-yl]-2-(4,5-dihydro-1h-imidazol-2-yl)hydrazine;dihydrochloride Chemical compound Cl.Cl.N1N=C(C=2C=CC(Cl)=CC=2)C(C)N=C1NNC1=NCCN1 VUJNVQBOFYFFEE-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- XRFWGKVNUICTJB-UHFFFAOYSA-N 1-butyl-6-(2-hydroxyiminopropanoyl)-3,4-dihydroquinolin-2-one Chemical compound ON=C(C)C(=O)C1=CC=C2N(CCCC)C(=O)CCC2=C1 XRFWGKVNUICTJB-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- DYRVYJUDNHMYQU-UHFFFAOYSA-N 1-methyl-1-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)hydrazine Chemical compound CC1N=C(N(C)N)NN=C1C1=CC=CC=C1 DYRVYJUDNHMYQU-UHFFFAOYSA-N 0.000 description 1
- CDIXSKMSRGQEIM-UHFFFAOYSA-N 1-methyl-3-[(5-methyl-6-phenyl-1,2,4-triazin-3-yl)amino]urea Chemical compound CC1=NC(NNC(=O)NC)=NN=C1C1=CC=CC=C1 CDIXSKMSRGQEIM-UHFFFAOYSA-N 0.000 description 1
- HYAYEZNIPAZJKD-UHFFFAOYSA-N 1-methyl-3-[(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)amino]urea Chemical compound N1C(NNC(=O)NC)=NC(C)C(C=2C=CC=CC=2)=N1 HYAYEZNIPAZJKD-UHFFFAOYSA-N 0.000 description 1
- BRMGXYCPPGIPML-UHFFFAOYSA-N 1-methyl-6-(5-methyl-3-oxo-4,5-dihydro-2h-1,2,4-triazin-6-yl)-3,4-dihydroquinolin-2-one Chemical compound CC1NC(=O)NN=C1C1=CC=C(N(C)C(=O)CC2)C2=C1 BRMGXYCPPGIPML-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- IIATVLXXAYLQIZ-UHFFFAOYSA-N 2,5-dihydro-1,2,4-triazine Chemical compound C1C=NNC=N1 IIATVLXXAYLQIZ-UHFFFAOYSA-N 0.000 description 1
- YDRIAYQPLPFORS-UHFFFAOYSA-N 2,5-dimethyl-6-phenyl-1,2,4-triazin-3-one Chemical compound CC1=NC(=O)N(C)N=C1C1=CC=CC=C1 YDRIAYQPLPFORS-UHFFFAOYSA-N 0.000 description 1
- BSZUNFKGOBZFJJ-UHFFFAOYSA-N 2-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)-5-methylsulfanyl-1,2,4-triazol-3-amine Chemical compound N1=C(SC)N=C(N)N1C1=NN=C(C=2C=CC=CC=2)C(C)=N1 BSZUNFKGOBZFJJ-UHFFFAOYSA-N 0.000 description 1
- VRPJIFMKZZEXLR-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NCC(O)=O VRPJIFMKZZEXLR-UHFFFAOYSA-N 0.000 description 1
- DMWNBDGEOHMMLP-UHFFFAOYSA-N 2-[(5-methyl-6-phenyl-1,2,4-triazin-3-yl)amino]ethanol Chemical compound CC1=NC(NCCO)=NN=C1C1=CC=CC=C1 DMWNBDGEOHMMLP-UHFFFAOYSA-N 0.000 description 1
- LUMHBCMDXAFBHK-UHFFFAOYSA-N 2-[2-hydroxyethyl-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)amino]ethanol Chemical compound CC1N=C(N(CCO)CCO)NN=C1C1=CC=CC=C1 LUMHBCMDXAFBHK-UHFFFAOYSA-N 0.000 description 1
- LOGRYCBLDJWXGF-UHFFFAOYSA-N 2-[4-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)piperazin-1-yl]ethanol Chemical compound CC1N=C(N2CCN(CCO)CC2)NN=C1C1=CC=CC=C1 LOGRYCBLDJWXGF-UHFFFAOYSA-N 0.000 description 1
- FYELSNVLZVIGTI-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-ethylpyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1CC)CC(=O)N1CC2=C(CC1)NN=N2 FYELSNVLZVIGTI-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- XFSQFUHWMDTVIE-UHFFFAOYSA-N 2-[[6-(4-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]amino]guanidine Chemical compound CC1=NC(NNC(N)=N)=NN=C1C1=CC=C(Cl)C=C1 XFSQFUHWMDTVIE-UHFFFAOYSA-N 0.000 description 1
- MLXDUYUQINCFFV-UHFFFAOYSA-N 2-acetyloxyacetic acid Chemical compound CC(=O)OCC(O)=O MLXDUYUQINCFFV-UHFFFAOYSA-N 0.000 description 1
- FZNOSALCDVTESF-UHFFFAOYSA-N 2-amino-1-(4-methylphenyl)propan-1-one;hydrochloride Chemical compound Cl.CC(N)C(=O)C1=CC=C(C)C=C1 FZNOSALCDVTESF-UHFFFAOYSA-N 0.000 description 1
