NO754001L - - Google Patents
Info
- Publication number
- NO754001L NO754001L NO754001A NO754001A NO754001L NO 754001 L NO754001 L NO 754001L NO 754001 A NO754001 A NO 754001A NO 754001 A NO754001 A NO 754001A NO 754001 L NO754001 L NO 754001L
- Authority
- NO
- Norway
- Prior art keywords
- alkyl
- chloro
- carboxylic acid
- hydrogen
- cycloalkylalkyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 134
- 125000000217 alkyl group Chemical group 0.000 claims description 98
- 239000001257 hydrogen Substances 0.000 claims description 77
- 229910052739 hydrogen Inorganic materials 0.000 claims description 77
- 238000000034 method Methods 0.000 claims description 65
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 62
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 62
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 62
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 62
- 150000002431 hydrogen Chemical class 0.000 claims description 61
- 229910052757 nitrogen Inorganic materials 0.000 claims description 37
- -1 5-chloro-2-[2-(diethylamino) ethyl]-3-phenyl-isoindole-1-carboxylic acid allyl ester Chemical class 0.000 claims description 25
- 239000007858 starting material Substances 0.000 claims description 25
- 238000002360 preparation method Methods 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- 125000003118 aryl group Chemical group 0.000 claims description 23
- 150000002518 isoindoles Chemical class 0.000 claims description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 15
- 239000007787 solid Substances 0.000 claims description 15
- 239000003638 chemical reducing agent Substances 0.000 claims description 14
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 229910052731 fluorine Inorganic materials 0.000 claims description 13
- 239000011737 fluorine Substances 0.000 claims description 13
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 13
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 12
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 12
- 125000002947 alkylene group Chemical group 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 11
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 9
- 150000002829 nitrogen Chemical class 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 8
- 125000006239 protecting group Chemical group 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 6
- 150000004678 hydrides Chemical class 0.000 claims description 6
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 6
- LDRNLJGRTRWILI-UHFFFAOYSA-N 5-chloro-2-[2-(diethylamino)ethyl]-n-methyl-3-phenylisoindole-1-carboxamide Chemical compound CCN(CC)CCN1C(C(=O)NC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 LDRNLJGRTRWILI-UHFFFAOYSA-N 0.000 claims description 5
- LTLBLEMDZRWPIK-UHFFFAOYSA-N ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 LTLBLEMDZRWPIK-UHFFFAOYSA-N 0.000 claims description 5
- 150000004985 diamines Chemical class 0.000 claims description 4
- GZXRKQGDDHDZPN-UHFFFAOYSA-N ethyl 5-chloro-2-[3-(diethylamino)propyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCN(CC)CC)C=1C1=CC=CC=C1 GZXRKQGDDHDZPN-UHFFFAOYSA-N 0.000 claims description 4
- KJBNKHARGBQFNU-UHFFFAOYSA-N ethyl 5-chloro-2-[3-(n-methylanilino)propyl]-3-phenylisoindole-1-carboxylate Chemical compound C=1C=CC=CC=1C1=C2C=C(Cl)C=CC2=C(C(=O)OCC)N1CCCN(C)C1=CC=CC=C1 KJBNKHARGBQFNU-UHFFFAOYSA-N 0.000 claims description 4
- LWJRQLBLYDLYII-UHFFFAOYSA-N 2-methylpropyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound CCN(CC)CCN1C(C(=O)OCC(C)C)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 LWJRQLBLYDLYII-UHFFFAOYSA-N 0.000 claims description 3
- 230000001539 anorectic effect Effects 0.000 claims description 3
- CNXICFYQWONCMJ-UHFFFAOYSA-N ethyl 5-chloro-2-[2-(dibutylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound CCCCN(CCCC)CCN1C(C(=O)OCC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 CNXICFYQWONCMJ-UHFFFAOYSA-N 0.000 claims description 3
- BJOREDQILVARTM-UHFFFAOYSA-N ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-(2-fluorophenyl)isoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1F BJOREDQILVARTM-UHFFFAOYSA-N 0.000 claims description 3
