NO763233L - Fremgangsm}te for fremstilling av et nitrokumarin. - Google Patents
Fremgangsm}te for fremstilling av et nitrokumarin.Info
- Publication number
- NO763233L NO763233L NO763233A NO763233A NO763233L NO 763233 L NO763233 L NO 763233L NO 763233 A NO763233 A NO 763233A NO 763233 A NO763233 A NO 763233A NO 763233 L NO763233 L NO 763233L
- Authority
- NO
- Norway
- Prior art keywords
- hydroxy
- formula
- carbon atoms
- nitrocoumarin
- group
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 22
- YTCVPEZECJYZRK-UHFFFAOYSA-N 3-nitrochromen-2-one Chemical compound C1=CC=C2OC(=O)C([N+](=O)[O-])=CC2=C1 YTCVPEZECJYZRK-UHFFFAOYSA-N 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 68
- -1 nitro, hydroxy Chemical group 0.000 claims description 28
- 125000001424 substituent group Chemical group 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 14
- 125000002947 alkylene group Chemical group 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000000304 alkynyl group Chemical group 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 230000000802 nitrating effect Effects 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 5
- 238000006396 nitration reaction Methods 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000001033 ether group Chemical group 0.000 claims description 3
- 229910017604 nitric acid Inorganic materials 0.000 claims description 3
- 150000002832 nitroso derivatives Chemical class 0.000 claims description 3
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 3
- 235000010288 sodium nitrite Nutrition 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 238000009938 salting Methods 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 26
- 239000007787 solid Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- VXIXUWQIVKSKSA-UHFFFAOYSA-N 4-hydroxycoumarin Chemical compound C1=CC=CC2=C1OC(=O)C=C2O VXIXUWQIVKSKSA-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- 235000019441 ethanol Nutrition 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 8
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 230000004044 response Effects 0.000 description 7
- 241001465754 Metazoa Species 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000005557 antagonist Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 5
- MLESGVIPDMJQSR-UHFFFAOYSA-N 7-hydroxy-4-phenylmethoxychromen-2-one Chemical compound C=1C(=O)OC2=CC(O)=CC=C2C=1OCC1=CC=CC=C1 MLESGVIPDMJQSR-UHFFFAOYSA-N 0.000 description 5
- 206010002198 Anaphylactic reaction Diseases 0.000 description 5
- RYAHAEQGBRLGFN-UHFFFAOYSA-N C1=CC=C2C(=N)C(O)C(=O)OC2=C1 Chemical compound C1=CC=C2C(=N)C(O)C(=O)OC2=C1 RYAHAEQGBRLGFN-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 230000036783 anaphylactic response Effects 0.000 description 5
- 208000003455 anaphylaxis Diseases 0.000 description 5
- 238000010790 dilution Methods 0.000 description 5
- 239000012895 dilution Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 210000002966 serum Anatomy 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 108010058846 Ovalbumin Proteins 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000000427 antigen Substances 0.000 description 4
- 108091007433 antigens Proteins 0.000 description 4
- 102000036639 antigens Human genes 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229960000956 coumarin Drugs 0.000 description 4
- 235000001671 coumarin Nutrition 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 229940092253 ovalbumin Drugs 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 3
