NO20005506L - Substituerte beta-aminosyre-inhibitorer for metionin- aminopeptidase-2 - Google Patents
Substituerte beta-aminosyre-inhibitorer for metionin- aminopeptidase-2Info
- Publication number
- NO20005506L NO20005506L NO20005506A NO20005506A NO20005506L NO 20005506 L NO20005506 L NO 20005506L NO 20005506 A NO20005506 A NO 20005506A NO 20005506 A NO20005506 A NO 20005506A NO 20005506 L NO20005506 L NO 20005506L
- Authority
- NO
- Norway
- Prior art keywords
- amino
- cyclohexyl
- hydroxy
- butanamide
- hydroxybutanamide
- Prior art date
Links
- 108090000192 Methionyl aminopeptidases Proteins 0.000 title description 16
- 102100023174 Methionine aminopeptidase 2 Human genes 0.000 title description 15
- 239000003112 inhibitor Substances 0.000 title description 6
- 150000001576 beta-amino acids Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 362
- -1 (2RS,3R)-3-amino-2-hydroxy-4-cyclohexyl Chemical group 0.000 claims description 199
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 claims description 74
- 125000000217 alkyl group Chemical group 0.000 claims description 70
- 150000001408 amides Chemical class 0.000 claims description 53
- 238000000034 method Methods 0.000 claims description 51
- IPWFJLQDVFKJDU-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O IPWFJLQDVFKJDU-UHFFFAOYSA-N 0.000 claims description 50
- 125000003118 aryl group Chemical group 0.000 claims description 49
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 43
- 150000002148 esters Chemical class 0.000 claims description 31
- 125000000623 heterocyclic group Chemical group 0.000 claims description 29
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 23
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 20
- 150000002367 halogens Chemical class 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 20
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 claims description 19
- 229940079593 drug Drugs 0.000 claims description 19
- 239000003814 drug Substances 0.000 claims description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 19
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 19
- 125000004423 acyloxy group Chemical group 0.000 claims description 18
- 229960003767 alanine Drugs 0.000 claims description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 18
- 229920001774 Perfluoroether Polymers 0.000 claims description 16
- 239000000651 prodrug Substances 0.000 claims description 16
- 229940002612 prodrug Drugs 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 125000002252 acyl group Chemical group 0.000 claims description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 14
- 230000033115 angiogenesis Effects 0.000 claims description 13
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 13
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 12
- 125000004104 aryloxy group Chemical group 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 9
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 9
- 239000002243 precursor Substances 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- JTEJPPKMYBDEMY-UHFFFAOYSA-N 5-Methoxytryptamine Natural products COC1=CC=C2NC=C(CCN)C2=C1 JTEJPPKMYBDEMY-UHFFFAOYSA-N 0.000 claims description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 7
- 125000000266 alpha-aminoacyl group Chemical group 0.000 claims description 7
- 239000003937 drug carrier Substances 0.000 claims description 7
- 125000006239 protecting group Chemical group 0.000 claims description 7
- XZKDNZNWHYYWCJ-KWCCSABGSA-N (3r)-3-amino-2-hydroxy-n-[2-(4-methoxyphenyl)ethyl]-5-methylsulfanylpentanamide Chemical compound COC1=CC=C(CCNC(=O)C(O)[C@H](N)CCSC)C=C1 XZKDNZNWHYYWCJ-KWCCSABGSA-N 0.000 claims description 6
- 241000124008 Mammalia Species 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- 229940097276 5-methoxytryptamine Drugs 0.000 claims description 5
- VWKZILYMAAVEEM-JHJMLUEUSA-N (3r)-3-amino-2-hydroxy-5-methylsulfanyl-n-(2-pyridin-3-ylethyl)pentanamide Chemical compound CSCC[C@@H](N)C(O)C(=O)NCCC1=CC=CN=C1 VWKZILYMAAVEEM-JHJMLUEUSA-N 0.000 claims description 4
- SFAAWUWQUWJOJN-JHJMLUEUSA-N (3r)-3-amino-2-hydroxy-5-methylsulfanyl-n-(2-pyridin-4-ylethyl)pentanamide Chemical compound CSCC[C@@H](N)C(O)C(=O)NCCC1=CC=NC=C1 SFAAWUWQUWJOJN-JHJMLUEUSA-N 0.000 claims description 4
- GOYBDMYTXSNRFJ-CNZKWPKMSA-N (3r)-3-amino-2-hydroxy-5-methylsulfanylpentanoic acid Chemical compound CSCC[C@@H](N)C(O)C(O)=O GOYBDMYTXSNRFJ-CNZKWPKMSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 4
- XDCVVGSBJOBLEX-VYJHHOQDSA-N n-[(2r)-2-amino-3-hydroxy-4-(4-phenylbutanoyl)cyclohexyl]butanamide Chemical compound OC1[C@H](N)C(NC(=O)CCC)CCC1C(=O)CCCC1=CC=CC=C1 XDCVVGSBJOBLEX-VYJHHOQDSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229940124530 sulfonamide Drugs 0.000 claims description 4
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- ZIGMWDSIQNYHNS-MRTLOADZSA-N (3r)-3-amino-2-hydroxy-4-phenyl-n-(4-phenylbutyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCCCC=1C=CC=CC=1)C1=CC=CC=C1 ZIGMWDSIQNYHNS-MRTLOADZSA-N 0.000 claims description 3
- CCMIKIMUXWEVRC-JHJMLUEUSA-N (3r)-3-amino-2-hydroxy-5-methylsulfanyl-n-(2-pyridin-2-ylethyl)pentanamide Chemical compound CSCC[C@@H](N)C(O)C(=O)NCCC1=CC=CC=N1 CCMIKIMUXWEVRC-JHJMLUEUSA-N 0.000 claims description 3