- CRXURJGMOTVRHA-UHFFFAOYSA-N ethyl 5-chloro-2-[3-(cyclohexylamino)propyl]-3-phenylisoindole-1-carboxylate Chemical compound C=1C=CC=CC=1C1=C2C=C(Cl)C=CC2=C(C(=O)OCC)N1CCCNC1CCCCC1 CRXURJGMOTVRHA-UHFFFAOYSA-N 0.000 claims description 3
- INIOXOMHSKYVQY-UHFFFAOYSA-N ethyl 5-chloro-3-(4-chlorophenyl)-2-[2-(diethylamino)ethyl]isoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=C(Cl)C=C1 INIOXOMHSKYVQY-UHFFFAOYSA-N 0.000 claims description 3
- OPFCHBKDUGIKBK-UHFFFAOYSA-N ethyl 6-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=CC(Cl)=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 OPFCHBKDUGIKBK-UHFFFAOYSA-N 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- CUSVXLOKRWPLLN-UHFFFAOYSA-N propan-2-yl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound CCN(CC)CCN1C(C(=O)OC(C)C)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 CUSVXLOKRWPLLN-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 2
- LSBGNSAWFVKGFD-UHFFFAOYSA-N ethyl 5-chloro-2-[2-[di(propan-2-yl)amino]ethyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(C(C)C)C(C)C)C=1C1=CC=CC=C1 LSBGNSAWFVKGFD-UHFFFAOYSA-N 0.000 claims description 2
- FWGRICBTPNQQGE-UHFFFAOYSA-N ethyl 5-chloro-3-phenyl-2-[4-(propan-2-ylamino)pentyl]isoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCC(C)NC(C)C)C=1C1=CC=CC=C1 FWGRICBTPNQQGE-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- GYYLFMRZCRQERN-UHFFFAOYSA-N 5-chloro-2-[2-(diethylamino)ethyl]-n-ethyl-3-phenylisoindole-1-carboxamide Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)NCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 GYYLFMRZCRQERN-UHFFFAOYSA-N 0.000 claims 2
- ZJVLPSVFGSNJRW-UHFFFAOYSA-N benzyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=CC(Cl)=CC2=C(C=2C=CC=CC=2)N(CCN(CC)CC)C=1C(=O)OCC1=CC=CC=C1 ZJVLPSVFGSNJRW-UHFFFAOYSA-N 0.000 claims 2
- GXVDGHDPKVFNRI-UHFFFAOYSA-N ethyl 2-[2-(diethylamino)ethyl]-3-phenyl-5-(trifluoromethyl)isoindole-1-carboxylate Chemical compound C=12C=C(C(F)(F)F)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 GXVDGHDPKVFNRI-UHFFFAOYSA-N 0.000 claims 2
- DVKQHGMVWVSSQS-UHFFFAOYSA-N ethyl 2-[3-[butyl(methyl)amino]propyl]-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound CCCCN(C)CCCN1C(C(=O)OCC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 DVKQHGMVWVSSQS-UHFFFAOYSA-N 0.000 claims 2
- NFHCBTGZMZZIHK-UHFFFAOYSA-N ethyl 2-[5-[butyl(methyl)amino]-3,3-dimethylpentyl]-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound CCCCN(C)CCC(C)(C)CCN1C(C(=O)OCC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 NFHCBTGZMZZIHK-UHFFFAOYSA-N 0.000 claims 2
- UUYRKYSSYOHUOW-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-2-[2-(diethylamino)ethyl]isoindole-1-carboxylate Chemical compound C=12C=CC=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=C(Cl)C=C1 UUYRKYSSYOHUOW-UHFFFAOYSA-N 0.000 claims 2
- LMGPLZLYVWQHOL-UHFFFAOYSA-N ethyl 5,7-dichloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=C(Cl)C2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 LMGPLZLYVWQHOL-UHFFFAOYSA-N 0.000 claims 2
- 125000001424 substituent group Chemical group 0.000 claims 2
- ZVCINJKXFIMSGR-UHFFFAOYSA-N 5-chloro-2-[2-(diethylamino)ethyl]-n,n-dimethyl-3-phenylisoindole-1-carboxamide Chemical compound CCN(CC)CCN1C(C(=O)N(C)C)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 ZVCINJKXFIMSGR-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 claims 1
- GGXACZHGRLFVTN-UHFFFAOYSA-N ethyl 2-[3-[bis(2-hydroxyethyl)amino]propyl]-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCN(CCO)CCO)C=1C1=CC=CC=C1 GGXACZHGRLFVTN-UHFFFAOYSA-N 0.000 claims 1
- HJRHORDAXBASDT-UHFFFAOYSA-N ethyl 5-chloro-3-(3,4-dichlorophenyl)-2-[2-(diethylamino)ethyl]isoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=C(Cl)C(Cl)=C1 HJRHORDAXBASDT-UHFFFAOYSA-N 0.000 claims 1
- 231100000252 nontoxic Toxicity 0.000 claims 1
- 230000003000 nontoxic effect Effects 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 230000001225 therapeutic effect Effects 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 219
