NO752217L - - Google Patents
Info
- Publication number
- NO752217L NO752217L NO752217A NO752217A NO752217L NO 752217 L NO752217 L NO 752217L NO 752217 A NO752217 A NO 752217A NO 752217 A NO752217 A NO 752217A NO 752217 L NO752217 L NO 752217L
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- hydrogen
- amino
- carbon atoms
- ylthio
- Prior art date
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 123
- 239000001257 hydrogen Substances 0.000 claims description 123
- 125000004432 carbon atom Chemical group C* 0.000 claims description 122
- -1 amino, hydroxy Chemical group 0.000 claims description 108
- 150000001875 compounds Chemical class 0.000 claims description 104
- 238000000034 method Methods 0.000 claims description 90
- 125000000217 alkyl group Chemical group 0.000 claims description 68
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 66
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 63
- 239000002253 acid Substances 0.000 claims description 61
- 150000002431 hydrogen Chemical group 0.000 claims description 61
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 45
- 238000002360 preparation method Methods 0.000 claims description 45
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 44
- 125000003118 aryl group Chemical group 0.000 claims description 42
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 36
- 125000001589 carboacyl group Chemical group 0.000 claims description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 31
- 239000002904 solvent Substances 0.000 claims description 29
- SCNWTQPZTZMXBG-UHFFFAOYSA-N 2-methyloct-2-enoic acid Chemical compound CCCCCC=C(C)C(O)=O SCNWTQPZTZMXBG-UHFFFAOYSA-N 0.000 claims description 27
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 22
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 18
- 229910052794 bromium Inorganic materials 0.000 claims description 18
- 239000000460 chlorine Chemical group 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 17
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 17
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 17
- 229910052760 oxygen Inorganic materials 0.000 claims description 17
- 239000001301 oxygen Substances 0.000 claims description 17
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 14
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 13
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 13
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 12
- 150000001768 cations Chemical class 0.000 claims description 12
- 231100000252 nontoxic Toxicity 0.000 claims description 12
- 230000003000 nontoxic effect Effects 0.000 claims description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 12
- 229910052717 sulfur Inorganic materials 0.000 claims description 12
- 239000011593 sulfur Substances 0.000 claims description 12
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 11
- 150000001450 anions Chemical class 0.000 claims description 11
- 239000011541 reaction mixture Substances 0.000 claims description 11
- PEHSSTUGJUBZBI-UHFFFAOYSA-N indan-5-ol Chemical compound OC1=CC=C2CCCC2=C1 PEHSSTUGJUBZBI-UHFFFAOYSA-N 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 9
- 230000000903 blocking effect Effects 0.000 claims description 9
- 238000005859 coupling reaction Methods 0.000 claims description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 claims description 4
- 230000001476 alcoholic effect Effects 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims 5
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical group O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 231100000331 toxic Toxicity 0.000 claims 1