- SJBYPFPOTSNMTP-GICMACPYSA-N (3r)-3-amino-2-hydroxy-5-methylsulfanyl-n-(4-phenylbutyl)pentanamide Chemical compound CSCC[C@@H](N)C(O)C(=O)NCCCCC1=CC=CC=C1 SJBYPFPOTSNMTP-GICMACPYSA-N 0.000 claims description 3
- IFCLPXHQPYBNRT-MRTLOADZSA-N (3r)-3-amino-2-hydroxy-5-methylsulfanyl-n-[2-(4-phenoxyphenyl)ethyl]pentanamide Chemical compound C1=CC(CCNC(=O)C(O)[C@H](N)CCSC)=CC=C1OC1=CC=CC=C1 IFCLPXHQPYBNRT-MRTLOADZSA-N 0.000 claims description 3
- PIUYYIOQTPBRGI-KWCCSABGSA-N (3r)-3-amino-2-hydroxy-n-methyl-5-methylsulfanyl-n-(2-phenylethyl)pentanamide Chemical compound CSCC[C@@H](N)C(O)C(=O)N(C)CCC1=CC=CC=C1 PIUYYIOQTPBRGI-KWCCSABGSA-N 0.000 claims description 3
- KNQYFKCOYGSUBU-NQRDHLDYSA-N (3r)-3-amino-4-cyclohexyl-1-(2,6-dimethylmorpholin-4-yl)-2-hydroxybutan-1-one Chemical compound C1C(C)OC(C)CN1C(=O)C(O)[C@H](N)CC1CCCCC1 KNQYFKCOYGSUBU-NQRDHLDYSA-N 0.000 claims description 3
- QKEFLDQOSNHMOP-LMDPOFIKSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1C2=CC=CC=C2CCC1)C1CCCCC1 QKEFLDQOSNHMOP-LMDPOFIKSA-N 0.000 claims description 3
- PDNRLTWXUWVOJL-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2,4,4-trimethylpentan-2-yl)butanamide Chemical compound CC(C)(C)CC(C)(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 PDNRLTWXUWVOJL-GICMACPYSA-N 0.000 claims description 3
- ANCKEWDBYVPDDH-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methoxy-5-methylphenyl)butanamide Chemical compound COC1=CC=C(C)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 ANCKEWDBYVPDDH-XPCCGILXSA-N 0.000 claims description 3
- XGBWLCHEOPEJOM-JBZHPUCOSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methoxy-5-nitrophenyl)butanamide Chemical compound COC1=CC=C([N+]([O-])=O)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 XGBWLCHEOPEJOM-JBZHPUCOSA-N 0.000 claims description 3
- JLQPMTHKVHTEFF-LCQOSCCDSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methoxy-5-phenylphenyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1=CC(=CC=C1OC)C=1C=CC=CC=1)C1CCCCC1 JLQPMTHKVHTEFF-LCQOSCCDSA-N 0.000 claims description 3
- LJUWUNJEQLDFHE-PLEWWHCXSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methoxydibenzofuran-3-yl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1=CC2=C(C3=CC=CC=C3O2)C=C1OC)C1CCCCC1 LJUWUNJEQLDFHE-PLEWWHCXSA-N 0.000 claims description 3
- FVICCILWXLFSPV-JBZHPUCOSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methoxyphenyl)butanamide Chemical compound COC1=CC=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 FVICCILWXLFSPV-JBZHPUCOSA-N 0.000 claims description 3
- ZXJWHQKDYBBLEH-IURRXHLWSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methyl-5-nitrophenyl)butanamide Chemical compound CC1=CC=C([N+]([O-])=O)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 ZXJWHQKDYBBLEH-IURRXHLWSA-N 0.000 claims description 3
- RKTJALSLXLIPEW-IURRXHLWSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-methylphenyl)butanamide Chemical compound CC1=CC=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 RKTJALSLXLIPEW-IURRXHLWSA-N 0.000 claims description 3
- PFNNCGBMFLGNJZ-ITUIMRKVSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-phenoxyphenyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C(=CC=CC=1)OC=1C=CC=CC=1)C1CCCCC1 PFNNCGBMFLGNJZ-ITUIMRKVSA-N 0.000 claims description 3
- VLDFVAQMWJOPAF-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(2-phenylethyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=CC=CC=1)C1CCCCC1 VLDFVAQMWJOPAF-TZHYSIJRSA-N 0.000 claims description 3
- MDSFSHNDHMUWCC-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3,4,5-trimethoxyphenyl)butanamide Chemical compound COC1=C(OC)C(OC)=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 MDSFSHNDHMUWCC-XPCCGILXSA-N 0.000 claims description 3
- XLAPNMKCRFDRJZ-LDCVWXEPSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-methoxy-4-methylphenyl)butanamide Chemical compound C1=C(C)C(OC)=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 XLAPNMKCRFDRJZ-LDCVWXEPSA-N 0.000 claims description 3
- QAZUHUAWNWCDKV-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-methoxyphenyl)butanamide Chemical compound COC1=CC=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 QAZUHUAWNWCDKV-AAFJCEBUSA-N 0.000 claims description 3
- SPCHJCDXXRJBTF-HRDQMINSSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-methylbutan-2-yl)butanamide Chemical compound CC(C)C(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 SPCHJCDXXRJBTF-HRDQMINSSA-N 0.000 claims description 3
- GVHKHIBAJZQAFH-VQCQRNETSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-phenoxyphenyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(OC=2C=CC=CC=2)C=CC=1)C1CCCCC1 GVHKHIBAJZQAFH-VQCQRNETSA-N 0.000 claims description 3
- SUYDTVLDCIHRND-ZMFCMNQTSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-phenylmethoxyphenyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(OCC=2C=CC=CC=2)C=CC=1)C1CCCCC1 SUYDTVLDCIHRND-ZMFCMNQTSA-N 0.000 claims description 3
- CKUOWKJRHWNRBD-QNSVNVJESA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-phenylpropyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCCC=1C=CC=CC=1)C1CCCCC1 CKUOWKJRHWNRBD-QNSVNVJESA-N 0.000 claims description 3
- QXNVTPZPDIFPOO-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(3-propan-2-yloxypropyl)butanamide Chemical compound CC(C)OCCCNC(=O)C(O)[C@H](N)CC1CCCCC1 QXNVTPZPDIFPOO-GICMACPYSA-N 0.000 claims description 3