- HPZCAKYHISJOIK-UHFFFAOYSA-N 2-amino-1-phenylpropan-1-one;hydron;chloride Chemical compound Cl.CC(N)C(=O)C1=CC=CC=C1 HPZCAKYHISJOIK-UHFFFAOYSA-N 0.000 description 1
- QFRHFCPIIALFSF-UHFFFAOYSA-N 2-amino-1-thiophen-2-ylpropan-1-one;hydrochloride Chemical compound Cl.CC(N)C(=O)C1=CC=CS1 QFRHFCPIIALFSF-UHFFFAOYSA-N 0.000 description 1
- HSZALOCHSZLLQZ-UHFFFAOYSA-N 2-hydroxy-n'-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)acetohydrazide Chemical compound CC1N=C(NNC(=O)CO)NN=C1C1=CC=CC=C1 HSZALOCHSZLLQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- IBYCWZQBUXLSBH-UHFFFAOYSA-N 2-hydroxyimino-1-(3-methylphenyl)propan-1-one Chemical compound ON=C(C)C(=O)C1=CC=CC(C)=C1 IBYCWZQBUXLSBH-UHFFFAOYSA-N 0.000 description 1
- HSDNQULSFCKMAZ-UHFFFAOYSA-N 2-hydroxyimino-1-(4-methoxyphenyl)propan-1-one Chemical compound COC1=CC=C(C(=O)C(C)=NO)C=C1 HSDNQULSFCKMAZ-UHFFFAOYSA-N 0.000 description 1
- MJMBKWMKABZPOI-UHFFFAOYSA-N 2-hydroxyimino-1-(4-nitrophenyl)propan-1-one Chemical compound ON=C(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1 MJMBKWMKABZPOI-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- QXKZJYVGGKDGHX-UHFFFAOYSA-N 3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propan-1-amine Chemical compound NCCCOC1=CC=CC(CN2CCCC2)=C1 QXKZJYVGGKDGHX-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- FCHLLJHPXMRQHA-UHFFFAOYSA-N 4-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)morpholine;hydrochloride Chemical compound Cl.CC1N=C(N2CCOCC2)NN=C1C1=CC=CC=C1 FCHLLJHPXMRQHA-UHFFFAOYSA-N 0.000 description 1
- WDYXWEBIEVWTMI-UHFFFAOYSA-N 4-[[methyl-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]benzonitrile Chemical compound N=1N=C(C=2C=CC=CC=2)C(C)=NC=1N(C)N=CC1=CC=C(C#N)C=C1 WDYXWEBIEVWTMI-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- YMBMXBOUDJKXSC-UHFFFAOYSA-N 5,6-dimethyl-3-methylsulfanyl-1,2,4-triazine Chemical compound CSC1=NN=C(C)C(C)=N1 YMBMXBOUDJKXSC-UHFFFAOYSA-N 0.000 description 1
- ATBJVSTZWSXXTQ-UHFFFAOYSA-N 5,6-dimethyl-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound CC1NC(=O)NN=C1C ATBJVSTZWSXXTQ-UHFFFAOYSA-N 0.000 description 1
- SVENAKRZKPZKHD-UHFFFAOYSA-N 5-benzyl-2,5-dimethyl-6-phenyl-4h-1,2,4-triazin-3-one Chemical compound C=1C=CC=CC=1CC1(C)NC(=O)N(C)N=C1C1=CC=CC=C1 SVENAKRZKPZKHD-UHFFFAOYSA-N 0.000 description 1
- OTDUZXMEGZMGCR-UHFFFAOYSA-N 5-methyl-3-methylsulfanyl-6-(4-nitrophenyl)-1,2,4-triazine Chemical compound CC1=NC(SC)=NN=C1C1=CC=C([N+]([O-])=O)C=C1 OTDUZXMEGZMGCR-UHFFFAOYSA-N 0.000 description 1
- NSVDWLSIFALOOX-UHFFFAOYSA-N 5-methyl-3-methylsulfanyl-6-pyridin-2-yl-1,2,4-triazine Chemical compound CC1=NC(SC)=NN=C1C1=CC=CC=N1 NSVDWLSIFALOOX-UHFFFAOYSA-N 0.000 description 1
- GHBGPKQIWBHFRM-UHFFFAOYSA-N 5-methyl-3-methylsulfinyl-6-phenyl-1,2,4-triazine Chemical compound CC1=NC(S(C)=O)=NN=C1C1=CC=CC=C1 GHBGPKQIWBHFRM-UHFFFAOYSA-N 0.000 description 1
- SIHRLFNKHKRVCS-UHFFFAOYSA-N 5-methyl-3-methylsulfonyl-6-phenyl-1,2,4-triazine Chemical compound CC1=NC(S(C)(=O)=O)=NN=C1C1=CC=CC=C1 SIHRLFNKHKRVCS-UHFFFAOYSA-N 0.000 description 1