- 230000002588 toxic effect Effects 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 30
- NKBWMBRPILTCRD-UHFFFAOYSA-N 2-Methylheptanoic acid Chemical compound CCCCCC(C)C(O)=O NKBWMBRPILTCRD-UHFFFAOYSA-N 0.000 description 29
- 239000000047 product Substances 0.000 description 28
- 239000000243 solution Substances 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 229930186147 Cephalosporin Natural products 0.000 description 20
- 229940124587 cephalosporin Drugs 0.000 description 20
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 19
- 150000001780 cephalosporins Chemical class 0.000 description 19
- 235000002639 sodium chloride Nutrition 0.000 description 19
- 150000002148 esters Chemical class 0.000 description 17
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 159000000000 sodium salts Chemical class 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 11
- HSHGZXNAXBPPDL-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-azaniumyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(N)C12 HSHGZXNAXBPPDL-UHFFFAOYSA-N 0.000 description 10
- 239000007789 gas Substances 0.000 description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 150000002960 penicillins Chemical class 0.000 description 9
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 9
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 7
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 238000005903 acid hydrolysis reaction Methods 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N isothiourea group Chemical group NC(S)=N UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical group CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 6
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 5
- WBZLWGLHESFGHD-UHFFFAOYSA-N 2-[4-(chloromethyl)phenyl]acetyl chloride Chemical compound ClCC1=CC=C(CC(Cl)=O)C=C1 WBZLWGLHESFGHD-UHFFFAOYSA-N 0.000 description 5
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 5
- 229910006069 SO3H Inorganic materials 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 5
- 235000005074 zinc chloride Nutrition 0.000 description 5
- 239000011592 zinc chloride Substances 0.000 description 5
- NIMLTRPHNCETQM-UHFFFAOYSA-N 2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetyl chloride Chemical compound COC1=CC=C(C(O)C(Cl)=O)C(CCl)=C1 NIMLTRPHNCETQM-UHFFFAOYSA-N 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- XQQYHIBRZYACRS-UHFFFAOYSA-N ethyl n-(chloromethyl)-n-methylcarbamate Chemical compound CCOC(=O)N(C)CCl XQQYHIBRZYACRS-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 150000002541 isothioureas Chemical class 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- GJNNLILROAPGRC-UHFFFAOYSA-N 2-[4-(chloromethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=C(CCl)C=C1 GJNNLILROAPGRC-UHFFFAOYSA-N 0.000 description 3
- MSUYMABVSZVGSV-UHFFFAOYSA-N 2-[4-(chloromethyl)phenyl]propanedioic acid Chemical compound OC(=O)C(C(O)=O)C1=CC=C(CCl)C=C1 MSUYMABVSZVGSV-UHFFFAOYSA-N 0.000 description 3
- QOEINMYFWQMSEB-UHFFFAOYSA-N 2-[5-(chloromethyl)thiophen-2-yl]acetyl chloride Chemical compound ClCC1=CC=C(CC(Cl)=O)S1 QOEINMYFWQMSEB-UHFFFAOYSA-N 0.000 description 3
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 3
- HJSGHKMSDOLGJJ-UHFFFAOYSA-N 7-azaniumyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)C2SC1 HJSGHKMSDOLGJJ-UHFFFAOYSA-N 0.000 description 3
- AYTDWGYFYZIASM-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl] 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC1=CC=C(CO)C=C1 AYTDWGYFYZIASM-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 description 3