- ZNQXNULNKQNTKN-IURRXHLWSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-iodo-2-methylphenyl)butanamide Chemical compound CC1=CC(I)=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 ZNQXNULNKQNTKN-IURRXHLWSA-N 0.000 claims description 3
- CTXKVGGFOZKBJO-HNFVBEJKSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-methylpentan-2-yl)butanamide Chemical compound CC(C)CC(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 CTXKVGGFOZKBJO-HNFVBEJKSA-N 0.000 claims description 3
- XGCYRJOPFQATIA-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-methylphenyl)butanamide Chemical compound C1=CC(C)=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 XGCYRJOPFQATIA-AAFJCEBUSA-N 0.000 claims description 3
- LHCQKAGXDGNEEU-MRTLOADZSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-morpholin-4-ylphenyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC(=CC=1)N1CCOCC1)C1CCCCC1 LHCQKAGXDGNEEU-MRTLOADZSA-N 0.000 claims description 3
- ZKYWBQUFILTQKX-ZCDLSOSASA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-phenylbutan-2-yl)butanamide Chemical compound OC([C@H](N)CC1CCCCC1)C(=O)NC(C)CCC1=CC=CC=C1 ZKYWBQUFILTQKX-ZCDLSOSASA-N 0.000 claims description 3
- UMCSFEQVPNOJIW-OGVSOVDVSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(5-methylhexan-2-yl)butanamide Chemical compound CC(C)CCC(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 UMCSFEQVPNOJIW-OGVSOVDVSA-N 0.000 claims description 3
- LTAILALDGUHWAL-ARWYELJZSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(6-methylheptan-2-yl)butanamide Chemical compound CC(C)CCCC(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 LTAILALDGUHWAL-ARWYELJZSA-N 0.000 claims description 3
- YFWHKQQCBFMTEQ-AFYYWNPRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(6-methylpyridin-2-yl)butanamide Chemical compound CC1=CC=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=N1 YFWHKQQCBFMTEQ-AFYYWNPRSA-N 0.000 claims description 3
- LCLIBFINTCHRCT-FIWHBWSRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(naphthalen-1-ylmethyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C2=CC=CC=C2C=CC=1)C1CCCCC1 LCLIBFINTCHRCT-FIWHBWSRSA-N 0.000 claims description 3
- ZCERJGLFUUNVNC-ROKHWSDSSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(oxolan-2-ylmethyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC1OCCC1)C1CCCCC1 ZCERJGLFUUNVNC-ROKHWSDSSA-N 0.000 claims description 3
- SOQKHEFFAZUCKQ-KWCCSABGSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(thiophen-2-ylmethyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1SC=CC=1)C1CCCCC1 SOQKHEFFAZUCKQ-KWCCSABGSA-N 0.000 claims description 3
- YHDZZSTUGZAOKG-GJLHKQACSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(1r)-1-naphthalen-1-ylethyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)N[C@H](C)C=1C2=CC=CC=C2C=CC=1)C1CCCCC1 YHDZZSTUGZAOKG-GJLHKQACSA-N 0.000 claims description 3
- QZBJDJBZGPHHCG-GJLHKQACSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(1r)-1-naphthalen-2-ylethyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)N[C@H](C)C=1C=C2C=CC=CC2=CC=1)C1CCCCC1 QZBJDJBZGPHHCG-GJLHKQACSA-N 0.000 claims description 3
- ONSQUGGHELUERZ-HRBLRVMOSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(1s,2r)-2-phenylcyclopropyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)N[C@@H]1[C@H](C1)C=1C=CC=CC=1)C1CCCCC1 ONSQUGGHELUERZ-HRBLRVMOSA-N 0.000 claims description 3
- RLVRWHNWPCFNPX-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(3-methoxyphenyl)methyl]butanamide Chemical compound COC1=CC=CC(CNC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 RLVRWHNWPCFNPX-TZHYSIJRSA-N 0.000 claims description 3
- ZUTDMFBKAFIHTJ-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(3-methylphenyl)methyl]butanamide Chemical compound CC1=CC=CC(CNC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 ZUTDMFBKAFIHTJ-TZHYSIJRSA-N 0.000 claims description 3
- XPMMIFHZJBFNGN-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(4-methoxyphenyl)methyl]butanamide Chemical compound C1=CC(OC)=CC=C1CNC(=O)C(O)[C@H](N)CC1CCCCC1 XPMMIFHZJBFNGN-TZHYSIJRSA-N 0.000 claims description 3
- VYGHADNCMWUJOR-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[(4-methylphenyl)methyl]butanamide Chemical compound C1=CC(C)=CC=C1CNC(=O)C(O)[C@H](N)CC1CCCCC1 VYGHADNCMWUJOR-TZHYSIJRSA-N 0.000 claims description 3
- UWQRUQPJKUXQFH-LKGZKJKYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]butanamide Chemical compound OC([C@H](N)CC1CCCCC1)C(=O)NC(C)CC1=CC=CC(C(F)(F)F)=C1 UWQRUQPJKUXQFH-LKGZKJKYSA-N 0.000 claims description 3
- RXFFELRATBRAPQ-PYUWXLGESA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-(2-methoxyphenyl)ethyl]butanamide Chemical compound COC1=CC=CC=C1CCNC(=O)C(O)[C@H](N)CC1CCCCC1 RXFFELRATBRAPQ-PYUWXLGESA-N 0.000 claims description 3
- SYCZYTAKRIJILT-QNSVNVJESA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-(3-methoxyphenyl)ethyl]butanamide Chemical compound COC1=CC=CC(CCNC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 SYCZYTAKRIJILT-QNSVNVJESA-N 0.000 claims description 3
- NKOSVNNNKCBMLY-QNSVNVJESA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-(4-methylphenyl)ethyl]butanamide Chemical compound C1=CC(C)=CC=C1CCNC(=O)C(O)[C@H](N)CC1CCCCC1 NKOSVNNNKCBMLY-QNSVNVJESA-N 0.000 claims description 3