- YBEVVDHUGFYSTA-UHFFFAOYSA-N 5-methyl-6-(3-methylphenyl)-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound CC1NC(=O)NN=C1C1=CC=CC(C)=C1 YBEVVDHUGFYSTA-UHFFFAOYSA-N 0.000 description 1
- OZAYVYJFTLTFTI-UHFFFAOYSA-N 5-methyl-6-(4-methylphenyl)-2h-1,2,4-triazine-3-thione Chemical compound C1=CC(C)=CC=C1C1=NNC(=S)N=C1C OZAYVYJFTLTFTI-UHFFFAOYSA-N 0.000 description 1
- BUUMABIEDGYDRT-UHFFFAOYSA-N 5-methyl-6-(4-nitrophenyl)-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound CC1NC(=O)NN=C1C1=CC=C([N+]([O-])=O)C=C1 BUUMABIEDGYDRT-UHFFFAOYSA-N 0.000 description 1
- ZTXLYTLAFVPWQX-UHFFFAOYSA-N 5-methyl-6-phenyl-2h-1,2,4-triazin-3-one Chemical compound CC1=NC(=O)NN=C1C1=CC=CC=C1 ZTXLYTLAFVPWQX-UHFFFAOYSA-N 0.000 description 1
- NUTRARNQWJYYCW-UHFFFAOYSA-N 5-methyl-6-phenyl-2h-1,2,4-triazine-3-thione Chemical compound CC1=NC(=S)NN=C1C1=CC=CC=C1 NUTRARNQWJYYCW-UHFFFAOYSA-N 0.000 description 1
- VGQTUIUWJWGCDB-UHFFFAOYSA-N 5-methyl-6-phenyl-4,5-dihydro-2h-1,2,4-triazine-3-thione Chemical compound CC1NC(=S)NN=C1C1=CC=CC=C1 VGQTUIUWJWGCDB-UHFFFAOYSA-N 0.000 description 1
- USARSADXZXAVIV-UHFFFAOYSA-N 5-methyl-6-phenyl-n-piperidin-1-yl-1,2,4-triazin-3-amine Chemical compound N=1N=C(C=2C=CC=CC=2)C(C)=NC=1NN1CCCCC1 USARSADXZXAVIV-UHFFFAOYSA-N 0.000 description 1
- CSYNYVSVEOKUAK-UHFFFAOYSA-N 5-methyl-6-phenyl-n-piperidin-1-yl-2,5-dihydro-1,2,4-triazin-3-amine Chemical compound N1N=C(C=2C=CC=CC=2)C(C)N=C1NN1CCCCC1 CSYNYVSVEOKUAK-UHFFFAOYSA-N 0.000 description 1
- UVZCTNUAYBDZLF-UHFFFAOYSA-N 5-methyl-6-pyridin-2-yl-2h-1,2,4-triazin-3-one Chemical compound CC1=NC(=O)NN=C1C1=CC=CC=N1 UVZCTNUAYBDZLF-UHFFFAOYSA-N 0.000 description 1
- LJHFYWXJFUFLEX-UHFFFAOYSA-N 5-methyl-6-pyridin-2-yl-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound CC1NC(=O)NN=C1C1=CC=CC=N1 LJHFYWXJFUFLEX-UHFFFAOYSA-N 0.000 description 1
- IPXMKSPWHGKCHE-UHFFFAOYSA-N 6-(2-chlorophenyl)-5-methyl-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound CC1NC(=O)NN=C1C1=CC=CC=C1Cl IPXMKSPWHGKCHE-UHFFFAOYSA-N 0.000 description 1
- CUUOICSIJLTYKC-UHFFFAOYSA-N 6-(3-chlorophenyl)-5-methyl-2h-1,2,4-triazin-3-one Chemical compound CC1=NC(=O)NN=C1C1=CC=CC(Cl)=C1 CUUOICSIJLTYKC-UHFFFAOYSA-N 0.000 description 1
- IKWBUJUENZSUIL-UHFFFAOYSA-N 6-(4-bromophenyl)-5-methyl-3-methylsulfanyl-1,2,4-triazine Chemical compound CC1=NC(SC)=NN=C1C1=CC=C(Br)C=C1 IKWBUJUENZSUIL-UHFFFAOYSA-N 0.000 description 1
- LXVLEZMGXFZDEI-UHFFFAOYSA-N 6-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazine Chemical compound N1=C(C)C=C(C)N1C1=NN=C(C=2C=CC(Cl)=CC=2)C(C)=N1 LXVLEZMGXFZDEI-UHFFFAOYSA-N 0.000 description 1
- AKHUOBIKGZXCIE-UHFFFAOYSA-N 6-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-2,5-dihydro-1,2,4-triazine;hydrochloride Chemical compound Cl.CC1N=C(N2C(=CC(C)=N2)C)NN=C1C1=CC=C(Cl)C=C1 AKHUOBIKGZXCIE-UHFFFAOYSA-N 0.000 description 1
- HFHXYEUJAWZOKP-UHFFFAOYSA-N 6-(4-methoxyphenyl)-5-methyl-3-methylsulfanyl-1,2,4-triazine Chemical compound C1=CC(OC)=CC=C1C1=NN=C(SC)N=C1C HFHXYEUJAWZOKP-UHFFFAOYSA-N 0.000 description 1
- UNILCLGZKFIKHN-UHFFFAOYSA-N 6-(4-methoxyphenyl)-5-methyl-4,5-dihydro-2h-1,2,4-triazin-3-one Chemical compound C1=CC(OC)=CC=C1C1=NNC(=O)NC1C UNILCLGZKFIKHN-UHFFFAOYSA-N 0.000 description 1