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 2
- FFGFCSDCPGPSAJ-UHFFFAOYSA-N 1-ethyl-3-methylthiourea Chemical compound CCNC(=S)NC FFGFCSDCPGPSAJ-UHFFFAOYSA-N 0.000 description 2
- YAGZHUZBHSJSQB-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(=O)OCOC(=O)C(C)(C)C)N2C(=O)C(N)C12 YAGZHUZBHSJSQB-UHFFFAOYSA-N 0.000 description 2
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 2
- OWUUOJBKIIEHTJ-UHFFFAOYSA-N 2-[2-(bromomethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1CBr OWUUOJBKIIEHTJ-UHFFFAOYSA-N 0.000 description 2
- HNVUTJYYTYBJDI-UHFFFAOYSA-N 2-[2-(bromomethyl)phenyl]acetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1CBr HNVUTJYYTYBJDI-UHFFFAOYSA-N 0.000 description 2
- YITOXWCIEJBSSD-UHFFFAOYSA-N 2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetic acid Chemical compound COC1=CC=C(C(O)C(O)=O)C(CCl)=C1 YITOXWCIEJBSSD-UHFFFAOYSA-N 0.000 description 2
- SRYGXMSDPNDVPM-UHFFFAOYSA-N 2-[4-(chloromethyl)anilino]acetic acid Chemical compound OC(=O)CNC1=CC=C(CCl)C=C1 SRYGXMSDPNDVPM-UHFFFAOYSA-N 0.000 description 2
- BBIHLUXQQMRAON-UHFFFAOYSA-N 2-[5-(chloromethyl)thiophen-2-yl]acetic acid Chemical compound OC(=O)CC1=CC=C(CCl)S1 BBIHLUXQQMRAON-UHFFFAOYSA-N 0.000 description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 2
- WOQMRJCOGCXSGK-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N(C2=O)C1C2NC(=O)CC1=CC=C(CCl)C=C1 WOQMRJCOGCXSGK-UHFFFAOYSA-N 0.000 description 2
- UJYMIAQQCKJYNT-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-amino-2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N(C2=O)C1C2NC(=O)C(N)C1=CC=C(CCl)C=C1 UJYMIAQQCKJYNT-UHFFFAOYSA-N 0.000 description 2
- CDPKJZJVTHSESZ-UHFFFAOYSA-N 4-chlorophenylacetic acid Chemical compound OC(=O)CC1=CC=C(Cl)C=C1 CDPKJZJVTHSESZ-UHFFFAOYSA-N 0.000 description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 2
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 2
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 2
- XUTQHTOXGKVJPN-UHFFFAOYSA-N 7-azaniumyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)C2SC1 XUTQHTOXGKVJPN-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000006242 amine protecting group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- BTBBPNVBJSIADI-UHFFFAOYSA-N chloromethyl propanoate Chemical compound CCC(=O)OCCl BTBBPNVBJSIADI-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 2
- FGYDHYCFHBSNPE-UHFFFAOYSA-N diethyl phenylmalonate Chemical compound CCOC(=O)C(C(=O)OCC)C1=CC=CC=C1 FGYDHYCFHBSNPE-UHFFFAOYSA-N 0.000 description 2
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000006606 n-butoxy group Chemical group 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000007970 thio esters Chemical class 0.000 description 2
- 125000004149 thio group Chemical group *S* 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- VMUMNEAONPINQW-UHFFFAOYSA-N (2-amino-3-methylbutanoyl)oxymethyl 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound O=C1N2C(C(=O)OCOC(=O)C(N)C(C)C)=C(COC(C)=O)CSC2C1NC(=O)CC1=CC=C(CCl)C=C1 VMUMNEAONPINQW-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- MQWPCFGCHZLFFK-UHFFFAOYSA-N (4-pentanoyloxyphenyl)methyl 3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1=CC(OC(=O)CCCC)=CC=C1COC(=O)C1=C(COC(C)=O)CSC2N1C(=O)C2N MQWPCFGCHZLFFK-UHFFFAOYSA-N 0.000 description 1
- HXMRAWVFMYZQMG-UHFFFAOYSA-N 1,1,3-triethylthiourea Chemical compound CCNC(=S)N(CC)CC HXMRAWVFMYZQMG-UHFFFAOYSA-N 0.000 description 1
- KREOCUNMMFZOOS-UHFFFAOYSA-N 1,3-di(propan-2-yl)thiourea Chemical compound CC(C)NC(S)=NC(C)C KREOCUNMMFZOOS-UHFFFAOYSA-N 0.000 description 1