- GXYDLDJWUCIPLI-WTQRLHSKSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-(4-phenoxyphenyl)ethyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=CC(OC=2C=CC=CC=2)=CC=1)C1CCCCC1 GXYDLDJWUCIPLI-WTQRLHSKSA-N 0.000 claims description 3
- FGEPWBGHMZHNDV-KEKZHRQWSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-(trifluoromethoxy)phenyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C(=CC=CC=1)OC(F)(F)F)C1CCCCC1 FGEPWBGHMZHNDV-KEKZHRQWSA-N 0.000 claims description 3
- JOCDQKWNSXQRNZ-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-[3-(trifluoromethyl)phenyl]ethyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=C(C=CC=1)C(F)(F)F)C1CCCCC1 JOCDQKWNSXQRNZ-TZHYSIJRSA-N 0.000 claims description 3
- WGUOUKCWOHTCDH-JBZHPUCOSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-methoxy-5-(trifluoromethyl)phenyl]butanamide Chemical compound COC1=CC=C(C(F)(F)F)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 WGUOUKCWOHTCDH-JBZHPUCOSA-N 0.000 claims description 3
- RSEAIRAZDWPUFE-IURRXHLWSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[3-(2-oxopyrrolidin-1-yl)propyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCCN1C(CCC1)=O)C1CCCCC1 RSEAIRAZDWPUFE-IURRXHLWSA-N 0.000 claims description 3
- WVUHPOANHBMYMU-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[3-(trifluoromethoxy)phenyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(OC(F)(F)F)C=CC=1)C1CCCCC1 WVUHPOANHBMYMU-GICMACPYSA-N 0.000 claims description 3
- HOZDUSRPJQAKJV-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[3-methoxy-5-(trifluoromethyl)phenyl]butanamide Chemical compound FC(F)(F)C1=CC(OC)=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 HOZDUSRPJQAKJV-AAFJCEBUSA-N 0.000 claims description 3
- IYUQWHWVCAAMQN-WTQRLHSKSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[4-(naphthalen-2-ylsulfonylamino)butyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCCCNS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C1CCCCC1 IYUQWHWVCAAMQN-WTQRLHSKSA-N 0.000 claims description 3
- VAGOIXIKSNMGRR-MRTLOADZSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCCCNS(=O)(=O)C=1C=C(C=CC=1)C(F)(F)F)C1CCCCC1 VAGOIXIKSNMGRR-MRTLOADZSA-N 0.000 claims description 3
- XKOLJRDSVOSDJU-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[[3-(trifluoromethoxy)phenyl]methyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=C(OC(F)(F)F)C=CC=1)C1CCCCC1 XKOLJRDSVOSDJU-AAFJCEBUSA-N 0.000 claims description 3
- SKQJMGFQGMZNRN-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[[4-(trifluoromethoxy)phenyl]methyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=CC(OC(F)(F)F)=CC=1)C1CCCCC1 SKQJMGFQGMZNRN-AAFJCEBUSA-N 0.000 claims description 3
- WQOWLNLZBGHPDT-VQCQRNETSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-methyl-n-(naphthalen-1-ylmethyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)N(CC=1C2=CC=CC=C2C=CC=1)C)C1CCCCC1 WQOWLNLZBGHPDT-VQCQRNETSA-N 0.000 claims description 3
- OHCLIPTUNSSOMU-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-phenylbutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC=CC=1)C1CCCCC1 OHCLIPTUNSSOMU-GICMACPYSA-N 0.000 claims description 3
- RIYKSLYRGABQHV-JHJMLUEUSA-N (3r)-3-amino-4-cyclohexyl-n-(1,3-dihydroxypropan-2-yl)-2-hydroxybutanamide Chemical compound OCC(CO)NC(=O)C(O)[C@H](N)CC1CCCCC1 RIYKSLYRGABQHV-JHJMLUEUSA-N 0.000 claims description 3
- SLZPNZUMVQKAKX-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-n-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C2OCCOC2=CC=1)C1CCCCC1 SLZPNZUMVQKAKX-XPCCGILXSA-N 0.000 claims description 3
- FHSNRDGDZJJONM-WWDZGPRUSA-N (3r)-3-amino-4-cyclohexyl-n-(2,3-dihydro-1h-inden-1-yl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1C2=CC=CC=C2CC1)C1CCCCC1 FHSNRDGDZJJONM-WWDZGPRUSA-N 0.000 claims description 3
- FNOBGIILFXRKKI-JBZHPUCOSA-N (3r)-3-amino-4-cyclohexyl-n-(2,3-dimethoxyphenyl)-2-hydroxybutanamide Chemical compound COC1=CC=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1OC FNOBGIILFXRKKI-JBZHPUCOSA-N 0.000 claims description 3
- WNGDMNVOWVSLMI-AFYYWNPRSA-N (3r)-3-amino-4-cyclohexyl-n-(2,4-dichlorophenyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C(=CC(Cl)=CC=1)Cl)C1CCCCC1 WNGDMNVOWVSLMI-AFYYWNPRSA-N 0.000 claims description 3
- IWEYCLHLWJNCMZ-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-n-(2,4-dimethoxyphenyl)-2-hydroxybutanamide Chemical compound COC1=CC(OC)=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 IWEYCLHLWJNCMZ-XPCCGILXSA-N 0.000 claims description 3
- MYGBGODGVDBADW-VTBWFHPJSA-N (3r)-3-amino-4-cyclohexyl-n-(2,5-diethoxyphenyl)-2-hydroxybutanamide Chemical compound CCOC1=CC=C(OCC)C(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 MYGBGODGVDBADW-VTBWFHPJSA-N 0.000 claims description 3
- TZUSTASMRTWNHQ-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-n-(2,5-dimethoxyphenyl)-2-hydroxybutanamide Chemical compound COC1=CC=C(OC)C(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 TZUSTASMRTWNHQ-XPCCGILXSA-N 0.000 claims description 3
- IOBSMVSJBSPTLM-LDCVWXEPSA-N (3r)-3-amino-4-cyclohexyl-n-(2,6-dimethylphenyl)-2-hydroxybutanamide Chemical compound CC1=CC=CC(C)=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 IOBSMVSJBSPTLM-LDCVWXEPSA-N 0.000 claims description 3
- GXEKORRASLNCQC-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-n-(2-ethoxyphenyl)-2-hydroxybutanamide Chemical compound CCOC1=CC=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 GXEKORRASLNCQC-XPCCGILXSA-N 0.000 claims description 3