- RBNBNHYZOLEZAQ-UHFFFAOYSA-N 7-(2-hydroxyiminopropanoyl)-1-methyl-4,5-dihydro-3h-1-benzazepin-2-one Chemical compound C1CCC(=O)N(C)C2=CC=C(C(=O)C(C)=NO)C=C21 RBNBNHYZOLEZAQ-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102100026735 Coagulation factor VIII Human genes 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 101000911390 Homo sapiens Coagulation factor VIII Proteins 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- JJSCUXAFAJEQGB-MRVPVSSYSA-N [(1r)-1-isocyanatoethyl]benzene Chemical compound O=C=N[C@H](C)C1=CC=CC=C1 JJSCUXAFAJEQGB-MRVPVSSYSA-N 0.000 description 1
- BLFJSFGFHVFOMS-UHFFFAOYSA-N [(2-hydroxyimino-1-pyridin-2-ylpropylidene)amino]thiourea Chemical compound NC(=S)NN=C(C(=NO)C)C1=CC=CC=N1 BLFJSFGFHVFOMS-UHFFFAOYSA-N 0.000 description 1
- IQSQGMBCVSMHSG-UHFFFAOYSA-N [1-(4-methoxyphenyl)-1-oxopropan-2-yl]azanium;chloride Chemical compound Cl.COC1=CC=C(C(=O)C(C)N)C=C1 IQSQGMBCVSMHSG-UHFFFAOYSA-N 0.000 description 1
- CDQBVNLKRUCSKJ-UHFFFAOYSA-N [6-(3-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]hydrazine Chemical compound CC1=NC(NN)=NN=C1C1=CC=CC(Cl)=C1 CDQBVNLKRUCSKJ-UHFFFAOYSA-N 0.000 description 1
- XCYOVHAVTXEGSG-UHFFFAOYSA-N [6-(3-chlorophenyl)-5-methyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine;hydrochloride Chemical compound Cl.CC1N=C(NN)NN=C1C1=CC=CC(Cl)=C1 XCYOVHAVTXEGSG-UHFFFAOYSA-N 0.000 description 1
- PVUKYWHCHUUMMC-UHFFFAOYSA-N [6-(4-chlorophenyl)-5-methyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine;hydrochloride Chemical compound Cl.CC1N=C(NN)NN=C1C1=CC=C(Cl)C=C1 PVUKYWHCHUUMMC-UHFFFAOYSA-N 0.000 description 1
- JQWWSAYNAIFFAA-UHFFFAOYSA-N [6-(4-methoxyphenyl)-5-methyl-1,2,4-triazin-3-yl]hydrazine Chemical compound C1=CC(OC)=CC=C1C1=NN=C(NN)N=C1C JQWWSAYNAIFFAA-UHFFFAOYSA-N 0.000 description 1
- XNXATOMXHSPQCW-UHFFFAOYSA-N [6-(4-methoxyphenyl)-5-methyl-2,5-dihydro-1,2,4-triazin-3-yl]hydrazine;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C1=NNC(NN)=NC1C XNXATOMXHSPQCW-UHFFFAOYSA-N 0.000 description 1
- UERQNTCZRYLZNG-UHFFFAOYSA-N [[2-hydroxyimino-1-(4-methoxyphenyl)propylidene]amino]thiourea Chemical compound COC1=CC=C(C(=NNC(N)=S)C(C)=NO)C=C1 UERQNTCZRYLZNG-UHFFFAOYSA-N 0.000 description 1
- ANHYATXYWRUNFK-UHFFFAOYSA-N [[2-hydroxyimino-1-(4-nitrophenyl)propylidene]amino]thiourea Chemical compound NC(=S)NN=C(C(=NO)C)C1=CC=C([N+]([O-])=O)C=C1 ANHYATXYWRUNFK-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 229960004676 antithrombotic agent Drugs 0.000 description 1
- 229940127217 antithrombotic drug Drugs 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- IULFXBLVJIPESI-UHFFFAOYSA-N bis(methylsulfanyl)methylidenecyanamide Chemical compound CSC(SC)=NC#N IULFXBLVJIPESI-UHFFFAOYSA-N 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- ZPFKRQXYKULZKP-UHFFFAOYSA-N butylidene Chemical group [CH2+]CC[CH-] ZPFKRQXYKULZKP-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- FKTUXVQEOXYNMO-UHFFFAOYSA-N cyanocarbamodithioic acid Chemical compound SC(=S)NC#N FKTUXVQEOXYNMO-UHFFFAOYSA-N 0.000 description 1
- 125000005170 cycloalkyloxycarbonyl group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 description 1