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 182
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 96
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 92
- 239000000243 solution Substances 0.000 description 88
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 81
- 238000002844 melting Methods 0.000 description 68
- 230000008018 melting Effects 0.000 description 68
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 62
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- 229910052938 sodium sulfate Inorganic materials 0.000 description 42
- 235000011152 sodium sulphate Nutrition 0.000 description 42
- 238000006243 chemical reaction Methods 0.000 description 37
- 239000000203 mixture Substances 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 31
- 239000011780 sodium chloride Substances 0.000 description 31
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 239000003921 oil Substances 0.000 description 27
- 235000019198 oils Nutrition 0.000 description 27
- 238000001953 recrystallisation Methods 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 26
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 238000001816 cooling Methods 0.000 description 24
- 238000000354 decomposition reaction Methods 0.000 description 24
- 238000010992 reflux Methods 0.000 description 23
- 230000002829 reductive effect Effects 0.000 description 22
- 239000005457 ice water Substances 0.000 description 21
- 239000012074 organic phase Substances 0.000 description 20
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 19
- 239000012312 sodium hydride Substances 0.000 description 19
- 229910000104 sodium hydride Inorganic materials 0.000 description 19
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000284 extract Substances 0.000 description 17
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 17
- 239000003960 organic solvent Substances 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 239000013078 crystal Substances 0.000 description 15
- 239000003480 eluent Substances 0.000 description 15
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 238000003756 stirring Methods 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- OXNBOFRFSMIKOK-UHFFFAOYSA-N ethyl 5-chloro-3-phenyl-2h-isoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)NC=1C1=CC=CC=C1 OXNBOFRFSMIKOK-UHFFFAOYSA-N 0.000 description 11
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 10
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 10
- 229910052783 alkali metal Inorganic materials 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- 239000006185 dispersion Substances 0.000 description 10
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 10
- 239000002480 mineral oil Substances 0.000 description 10
- 235000010446 mineral oil Nutrition 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Natural products CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229910052786 argon Inorganic materials 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- 235000019439 ethyl acetate Nutrition 0.000 description 8
- 235000019253 formic acid Nutrition 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 7
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 239000012047 saturated solution Substances 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- JARRFJLRNFBULQ-UHFFFAOYSA-N ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 JARRFJLRNFBULQ-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 5
- 238000001665 trituration Methods 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- RJTANRZEWTUVMA-UHFFFAOYSA-N boron;n-methylmethanamine Chemical compound [B].CNC RJTANRZEWTUVMA-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 230000004992 fission Effects 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 4
- 238000006268 reductive amination reaction Methods 0.000 description 4
- DNEVVXBMQZYGEI-UHFFFAOYSA-N 2-benzofuran-1-carbonitrile Chemical compound C1=CC=CC2=C(C#N)OC=C21 DNEVVXBMQZYGEI-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 229910000085 borane Inorganic materials 0.000 description 3