- CYYBVVRXEUYIQS-ARWYELJZSA-N (3r)-3-amino-4-cyclohexyl-n-(2-ethylhexyl)-2-hydroxybutanamide Chemical compound CCCCC(CC)CNC(=O)C(O)[C@H](N)CC1CCCCC1 CYYBVVRXEUYIQS-ARWYELJZSA-N 0.000 claims description 3
- RCOMBXGFNLQUBD-MIHMCVIASA-N (3r)-3-amino-4-cyclohexyl-n-(3,3-diphenylpropyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC(C=1C=CC=CC=1)C=1C=CC=CC=1)C1CCCCC1 RCOMBXGFNLQUBD-MIHMCVIASA-N 0.000 claims description 3
- MICJRJJABPTVKP-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-n-(3,4-dichlorophenyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(Cl)C(Cl)=CC=1)C1CCCCC1 MICJRJJABPTVKP-GICMACPYSA-N 0.000 claims description 3
- TXEJSMLHOIODLE-XPCCGILXSA-N (3r)-3-amino-4-cyclohexyl-n-(3,4-dimethoxyphenyl)-2-hydroxybutanamide Chemical compound C1=C(OC)C(OC)=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 TXEJSMLHOIODLE-XPCCGILXSA-N 0.000 claims description 3
- OFGAGMSOQHULND-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-n-(3,5-dichlorophenyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(Cl)C=C(Cl)C=1)C1CCCCC1 OFGAGMSOQHULND-GICMACPYSA-N 0.000 claims description 3
- XCZNGBWKYBBMGU-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-n-(3,5-dimethoxyphenyl)-2-hydroxybutanamide Chemical compound COC1=CC(OC)=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 XCZNGBWKYBBMGU-TZHYSIJRSA-N 0.000 claims description 3
- OZNNDRXIYZWRGC-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-n-(3-ethoxyphenyl)-2-hydroxybutanamide Chemical compound CCOC1=CC=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1 OZNNDRXIYZWRGC-TZHYSIJRSA-N 0.000 claims description 3
- VVSGEHWKMQRSLJ-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-n-(4-fluorophenyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC(F)=CC=1)C1CCCCC1 VVSGEHWKMQRSLJ-GICMACPYSA-N 0.000 claims description 3
- FGTBNEMCVRMIJV-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-n-(cyclohexylmethyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC1CCCCC1)C1CCCCC1 FGTBNEMCVRMIJV-AAFJCEBUSA-N 0.000 claims description 3
- ZNBWBVZSPDSEBR-KWCCSABGSA-N (3r)-3-amino-4-cyclohexyl-n-(furan-2-ylmethyl)-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1OC=CC=1)C1CCCCC1 ZNBWBVZSPDSEBR-KWCCSABGSA-N 0.000 claims description 3
- USWYNWSSMJPTJB-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-n-[(2,4-dichlorophenyl)methyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C(=CC(Cl)=CC=1)Cl)C1CCCCC1 USWYNWSSMJPTJB-AAFJCEBUSA-N 0.000 claims description 3
- UKTZALAGUNSJKB-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-n-[(2-fluorophenyl)methyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C(=CC=CC=1)F)C1CCCCC1 UKTZALAGUNSJKB-AAFJCEBUSA-N 0.000 claims description 3
- MOLHQAPBSWVSHX-LKGZKJKYSA-N (3r)-3-amino-4-cyclohexyl-n-[1-(2-fluorophenyl)propan-2-yl]-2-hydroxybutanamide Chemical compound OC([C@H](N)CC1CCCCC1)C(=O)NC(C)CC1=CC=CC=C1F MOLHQAPBSWVSHX-LKGZKJKYSA-N 0.000 claims description 3
- IVLJKLNFILQQMD-QNSVNVJESA-N (3r)-3-amino-4-cyclohexyl-n-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-2-hydroxybutanamide Chemical compound OC([C@H](N)CC1CCCCC1)C(=O)NC(C)(C)CC1=CC=C(F)C=C1 IVLJKLNFILQQMD-QNSVNVJESA-N 0.000 claims description 3
- MBVUWTZNVSABGR-PTXATLKXSA-N (3r)-3-amino-4-cyclohexyl-n-[1-(4-fluorophenyl)ethyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC(C)C=1C=CC(F)=CC=1)C1CCCCC1 MBVUWTZNVSABGR-PTXATLKXSA-N 0.000 claims description 3
- VACACWHUDPGHHK-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-n-[2-(2,4-dichlorophenyl)ethyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C(=CC(Cl)=CC=1)Cl)C1CCCCC1 VACACWHUDPGHHK-TZHYSIJRSA-N 0.000 claims description 3
- KQJSXZSFFCURET-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-n-[2-(2,6-dichlorophenyl)ethyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C(=CC=CC=1Cl)Cl)C1CCCCC1 KQJSXZSFFCURET-TZHYSIJRSA-N 0.000 claims description 3
- KOVDVIPYIYLTDH-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-n-[2-(3-fluorophenyl)ethyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=C(F)C=CC=1)C1CCCCC1 KOVDVIPYIYLTDH-TZHYSIJRSA-N 0.000 claims description 3
- MWQUEZJHILHTSJ-TZHYSIJRSA-N (3r)-3-amino-4-cyclohexyl-n-[2-(4-fluorophenyl)ethyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=CC(F)=CC=1)C1CCCCC1 MWQUEZJHILHTSJ-TZHYSIJRSA-N 0.000 claims description 3
- QOLAPWQSTWWENL-ITUIMRKVSA-N (3r)-3-amino-4-cyclohexyl-n-[4-[(3,4-dimethoxyphenyl)sulfonylamino]butyl]-2-hydroxybutanamide Chemical compound C1=C(OC)C(OC)=CC=C1S(=O)(=O)NCCCCNC(=O)C(O)[C@H](N)CC1CCCCC1 QOLAPWQSTWWENL-ITUIMRKVSA-N 0.000 claims description 3
- STPOTMDTERXFHP-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-n-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=C(C(F)=CC=1)C(F)(F)F)C1CCCCC1 STPOTMDTERXFHP-AAFJCEBUSA-N 0.000 claims description 3
- CSKMWFXJMAZBQC-MRTLOADZSA-N (3r)-3-amino-4-cyclohexyl-n-decyl-2-hydroxybutanamide Chemical compound CCCCCCCCCCNC(=O)C(O)[C@H](N)CC1CCCCC1 CSKMWFXJMAZBQC-MRTLOADZSA-N 0.000 claims description 3
- KDWITRYWTKYJAF-GICMACPYSA-N (3r)-3-amino-n,4-dicyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1CCCCC1)C1CCCCC1 KDWITRYWTKYJAF-GICMACPYSA-N 0.000 claims description 3