- 125000006534 ethyl amino methyl group Chemical group [H]N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- QMSLQAIFKUQFAI-UHFFFAOYSA-N ethyl n-(1-hydrazinylidene-1-phenylpropan-2-yl)carbamate Chemical compound CCOC(=O)NC(C)C(=NN)C1=CC=CC=C1 QMSLQAIFKUQFAI-UHFFFAOYSA-N 0.000 description 1
- RDCJQCJPTLDWRW-UHFFFAOYSA-N ethyl n-(1-oxo-1-thiophen-2-ylpropan-2-yl)carbamate Chemical compound CCOC(=O)NC(C)C(=O)C1=CC=CS1 RDCJQCJPTLDWRW-UHFFFAOYSA-N 0.000 description 1
- SJNXNUCRBLWNDA-UHFFFAOYSA-N ethyl n-[(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)amino]carbamate Chemical compound N1C(NNC(=O)OCC)=NC(C)C(C=2C=CC=CC=2)=N1 SJNXNUCRBLWNDA-UHFFFAOYSA-N 0.000 description 1
- ODBRFDLCONXUDR-UHFFFAOYSA-N ethyl n-[1-(4-bromophenyl)-1-oxopropan-2-yl]carbamate Chemical compound CCOC(=O)NC(C)C(=O)C1=CC=C(Br)C=C1 ODBRFDLCONXUDR-UHFFFAOYSA-N 0.000 description 1
- MAGOEZQQHUMMGT-UHFFFAOYSA-N ethyl n-[1-(4-methylphenyl)-1-oxopropan-2-yl]carbamate Chemical compound CCOC(=O)NC(C)C(=O)C1=CC=C(C)C=C1 MAGOEZQQHUMMGT-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- SADPINFEWFPMEA-UHFFFAOYSA-N furan-2-yl(piperazin-1-yl)methanone Chemical compound C=1C=COC=1C(=O)N1CCNCC1 SADPINFEWFPMEA-UHFFFAOYSA-N 0.000 description 1
- FDVYWDGOJHPUIN-UHFFFAOYSA-N furan-2-yl-[4-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)piperazin-1-yl]methanone Chemical compound CC1=NC(N2CCN(CC2)C(=O)C=2OC=CC=2)=NN=C1C1=CC=CC=C1 FDVYWDGOJHPUIN-UHFFFAOYSA-N 0.000 description 1
- LEBPHMQWHHQHBK-UHFFFAOYSA-N furan-2-yl-[4-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)piperazin-1-yl]methanone Chemical compound CC1N=C(N2CCN(CC2)C(=O)C=2OC=CC=2)NN=C1C1=CC=CC=C1 LEBPHMQWHHQHBK-UHFFFAOYSA-N 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 210000000554 iris Anatomy 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- BLQJIBCZHWBKSL-UHFFFAOYSA-L magnesium iodide Chemical compound [Mg+2].[I-].[I-] BLQJIBCZHWBKSL-UHFFFAOYSA-L 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- SCEZYJKGDJPHQO-UHFFFAOYSA-M magnesium;methanidylbenzene;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C1=CC=CC=C1 SCEZYJKGDJPHQO-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- TZFOWHQHVSSTSP-UHFFFAOYSA-N methyl 5-[(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)sulfanyl]-4-oxopentanoate Chemical compound N1C(SCC(=O)CCC(=O)OC)=NC(C)C(C=2C=CC=CC=2)=N1 TZFOWHQHVSSTSP-UHFFFAOYSA-N 0.000 description 1
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 1
- CTUBEZCQGZYMEG-UHFFFAOYSA-N methyl n-cyano-n'-(1-oxo-1-phenylpropan-2-yl)carbamimidothioate Chemical compound N#CN=C(SC)NC(C)C(=O)C1=CC=CC=C1 CTUBEZCQGZYMEG-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 1
- QOBYUKRXPRKNLT-UHFFFAOYSA-N n',n'-diethyl-n-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)ethane-1,2-diamine Chemical compound CC1=NC(NCCN(CC)CC)=NN=C1C1=CC=CC=C1 QOBYUKRXPRKNLT-UHFFFAOYSA-N 0.000 description 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 1
- BVUJRQBCBXZCNO-UHFFFAOYSA-N n'-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)acetohydrazide Chemical compound CC1=NC(NNC(=O)C)=NN=C1C1=CC=CC=C1 BVUJRQBCBXZCNO-UHFFFAOYSA-N 0.000 description 1
- IGWVLDLTFQUANZ-UHFFFAOYSA-N n'-(5-methyl-6-phenyl-1,2,4-triazin-3-yl)pentanehydrazide Chemical compound CC1=NC(NNC(=O)CCCC)=NN=C1C1=CC=CC=C1 IGWVLDLTFQUANZ-UHFFFAOYSA-N 0.000 description 1