- 150000001733 carboxylic acid esters Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 229940099112 cornstarch Drugs 0.000 description 3
- 238000010908 decantation Methods 0.000 description 3
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- OPJNAOJDNLURGZ-UHFFFAOYSA-N ethyl 2-(2-benzoyl-4-chlorophenyl)-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 OPJNAOJDNLURGZ-UHFFFAOYSA-N 0.000 description 3
- DTKOQJNQMOCKQU-UHFFFAOYSA-N ethyl 7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)OCC)N=C1C1=CC=CC=C1 DTKOQJNQMOCKQU-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 230000007717 exclusion Effects 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 238000005809 transesterification reaction Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- REFMUVZBSRUILL-UHFFFAOYSA-N 2-(4-chlorobenzoyl)benzaldehyde Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=CC=C1C=O REFMUVZBSRUILL-UHFFFAOYSA-N 0.000 description 2
- VIQUHTKPCLDHKY-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-benzofuran-1-carbonitrile Chemical compound C1=CC(Cl)=CC=C1C1=C2C=CC=CC2=C(C#N)O1 VIQUHTKPCLDHKY-UHFFFAOYSA-N 0.000 description 2
- DKYXAVUKDFRHPM-UHFFFAOYSA-N 5-chloro-n,n,2-trimethyl-3-phenylisoindole-1-carboxamide Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)N(C)C)N(C)C=1C1=CC=CC=C1 DKYXAVUKDFRHPM-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- HSJPMRKMPBAUAU-UHFFFAOYSA-N cerium(3+);trinitrate Chemical compound [Ce+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O HSJPMRKMPBAUAU-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- PGGQCDUTKQCONV-UHFFFAOYSA-N ethyl 2-(2-aminoethyl)-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN)C=1C1=CC=CC=C1 PGGQCDUTKQCONV-UHFFFAOYSA-N 0.000 description 2
- QAZSBTPNWKEDOJ-UHFFFAOYSA-N ethyl 2-(4-bromobutyl)-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCCBr)C=1C1=CC=CC=C1 QAZSBTPNWKEDOJ-UHFFFAOYSA-N 0.000 description 2
- REIQYKSWYQMXHI-UHFFFAOYSA-N ethyl 2-(5-bromo-3,3-dimethylpentyl)-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCC(C)(C)CCBr)C=1C1=CC=CC=C1 REIQYKSWYQMXHI-UHFFFAOYSA-N 0.000 description 2
- CEEYMNOSSTVMLF-UHFFFAOYSA-N ethyl 2-[3-[acetyl(ethyl)amino]propyl]-5-chloro-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCN(CC)C(C)=O)C=1C1=CC=CC=C1 CEEYMNOSSTVMLF-UHFFFAOYSA-N 0.000 description 2
- GIFNBEMVRGUKCY-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-2-benzofuran-1-carboxylate Chemical compound C=12C=CC=CC2=C(C(=O)OCC)OC=1C1=CC=C(Cl)C=C1 GIFNBEMVRGUKCY-UHFFFAOYSA-N 0.000 description 2
- KYMJLNPIIZATST-UHFFFAOYSA-N ethyl 3-[3-(trifluoromethyl)phenyl]-2h-isoindole-1-carboxylate Chemical compound C=12C=CC=CC2=C(C(=O)OCC)NC=1C1=CC=CC(C(F)(F)F)=C1 KYMJLNPIIZATST-UHFFFAOYSA-N 0.000 description 2
- DHQFORWGYNVBFD-UHFFFAOYSA-N ethyl 3-phenyl-2h-isoindole-1-carboxylate Chemical compound C=12C=CC=CC2=C(C(=O)OCC)NC=1C1=CC=CC=C1 DHQFORWGYNVBFD-UHFFFAOYSA-N 0.000 description 2
- WITAZQSDYUVBNP-UHFFFAOYSA-N ethyl 5-chloro-2-(2-hydroxyethyl)-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCO)C=1C1=CC=CC=C1 WITAZQSDYUVBNP-UHFFFAOYSA-N 0.000 description 2
- MLYIBHIUSZUEQL-UHFFFAOYSA-N ethyl 5-chloro-2-(3-hydroxypropyl)-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCO)C=1C1=CC=CC=C1 MLYIBHIUSZUEQL-UHFFFAOYSA-N 0.000 description 2
- AUFRKVGWMWMYNM-UHFFFAOYSA-N ethyl 8-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate Chemical compound C12=CC=C(Cl)C=C2NC(=O)C(C(=O)OCC)N=C1C1=CC=CC=C1 AUFRKVGWMWMYNM-UHFFFAOYSA-N 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 2
- JQINOVWQDJTIFQ-UHFFFAOYSA-N methyl 5-chloro-3-phenyl-2h-isoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OC)NC=1C1=CC=CC=C1 JQINOVWQDJTIFQ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- WDYFJVKIRVKYID-UHFFFAOYSA-N n-benzyl-5-chloro-3-phenyl-2h-isoindole-1-carboxamide Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)NCC=2C=CC=CC=2)NC=1C1=CC=CC=C1 WDYFJVKIRVKYID-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- JNNYFIAFTNDTED-UHFFFAOYSA-N propan-2-yl 7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)OC(C)C)N=C1C1=CC=CC=C1 JNNYFIAFTNDTED-UHFFFAOYSA-N 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- PELAWRHVRDOWQT-UHFFFAOYSA-N (2-amino-4-chlorophenyl)-phenylmethanone Chemical compound NC1=CC(Cl)=CC=C1C(=O)C1=CC=CC=C1 PELAWRHVRDOWQT-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- RITBDIOQNLAQSN-UHFFFAOYSA-N 1,5-dibromo-3,3-dimethylpentane Chemical compound BrCCC(C)(C)CCBr RITBDIOQNLAQSN-UHFFFAOYSA-N 0.000 description 1