- KBXGBMFXTQDNEU-JBZHPUCOSA-N (3r)-3-amino-n-(1,3-benzodioxol-5-yl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C2OCOC2=CC=1)C1CCCCC1 KBXGBMFXTQDNEU-JBZHPUCOSA-N 0.000 claims description 3
- AQQPUSSVPPYXFA-AFYYWNPRSA-N (3r)-3-amino-n-(2-chlorophenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C(=CC=CC=1)Cl)C1CCCCC1 AQQPUSSVPPYXFA-AFYYWNPRSA-N 0.000 claims description 3
- DGIIJNZIZUVRIB-GICMACPYSA-N (3r)-3-amino-n-(3-chlorophenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(Cl)C=CC=1)C1CCCCC1 DGIIJNZIZUVRIB-GICMACPYSA-N 0.000 claims description 3
- HGYQUJCMXKVCEE-LCQOSCCDSA-N (3r)-3-amino-n-(4-anilino-2-methoxyphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C=1C=C(NC(=O)C(O)[C@H](N)CC2CCCCC2)C(OC)=CC=1NC1=CC=CC=C1 HGYQUJCMXKVCEE-LCQOSCCDSA-N 0.000 claims description 3
- ZXSYVPMOUTUQGM-GICMACPYSA-N (3r)-3-amino-n-(4-bromophenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC(Br)=CC=1)C1CCCCC1 ZXSYVPMOUTUQGM-GICMACPYSA-N 0.000 claims description 3
- IPPLTTXYPPYQJW-FWJOYPJLSA-N (3r)-3-amino-n-(4-chloro-2,5-dimethoxyphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C1=C(Cl)C(OC)=CC(NC(=O)C(O)[C@H](N)CC2CCCCC2)=C1OC IPPLTTXYPPYQJW-FWJOYPJLSA-N 0.000 claims description 3
- GPQBBMSCVZKORM-XPCCGILXSA-N (3r)-3-amino-n-(4-chloro-2-methoxy-5-methylphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound COC1=CC(Cl)=C(C)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 GPQBBMSCVZKORM-XPCCGILXSA-N 0.000 claims description 3
- ICSIFASTTZPAAX-GICMACPYSA-N (3r)-3-amino-n-(4-chlorophenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC(Cl)=CC=1)C1CCCCC1 ICSIFASTTZPAAX-GICMACPYSA-N 0.000 claims description 3
- UJTNOTHPAGCYNU-QQQDYKAYSA-N (3r)-3-amino-n-(4-tert-butylcyclohexyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C1CC(C(C)(C)C)CCC1NC(=O)C(O)[C@H](N)CC1CCCCC1 UJTNOTHPAGCYNU-QQQDYKAYSA-N 0.000 claims description 3
- VPZNYZLNOPYSCB-QNSVNVJESA-N (3r)-3-amino-n-(4-tert-butylphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C1=CC(C(C)(C)C)=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 VPZNYZLNOPYSCB-QNSVNVJESA-N 0.000 claims description 3
- NCSBEVQTRRQARH-FWJOYPJLSA-N (3r)-3-amino-n-(5-chloro-2,4-dimethoxyphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C1=C(Cl)C(OC)=CC(OC)=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 NCSBEVQTRRQARH-FWJOYPJLSA-N 0.000 claims description 3
- ALTJRQJHPOTJOE-JBZHPUCOSA-N (3r)-3-amino-n-(5-chloro-2-methoxyphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound COC1=CC=C(Cl)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 ALTJRQJHPOTJOE-JBZHPUCOSA-N 0.000 claims description 3
- MHUUZNUQFWSYQB-VTBWFHPJSA-N (3r)-3-amino-n-(5-tert-butyl-2-methoxyphenyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound COC1=CC=C(C(C)(C)C)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 MHUUZNUQFWSYQB-VTBWFHPJSA-N 0.000 claims description 3
- FHNDTJLEUABPIW-PUODRLBUSA-N (3r)-3-amino-n-(6-chloropyridin-3-yl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=NC(Cl)=CC=1)C1CCCCC1 FHNDTJLEUABPIW-PUODRLBUSA-N 0.000 claims description 3
- VHQMURPHXCVISG-ZJKXKIRJSA-N (3r)-3-amino-n-[(1s,4r)-3-bicyclo[2.2.1]heptanyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1[C@]2([H])CC[C@@](C2)(C1)[H])C1CCCCC1 VHQMURPHXCVISG-ZJKXKIRJSA-N 0.000 claims description 3
- VVRVDKSQLOZWLL-AAFJCEBUSA-N (3r)-3-amino-n-[(2-chlorophenyl)methyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C(=CC=CC=1)Cl)C1CCCCC1 VVRVDKSQLOZWLL-AAFJCEBUSA-N 0.000 claims description 3
- VFEIPXKJIMAEOB-AAFJCEBUSA-N (3r)-3-amino-n-[(3-chlorophenyl)methyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=C(Cl)C=CC=1)C1CCCCC1 VFEIPXKJIMAEOB-AAFJCEBUSA-N 0.000 claims description 3
- LBIGSMKKULZHFG-AAFJCEBUSA-N (3r)-3-amino-n-[(4-chlorophenyl)methyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=CC(Cl)=CC=1)C1CCCCC1 LBIGSMKKULZHFG-AAFJCEBUSA-N 0.000 claims description 3
- NFQNGOLLSWZEIK-MRTLOADZSA-N (3r)-3-amino-n-[(4-tert-butylphenyl)methyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C1=CC(C(C)(C)C)=CC=C1CNC(=O)C(O)[C@H](N)CC1CCCCC1 NFQNGOLLSWZEIK-MRTLOADZSA-N 0.000 claims description 3
- OXGSMXAPDMOYPC-TZHYSIJRSA-N (3r)-3-amino-n-[2-(2-chlorophenyl)ethyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C(=CC=CC=1)Cl)C1CCCCC1 OXGSMXAPDMOYPC-TZHYSIJRSA-N 0.000 claims description 3
- GFNQPLFSJDAUGU-TZHYSIJRSA-N (3r)-3-amino-n-[2-(3-chlorophenyl)ethyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=C(Cl)C=CC=1)C1CCCCC1 GFNQPLFSJDAUGU-TZHYSIJRSA-N 0.000 claims description 3
- BERSKHMIKQDRGF-TZHYSIJRSA-N (3r)-3-amino-n-[2-(4-bromophenyl)ethyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=CC(Br)=CC=1)C1CCCCC1 BERSKHMIKQDRGF-TZHYSIJRSA-N 0.000 claims description 3
- COAUNYKFYHMMHG-TZHYSIJRSA-N (3r)-3-amino-n-[2-(4-chlorophenyl)ethyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=CC(Cl)=CC=1)C1CCCCC1 COAUNYKFYHMMHG-TZHYSIJRSA-N 0.000 claims description 3
- MMDRTVZQSNDIRY-ZZTVPSNHSA-N (3r)-3-amino-n-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCCC=1C=C(OCC=2C=CC=CC=2)C(OCC=2C=CC=CC=2)=CC=1)C1CCCCC1 MMDRTVZQSNDIRY-ZZTVPSNHSA-N 0.000 claims description 3
- HOYVHQASUKCFDW-AAFJCEBUSA-N (3r)-3-amino-n-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=C(C=C(C=1)C(F)(F)F)C(F)(F)F)C1CCCCC1 HOYVHQASUKCFDW-AAFJCEBUSA-N 0.000 claims description 3