- ODUQPCWNTCKGIH-UHFFFAOYSA-N n'-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)acetohydrazide Chemical compound CC1N=C(NNC(C)=O)NN=C1C1=CC=CC=C1 ODUQPCWNTCKGIH-UHFFFAOYSA-N 0.000 description 1
- ORUJOWBZVQHDDG-UHFFFAOYSA-N n'-(5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-3-yl)benzohydrazide Chemical compound N1N=C(C=2C=CC=CC=2)C(C)N=C1NNC(=O)C1=CC=CC=C1 ORUJOWBZVQHDDG-UHFFFAOYSA-N 0.000 description 1
- VDHBTEHELGSSRQ-UHFFFAOYSA-N n'-[6-(4-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]acetohydrazide Chemical compound CC1=NC(NNC(=O)C)=NN=C1C1=CC=C(Cl)C=C1 VDHBTEHELGSSRQ-UHFFFAOYSA-N 0.000 description 1
- INOKJYPCPBXAAX-UHFFFAOYSA-N n'-[6-(4-chlorophenyl)-5-methyl-2,5-dihydro-1,2,4-triazin-3-yl]acetohydrazide Chemical compound CC1N=C(NNC(C)=O)NN=C1C1=CC=C(Cl)C=C1 INOKJYPCPBXAAX-UHFFFAOYSA-N 0.000 description 1
- JQIAXYFLAWXTSE-UHFFFAOYSA-N n-(4-chlorophenyl)-5-methyl-6-phenyl-1,2,4-triazin-3-amine Chemical compound N=1N=C(C=2C=CC=CC=2)C(C)=NC=1NC1=CC=C(Cl)C=C1 JQIAXYFLAWXTSE-UHFFFAOYSA-N 0.000 description 1
- OKZWDPQNWCJLKS-UHFFFAOYSA-N n-[(5-methyl-6-phenyl-1,2,4-triazin-3-yl)amino]formamide Chemical compound CC1=NC(NNC=O)=NN=C1C1=CC=CC=C1 OKZWDPQNWCJLKS-UHFFFAOYSA-N 0.000 description 1
- PUZZMCBYRFWIIX-UHFFFAOYSA-N n-[[6-(4-chlorophenyl)-5-methyl-1,2,4-triazin-3-yl]amino]formamide Chemical compound CC1=NC(NNC=O)=NN=C1C1=CC=C(Cl)C=C1 PUZZMCBYRFWIIX-UHFFFAOYSA-N 0.000 description 1
- JYEIQFMYVLUNMW-UHFFFAOYSA-N n-[[6-(4-chlorophenyl)-5-methyl-2,5-dihydro-1,2,4-triazin-3-yl]amino]formamide Chemical compound CC1N=C(NNC=O)NN=C1C1=CC=C(Cl)C=C1 JYEIQFMYVLUNMW-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N o-phenylene-diaceto-nitrile Natural products N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 150000002902 organometallic compounds Chemical group 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 125000006628 propoxycarbonylamino group Chemical group 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000011477 surgical intervention Methods 0.000 description 1
- 101150029150 syd-1 gene Proteins 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005934 tert-pentyloxycarbonyl group Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- PIEPQKCYPFFYMG-UHFFFAOYSA-N tris acetate Chemical compound CC(O)=O.OCC(N)(CO)CO PIEPQKCYPFFYMG-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/16—Benzazepines; Hydrogenated benzazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8131900 | 1981-10-22 | ||
| GB8224151 | 1982-08-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO823506L true NO823506L (no) | 1983-04-25 |
Family
ID=26281042
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO823506A NO823506L (no) | 1981-10-22 | 1982-10-21 | Fremgangsmaate for fremstilling av terapeutisk aktive triazinderivater. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4616014A (es) |
| EP (1) | EP0077983B1 (es) |
| JP (1) | JPS5899468A (es) |
| AU (1) | AU8926982A (es) |
| DE (1) | DE3276164D1 (es) |
| DK (1) | DK453882A (es) |
| ES (3) | ES516724A0 (es) |
| FI (1) | FI823544L (es) |
| GR (1) | GR76714B (es) |
| NO (1) | NO823506L (es) |