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 3
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000004775 coumarins Chemical class 0.000 description 3
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- HCTDRZMGZRHFJV-UHFFFAOYSA-N 1-chloro-3-phenoxypropan-2-ol Chemical compound ClCC(O)COC1=CC=CC=C1 HCTDRZMGZRHFJV-UHFFFAOYSA-N 0.000 description 2
- HEJLFBLJYFSKCE-UHFFFAOYSA-N 2',3'-Dihydroxyacetophenone Chemical compound CC(=O)C1=CC=CC(O)=C1O HEJLFBLJYFSKCE-UHFFFAOYSA-N 0.000 description 2
- SULYEHHGGXARJS-UHFFFAOYSA-N 2',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1O SULYEHHGGXARJS-UHFFFAOYSA-N 0.000 description 2
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- NARVIWMVBMUEOG-UHFFFAOYSA-N 2-Hydroxy-propylene Natural products CC(O)=C NARVIWMVBMUEOG-UHFFFAOYSA-N 0.000 description 2
- JECYUBVRTQDVAT-UHFFFAOYSA-N 2-acetylphenol Chemical class CC(=O)C1=CC=CC=C1O JECYUBVRTQDVAT-UHFFFAOYSA-N 0.000 description 2
- SSOHHGCUOKAMQW-UHFFFAOYSA-N 3-hydroxy-4-phenylmethoxychromen-2-one Chemical compound C12=CC=CC=C2OC(=O)C(O)=C1OCC1=CC=CC=C1 SSOHHGCUOKAMQW-UHFFFAOYSA-N 0.000 description 2
- XFOFHELUDYDYMX-UHFFFAOYSA-N 3-imino-4h-chromen-2-one Chemical compound C1=CC=C2OC(=O)C(=N)CC2=C1 XFOFHELUDYDYMX-UHFFFAOYSA-N 0.000 description 2
- OMFPDVLEQWKJEL-UHFFFAOYSA-N 4-hydroxy-7-[3-(2-methylphenoxy)propoxy]-3-nitrochromen-2-one Chemical compound CC1=CC=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 OMFPDVLEQWKJEL-UHFFFAOYSA-N 0.000 description 2
- BNSUAXSCNHUIGC-UHFFFAOYSA-N 4-iminochromen-2-one Chemical compound C1=CC=C2C(=N)CC(=O)OC2=C1 BNSUAXSCNHUIGC-UHFFFAOYSA-N 0.000 description 2
- WENDLYAWLLZTBK-UHFFFAOYSA-N 7-(2-hydroxy-3-phenoxypropoxy)-4-iminochromen-2-one Chemical compound C=1C=C2C(=N)CC(=O)OC2=CC=1OCC(O)COC1=CC=CC=C1 WENDLYAWLLZTBK-UHFFFAOYSA-N 0.000 description 2
- NTAUMWFNWCLWCE-UHFFFAOYSA-N 7-[2-(4-fluoro-2-propylphenyl)ethoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound CCCC1=CC(F)=CC=C1CCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 NTAUMWFNWCLWCE-UHFFFAOYSA-N 0.000 description 2
- ZLCBDNBMEORBPN-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxy-2-methylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound CC1=C(O)C(C(=O)C)=CC=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 ZLCBDNBMEORBPN-UHFFFAOYSA-N 0.000 description 2
- KVYMOGVMKNOTDI-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitro-8-propylchromen-2-one Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1CCC KVYMOGVMKNOTDI-UHFFFAOYSA-N 0.000 description 2
- RJYMDCQMKZNDHB-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 RJYMDCQMKZNDHB-UHFFFAOYSA-N 0.000 description 2
- DNXLZGAYTQHOBB-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxychromen-2-one Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)COC1=CC=C(C(O)=CC(=O)O2)C2=C1 DNXLZGAYTQHOBB-UHFFFAOYSA-N 0.000 description 2
- BQVOPEHSODHOER-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-phenylmethoxychromen-2-one Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)COC1=CC=C(C(OCC=2C=CC=CC=2)=CC(=O)O2)C2=C1 BQVOPEHSODHOER-UHFFFAOYSA-N 0.000 description 2
- QPGCGQFCZIRZJO-UHFFFAOYSA-N 7-[3-(4-fluorophenoxy)propoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCOC1=CC=C(F)C=C1 QPGCGQFCZIRZJO-UHFFFAOYSA-N 0.000 description 2
- AOVNRVGYOYJFKQ-UHFFFAOYSA-N 7-hydroxy-4-iminochromen-2-one Chemical compound N=C1CC(=O)OC2=CC(O)=CC=C21 AOVNRVGYOYJFKQ-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- 241001239379 Calophysus macropterus Species 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 244000178289 Verbascum thapsus Species 0.000 description 2