- AORFDWBJTHGOPI-AAFJCEBUSA-N (3r)-3-amino-n-cycloheptyl-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1CCCCCC1)C1CCCCC1 AORFDWBJTHGOPI-AAFJCEBUSA-N 0.000 claims description 3
- GYPZUGGKRSYSGW-PHDAXPOJSA-N (3r)-n-(1-adamantyl)-3-amino-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC12CC3CC(CC(C3)C1)C2)C1CCCCC1 GYPZUGGKRSYSGW-PHDAXPOJSA-N 0.000 claims description 3
- MPMDITWRJHIYBH-BBKYASGISA-N (3r)-n-(2-adamantyl)-3-amino-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1C2CC3CC(C2)CC1C3)C1CCCCC1 MPMDITWRJHIYBH-BBKYASGISA-N 0.000 claims description 3
- XHSMGJZKYBLZDE-NNJIEVJOSA-N (3r)-n-(5-acetamido-2-methoxyphenyl)-3-amino-4-cyclohexyl-2-hydroxybutanamide Chemical compound COC1=CC=C(NC(C)=O)C=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 XHSMGJZKYBLZDE-NNJIEVJOSA-N 0.000 claims description 3
- SBNYCUYBLFWPEP-IOWPZXFHSA-N (3r)-n-[1-(1-adamantyl)ethyl]-3-amino-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2)C1CCCCC1 SBNYCUYBLFWPEP-IOWPZXFHSA-N 0.000 claims description 3
- CGZDWVZMOMDGBN-UHFFFAOYSA-N 2-Ethylthiazole Chemical compound CCC1=NC=CS1 CGZDWVZMOMDGBN-UHFFFAOYSA-N 0.000 claims description 3
- UCAIMFSNINSCQZ-WWDZGPRUSA-N COC(=O)C(Cc1ccccc1)NC(=O)C(O)[C@H](N)CC1CCCCC1 Chemical compound COC(=O)C(Cc1ccccc1)NC(=O)C(O)[C@H](N)CC1CCCCC1 UCAIMFSNINSCQZ-WWDZGPRUSA-N 0.000 claims description 3
- IQNLZINRCYNTDC-IYXRBSQSSA-N COC(=O)C(NC(=O)C(O)[C@H](N)CC1CCCCC1)C(C)C Chemical compound COC(=O)C(NC(=O)C(O)[C@H](N)CC1CCCCC1)C(C)C IQNLZINRCYNTDC-IYXRBSQSSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- BZLKZNLUPGNNRE-AFYYWNPRSA-N butyl 2-[[(3r)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]acetate Chemical compound CCCCOC(=O)CNC(=O)C(O)[C@H](N)CC1CCCCC1 BZLKZNLUPGNNRE-AFYYWNPRSA-N 0.000 claims description 3
- MSZJEPVVQWJCIF-UHFFFAOYSA-N butylazanide Chemical compound CCCC[NH-] MSZJEPVVQWJCIF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- JTTVZTDDNJXKCN-NYFJODQOSA-N ethyl 2-[(3r)-3-amino-4-(butanoylamino)-2-hydroxycyclohexyl]-2-methylpropanoate Chemical compound CCCC(=O)NC1CCC(C(C)(C)C(=O)OCC)C(O)[C@@H]1N JTTVZTDDNJXKCN-NYFJODQOSA-N 0.000 claims description 3
- PXXVLZSNIUKBQQ-PUODRLBUSA-N ethyl 3-[[(3r)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]propanoate Chemical compound CCOC(=O)CCNC(=O)C(O)[C@H](N)CC1=CC=CC=C1 PXXVLZSNIUKBQQ-PUODRLBUSA-N 0.000 claims description 3
- OBCQQUOALPDDIC-PUODRLBUSA-N ethyl 3-[[(3r)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate Chemical compound CCOC(=O)CCNC(=O)C(O)[C@H](N)CC1CCCCC1 OBCQQUOALPDDIC-PUODRLBUSA-N 0.000 claims description 3
- HZCJCAUOOOMLFP-AFYYWNPRSA-N ethyl 4-[[(3r)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]butanoate Chemical compound CCOC(=O)CCCNC(=O)C(O)[C@H](N)CC1=CC=CC=C1 HZCJCAUOOOMLFP-AFYYWNPRSA-N 0.000 claims description 3
- PRRCROKYNVRWPC-AFYYWNPRSA-N ethyl 4-[[(3r)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]butanoate Chemical compound CCOC(=O)CCCNC(=O)C(O)[C@H](N)CC1CCCCC1 PRRCROKYNVRWPC-AFYYWNPRSA-N 0.000 claims description 3
- TXWUQXZNMZZBRK-RWANSRKNSA-N ethyl 4-[[(3r)-3-amino-5-ethylsulfanyl-2-hydroxypentanoyl]amino]butanoate Chemical compound CCOC(=O)CCCNC(=O)C(O)[C@H](N)CCSCC TXWUQXZNMZZBRK-RWANSRKNSA-N 0.000 claims description 3
- MUJUCMHVEMVFLD-PUODRLBUSA-N methyl 4-[[(3r)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate Chemical compound COC(=O)C1=CSC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 MUJUCMHVEMVFLD-PUODRLBUSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- VPLNORNXJVDZEZ-PUODRLBUSA-N tert-butyl 2-[[(3r)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]acetate Chemical compound CC(C)(C)OC(=O)CNC(=O)C(O)[C@H](N)CC1CCCCC1 VPLNORNXJVDZEZ-PUODRLBUSA-N 0.000 claims description 3
- 125000000464 thioxo group Chemical group S=* 0.000 claims description 3
- KNQYFKCOYGSUBU-ZDGFDOJISA-N (3r)-3-amino-4-cyclohexyl-1-[(2s,6r)-2,6-dimethylmorpholin-4-yl]-2-hydroxybutan-1-one Chemical compound C1[C@@H](C)O[C@@H](C)CN1C(=O)C(O)[C@H](N)CC1CCCCC1 KNQYFKCOYGSUBU-ZDGFDOJISA-N 0.000 claims description 2
- JTBPLBDEBIYKAL-FIWHBWSRSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-1-(4-phenyl-3,6-dihydro-2h-pyridin-1-yl)butan-1-one Chemical compound C([C@@H](N)C(O)C(=O)N1CC=C(CC1)C=1C=CC=CC=1)C1CCCCC1 JTBPLBDEBIYKAL-FIWHBWSRSA-N 0.000 claims description 2
- CKDBHKIOCCDNAZ-KWCCSABGSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-1-piperidin-1-ylbutan-1-one Chemical compound C([C@@H](N)C(O)C(=O)N1CCCCC1)C1CCCCC1 CKDBHKIOCCDNAZ-KWCCSABGSA-N 0.000 claims description 2
- MNEYNJVEQYMKSN-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-methoxyphenyl)butanamide Chemical compound C1=CC(OC)=CC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 MNEYNJVEQYMKSN-AAFJCEBUSA-N 0.000 claims description 2
- GAMYFQQPUHLVTC-VQCQRNETSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-phenoxyphenyl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC(OC=2C=CC=CC=2)=CC=1)C1CCCCC1 GAMYFQQPUHLVTC-VQCQRNETSA-N 0.000 claims description 2
- CLMOHKKGEZTVHL-QNSVNVJESA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[2-(4-methoxyphenyl)ethyl]butanamide Chemical compound C1=CC(OC)=CC=C1CCNC(=O)C(O)[C@H](N)CC1CCCCC1 CLMOHKKGEZTVHL-QNSVNVJESA-N 0.000 claims description 2
- MKWQOWIRHYHTSJ-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[3-(trifluoromethyl)phenyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(C=CC=1)C(F)(F)F)C1CCCCC1 MKWQOWIRHYHTSJ-GICMACPYSA-N 0.000 claims description 2
