NO771393L - Fremgangsm}te ved fremstilling av epoksyder - Google Patents
Fremgangsm}te ved fremstilling av epoksyderInfo
- Publication number
- NO771393L NO771393L NO771393A NO771393A NO771393L NO 771393 L NO771393 L NO 771393L NO 771393 A NO771393 A NO 771393A NO 771393 A NO771393 A NO 771393A NO 771393 L NO771393 L NO 771393L
- Authority
- NO
- Norway
- Prior art keywords
- thallium
- iii
- acid
- carboxylate
- oxide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 19
- 150000002118 epoxides Chemical class 0.000 title claims 2
- -1 aryl thallium-(III) carboxylate Chemical class 0.000 claims description 40
- 150000001336 alkenes Chemical class 0.000 claims description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 26
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 16
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 8
- 239000005977 Ethylene Substances 0.000 claims description 8
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 5
- 150000007942 carboxylates Chemical class 0.000 claims description 4
- 239000003495 polar organic solvent Substances 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 60
- 239000005711 Benzoic acid Substances 0.000 description 27
- 235000010233 benzoic acid Nutrition 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 239000013078 crystal Substances 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- KLBIUKJOZFWCLW-UHFFFAOYSA-N thallium(iii) nitrate Chemical compound [Tl+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O KLBIUKJOZFWCLW-UHFFFAOYSA-N 0.000 description 14
- SMRRYUGQTFYZGD-UHFFFAOYSA-K diacetyloxythallanyl acetate Chemical compound [Tl+3].CC([O-])=O.CC([O-])=O.CC([O-])=O SMRRYUGQTFYZGD-UHFFFAOYSA-K 0.000 description 13
- 150000002924 oxiranes Chemical class 0.000 description 13
- XWVKTOHUMPLABF-UHFFFAOYSA-N thallium(3+) Chemical class [Tl+3] XWVKTOHUMPLABF-UHFFFAOYSA-N 0.000 description 13
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 12
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 8
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 8
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical class 0.000 description 3
- 238000006735 epoxidation reaction Methods 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- ZLUSCZLCHQSJRU-UHFFFAOYSA-N thallium(1+) Chemical compound [Tl+] ZLUSCZLCHQSJRU-UHFFFAOYSA-N 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- 238000003828 vacuum filtration Methods 0.000 description 3
- CTMHWPIWNRWQEG-UHFFFAOYSA-N 1-methylcyclohexene Chemical compound CC1=CCCCC1 CTMHWPIWNRWQEG-UHFFFAOYSA-N 0.000 description 2
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- QTQRFJQXXUPYDI-UHFFFAOYSA-N oxo(oxothallanyloxy)thallane Chemical compound O=[Tl]O[Tl]=O QTQRFJQXXUPYDI-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 2
- CCFAKBRKTKVJPO-UHFFFAOYSA-N 1-anthroic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=CC2=C1 CCFAKBRKTKVJPO-UHFFFAOYSA-N 0.000 description 1
- SDRZFSPCVYEJTP-UHFFFAOYSA-N 1-ethenylcyclohexene Chemical compound C=CC1=CCCCC1 SDRZFSPCVYEJTP-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- CGMMPMYKMDITEA-UHFFFAOYSA-N 2-ethylbenzoic acid Chemical compound CCC1=CC=CC=C1C(O)=O CGMMPMYKMDITEA-UHFFFAOYSA-N 0.000 description 1
- JMMZCWZIJXAGKW-UHFFFAOYSA-N 2-methylpent-2-ene Chemical compound CCC=C(C)C JMMZCWZIJXAGKW-UHFFFAOYSA-N 0.000 description 1
- BYDRTKVGBRTTIT-UHFFFAOYSA-N 2-methylprop-2-en-1-ol Chemical compound CC(=C)CO BYDRTKVGBRTTIT-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- WCMSFBRREKZZFL-UHFFFAOYSA-N 3-cyclohexen-1-yl-Benzene Chemical class C1CCCC(C=2C=CC=CC=2)=C1 WCMSFBRREKZZFL-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- TXSFFZYXHRAMBM-UHFFFAOYSA-N benzoic acid;ethoxyethane Chemical compound CCOCC.OC(=O)C1=CC=CC=C1 TXSFFZYXHRAMBM-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000021523 carboxylation Effects 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- IAQRGUVFOMOMEM-ARJAWSKDSA-N cis-but-2-ene Chemical compound C\C=C/C IAQRGUVFOMOMEM-ARJAWSKDSA-N 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohexene oxide Natural products O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- RALDHUZFXJKFQB-UHFFFAOYSA-N cyclopentene-1-carbaldehyde Chemical compound O=CC1=CCCC1 RALDHUZFXJKFQB-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- QYDYPVFESGNLHU-UHFFFAOYSA-N elaidic acid methyl ester Natural products CCCCCCCCC=CCCCCCCCC(=O)OC QYDYPVFESGNLHU-UHFFFAOYSA-N 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000004836 hexamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QYDYPVFESGNLHU-KHPPLWFESA-N methyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC QYDYPVFESGNLHU-KHPPLWFESA-N 0.000 description 1