- 235000010599 Verbascum thapsus Nutrition 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 210000003567 ascitic fluid Anatomy 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 210000003405 ileum Anatomy 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000007034 nitrosation reaction Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 206010039083 rhinitis Diseases 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- FLRUNCJXOVYWDH-UHFFFAOYSA-N 1-(2-bromoethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCBr)C=C1 FLRUNCJXOVYWDH-UHFFFAOYSA-N 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N 1-Heptene Chemical group CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- LUNSDTBILQMRSJ-UHFFFAOYSA-N 1-[4-(3-bromopropyl)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(CCCBr)C=C1 LUNSDTBILQMRSJ-UHFFFAOYSA-N 0.000 description 1
- BEVQDYXJOOTCCN-UHFFFAOYSA-N 1-[4-(3-chloro-2-hydroxypropoxy)-2-hydroxy-3-propylphenyl]ethanone Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCC(O)CCl BEVQDYXJOOTCCN-UHFFFAOYSA-N 0.000 description 1
- 125000006021 1-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- ZSKODIXMBSLCHY-UHFFFAOYSA-N 3-(4-hydroxy-3-nitro-6-phenoxyhexoxy)chromen-2-one Chemical compound C=1C2=CC=CC=C2OC(=O)C=1OCCC([N+]([O-])=O)C(O)CCOC1=CC=CC=C1 ZSKODIXMBSLCHY-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- PGAZJLNVGSFKNW-UHFFFAOYSA-N 3-phenylmethoxychromen-2-one Chemical compound O=C1OC=2C=CC=CC=2C=C1OCC1=CC=CC=C1 PGAZJLNVGSFKNW-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- CYSRKZFPSNZSCS-UHFFFAOYSA-N 4,7-Dihydroxy-2H-1-benzopyran-2-one Chemical compound OC1=CC(=O)OC2=CC(O)=CC=C21 CYSRKZFPSNZSCS-UHFFFAOYSA-N 0.000 description 1
- YWSTXBCPHOEKLS-UHFFFAOYSA-N 4-[2-hydroxy-3-(4-hydroxy-3-nitro-2-oxochromen-7-yl)oxypropoxy]benzoic acid Chemical compound C=1C=C2C(O)=C([N+]([O-])=O)C(=O)OC2=CC=1OCC(O)COC1=CC=C(C(O)=O)C=C1 YWSTXBCPHOEKLS-UHFFFAOYSA-N 0.000 description 1
- QMHUMYQZAGKFBV-UHFFFAOYSA-N 4-[3-(4-hydroxy-3-nitro-2-oxochromen-7-yl)oxypropoxy]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 QMHUMYQZAGKFBV-UHFFFAOYSA-N 0.000 description 1
- WUAITDUFVPZLFO-UHFFFAOYSA-N 4-[3-(4-hydroxy-3-nitro-2-oxochromen-7-yl)oxypropoxy]benzonitrile Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCOC1=CC=C(C#N)C=C1 WUAITDUFVPZLFO-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- XEPRCBIPMOMGPN-UHFFFAOYSA-N 4-hydroxy-3-nitro-6-(2-phenoxyethoxy)chromen-2-one Chemical compound C=1C=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=CC=1OCCOC1=CC=CC=C1 XEPRCBIPMOMGPN-UHFFFAOYSA-N 0.000 description 1
- OWXKFQXYSKFTRQ-UHFFFAOYSA-N 4-hydroxy-3-nitro-6-(6-phenoxyhexoxy)chromen-2-one Chemical compound C=1C=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=CC=1OCCCCCCOC1=CC=CC=C1 OWXKFQXYSKFTRQ-UHFFFAOYSA-N 0.000 description 1
- JJRQUSBPCKUXEV-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(2-phenylethoxy)chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCC1=CC=CC=C1 JJRQUSBPCKUXEV-UHFFFAOYSA-N 0.000 description 1
- RCSSIUHMBSBYQB-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(3-phenoxypropoxy)-8-propylchromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C(CCC)=C1OCCCOC1=CC=CC=C1 RCSSIUHMBSBYQB-UHFFFAOYSA-N 0.000 description 1
- ZCYXWLHTPFQKQF-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(3-phenoxypropoxy)chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCOC1=CC=CC=C1 ZCYXWLHTPFQKQF-UHFFFAOYSA-N 0.000 description 1