- AUXGIIVHLRLBSG-UHFFFAOYSA-N 1,3-dipropylthiourea Chemical compound CCCNC(=S)NCCC AUXGIIVHLRLBSG-UHFFFAOYSA-N 0.000 description 1
- HZSRFLLZMWDVEV-UHFFFAOYSA-N 1-butyl-3-ethylthiourea Chemical compound CCCCNC(=S)NCC HZSRFLLZMWDVEV-UHFFFAOYSA-N 0.000 description 1
- KLJCONJPDXSHGN-UHFFFAOYSA-N 1-ethyl-3-propylthiourea Chemical compound CCCNC(=S)NCC KLJCONJPDXSHGN-UHFFFAOYSA-N 0.000 description 1
- HAXCCXURWURETL-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 3-(acetyloxymethyl)-7-[[2-[4-(chloromethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(COC(=O)C)=C(C(=O)OCOC(=O)C(C)(C)C)N(C2=O)C1C2NC(=O)CC1=CC=C(CCl)C=C1 HAXCCXURWURETL-UHFFFAOYSA-N 0.000 description 1
- SFOZYQITDQHSHW-UHFFFAOYSA-N 2-methyloct-2-enoic acid;hydrochloride Chemical compound Cl.CCCCCC=C(C)C(O)=O SFOZYQITDQHSHW-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- PMKCODROLUVQTR-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[[2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClCC1=CC(OC)=CC=C1C(O)C(=O)NC1C(=O)N2C(C(O)=O)=C(COC(C)=O)CSC21 PMKCODROLUVQTR-UHFFFAOYSA-N 0.000 description 1
- RFTYZLNBEGIZRP-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-amino-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(C)=O)=C(C(O)=O)N2C(=O)C(OC)(N)C21 RFTYZLNBEGIZRP-UHFFFAOYSA-N 0.000 description 1
- VKFXRBZSVGYYSA-UHFFFAOYSA-N 3-ethyl-1,1-dimethylthiourea Chemical compound CCNC(=S)N(C)C VKFXRBZSVGYYSA-UHFFFAOYSA-N 0.000 description 1
- BDNJWMFQLICJBH-UHFFFAOYSA-N 3-ethyl-1,1-dipropylthiourea Chemical compound CCCN(CCC)C(S)=NCC BDNJWMFQLICJBH-UHFFFAOYSA-N 0.000 description 1
- JDXQWYKOKYUQDN-UHFFFAOYSA-N 3-hydroxypyrrolidine-2,5-dione Chemical group OC1CC(=O)NC1=O JDXQWYKOKYUQDN-UHFFFAOYSA-N 0.000 description 1
- IBQTWOXEJABQFD-UHFFFAOYSA-N 3-methyl-1,1-dipropylthiourea Chemical compound CCCN(CCC)C(=S)NC IBQTWOXEJABQFD-UHFFFAOYSA-N 0.000 description 1
- FKMVNGWJGSSDCF-UHFFFAOYSA-N 4-acetoxybenzyl alcohol Chemical compound CC(=O)OC1=CC=C(CO)C=C1 FKMVNGWJGSSDCF-UHFFFAOYSA-N 0.000 description 1
- DAVGLVMANDULMD-UHFFFAOYSA-N 5-(chloromethyl)-2-(2-chloro-2-oxoethyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(CCl)=CC=C1CC(Cl)=O DAVGLVMANDULMD-UHFFFAOYSA-N 0.000 description 1
- SNYWLAYOLPGDSS-UHFFFAOYSA-N 5-(chloromethyl)thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(CCl)S1 SNYWLAYOLPGDSS-UHFFFAOYSA-N 0.000 description 1
- PSLIYZMNCMIURN-UHFFFAOYSA-N 6-[[2-[2-(chloromethyl)-4-methoxyphenyl]-2-hydroxyacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound ClCC1=CC(OC)=CC=C1C(O)C(=O)NC1C(=O)N2C(C(O)=O)C(C)(C)SC21 PSLIYZMNCMIURN-UHFFFAOYSA-N 0.000 description 1
- WITCUPSJFUQYEE-UHFFFAOYSA-N 6-[[2-[4-(chloromethyl)phenyl]-2-sulfoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(S(O)(=O)=O)C1=CC=C(CCl)C=C1 WITCUPSJFUQYEE-UHFFFAOYSA-N 0.000 description 1
- RZWGHBULIQEVRX-UHFFFAOYSA-N 6-[[2-amino-2-[4-(chloromethyl)phenyl]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(CCl)C=C1 RZWGHBULIQEVRX-UHFFFAOYSA-N 0.000 description 1
- FPJDVQKEBQYKBF-UHFFFAOYSA-N 6-[[2-carboxy-3-[4-(chloromethyl)anilino]propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(C(O)=O)CNC1=CC=C(CCl)C=C1 FPJDVQKEBQYKBF-UHFFFAOYSA-N 0.000 description 1
- JCOBFIMZIRZFQN-UHFFFAOYSA-N 6-[[2-carboxy-3-[4-(chloromethyl)phenyl]propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(C(O)=O)CC1=CC=C(CCl)C=C1 JCOBFIMZIRZFQN-UHFFFAOYSA-N 0.000 description 1
- IQXSPWMVFPVPAK-UHFFFAOYSA-N 6-[[2-carboxy-3-[5-(chloromethyl)thiophen-2-yl]propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(C(O)=O)CC1=CC=C(CCl)S1 IQXSPWMVFPVPAK-UHFFFAOYSA-N 0.000 description 1