| OA (1) | OA07236A (es) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1199027A (en) * | 1981-11-12 | 1986-01-07 | Stuart D. Mills | Heterocyclic derivatives of pyridazinone, thiadiazinone, oxadiazinone and triazinone |
| US4581356A (en) * | 1983-03-22 | 1986-04-08 | Fujisawa Pharmaceutical Co., Ltd. | Triazine derivatives, and pharmaceutical compositions comprising the same |
| JPS59196874A (ja) * | 1983-04-22 | 1984-11-08 | Fujisawa Pharmaceut Co Ltd | トリアジン誘導体 |
| GB8328757D0 (en) * | 1983-10-27 | 1983-11-30 | Wellcome Found | Chemical compounds |
| GB8612796D0 (en) * | 1986-05-27 | 1986-07-02 | Fbc Ltd | Fungicides |
| US4970210A (en) * | 1987-07-17 | 1990-11-13 | Abbott Laboratories | Triazinone lipoxygenase compounds |
| CN1038249C (zh) * | 1991-08-28 | 1998-05-06 | 罗姆和哈斯公司 | 含有二氢哒嗪酮及其相关化合物的杀菌组合物 |
| IT1318392B1 (it) | 2000-03-15 | 2003-08-25 | Getters Spa | Composizione getter di idrogeno. |
| EP1328275B1 (en) * | 2000-10-27 | 2008-05-07 | Dow AgroSciences LLC | Substituted 4,5-dihydro-1,2,4-triazin-3-ones, 1,2,4-triazin-3-ones, and their use as fungicides and insecticides |
| BR0115262A (pt) * | 2000-11-09 | 2003-08-12 | Mitsui Chemicals Inc | Derivados de amina opticamente ativos e processo de preparação destes |
| US20030236259A1 (en) * | 2002-02-05 | 2003-12-25 | Rolf Hohlweg | Novel aryl- and heteroarylpiperazines |
| WO2004005262A2 (en) * | 2002-07-02 | 2004-01-15 | Schering Corporation | New neuropeptide y y5 receptor antagonists |
| US7323455B2 (en) | 2004-03-24 | 2008-01-29 | Wyeth | 7-aryl 1,5-dihydro-4,1-benzoxazepin-2(3H)-one derivatives and their use as progesterone receptor modulators |
| EP2233470B1 (en) * | 2005-07-04 | 2011-12-07 | High Point Pharmaceuticals, LLC | Histamine H3 receptor antagonists |
| RU2442775C2 (ru) * | 2005-07-04 | 2012-02-20 | Хай Пойнт Фармасьютикалс, ЛЛС | Антагонисты гистаминовых н3-рецепторов |
| JP2009537596A (ja) * | 2006-05-23 | 2009-10-29 | ハイ ポイント ファーマシューティカルズ，リミティド ライアビリティ カンパニー | ６−（４−シクロプロピルピペリジン−１−イル）−２’−メチル−［３，４’］−ビピリジン及びその医薬としての使用 |
| SG163547A1 (en) * | 2006-05-29 | 2010-08-30 | High Point Pharmaceuticals Llc | 3- (1, 3-benz0di0x0l-5-yl) -6- (4-cyclopropylpiperazin-1-yl) -pyridazine, its salts and solvates and its use as histamine h3 receptor antagonist |
| EP2014656A3 (en) * | 2007-06-11 | 2011-08-24 | High Point Pharmaceuticals, LLC | New heteocyclic h3 antagonists |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1604084A (en) * | 1977-05-17 | 1981-12-02 | Diamond Shamrock Corp | Pharmaceutical preparations containing 1,2,4-triazine derivatives |
| US4157392A (en) * | 1977-05-17 | 1979-06-05 | Diamond Shamrock Corporation | Pharmacologically active substituted 1,2,4-triazines |
| DE3172252D1 (en) * | 1980-11-14 | 1985-10-17 | Ici Plc | Heterocyclic compounds |
| US4495185A (en) * | 1981-11-12 | 1985-01-22 | Imperial Chemical Industries, Plc | 1,2,4-Triazin-3(2H) ones |
| US4581356A (en) * | 1983-03-22 | 1986-04-08 | Fujisawa Pharmaceutical Co., Ltd. | Triazine derivatives, and pharmaceutical compositions comprising the same |
-
1982
- 1982-10-08 US US06/433,513 patent/US4616014A/en not_active Expired - Fee Related
- 1982-10-11 GR GR69503A patent/GR76714B/el unknown
- 1982-10-11 AU AU89269/82A patent/AU8926982A/en not_active Abandoned