- 229940073769 methyl oleate Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 150000003475 thallium Chemical class 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D301/00—Preparation of oxiranes
- C07D301/02—Synthesis of the oxirane ring
- C07D301/03—Synthesis of the oxirane ring by oxidation of unsaturated compounds, or of mixtures of unsaturated and saturated compounds
- C07D301/14—Synthesis of the oxirane ring by oxidation of unsaturated compounds, or of mixtures of unsaturated and saturated compounds with organic peracids, or salts, anhydrides or esters thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/04—Compounds containing oxirane rings containing only hydrogen and carbon atoms in addition to the ring oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Epoxy Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/679,584 US4021453A (en) | 1976-04-23 | 1976-04-23 | Preparation of epoxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO771393L true NO771393L (no) | 1977-10-25 |
Family
ID=24727493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO771393A NO771393L (no) | 1976-04-23 | 1977-04-22 | Fremgangsm}te ved fremstilling av epoksyder |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4021453A (enFirst) |
| JP (1) | JPS52131505A (enFirst) |
| AU (1) | AU2434277A (enFirst) |
| BE (1) | BE853863A (enFirst) |
| BR (1) | BR7702370A (enFirst) |
| CA (1) | CA1080727A (enFirst) |
| DD (1) | DD130146A5 (enFirst) |
| DE (1) | DE2718057C3 (enFirst) |
| DK (1) | DK179277A (enFirst) |
| ES (1) | ES458081A1 (enFirst) |
| FR (1) | FR2348922A1 (enFirst) |
| GB (1) | GB1560505A (enFirst) |
| IL (1) | IL51664A0 (enFirst) |
| IT (1) | IT1086595B (enFirst) |
| LU (1) | LU77180A1 (enFirst) |
| MX (1) | MX144780A (enFirst) |
| NL (1) | NL172156C (enFirst) |
| NO (1) | NO771393L (enFirst) |
| PL (1) | PL197548A1 (enFirst) |
| RO (1) | RO74965A (enFirst) |
| SE (1) | SE7703122L (enFirst) |
| SU (1) | SU715022A3 (enFirst) |
| ZA (1) | ZA772432B (enFirst) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE868146A (fr) * | 1977-06-16 | 1978-12-15 | Halcon Res And Dev Corp | Preparation d'oxyde de propylene |
| US4290959A (en) * | 1977-06-16 | 1981-09-22 | Halcon Research And Development Corp. | Preparation of propylene oxide |
| IL63433A (en) * | 1980-08-06 | 1986-04-29 | Univ Leland Stanford Junior | Method of asymmetrical epoxidation |
| US4356311A (en) * | 1981-12-21 | 1982-10-26 | Allied Corporation | Producing epoxide from olefin using metal nitro complexes |
| JPS58183924A (ja) * | 1982-04-19 | 1983-10-27 | Taikisha Ltd | 乾式除湿体 |
| US4483994A (en) * | 1983-02-22 | 1984-11-20 | The Halcon Sd Group, Inc. | Process for the production of alkylene carbonates and oxides |
| US4483996A (en) * | 1983-02-22 | 1984-11-20 | The Halcon Sd Group, Inc. | Process for production of olefin oxides and ketones |
| JPS6291225A (ja) * | 1985-10-18 | 1987-04-25 | Nippon Chem Ind Co Ltd:The | 空気浄化剤 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3024253A (en) * | 1956-09-14 | 1962-03-06 | Scient Design Co | Process for oxidizing styrene to styrene oxide |
| US3020293A (en) * | 1959-04-24 | 1962-02-06 | Hoechst Ag | Process for the manufacture of olefin oxidation products from olefin-mercury complexes |
| US3436409A (en) * | 1964-12-30 | 1969-04-01 | Union Carbide Corp | Epoxidation process |
| US3641067A (en) * | 1969-11-03 | 1972-02-08 | Hercules Inc | Epoxidation of olefins with thallic carboxylates |
-
1976
- 1976-04-23 US US05/679,584 patent/US4021453A/en not_active Expired - Lifetime
-
1977