- ZFZGDSLHYVMFJL-UHFFFAOYSA-N 6-[[2-carboxy-4-[4-(chloromethyl)phenyl]butanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(C(O)=O)CCC1=CC=C(CCl)C=C1 ZFZGDSLHYVMFJL-UHFFFAOYSA-N 0.000 description 1
- XGEIITYUVQANML-UHFFFAOYSA-N 6-[[3-[4-(chloromethyl)phenyl]-2-hydroxypropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(O)CC1=CC=C(CCl)C=C1 XGEIITYUVQANML-UHFFFAOYSA-N 0.000 description 1
- CUKKSYZICLMRTN-UHFFFAOYSA-N 6-[[4-[4-(chloromethyl)phenoxy]-2-methylbutanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C12SC(C)(C)C(C(O)=O)N2C(=O)C1NC(=O)C(C)CCOC1=CC=C(CCl)C=C1 CUKKSYZICLMRTN-UHFFFAOYSA-N 0.000 description 1
- BVFZGOKCRMWQIZ-UHFFFAOYSA-N 6-[[4-[4-(chloromethyl)phenyl]-2-sulfobutanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(S(O)(=O)=O)CCC1=CC=C(CCl)C=C1 BVFZGOKCRMWQIZ-UHFFFAOYSA-N 0.000 description 1
- VTLUUUDEJNWMRL-UHFFFAOYSA-N 7-[[2-[4-(chloromethyl)phenyl]-2-hydroxyacetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(O)C=3C=CC(CCl)=CC=3)C2SC1 VTLUUUDEJNWMRL-UHFFFAOYSA-N 0.000 description 1
- YDWZSMZMNGALGR-UHFFFAOYSA-N 7-[[2-carboxy-2-[4-(chloromethyl)phenyl]acetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(C(O)=O)C=3C=CC(CCl)=CC=3)C2SC1 YDWZSMZMNGALGR-UHFFFAOYSA-N 0.000 description 1
- NVIAYEIXYQCDAN-UHFFFAOYSA-N 7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(N)C12 NVIAYEIXYQCDAN-UHFFFAOYSA-N 0.000 description 1
- LRGZZONZUPMKGF-UHFFFAOYSA-N 7-amino-8-oxo-3-(2h-tetrazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C=1N2C(=O)C(N)C2SCC=1CSC1=NN=NN1 LRGZZONZUPMKGF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 108020004256 Beta-lactamase Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- MKGXWTIJBXMHPC-UHFFFAOYSA-N Cl.NC(C(O)=O)c1ccc(CCl)cc1 Chemical compound Cl.NC(C(O)=O)c1ccc(CCl)cc1 MKGXWTIJBXMHPC-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- VLCDUOXHFNUCKK-UHFFFAOYSA-N N,N'-Dimethylthiourea Chemical compound CNC(=S)NC VLCDUOXHFNUCKK-UHFFFAOYSA-N 0.000 description 1
- KFFQABQEJATQAT-UHFFFAOYSA-N N,N'-dibutylthiourea Chemical compound CCCCNC(=S)NCCCC KFFQABQEJATQAT-UHFFFAOYSA-N 0.000 description 1
- FLVIGYVXZHLUHP-UHFFFAOYSA-N N,N'-diethylthiourea Chemical compound CCNC(=S)NCC FLVIGYVXZHLUHP-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical group CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- GMEHFXXZSWDEDB-UHFFFAOYSA-N N-ethylthiourea Chemical compound CCNC(N)=S GMEHFXXZSWDEDB-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102100035591 POU domain, class 2, transcription factor 2 Human genes 0.000 description 1
- 101710084411 POU domain, class 2, transcription factor 2 Proteins 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical group N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- UHGKYJXJYJWDAM-UHFFFAOYSA-N Propylthiourea Chemical compound CCCNC(N)=S UHGKYJXJYJWDAM-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- UVNQKJIJINULCP-UHFFFAOYSA-N [4-(2,2-dimethylpropanoyloxy)phenyl]methyl 2-methyloct-2-enoate Chemical compound C(C(C)(C)C)(=O)OC1=CC=C(COC(=O)C(C)=CCCCCC)C=C1 UVNQKJIJINULCP-UHFFFAOYSA-N 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 1
- 229950004030 cefaloglycin Drugs 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- NHUFQUUQDKNIOP-QMMMGPOBSA-N chloromethyl (2s)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound ClCOC(=O)[C@H](C(C)C)NC(=O)OC(C)(C)C NHUFQUUQDKNIOP-QMMMGPOBSA-N 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- SMJYMSAPPGLBAR-UHFFFAOYSA-N chloromethyl acetate Chemical compound CC(=O)OCCl SMJYMSAPPGLBAR-UHFFFAOYSA-N 0.000 description 1