- 1982-10-13 DK DK453882A patent/DK453882A/da not_active Application Discontinuation
- 1982-10-15 EP EP82109529A patent/EP0077983B1/en not_active Expired
- 1982-10-15 DE DE8282109529T patent/DE3276164D1/de not_active Expired
- 1982-10-18 FI FI823544A patent/FI823544L/fi not_active Application Discontinuation
- 1982-10-21 ES ES516724A patent/ES516724A0/es active Granted
- 1982-10-21 NO NO823506A patent/NO823506L/no unknown
- 1982-10-22 OA OA57828A patent/OA07236A/xx unknown
- 1982-10-22 JP JP57186641A patent/JPS5899468A/ja active Pending
-
1983
- 1983-06-15 ES ES523300A patent/ES523300A0/es active Granted
- 1983-06-15 ES ES523299A patent/ES8601934A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES8401042A1 (es) | 1983-11-16 |
| US4616014A (en) | 1986-10-07 |
| OA07236A (fr) | 1984-04-30 |
| DE3276164D1 (en) | 1987-06-04 |
| EP0077983B1 (en) | 1987-04-29 |
| ES8500247A1 (es) | 1984-10-01 |
| ES523299A0 (es) | 1985-04-16 |
| ES523300A0 (es) | 1984-10-01 |
| DK453882A (da) | 1983-04-23 |
| EP0077983A1 (en) | 1983-05-04 |
| ES8601934A1 (es) | 1985-04-16 |
| FI823544A0 (fi) | 1982-10-18 |
| ES516724A0 (es) | 1983-11-16 |
| GR76714B (es) | 1984-08-29 |
| FI823544L (fi) | 1983-04-23 |
| AU8926982A (en) | 1983-04-28 |
| JPS5899468A (ja) | 1983-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO823506L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive triazinderivater. | |
| CN108602776B (zh) | 用作irak抑制剂的杂芳基化合物及其用途 | |
| US7226920B2 (en) | Aminotriazole compounds useful as inhibitors of protein kinases | |
| EP1692140B1 (en) | Compositions useful as inhibitors of protein kinases | |
| JP5197014B2 (ja) | ヒストンデアセチラーゼ（ｈｄａｃ）阻害剤としての複素環誘導体 | |
| CA2595514C (en) | Kinase inhibitors | |
| AU2009263037B2 (en) | Alkynyl alcohols as kinase inhibitors | |
| KR100755577B1 (ko) | 타키키닌 수용체 길항제로서의 트리아졸 유도체 | |
| US7226919B2 (en) | Compositions useful as inhibitors of protein kinases | |
| EP1714961B1 (en) | Indazole compound and pharmaceutical use thereof | |
| CA2643066A1 (en) | Pyrazole compounds | |
| CA2646952A1 (en) | Pyridyl- and pyrimidinyl-substituted pyrrole-, thiophene- and furane-derivatives as kinase inhibitors | |
| AU2004264440B2 (en) | Pyrrole compositions useful as inhibitors of c-Met | |
| MXPA06013954A (es) | Indazoles sustituidos, composiciones que contienen los mismos, preparacion y uso. | |
| CA2554551A1 (en) | Compositions useful as inhibitors of protein kinases | |
| JP2009536617A (ja) | タンパク質キナーゼの阻害剤として有用なチアゾール、イミダゾール、およびピラゾール | |
| US7176314B2 (en) | Inflammation modulators | |
| AU728360B2 (en) | Thienylcyclohexanone derivatives as ligands of the gabaa alpha5 receptor subtype | |
| Rezessy et al. | Synthesis and structure elucidation of new thiazolotriazepines | |
| EP2629616A2 (en) | Substituted amino-triazolyl pde10 inhibitors | |
| CA1304376C (en) | Imidazolidinone compound and processes for preparation thereof | |
| CA2168739A1 (en) | Fused tricyclic heteroaromatic derivatives | |
| WO2015155680A2 (en) | Pyrazole derivatives as dihydroorotate dehydrogenase (dhodh) inhibitors | |
| EP0501568B1 (en) | Substituted cyclic sulphamide derivatives | |
| CA1321201C (en) | Benzothiepino[5,4-c]pyridazine compounds and their pharmaceutical uses |