NO810363L - Ammellinium beta-oktamolybdat og sammensetning inneholdende dette. - Google Patents
Ammellinium beta-oktamolybdat og sammensetning inneholdende dette.Info
- Publication number
- NO810363L NO810363L NO810363A NO810363A NO810363L NO 810363 L NO810363 L NO 810363L NO 810363 A NO810363 A NO 810363A NO 810363 A NO810363 A NO 810363A NO 810363 L NO810363 L NO 810363L
- Authority
- NO
- Norway
- Prior art keywords
- octamolybdate
- beta
- vinyl
- approx
- smoke
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 21
- -1 amine molybdate Chemical class 0.000 claims description 11
- 229920000642 polymer Polymers 0.000 claims description 9
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 8
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 8
- 238000002441 X-ray diffraction Methods 0.000 claims description 3
- 239000000779 smoke Substances 0.000 description 16
- 239000002253 acid Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- MASBWURJQFFLOO-UHFFFAOYSA-N ammeline Chemical compound NC1=NC(N)=NC(O)=N1 MASBWURJQFFLOO-UHFFFAOYSA-N 0.000 description 8
- XUFUCDNVOXXQQC-UHFFFAOYSA-L azane;hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxomolybdenum Chemical compound N.N.O[Mo](=O)(=O)O[Mo](O)(=O)=O XUFUCDNVOXXQQC-UHFFFAOYSA-L 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 230000000996 additive effect Effects 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Chemical compound O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 230000000979 retarding effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- LEJBBGNFPAFPKQ-UHFFFAOYSA-N 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOC(=O)C=C LEJBBGNFPAFPKQ-UHFFFAOYSA-N 0.000 description 2
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- OJOWICOBYCXEKR-KRXBUXKQSA-N (5e)-5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C/C)/CC1C=C2 OJOWICOBYCXEKR-KRXBUXKQSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- RFIMISVNSAUMBU-UHFFFAOYSA-N 2-(hydroxymethyl)-2-(prop-2-enoxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC=C RFIMISVNSAUMBU-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- UHBAWOXYQROEIH-UHFFFAOYSA-N 3-chloro-4-(2-chlorobut-3-enoxy)but-1-ene Chemical compound C=CC(Cl)COCC(Cl)C=C UHBAWOXYQROEIH-UHFFFAOYSA-N 0.000 description 1
- KWCPPCKBBRBYEE-UHFFFAOYSA-N 3-chloropropyl prop-2-enoate Chemical compound ClCCCOC(=O)C=C KWCPPCKBBRBYEE-UHFFFAOYSA-N 0.000 description 1
- JVUAYVUZADWJBK-UHFFFAOYSA-N 3-cyanopropyl prop-2-enoate Chemical class C=CC(=O)OCCCC#N JVUAYVUZADWJBK-UHFFFAOYSA-N 0.000 description 1
- FASUFOTUSHAIHG-UHFFFAOYSA-N 3-methoxyprop-1-ene Chemical compound COCC=C FASUFOTUSHAIHG-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000004609 Impact Modifier Substances 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000004386 diacrylate group Chemical group 0.000 description 1
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 1
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-L ethenyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-L 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002751 molybdenum Chemical class 0.000 description 1
- 239000005078 molybdenum compound Substances 0.000 description 1
- 150000002752 molybdenum compounds Chemical class 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/049,256 US4235770A (en) | 1979-06-18 | 1979-06-18 | Ammelinium beta-octamolybdate and composition containing same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO810363L true NO810363L (no) | 1981-02-03 |
Family
ID=21958865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO810363A NO810363L (no) | 1979-06-18 | 1981-02-03 | Ammellinium beta-oktamolybdat og sammensetning inneholdende dette. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4235770A (enExample) |
| EP (1) | EP0030546B1 (enExample) |
| JP (1) | JPS6348879B2 (enExample) |
| BE (1) | BE883749A (enExample) |
| CA (1) | CA1119171A (enExample) |
| DE (1) | DE3067811D1 (enExample) |
| DK (1) | DK152580C (enExample) |
| IT (1) | IT1132073B (enExample) |
| NO (1) | NO810363L (enExample) |
| NZ (1) | NZ193784A (enExample) |
| WO (1) | WO1980002842A1 (enExample) |
| ZA (1) | ZA803100B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4464495A (en) * | 1982-05-14 | 1984-08-07 | The B. F. Goodrich Company | Smoke retardant vinyl halide polymer compositions |
| US4507414A (en) * | 1982-05-14 | 1985-03-26 | The B. F. Goodrich Company | Smoke retardant vinyl halide polymer compositions |
| US4410463A (en) * | 1982-07-28 | 1983-10-18 | The B. F. Goodrich Company | Tetrapentylammonium molybdates |
| US4406837A (en) * | 1982-07-28 | 1983-09-27 | The B. F. Goodrich Company | Methyltricapryl ammonium molybdates |
| US4406840A (en) * | 1982-07-28 | 1983-09-27 | The B. F. Goodrich Company | Tri(tridecyl)ammonium molybdates |
| US4410462A (en) * | 1982-07-28 | 1983-10-18 | The B. F. Goodrich Company | Didodecyldimethylammonium molybdates |