- BDPZFQLKFUONAG-UHFFFAOYSA-N chloromethyl butanoate Chemical compound CCCC(=O)OCCl BDPZFQLKFUONAG-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- GPAQDGYYVLFLMP-UHFFFAOYSA-N diethyl 2-[4-(chloromethyl)phenyl]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C1=CC=C(CCl)C=C1 GPAQDGYYVLFLMP-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- FRBMVYVWYFKTAB-UHFFFAOYSA-N methyl 2-[5-(chloromethyl)thiophen-2-yl]acetate Chemical compound COC(=O)CC1=CC=C(CCl)S1 FRBMVYVWYFKTAB-UHFFFAOYSA-N 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- RJUYQILKOXQOHT-UHFFFAOYSA-N n-(chloromethyl)-n-methylpropanamide Chemical compound CCC(=O)N(C)CCl RJUYQILKOXQOHT-UHFFFAOYSA-N 0.000 description 1
- OOUSUFKQKJONBC-UHFFFAOYSA-N n-(chloromethyl)acetamide Chemical compound CC(=O)NCCl OOUSUFKQKJONBC-UHFFFAOYSA-N 0.000 description 1
- KHKMEVHVXIOIGK-UHFFFAOYSA-N n-(chloromethyl)butanamide Chemical compound CCCC(=O)NCCl KHKMEVHVXIOIGK-UHFFFAOYSA-N 0.000 description 1
- ZBPYTVBKHKUNHG-UHFFFAOYSA-N non-3-enoic acid Chemical compound CCCCCC=CCC(O)=O ZBPYTVBKHKUNHG-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- POXAIQSXNOEQGM-UHFFFAOYSA-N propan-2-ylthiourea Chemical compound CC(C)NC(N)=S POXAIQSXNOEQGM-UHFFFAOYSA-N 0.000 description 1
- GTNZKIYQVLFAII-UHFFFAOYSA-N propanoyloxymethyl 7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1SC2C(N)C(=O)N2C(C(=O)OCOC(=O)CC)=C1CSC1=NN=C(C)S1 GTNZKIYQVLFAII-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- XJVIPPHGDPEDJL-UHFFFAOYSA-N thiourea;hydrochloride Chemical class Cl.NC(N)=S XJVIPPHGDPEDJL-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/64—Acyl halides
- C07C57/76—Acyl halides containing halogen outside the carbonyl halide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/76—Benzo[c]pyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
NO761492A NO761492L (id) | 1974-06-24 | 1976-04-29 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US05/482,264 US3948904A (en) | 1974-06-24 | 1974-06-24 | Isothiourea substituted cephalosporin derivatives |
Publications (1)
Publication Number | Publication Date |
---|---|
NO752217L true NO752217L (id) | 1975-12-30 |
Family
ID=23915385
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO752217A NO752217L (id) | 1974-06-24 | 1975-06-23 |
Country Status (15)
Country | Link |
---|---|
US (1) | US3948904A (id) |
JP (1) | JPS5116689A (id) |
BE (1) | BE830532A (id) |
CA (1) | CA1100483A (id) |
CH (1) | CH618441A5 (id) |
DE (1) | DE2526990A1 (id) |
DK (1) | DK284275A (id) |
FR (2) | FR2276041A1 (id) |
GB (2) | GB1490452A (id) |
IE (1) | IE42434B1 (id) |
IL (1) | IL47348A (id) |
NL (1) | NL7506939A (id) |
NO (1) | NO752217L (id) |
SE (1) | SE7507205L (id) |
ZA (1) | ZA753263B (id) |
Families Citing this family (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS50144228A (id) * | 1974-05-10 | 1975-11-20 | ||
US4049651A (en) * | 1976-04-19 | 1977-09-20 | E. R. Squibb & Sons, Inc. | Alkoxy and alkylthioalkylureido cephalosporins |
US4125715A (en) * | 1977-11-25 | 1978-11-14 | Yeda Research And Development Co. Ltd. | 7-[(Substituted-isothioureamethyl)phenyl]-acetamidocephalosporin derivatives |
US4789460A (en) * | 1987-08-10 | 1988-12-06 | Phillips Petroleum Company | Process for facilitating filtration of used lubricating oil |
JPH02167938A (ja) * | 1988-12-21 | 1990-06-28 | Topy Ind Ltd | 長い鋼棒による柱と梁の接合構造 |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3839329A (en) * | 1971-11-04 | 1974-10-01 | Squibb & Sons Inc | {60 -amidinothioacetamidocephalosporanic acid compounds |
-
1974