- XQTWIWCBAHXTES-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(3-phenylpropoxy)chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCC1=CC=CC=C1 XQTWIWCBAHXTES-UHFFFAOYSA-N 0.000 description 1
- VGASZBIVYKBXEA-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(4-phenylbutoxy)chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCCC1=CC=CC=C1 VGASZBIVYKBXEA-UHFFFAOYSA-N 0.000 description 1
- YDQQWAUYRRZKCA-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(5-phenoxypentoxy)chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCCCOC1=CC=CC=C1 YDQQWAUYRRZKCA-UHFFFAOYSA-N 0.000 description 1
- HAMZZXREANZCMS-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-(6-phenoxyhexoxy)chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCCCCOC1=CC=CC=C1 HAMZZXREANZCMS-UHFFFAOYSA-N 0.000 description 1
- SMUVWQYHDZYMRS-UHFFFAOYSA-N 4-hydroxy-3-nitro-7-[3-(4-phenylphenoxy)propoxy]chromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCOC(C=C1)=CC=C1C1=CC=CC=C1 SMUVWQYHDZYMRS-UHFFFAOYSA-N 0.000 description 1
- YNOSNBUCQXYWOC-UHFFFAOYSA-N 4-hydroxy-7-(2-hydroxy-3-phenoxypropoxy)-3-nitrochromen-2-one Chemical compound C=1C=C2C(O)=C([N+]([O-])=O)C(=O)OC2=CC=1OCC(O)COC1=CC=CC=C1 YNOSNBUCQXYWOC-UHFFFAOYSA-N 0.000 description 1
- PWAWQIXJTNLCMO-UHFFFAOYSA-N 4-hydroxy-7-(2-hydroxy-3-phenoxypropoxy)chromen-2-one Chemical compound C=1C=C2C(O)=CC(=O)OC2=CC=1OCC(O)COC1=CC=CC=C1 PWAWQIXJTNLCMO-UHFFFAOYSA-N 0.000 description 1
- PMGJSINFNLWHDP-UHFFFAOYSA-N 4-hydroxy-7-[2-hydroxy-3-(2-propylphenoxy)propoxy]-3-nitrochromen-2-one Chemical compound CCCC1=CC=CC=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 PMGJSINFNLWHDP-UHFFFAOYSA-N 0.000 description 1
- WQCLBYRRQMSWGP-UHFFFAOYSA-N 4-hydroxy-7-[2-hydroxy-3-(3-hydroxy-4-propanoyl-2-propylphenoxy)propoxy]-3-nitrochromen-2-one Chemical compound C1=CC(C(=O)CC)=C(O)C(CCC)=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 WQCLBYRRQMSWGP-UHFFFAOYSA-N 0.000 description 1
- QXHQXNKFPAQIGE-UHFFFAOYSA-N 4-hydroxy-7-[3-(3-methylphenoxy)propoxy]-3-nitrochromen-2-one Chemical compound CC1=CC=CC(OCCCOC=2C=C3OC(=O)C([N+]([O-])=O)=C(O)C3=CC=2)=C1 QXHQXNKFPAQIGE-UHFFFAOYSA-N 0.000 description 1
- PDWDIJSTZCDJEV-UHFFFAOYSA-N 4-hydroxy-7-[3-(4-methoxyphenoxy)propoxy]-3-nitrochromen-2-one Chemical compound C1=CC(OC)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 PDWDIJSTZCDJEV-UHFFFAOYSA-N 0.000 description 1
- DOQAAFROJULWGE-UHFFFAOYSA-N 4-hydroxy-7-[3-(4-methyl-2-nitrophenoxy)propoxy]-3-nitrochromen-2-one Chemical compound [O-][N+](=O)C1=CC(C)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 DOQAAFROJULWGE-UHFFFAOYSA-N 0.000 description 1
- HYPAULIIXKYYIJ-UHFFFAOYSA-N 4-hydroxy-7-[3-(4-methylphenoxy)propoxy]-3-nitrochromen-2-one Chemical compound C1=CC(C)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 HYPAULIIXKYYIJ-UHFFFAOYSA-N 0.000 description 1
- OMUVYLYWYONGPG-UHFFFAOYSA-N 4-phenylmethoxychromen-2-one Chemical compound C12=CC=CC=C2OC(=O)C=C1OCC1=CC=CC=C1 OMUVYLYWYONGPG-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- HWVBEQRLTFWDRR-UHFFFAOYSA-N 6-ethyl-4-hydroxy-3-nitro-7-(3-phenoxypropoxy)chromen-2-one Chemical compound CCC1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCOC1=CC=CC=C1 HWVBEQRLTFWDRR-UHFFFAOYSA-N 0.000 description 1
- VCQGOSIVBVGKHO-UHFFFAOYSA-N 7-[2-(4-fluorophenyl)ethoxy]-4-phenylmethoxychromen-2-one Chemical compound C1=CC(F)=CC=C1CCOC1=CC=C(C(OCC=2C=CC=CC=2)=CC(=O)O2)C2=C1 VCQGOSIVBVGKHO-UHFFFAOYSA-N 0.000 description 1