- FSNGFFWICFYWQC-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidine;hydron;chloride Chemical compound Cl.ClCCN1CCCC1 FSNGFFWICFYWQC-UHFFFAOYSA-N 0.000 description 1
- LVHLSWAMGRLJKW-UHFFFAOYSA-N 1-benzyl-7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-one Chemical compound O=C1CN=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1CC1=CC=CC=C1 LVHLSWAMGRLJKW-UHFFFAOYSA-N 0.000 description 1
- PLZWYQYDWCXHTF-UHFFFAOYSA-N 1-methyl-5-phenyl-3h-1,4-benzodiazepin-2-one Chemical compound N=1CC(=O)N(C)C2=CC=CC=C2C=1C1=CC=CC=C1 PLZWYQYDWCXHTF-UHFFFAOYSA-N 0.000 description 1
- HCSPBFOBIWFBOU-UHFFFAOYSA-N 1-methyl-5-phenyl-7-(trifluoromethyl)-3h-1,4-benzodiazepin-2-one Chemical compound N=1CC(=O)N(C)C2=CC=C(C(F)(F)F)C=C2C=1C1=CC=CC=C1 HCSPBFOBIWFBOU-UHFFFAOYSA-N 0.000 description 1
- UPKTWHGYZDUUQC-UHFFFAOYSA-N 2-(2-benzoyl-4-chlorophenyl)-n,n-dimethyl-2-oxoacetamide Chemical compound CN(C)C(=O)C(=O)C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 UPKTWHGYZDUUQC-UHFFFAOYSA-N 0.000 description 1
- OFERIRWCHSOJJT-UHFFFAOYSA-N 2-(3-chloropropyl)-2-methyl-1,3-dioxolane Chemical compound ClCCCC1(C)OCCO1 OFERIRWCHSOJJT-UHFFFAOYSA-N 0.000 description 1
- HXTHNRUFYBMQJH-UHFFFAOYSA-N 2-(5-chloro-1-ethoxycarbonyl-3-phenylisoindol-2-yl)acetic acid Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CC(O)=O)C=1C1=CC=CC=C1 HXTHNRUFYBMQJH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- WSMRDQYRUQAEKX-UHFFFAOYSA-N 2-benzoyl-4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C(C(=O)C=2C=CC=CC=2)=C1 WSMRDQYRUQAEKX-UHFFFAOYSA-N 0.000 description 1
- HIHTVTATSKDEQF-UHFFFAOYSA-N 2-benzoylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C(=O)C1=CC=CC=C1 HIHTVTATSKDEQF-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- IBZKBSXREAQDTO-UHFFFAOYSA-N 2-methoxy-n-(2-methoxyethyl)ethanamine Chemical compound COCCNCCOC IBZKBSXREAQDTO-UHFFFAOYSA-N 0.000 description 1
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- FGMKBHJSVSWJOP-UHFFFAOYSA-N 5-chloro-2-[2-(diethylamino)ethyl]-n,n-dimethyl-3-phenylisoindole-1-carboxamide;cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1.CCN(CC)CCN1C(C(=O)N(C)C)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 FGMKBHJSVSWJOP-UHFFFAOYSA-N 0.000 description 1
- YCUPAIPSUNNQNY-UHFFFAOYSA-N 5-chloro-3-phenyl-2-benzofuran-1-carbonitrile Chemical compound C=12C=C(Cl)C=CC2=C(C#N)OC=1C1=CC=CC=C1 YCUPAIPSUNNQNY-UHFFFAOYSA-N 0.000 description 1
- ZGJIOTYUNZEVBN-UHFFFAOYSA-N 5-chloro-n,2-dimethyl-3-phenylisoindole-1-carboxamide Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)NC)N(C)C=1C1=CC=CC=C1 ZGJIOTYUNZEVBN-UHFFFAOYSA-N 0.000 description 1
- BRQXCQROHGZBPT-UHFFFAOYSA-N 5-chloro-n-methyl-3-phenyl-2h-isoindole-1-carboxamide Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)NC)NC=1C1=CC=CC=C1 BRQXCQROHGZBPT-UHFFFAOYSA-N 0.000 description 1
- PBXNLIJSMPXHJU-UHFFFAOYSA-N 7-chloro-5-(3,4-dichlorophenyl)-1-methyl-3h-1,4-benzodiazepin-2-one Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=C(Cl)C(Cl)=C1 PBXNLIJSMPXHJU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DLKJYOQUCBLCKS-UHFFFAOYSA-N Cl.C(C)OC(=O)C=1NC=C2C=CC=CC12 Chemical compound Cl.C(C)OC(=O)C=1NC=C2C=CC=CC12 DLKJYOQUCBLCKS-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 230000000578 anorexic effect Effects 0.000 description 1
- 235000021407 appetite control Nutrition 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 239000012435 aralkylating agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- HREXFDIZSAUXBO-UHFFFAOYSA-N benzyl n-(2-bromoethyl)carbamate Chemical compound BrCCNC(=O)OCC1=CC=CC=C1 HREXFDIZSAUXBO-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- OZECDDHOAMNMQI-UHFFFAOYSA-H cerium(3+);trisulfate Chemical compound [Ce+3].[Ce+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O OZECDDHOAMNMQI-UHFFFAOYSA-H 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- MTMGCQWFRBSKJK-UHFFFAOYSA-N ethyl 2-(2-aminoethyl)-5-chloro-3-phenylisoindole-1-carboxylate;hydrobromide Chemical compound Br.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN)C=1C1=CC=CC=C1 MTMGCQWFRBSKJK-UHFFFAOYSA-N 0.000 description 1