| US4406838A (en) * | 1982-07-28 | 1983-09-27 | The B. F. Goodrich Company | Trioctylammonium molybdates |
| US4988751A (en) * | 1989-04-28 | 1991-01-29 | Witco Corporation | Halogenated vinyl polymer composition and method for stabilizing halogenated vinyl polymer composition containing smoke retardants |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2795550A (en) * | 1954-06-29 | 1957-06-11 | California Research Corp | Lubricating oil compositions |
| US3282838A (en) * | 1960-05-10 | 1966-11-01 | Texaco Inc | Petroleum liquids containing amine salts of molybdic acid |
| US3349108A (en) * | 1963-09-09 | 1967-10-24 | American Cyanamid Co | Molybdenum trioxide complex with diethylenetriamine |
| FR1506286A (fr) * | 1966-02-12 | 1967-12-22 | Inst Francais Du Petrole | Procédé d'époxydation de composés oléfiniques |
| US3870679A (en) * | 1971-11-08 | 1975-03-11 | Ethyl Corp | Smoke retardant vinyl halide polymers |
| US3956231A (en) * | 1974-09-03 | 1976-05-11 | Amax Inc. | Flame and smoke retardant styrene polymer composition |
| US4053453A (en) * | 1977-02-14 | 1977-10-11 | The B. F. Goodrich Company | Vinyl halide polymers having improved resistance to burning and smoke formation |
| US4053455A (en) * | 1977-02-14 | 1977-10-11 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
| US4055538A (en) * | 1977-03-04 | 1977-10-25 | The B. F. Goodrich Company | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions |
| US4217292A (en) * | 1979-03-01 | 1980-08-12 | The B. F. Goodrich Company | Process for making amine molybdates |
-
1979
- 1979-06-18 US US06/049,256 patent/US4235770A/en not_active Expired - Lifetime
-
1980
- 1980-05-19 JP JP55501514A patent/JPS6348879B2/ja not_active Expired
- 1980-05-19 WO PCT/US1980/000601 patent/WO1980002842A1/en not_active Ceased
- 1980-05-19 DE DE8080901286T patent/DE3067811D1/de not_active Expired
- 1980-05-20 NZ NZ193784A patent/NZ193784A/xx unknown
- 1980-05-22 CA CA000352545A patent/CA1119171A/en not_active Expired
- 1980-05-23 ZA ZA00803100A patent/ZA803100B/xx unknown
- 1980-06-04 IT IT22553/80A patent/IT1132073B/it active
- 1980-06-10 BE BE0/200983A patent/BE883749A/fr not_active IP Right Cessation
- 1980-12-30 EP EP80901286A patent/EP0030546B1/en not_active Expired
-
1981
- 1981-02-03 NO NO810363A patent/NO810363L/no unknown
- 1981-02-16 DK DK066881A patent/DK152580C/da active
Also Published As
| Publication number | Publication date |
|---|---|
| BE883749A (fr) | 1980-10-01 |
| JPS56500742A (enExample) | 1981-06-04 |
| DK66881A (da) | 1981-02-16 |
| NZ193784A (en) | 1982-03-16 |
| JPS6348879B2 (enExample) | 1988-09-30 |
| IT1132073B (it) | 1986-06-25 |
| US4235770A (en) | 1980-11-25 |
| EP0030546B1 (en) | 1984-05-16 |
| DK152580B (da) | 1988-03-21 |
| EP0030546A4 (en) | 1981-10-13 |
| CA1119171A (en) | 1982-03-02 |
| EP0030546A1 (en) | 1981-06-24 |
| DK152580C (da) | 1988-09-19 |
| IT8022553A0 (it) | 1980-06-04 |
| WO1980002842A1 (en) | 1980-12-24 |
| ZA803100B (en) | 1981-05-27 |
| DE3067811D1 (en) | 1984-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO810363L (no) | Ammellinium beta-oktamolybdat og sammensetning inneholdende dette. | |
| CN109369690B (zh) | 一种含锌配合物、含锌复合热稳定剂及其制备方法、应用 | |
| NO810361L (no) | Didodecylammonium beta-oktamolybdat og sammensetning inneholdende dette. | |
| US4406837A (en) | Methyltricapryl ammonium molybdates | |
| US4248767A (en) | Dodecylammonium alpha-octamolybdate and composition containing same | |
| US4234474A (en) | Tribenzylammonium octamolybdate and composition containing same | |
| NO810362L (no) | Tripentylammoniumdekamolybdat og sammensetning inneholdende dette | |
| US4406840A (en) | Tri(tridecyl)ammonium molybdates | |
| NO148223B (no) | Vinylklorid- eller vinylidenkloridplast med forminsket roekutvikling i tilfelle av brann. | |
| CA1134847A (en) | Dicyclohexylammonium alpha-octamolybdate and composition containing same | |
| US4240955A (en) | Octadecylammonium alpha-octamolybdate and composition containing same | |
| US4424164A (en) | Dimethyldioctadecylammonium molybdates | |
| US4234473A (en) | Dodecyl-1,12-diammonium dimolybdate and composition containing same | |
| US4425279A (en) | Tridodecylammonium molybdates | |
| US4406838A (en) | Trioctylammonium molybdates | |
| US4410463A (en) | Tetrapentylammonium molybdates | |
| CA1219270A (en) | Amine molybdates | |
| AU537431B2 (en) | Didodecylammonium beta-octamolybdate and composition containing same | |
| US4053452A (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| US4055537A (en) | Smoke retardant vinyl chloride and vinylidene chloride polymer compositions | |
| US4410462A (en) | Didodecyldimethylammonium molybdates | |
| AU6058380A (en) | Tripentylammonium decamolybdate and composition containing same | |
| US4517347A (en) | Method for copolymerization of styrene and acrylonitrile | |
| US3686246A (en) | Nickel compounds | |
| JPS6023716B2 (ja) | 有機材料用安定剤 |