- WZKSDYBKXJSNCQ-UHFFFAOYSA-N 7-[3-(4-acetyl-2-ethyl-5-hydroxyphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound CCC1=CC(C(C)=O)=C(O)C=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 WZKSDYBKXJSNCQ-UHFFFAOYSA-N 0.000 description 1
- KBSHAWJFLFEBKL-UHFFFAOYSA-N 7-[3-(4-acetyl-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound CCCC1=CC(C(C)=O)=CC=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 KBSHAWJFLFEBKL-UHFFFAOYSA-N 0.000 description 1
- QCLWLXAQSIRVTK-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-8-methyl-3-nitrochromen-2-one Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1C QCLWLXAQSIRVTK-UHFFFAOYSA-N 0.000 description 1
- BSGLEUBUVJIJGA-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxyphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=C(O)C(C(=O)C)=CC=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 BSGLEUBUVJIJGA-UHFFFAOYSA-N 0.000 description 1
- GCXKEZWYCSFHRY-UHFFFAOYSA-N 7-[3-(4-acetyl-3-hydroxyphenoxy)propoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=C(O)C(C(=O)C)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 GCXKEZWYCSFHRY-UHFFFAOYSA-N 0.000 description 1
- IGCCYQZPGSCGEF-UHFFFAOYSA-N 7-[3-(4-acetylphenoxy)propoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=CC(C(=O)C)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 IGCCYQZPGSCGEF-UHFFFAOYSA-N 0.000 description 1
- MMJZOHNOPLIWIB-UHFFFAOYSA-N 7-[3-(4-acetylphenyl)propoxy]-4-phenylmethoxychromen-2-one Chemical compound C1=CC(C(=O)C)=CC=C1CCCOC1=CC=C(C(OCC=2C=CC=CC=2)=CC(=O)O2)C2=C1 MMJZOHNOPLIWIB-UHFFFAOYSA-N 0.000 description 1
- QDCPDOYPJHYHHI-UHFFFAOYSA-N 7-[3-(4-chlorophenoxy)propoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCOC1=CC=C(Cl)C=C1 QDCPDOYPJHYHHI-UHFFFAOYSA-N 0.000 description 1
- WODJPDQVDKFZCC-UHFFFAOYSA-N 7-[3-(4-fluoro-2-propylphenoxy)-2-hydroxypropoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound CCCC1=CC(F)=CC=C1OCC(O)COC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 WODJPDQVDKFZCC-UHFFFAOYSA-N 0.000 description 1
- UQGOGKXYMPLXKW-UHFFFAOYSA-N 7-[4-(4-chlorophenyl)butoxy]-4-hydroxy-3-nitrochromen-2-one Chemical compound C1=CC=2C(O)=C([N+]([O-])=O)C(=O)OC=2C=C1OCCCCC1=CC=C(Cl)C=C1 UQGOGKXYMPLXKW-UHFFFAOYSA-N 0.000 description 1
- QFFFDMRIQNWJHB-UHFFFAOYSA-N 7-hydroxy-4-phenylmethoxy-8-propylchromen-2-one Chemical compound C=1C(=O)OC=2C(CCC)=C(O)C=CC=2C=1OCC1=CC=CC=C1 QFFFDMRIQNWJHB-UHFFFAOYSA-N 0.000 description 1
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical class O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 244000175448 Citrus madurensis Species 0.000 description 1
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 1
- 206010012434 Dermatitis allergic Diseases 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- HUYWAWARQUIQLE-UHFFFAOYSA-N Isoetharine Chemical compound CC(C)NC(CC)C(O)C1=CC=C(O)C(O)=C1 HUYWAWARQUIQLE-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 208000003443 Unconsciousness Diseases 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001919 adrenal effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001088 anti-asthma Effects 0.000 description 1
- 239000000924 antiasthmatic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- BPHHNXJPFPEJOF-UHFFFAOYSA-J chembl296966 Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S(=O)(=O)C1=CC(S([O-])(=O)=O)=C(N)C2=C(O)C(N=NC3=CC=C(C=C3OC)C=3C=C(C(=CC=3)N=NC=3C(=C4C(N)=C(C=C(C4=CC=3)S([O-])(=O)=O)S([O-])(=O)=O)O)OC)=CC=C21 BPHHNXJPFPEJOF-UHFFFAOYSA-J 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- IDLFZVILOHSSID-OVLDLUHVSA-N corticotropin Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@@H](N)CO)C1=CC=C(O)C=C1 IDLFZVILOHSSID-OVLDLUHVSA-N 0.000 description 1