- BSPWGBAEPOCWNK-UHFFFAOYSA-N ethyl 2-[2-(4-chlorobenzoyl)phenyl]-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CC=CC=C1C(=O)C1=CC=C(Cl)C=C1 BSPWGBAEPOCWNK-UHFFFAOYSA-N 0.000 description 1
- XWPAMFGOWISHSS-UHFFFAOYSA-N ethyl 2-[2-(diethylamino)ethyl]-3-phenyl-5-(trifluoromethyl)isoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(C(F)(F)F)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 XWPAMFGOWISHSS-UHFFFAOYSA-N 0.000 description 1
- CPSTZUDOIHUYDZ-UHFFFAOYSA-N ethyl 2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=CC=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=CC=C1 CPSTZUDOIHUYDZ-UHFFFAOYSA-N 0.000 description 1
- WIUNUVBEBRTQDV-UHFFFAOYSA-N ethyl 2-[3-[butyl(methyl)amino]propyl]-5-chloro-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.CCCCN(C)CCCN1C(C(=O)OCC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 WIUNUVBEBRTQDV-UHFFFAOYSA-N 0.000 description 1
- MWCHBRNVWYKZMX-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-2-[2-(diethylamino)ethyl]isoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=CC=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=C(Cl)C=C1 MWCHBRNVWYKZMX-UHFFFAOYSA-N 0.000 description 1
- ZQRUFNBEBVHULA-UHFFFAOYSA-N ethyl 5-chloro-2-(2-ethoxy-2-oxoethyl)-3-phenylisoindole-1-carboxylate Chemical compound CCOC(=O)CN1C(C(=O)OCC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 ZQRUFNBEBVHULA-UHFFFAOYSA-N 0.000 description 1
- YDSHFBXLZMPFMZ-UHFFFAOYSA-N ethyl 5-chloro-2-(4-oxocyclohexa-1,5-dien-1-yl)-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(C=2C=CC(=O)CC=2)C=1C1=CC=CC=C1 YDSHFBXLZMPFMZ-UHFFFAOYSA-N 0.000 description 1
- YXZQXOPZGZRHGO-UHFFFAOYSA-N ethyl 5-chloro-2-(4-oxopentyl)-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCC(C)=O)C=1C1=CC=CC=C1 YXZQXOPZGZRHGO-UHFFFAOYSA-N 0.000 description 1
- XHBWGKIYNKYWON-UHFFFAOYSA-N ethyl 5-chloro-2-[2-(diethylamino)-2-oxoethyl]-3-phenylisoindole-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CC(=O)N(CC)CC)C=1C1=CC=CC=C1 XHBWGKIYNKYWON-UHFFFAOYSA-N 0.000 description 1
- WBRJVBUURGDJSK-UHFFFAOYSA-N ethyl 5-chloro-2-[2-(dimethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(C)C)C=1C1=CC=CC=C1 WBRJVBUURGDJSK-UHFFFAOYSA-N 0.000 description 1
- IGLAODWIVAVDIO-UHFFFAOYSA-N ethyl 5-chloro-2-[3-(diethylamino)propyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCN(CC)CC)C=1C1=CC=CC=C1 IGLAODWIVAVDIO-UHFFFAOYSA-N 0.000 description 1
- CICWCDFGKZWONA-UHFFFAOYSA-N ethyl 5-chloro-2-[4-(1,3-dioxolan-2-yl)pentyl]-3-phenylisoindole-1-carboxylate Chemical compound C=1C=CC=CC=1C1=C2C=C(Cl)C=CC2=C(C(=O)OCC)N1CCCC(C)C1OCCO1 CICWCDFGKZWONA-UHFFFAOYSA-N 0.000 description 1
- FFQVAXMXNGVXMC-UHFFFAOYSA-N ethyl 5-chloro-2-[4-(diethylamino)butyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCCN(CC)CC)C=1C1=CC=CC=C1 FFQVAXMXNGVXMC-UHFFFAOYSA-N 0.000 description 1
- KPHZTBDGLMIJFI-UHFFFAOYSA-N ethyl 5-chloro-3-(3,4-dichlorophenyl)-2-[2-(diethylamino)ethyl]isoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCN(CC)CC)C=1C1=CC=C(Cl)C(Cl)=C1 KPHZTBDGLMIJFI-UHFFFAOYSA-N 0.000 description 1
- PGMRGKPXOKATCF-UHFFFAOYSA-N ethyl 5-chloro-3-phenyl-2-(2-pyrrolidin-1-ylethyl)isoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C1=C2C=C(Cl)C=CC2=C(C(=O)OCC)N1CCN1CCCC1 PGMRGKPXOKATCF-UHFFFAOYSA-N 0.000 description 1
- BYTPLAPZDVFUMW-UHFFFAOYSA-N ethyl 5-chloro-3-phenyl-2-[2-(phenylmethoxycarbonylamino)ethyl]isoindole-1-carboxylate Chemical compound C=1C=CC=CC=1C1=C2C=C(Cl)C=CC2=C(C(=O)OCC)N1CCNC(=O)OCC1=CC=CC=C1 BYTPLAPZDVFUMW-UHFFFAOYSA-N 0.000 description 1
- YRKNTPVRCVNFGD-UHFFFAOYSA-N ethyl 5-chloro-3-phenyl-2-[4-(propan-2-ylamino)pentyl]isoindole-1-carboxylate;hydrochloride Chemical compound Cl.C=12C=C(Cl)C=CC2=C(C(=O)OCC)N(CCCC(C)NC(C)C)C=1C1=CC=CC=C1 YRKNTPVRCVNFGD-UHFFFAOYSA-N 0.000 description 1