- 1974-06-24 US US05/482,264 patent/US3948904A/en not_active Expired - Lifetime
-
1975
- 1975-05-20 ZA ZA00753263A patent/ZA753263B/xx unknown
- 1975-05-22 IE IE1150/75A patent/IE42434B1/en unknown
- 1975-05-23 CA CA227,665A patent/CA1100483A/en not_active Expired
- 1975-05-26 IL IL47348A patent/IL47348A/xx unknown
- 1975-06-11 NL NL7506939A patent/NL7506939A/xx not_active Application Discontinuation
- 1975-06-13 GB GB40925/76A patent/GB1490452A/en not_active Expired
- 1975-06-13 GB GB25460/75A patent/GB1490451A/en not_active Expired
- 1975-06-18 DE DE19752526990 patent/DE2526990A1/de not_active Withdrawn
- 1975-06-23 JP JP50075799A patent/JPS5116689A/ja active Pending
- 1975-06-23 DK DK284275A patent/DK284275A/da unknown
- 1975-06-23 FR FR7519592A patent/FR2276041A1/fr active Granted
- 1975-06-23 BE BE157587A patent/BE830532A/xx unknown
- 1975-06-23 NO NO752217A patent/NO752217L/no unknown
- 1975-06-24 SE SE7507205A patent/SE7507205L/xx not_active Application Discontinuation
- 1975-06-24 CH CH820975A patent/CH618441A5/de not_active IP Right Cessation
-
1976
- 1976-04-26 FR FR7612316A patent/FR2330675A1/fr active Granted
Also Published As
Publication number | Publication date |
---|---|
CH618441A5 (id) | 1980-07-31 |
SE7507205L (sv) | 1975-12-29 |
DE2526990A1 (de) | 1976-01-15 |
IL47348A (en) | 1980-11-30 |
GB1490452A (en) | 1977-11-02 |
JPS5116689A (id) | 1976-02-10 |
IE42434L (en) | 1975-12-24 |
BE830532A (fr) | 1975-10-16 |
FR2330675B1 (id) | 1979-08-10 |
ZA753263B (en) | 1976-04-28 |
NL7506939A (nl) | 1975-12-30 |
CA1100483A (en) | 1981-05-05 |
IE42434B1 (en) | 1980-08-13 |
FR2276041A1 (fr) | 1976-01-23 |
GB1490451A (en) | 1977-11-02 |
FR2330675A1 (fr) | 1977-06-03 |
IL47348A0 (en) | 1975-07-28 |
AU8133075A (en) | 1976-11-25 |
US3948904A (en) | 1976-04-06 |
DK284275A (da) | 1975-12-25 |
FR2276041B1 (id) | 1980-05-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US3485819A (en) | Alpha-amino-cyclohexadienylalkylene-penicillins and cephalosporins | |
US3708479A (en) | Acyloxymethyl esters of alpha-ureidocyclo-hexadie nylalkylene-cephalosporins | |
NO763601L (id) | ||
US3919206A (en) | 7-(Halomethylaryl)acetamidocephalosporin derivatives | |
NO763600L (id) | ||
NO752217L (id) | ||
US4104469A (en) | 7-(Syn-α-alkoxy-iminofuryl)acetamido-3-(2-methyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids | |
US3919208A (en) | 7-(Cyanomethylaryl)acetamide-cephalosporin derivatives | |
US4219648A (en) | 7-[[Amino(1,3-dihydrobenzo[c]thienyl)acetyl]amino]cephalosporin derivatives | |
NO763602L (id) | ||
US4150224A (en) | 7[[(1-Pyrrollyl)7 acetyl]amino]cephalosporin derivatives | |
EP0015690B1 (en) | Penicillin derivatives, process for their preparation and pharmaceutical composition comprising them | |
US3991051A (en) | [(Oxyalkyl)thioacetyl]cephalosporin derivatives | |
US4180660A (en) | Cephalosporin derivatives | |
NO761492L (id) | ||
US3994875A (en) | Antibiotics | |
US3427302A (en) | Alpha-tetrazolylbenzylpenicillins | |
EP0066373B1 (en) | Beta-lactam derivatives, a process for their preparation and compositions containing them | |
CA1098117A (en) | Indole cephalosporin derivatives | |
US4200747A (en) | 7-2-Indolyl acetamido cephalosporin derivatives | |
US4122260A (en) | Cephalosporin derivatives | |
US3910900A (en) | 7-(D-a-hydroxy-2-arylacetamido)-3-(3-hydroxypyridazin-6-ylthiomethyl)-3-cephem-4-carboxylic acids | |
US3994889A (en) | 3-Heterothio derivatives of (α-thiocarbonylaminol)-7α-methoxy-cephalosporins | |
US4229574A (en) | Indole cephalosporin derivatives | |
US3720665A (en) | Acyloxymethyl esters of alpha-preidocyclo-hexadienylalkylene-penicillins |