- 229960000258 corticotropin Drugs 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 229960001268 isoetarine Drugs 0.000 description 1
- 229960001317 isoprenaline Drugs 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229940083747 low-ceiling diuretics xanthine derivative Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 1
- 229960000582 mepyramine Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- MDSXSQBEQAJLMZ-UHFFFAOYSA-N methyl 4-[3-(4-hydroxy-3-nitro-2-oxochromen-7-yl)oxypropoxy]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCCCOC1=CC=C(C(O)=C([N+]([O-])=O)C(=O)O2)C2=C1 MDSXSQBEQAJLMZ-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- KLAKIAVEMQMVBT-UHFFFAOYSA-N p-hydroxy-phenacyl alcohol Natural products OCC(=O)C1=CC=C(O)C=C1 KLAKIAVEMQMVBT-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000010603 pastilles Nutrition 0.000 description 1
- 210000003200 peritoneal cavity Anatomy 0.000 description 1
- 229940066827 pertussis vaccine Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229960001802 phenylephrine Drugs 0.000 description 1
- SONNWYBIRXJNDC-VIFPVBQESA-N phenylephrine Chemical compound CNC[C@H](O)C1=CC=CC(O)=C1 SONNWYBIRXJNDC-VIFPVBQESA-N 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 229960002052 salbutamol Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/42—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4
- C07D311/56—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 without hydrogen atoms in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/178—Unsaturated ethers containing hydroxy or O-metal groups
- C07C43/1786—Unsaturated ethers containing hydroxy or O-metal groups containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/18—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted otherwise than in position 3 or 7
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/42—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4
- C07D311/44—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3
- C07D311/54—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3 substituted in the carbocyclic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3904275 | 1975-09-23 | ||
| GB3904175 | 1975-09-23 | ||
| GB432176 | 1976-02-04 | ||
| GB2445076 | 1976-06-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO763233L true NO763233L (no) | 1977-03-24 |
Family
ID=27447372
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO763233A NO763233L (no) | 1975-09-23 | 1976-09-21 | Fremgangsm}te for fremstilling av et nitrokumarin. |
Country Status (15)
| Country | Link |
|---|---|
| AU (1) | AU1808976A (enExample) |
| BE (1) | BE846385A (enExample) |
| DE (1) | DE2642248A1 (enExample) |
| DK (1) | DK427476A (enExample) |
| ES (2) | ES451804A1 (enExample) |
| FI (1) | FI762579A7 (enExample) |
| FR (1) | FR2372627A1 (enExample) |
| GR (1) | GR61306B (enExample) |
| IL (1) | IL50465A0 (enExample) |
| LU (1) | LU75845A1 (enExample) |
| NL (1) | NL7610509A (enExample) |
| NO (1) | NO763233L (enExample) |
| NZ (1) | NZ181995A (enExample) |
| PT (1) | PT65588B (enExample) |
| SE (1) | SE7610367L (enExample) |
-
1976
- 1976-09-08 FI FI762579A patent/FI762579A7/fi not_active Application Discontinuation
- 1976-09-09 NZ NZ181995A patent/NZ181995A/xx unknown