- XZIHTRHKMWNAHR-UHFFFAOYSA-N ethyl 5-chloro-3-phenyl-2-benzofuran-1-carboxylate Chemical compound C=12C=C(Cl)C=CC2=C(C(=O)OCC)OC=1C1=CC=CC=C1 XZIHTRHKMWNAHR-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- QKLCQKPAECHXCQ-UHFFFAOYSA-N ethyl phenylglyoxylate Chemical compound CCOC(=O)C(=O)C1=CC=CC=C1 QKLCQKPAECHXCQ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 239000003077 lignite Substances 0.000 description 1
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- YMAYUMRHEXHILQ-UHFFFAOYSA-N methyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.CCN(CC)CCN1C(C(=O)OC)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 YMAYUMRHEXHILQ-UHFFFAOYSA-N 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- OSDZHDOKXGSWOD-UHFFFAOYSA-N nitroxyl;hydrochloride Chemical compound Cl.O=N OSDZHDOKXGSWOD-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- FDJIMOYMEKYUPB-UHFFFAOYSA-N propan-2-yl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride Chemical compound Cl.CCN(CC)CCN1C(C(=O)OC(C)C)=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 FDJIMOYMEKYUPB-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 235000012976 tarts Nutrition 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1579574A CH605749A5 (en) | 1974-11-28 | 1974-11-28 | 2-Aminoalkyl-3-phenyl isoindole derivs |
| CH1234275A CH620431A5 (en) | 1975-09-23 | 1975-09-23 | Process for the preparation of novel isoindole derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO754001L true NO754001L (enFirst) | 1976-05-31 |
Family
ID=25710097
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO754001A NO754001L (enFirst) | 1974-11-28 | 1975-11-27 |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3996374A (enFirst) |
| JP (1) | JPS51125276A (enFirst) |
| KR (1) | KR800000530B1 (enFirst) |
| AR (4) | AR214713A1 (enFirst) |
| AT (1) | AT352109B (enFirst) |
| BR (1) | BR7507900A (enFirst) |
| CA (1) | CA1070698A (enFirst) |
| DD (1) | DD123459A5 (enFirst) |
| DE (1) | DE2553595A1 (enFirst) |
| DK (1) | DK537275A (enFirst) |
| ES (4) | ES442976A1 (enFirst) |
| FI (1) | FI753356A7 (enFirst) |
| FR (1) | FR2292472A1 (enFirst) |
| GB (3) | GB1526267A (enFirst) |
| HU (1) | HU173877B (enFirst) |
| IE (2) | IE42933B1 (enFirst) |
| IL (1) | IL48441A (enFirst) |
| LU (1) | LU73870A1 (enFirst) |
| NL (1) | NL7513935A (enFirst) |
| NO (1) | NO754001L (enFirst) |
| NZ (1) | NZ179201A (enFirst) |
| PH (1) | PH12932A (enFirst) |
| SE (1) | SE405356B (enFirst) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4077978A (en) * | 1974-11-28 | 1978-03-07 | Hoffmann-La Roche Inc. | Isoindole derivatives |
| US4122265A (en) * | 1976-05-21 | 1978-10-24 | Hoffmann-La Roche Inc. | Derivatives of 3-phenylisoindole-1-carboxylic acid |
| AT348512B (de) * | 1976-08-02 | 1979-02-26 | Hoffmann La Roche | Verfahren zur herstellung von isoindol- derivaten |
| ATE145891T1 (de) * | 1989-05-17 | 1996-12-15 | Shionogi & Co | Verfahren zur herstellung von alkoxyiminoacetamid-derivaten und ein zwischenproduckt dafür |
| US5312988A (en) * | 1993-05-28 | 1994-05-17 | Hoechst Celanese Corporation | Amines derived from THPE |
| DE19540361A1 (de) | 1995-10-30 | 1997-05-07 | Basf Ag | Phenylessigsäurederivate, Verfahren und Zwischenprodukte zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Schadpilzen und tierischen Schädlingen |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL6612891A (enFirst) * | 1965-09-15 | 1967-03-16 | ||
| US3466298A (en) * | 1967-03-14 | 1969-09-09 | American Home Prod | Process for the preparation of 2-(2-aminoethyl)isoindolines |
| US3879415A (en) * | 1967-03-30 | 1975-04-22 | Hoffmann La Roche | Novel 2{8 2-(1,3-diazacycloalk-2-enyl){9 benzophenone derivatives and novel 1,3-diazacycloalkenyl {8 2,1-a{9 {0 isoindole derivatives |
-
1975
- 1975-11-07 IL IL48441A patent/IL48441A/xx unknown
- 1975-11-10 NZ NZ179201A patent/NZ179201A/xx unknown
- 1975-11-20 US US05/633,514 patent/US3996374A/en not_active Expired - Lifetime
- 1975-11-25 AR AR261338A patent/AR214713A1/es active
- 1975-11-25 FR FR7535985A patent/FR2292472A1/fr active Granted