- 1977-03-15 IL IL51664A patent/IL51664A0/xx unknown
- 1977-03-18 SE SE7703122A patent/SE7703122L/xx unknown
- 1977-03-31 NL NLAANVRAGE7703506,A patent/NL172156C/xx not_active IP Right Cessation
- 1977-04-04 CA CA275,420A patent/CA1080727A/en not_active Expired
- 1977-04-14 BR BR7702370A patent/BR7702370A/pt unknown
- 1977-04-18 AU AU24342/77A patent/AU2434277A/en not_active Expired
- 1977-04-20 FR FR7711820A patent/FR2348922A1/fr active Granted
- 1977-04-20 IT IT49042/77A patent/IT1086595B/it active
- 1977-04-21 RO RO7790113A patent/RO74965A/ro unknown
- 1977-04-21 SU SU772473621A patent/SU715022A3/ru active
- 1977-04-22 LU LU77180A patent/LU77180A1/xx unknown
- 1977-04-22 ZA ZA00772432A patent/ZA772432B/xx unknown
- 1977-04-22 NO NO771393A patent/NO771393L/no unknown
- 1977-04-22 MX MX168867A patent/MX144780A/es unknown
- 1977-04-22 DE DE2718057A patent/DE2718057C3/de not_active Expired
- 1977-04-22 DD DD7700198560A patent/DD130146A5/xx unknown
- 1977-04-22 PL PL19754877A patent/PL197548A1/xx unknown
- 1977-04-22 BE BE176933A patent/BE853863A/xx not_active IP Right Cessation
- 1977-04-22 DK DK179277A patent/DK179277A/da unknown
- 1977-04-22 ES ES458081A patent/ES458081A1/es not_active Expired
- 1977-04-22 GB GB16873/77A patent/GB1560505A/en not_active Expired
- 1977-04-23 JP JP4728777A patent/JPS52131505A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2348922A1 (fr) | 1977-11-18 |
| IT1086595B (it) | 1985-05-28 |
| NL172156C (nl) | 1983-07-18 |
| LU77180A1 (enFirst) | 1979-01-18 |
| US4021453A (en) | 1977-05-03 |
| PL197548A1 (pl) | 1978-01-02 |
| NL172156B (nl) | 1983-02-16 |
| DE2718057A1 (de) | 1977-11-17 |
| JPS52131505A (en) | 1977-11-04 |
| RO74965A (ro) | 1982-09-09 |
| NL7703506A (nl) | 1977-10-25 |
| ES458081A1 (es) | 1978-03-16 |
| BE853863A (fr) | 1977-10-24 |
| FR2348922B1 (enFirst) | 1982-05-21 |
| DE2718057B2 (de) | 1979-06-07 |
| DK179277A (da) | 1977-10-24 |
| BR7702370A (pt) | 1978-05-09 |
| MX144780A (es) | 1981-11-23 |
| DD130146A5 (de) | 1978-03-08 |
| SE7703122L (sv) | 1977-10-24 |
| CA1080727A (en) | 1980-07-01 |
| DE2718057C3 (de) | 1980-02-07 |
| IL51664A0 (en) | 1977-05-31 |
| AU2434277A (en) | 1978-10-26 |
| JPS5652021B2 (enFirst) | 1981-12-09 |
| SU715022A3 (ru) | 1980-02-05 |
| ZA772432B (en) | 1978-11-29 |
| GB1560505A (en) | 1980-02-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0560488B1 (en) | Epoxidation process | |
| EP0268870B1 (en) | Alkylene oxides production using molten nitrate salt catalysts | |
| KR20070020016A (ko) | 알켄으로부터 에폭시드를 제조하기 위한 개선된 촉매 방법 | |
| NO771393L (no) | Fremgangsm}te ved fremstilling av epoksyder | |
| JPS5850990B2 (ja) | オレフインのエポキシ化法 | |
| US4883889A (en) | Alkylene oxides production using molten nitrate salt catalyst and a co-catalyst | |
| US4193929A (en) | Epoxidation | |
| US4168274A (en) | Production of a peracid and an oxirane | |
| Yamanaka et al. | Direct synthesis of propene oxide by using an EuCl 3 catalytic system at room temperature | |
| US4172840A (en) | Epoxidation | |
| US4391756A (en) | Organo-monovalent aurus complex catalysts for the manufacture of olefin oxides | |
| US4943643A (en) | Molten salt catalyzed oxidation of alkanes or olefins using lower temperture nitrate salts | |
| US4992567A (en) | Alkylene oxide production using vapor phase oxidation of an alkane or olefin in molten salt and recirculation of aldehyde by-products | |
| US5103027A (en) | Olefin expoxidation using an oxorhenium porphyrin complex catalyst and an organic hydroperoxide | |
| US4122106A (en) | Process for preparing thallic benzoate | |
| CN104093710A (zh) | 制备环氧基羧酸酯的方法 | |
| US20050222440A1 (en) | Catalytic process for the preparation of epoxides from alkenes | |
| NO157414B (no) | Fremgangsmaate for fremstilling av karboksylsyrer og estere derav. | |
| JPS6233167A (ja) | 脂環式ジエポキシドの製造法 | |
| US4882443A (en) | Alkylene oxides production from C7 to C22 olefins using molten nitrate salt catalyst | |
| JPS6233183A (ja) | 脂環式ジエポキシドの製造法 | |
| JPS6233166A (ja) | 脂環式ジエポキシドの製造法 | |
| JPH0157113B2 (enFirst) | ||
| JPS6233165A (ja) | 脂肪族エポキシドの製造法 | |
| US7183420B2 (en) | Method for the preparation of 11(12)-pentadecen-15-olides |