- 1976-09-10 IL IL50465A patent/IL50465A0/xx unknown
- 1976-09-13 PT PT65588A patent/PT65588B/pt unknown
- 1976-09-16 GR GR51704A patent/GR61306B/el unknown
- 1976-09-17 SE SE7610367A patent/SE7610367L/xx unknown
- 1976-09-20 DE DE19762642248 patent/DE2642248A1/de active Pending
- 1976-09-20 BE BE170778A patent/BE846385A/xx unknown
- 1976-09-21 NO NO763233A patent/NO763233L/no unknown
- 1976-09-22 DK DK427476A patent/DK427476A/da unknown
- 1976-09-22 LU LU75845A patent/LU75845A1/xx unknown
- 1976-09-22 NL NL7610509A patent/NL7610509A/xx not_active Application Discontinuation
- 1976-09-22 FR FR7628467A patent/FR2372627A1/fr active Granted
- 1976-09-23 ES ES451804A patent/ES451804A1/es not_active Expired
- 1976-09-23 AU AU18089/76A patent/AU1808976A/en not_active Expired
-
1977
- 1977-10-14 ES ES463258A patent/ES463258A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| LU75845A1 (enExample) | 1977-05-04 |
| PT65588B (en) | 1978-03-28 |
| SE7610367L (sv) | 1977-03-24 |
| AU1808976A (en) | 1978-04-06 |
| DK427476A (da) | 1977-03-24 |
| DE2642248A1 (de) | 1977-03-31 |
| ES451804A1 (es) | 1978-02-16 |
| IL50465A0 (en) | 1976-11-30 |
| FI762579A7 (enExample) | 1977-03-24 |
| FR2372627A1 (fr) | 1978-06-30 |
| BE846385A (fr) | 1977-03-21 |
| PT65588A (en) | 1976-10-01 |
| GR61306B (en) | 1978-10-19 |
| FR2372627B1 (enExample) | 1979-03-23 |
| NL7610509A (nl) | 1977-03-25 |
| NZ181995A (en) | 1978-09-25 |
| ES463258A1 (es) | 1978-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4281008A (en) | Pharmaceutical heterocyclic compounds and compositions | |
| EP0202589B1 (en) | Pharmaceutical compositions containing ascorbic acid derivatives | |
| US5776977A (en) | Arylcycloalkyl derivatives, their production and their use | |
| JPS59225150A (ja) | 殺生物性芳香族化合物、その合成および医薬としてのその使用 | |
| CH635813A5 (fr) | 1,9-dihydroxyoctahydrophenanthrenes et medicament les contenant. | |
| US4801593A (en) | Chemotherapeutic agents | |
| EP0051917B1 (en) | Benzofuran ethanolamine derivatives, processes for their preparation, and their use in medicine | |
| US5110831A (en) | Vinylogous hydroxamic acids and derivatives thereof as 5-lipoxygenase inhibitors | |
| US4200577A (en) | Coumarin derivatives | |
| JP2796876B2 (ja) | 置換ピロリジン化合物および医薬組成物 | |
| US4686235A (en) | Substituted cinnamyl-2,3-dihydrobenzofuran and analogs useful as anti-inflammatory agents | |
| US4211791A (en) | Indanediones | |
| DK160760B (da) | Analogifremgangsmaade til fremstilling af n-naphthoylglycinderivater | |
| US4778818A (en) | Substituted 2-(heteroaryl-2-propenyl)phenols useful as anti-inflammatory agents | |
| EP0025161A1 (en) | 3-Methylene flavanones and 3-methylene chromanones, antimicrobial composition containing same and method of inhibiting the growth of microorganisms | |
| US4136192A (en) | 4-hydroxy-3-nitro (cyano) coumarins | |
| US4207335A (en) | Indan-1,3-diones | |
| US4427686A (en) | Pharmacologically active benzopyranotriazole compounds | |
| NO763233L (no) | Fremgangsm}te for fremstilling av et nitrokumarin. | |
| US4248879A (en) | Benzopyranotriazoles | |
| US4335048A (en) | 5-(2-Hydroxypropoxy)-8-propyl-4H-1-benzopyran-4-one-2-carboxylic acid | |
| FR2491064A1 (fr) | Quinolones, leurs procedes de preparation et composition therapeutique les contenant | |
| KR860001583B1 (ko) | 6-아닐리노-5,8-퀴녹살린 디온의 제조방법 | |
| EP0032821B1 (en) | Substituted benzopyranotriazoles | |
| CH652119A5 (fr) | Derives de l'acide guanidinocyclohexanecarboxylique et leur procede de fabrication. |