- 1975-11-26 ES ES442976A patent/ES442976A1/es not_active Expired
- 1975-11-26 SE SE7513326A patent/SE405356B/xx unknown
- 1975-11-26 JP JP50140866A patent/JPS51125276A/ja active Pending
- 1975-11-26 DD DD189708A patent/DD123459A5/xx unknown
- 1975-11-26 HU HU75HO1854A patent/HU173877B/hu unknown
- 1975-11-26 LU LU73870A patent/LU73870A1/xx unknown
- 1975-11-27 DK DK537275A patent/DK537275A/da not_active Application Discontinuation
- 1975-11-27 IE IE123/79A patent/IE42933B1/en unknown
- 1975-11-27 BR BR7507900A patent/BR7507900A/pt unknown
- 1975-11-27 NO NO754001A patent/NO754001L/no unknown
- 1975-11-27 FI FI753356A patent/FI753356A7/fi not_active Application Discontinuation
- 1975-11-27 CA CA240,663A patent/CA1070698A/en not_active Expired
- 1975-11-27 GB GB48804/75A patent/GB1526267A/en not_active Expired
- 1975-11-27 AT AT903975A patent/AT352109B/de not_active IP Right Cessation
- 1975-11-27 GB GB6707/77A patent/GB1526269A/en not_active Expired
- 1975-11-27 KR KR7502590A patent/KR800000530B1/ko not_active Expired
- 1975-11-27 IE IE2583/75A patent/IE42932B1/en unknown
- 1975-11-27 GB GB6708/77A patent/GB1526270A/en not_active Expired
- 1975-11-28 DE DE19752553595 patent/DE2553595A1/de not_active Withdrawn
- 1975-11-28 PH PH17818A patent/PH12932A/en unknown
- 1975-11-28 NL NL7513935A patent/NL7513935A/xx not_active Application Discontinuation
-
1976
- 1976-07-30 AR AR264149A patent/AR214295A1/es active
- 1976-07-30 AR AR264147A patent/AR217808A1/es active
- 1976-07-30 AR AR264148A patent/AR219283A1/es active
- 1976-09-07 ES ES451295A patent/ES451295A1/es not_active Expired
- 1976-09-07 ES ES451294A patent/ES451294A1/es not_active Expired
- 1976-09-07 ES ES451296A patent/ES451296A1/es not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4430343A (en) | Benzimidazole derivatives, process for the preparation thereof and pharmaceutical composition containing the same | |
| NZ212856A (en) | Glutarimide derivatives and pharmaceutical compositions | |
| US2852510A (en) | Heterocyclic compounds and process for producing same | |
| US4052508A (en) | Heterocyclic dihydroanthracen imines | |
| US3983239A (en) | Hexahydro-γ-carboline derivatives and their salts | |
| CA1109064A (en) | New, in 11-position substituted, 5,11-dihydro-6h- pyrido [2,3-b] - [1,4] benzodiazepine-6-ones, processes for their production and pharmaceutical compositions containing them | |
| NO754001L (enFirst) | ||
| IE61400B1 (en) | New derivatives of indiane, the process for their preparation, the new intermediates obtained, their use as medicaments and the pharmaceutical compositions containing them | |
| GB1569251A (en) | Pyridobenzodiazepines | |
| EP0107930A2 (en) | Fused aromatic oxazepinones and sulphur analogues thereof and their preparation and use in counteracting histamine | |
| US4237135A (en) | 2-(4-Ethyl-1-piperazinyl)-4-phenylquinoline, process for preparation thereof, and composition thereof | |
| US4608375A (en) | Quinazolinone derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| FR2558835A1 (fr) | Derives d'hydantoine, leur procede de production et medicament les contenant | |
| US3674787A (en) | 2-(alpha-morpholinobenzyl)-anilides | |
| US3244698A (en) | 1, 4-benzodiazepines | |
| US4122265A (en) | Derivatives of 3-phenylisoindole-1-carboxylic acid | |
| US3635966A (en) | 6-substituted-indolo(1 2-c)quinazolines | |
| US5071849A (en) | Dihydropyrimidothiazine derivatives | |
| EP0072029B1 (de) | Triazolobenzazepine, Verfahren und Zwischenprodukte zu deren Herstellung und diese enthaltende Arzneimittel | |
| CA1094070A (en) | 1-phenyl-piperazine derivatives | |
| US3862950A (en) | Dibenzo{8 b,f{9 -5-triazolo{8 4,3-a{9 {8 1,4{9 diazepin-3-ones | |
| DK143752B (da) | Analogifremgangsmaade til fremstilling af pyridobenzodiazepinoner eller farmakologisk acceptable salte deraf | |
| SK282600B6 (sk) | Deriváty 6-metoxy-1H-benzotriazol-5-karboxamidu, spôsob ich prípravy, farmaceutický prostriedok obsahujúci tieto deriváty a medziprodukty | |
| US3528989A (en) | 3-aminoalkyl derivatives of 2,1-benzisothiazoline | |
| US4077978A (en) | Isoindole derivatives |