- WNCPNYKETLKBGC-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[[2-(trifluoromethyl)phenyl]methyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C(=CC=CC=1)C(F)(F)F)C1CCCCC1 WNCPNYKETLKBGC-AAFJCEBUSA-N 0.000 claims description 2
- BYGZNPLCQHBTAO-AAFJCEBUSA-N (3r)-3-amino-n-[(4-bromophenyl)methyl]-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=CC(Br)=CC=1)C1CCCCC1 BYGZNPLCQHBTAO-AAFJCEBUSA-N 0.000 claims description 2
- WTQZHNAYQAHYTE-VQCQRNETSA-N (3r)-n-[4-[(4-acetamidophenyl)sulfonylamino]butyl]-3-amino-4-cyclohexyl-2-hydroxybutanamide Chemical compound C1=CC(NC(=O)C)=CC=C1S(=O)(=O)NCCCCNC(=O)C(O)[C@H](N)CC1CCCCC1 WTQZHNAYQAHYTE-VQCQRNETSA-N 0.000 claims description 2
- WQADWIOXOXRPLN-AZXPZELESA-N 1,3-dithiane Chemical group C1CS[13CH2]SC1 WQADWIOXOXRPLN-AZXPZELESA-N 0.000 claims description 2
- IMLSAISZLJGWPP-UHFFFAOYSA-N 1,3-dithiolane Chemical group C1CSCS1 IMLSAISZLJGWPP-UHFFFAOYSA-N 0.000 claims description 2
- IGJWHVUMEJASKV-UHFFFAOYSA-N chloronium Chemical compound [ClH2+] IGJWHVUMEJASKV-UHFFFAOYSA-N 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims 8
- 235000004279 alanine Nutrition 0.000 claims 7
- WHJBZYIBIYGODX-UHFFFAOYSA-N 4-[[4-(3-morpholin-4-ylpropoxy)-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile Chemical compound CC1=CC(C)=CC(C)=C1NC1=NC(NC=2C=CC(=CC=2)C#N)=NC(OCCCN2CCOCC2)=N1 WHJBZYIBIYGODX-UHFFFAOYSA-N 0.000 claims 3
- IRZDHSKUSJPBOZ-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[3-(2-methylpropoxy)propyl]butanamide Chemical compound CC(C)COCCCNC(=O)C(O)[C@H](N)CC1CCCCC1 IRZDHSKUSJPBOZ-AAFJCEBUSA-N 0.000 claims 2
- NYMZKLKLESIZLM-OGVSOVDVSA-N (3r)-3-amino-4-cyclohexyl-n-heptan-2-yl-2-hydroxybutanamide Chemical compound CCCCCC(C)NC(=O)C(O)[C@H](N)CC1CCCCC1 NYMZKLKLESIZLM-OGVSOVDVSA-N 0.000 claims 2
- RUJPPJYDHHAEEK-UHFFFAOYSA-N ethyl piperidine-4-carboxylate Chemical compound CCOC(=O)C1CCNCC1 RUJPPJYDHHAEEK-UHFFFAOYSA-N 0.000 claims 2
- RQRBXAIYNBBAMS-PZORYLMUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n,n-bis(methoxymethyl)butanamide Chemical compound COCN(COC)C(=O)C(O)[C@H](N)CC1CCCCC1 RQRBXAIYNBBAMS-PZORYLMUSA-N 0.000 claims 1
- JXSWQBWPXWLBFU-QSVWIEALSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-(4-methoxynaphthalen-2-yl)butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=C(C2=CC=CC=C2C=1)OC)C1CCCCC1 JXSWQBWPXWLBFU-QSVWIEALSA-N 0.000 claims 1
- LFAYVUAMOPBEED-GICMACPYSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[4-(trifluoromethyl)phenyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NC=1C=CC(=CC=1)C(F)(F)F)C1CCCCC1 LFAYVUAMOPBEED-GICMACPYSA-N 0.000 claims 1
- YRVWLTLYDMVRIG-NNJIEVJOSA-N (3r)-3-amino-n-(1,3-benzodioxol-5-ylmethyl)-4-cyclohexyl-2-hydroxy-n-methylbutanamide Chemical compound C([C@@H](N)C(O)C(=O)N(CC=1C=C2OCOC2=CC=1)C)C1CCCCC1 YRVWLTLYDMVRIG-NNJIEVJOSA-N 0.000 claims 1
- MWRHHIPVNBYTAS-XPCCGILXSA-N (3r)-3-amino-n-(1,3-benzodioxol-5-ylmethyl)-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=C2OCOC2=CC=1)C1CCCCC1 MWRHHIPVNBYTAS-XPCCGILXSA-N 0.000 claims 1
- WVSKAJARJSDYSY-ARWYELJZSA-N (3r)-3-amino-n-[(2-chlorocyclohexa-2,3,5-trien-1-yl)methyl]-4-cyclohexyl-2-hydroxy-n-methylbutanamide Chemical compound OC([C@H](N)CC1CCCCC1)C(=O)N(C)CC1C=CC=C=C1Cl WVSKAJARJSDYSY-ARWYELJZSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 289
- 238000005481 NMR spectroscopy Methods 0.000 description 215
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 196
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 58
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 51
- 238000005160 1H NMR spectroscopy Methods 0.000 description 47
- 239000011734 sodium Substances 0.000 description 44
- 239000000203 mixture Substances 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000000243 solution Substances 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 25
- WIYDEVSKVYFPPV-UHFFFAOYSA-N pentanamide;hydrochloride Chemical compound Cl.CCCCC(N)=O WIYDEVSKVYFPPV-UHFFFAOYSA-N 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 239000012267 brine Substances 0.000 description 22
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 235000019441 ethanol Nutrition 0.000 description 9
- 238000010898 silica gel chromatography Methods 0.000 description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 8
- 239000000546 pharmaceutical excipient Substances 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 7
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical compound BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 7
- ARUJJNVNLJPSDO-UHFFFAOYSA-N butanamide;hydrochloride Chemical compound Cl.CCCC(N)=O ARUJJNVNLJPSDO-UHFFFAOYSA-N 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- LTPVSOCPYWDIFU-UHFFFAOYSA-N 4-methoxyphenylethylamine Chemical compound COC1=CC=C(CCN)C=C1 LTPVSOCPYWDIFU-UHFFFAOYSA-N 0.000 description 6
- AGNFWIZBEATIAK-UHFFFAOYSA-N 4-phenylbutylamine Chemical compound NCCCCC1=CC=CC=C1 AGNFWIZBEATIAK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 6
- 239000012346 acetyl chloride Substances 0.000 description 6
- 210000004027 cell Anatomy 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- JCXLZWMDXJFOOI-WCCKRBBISA-N ethyl (2s)-2-aminopropanoate;hydrochloride Chemical compound Cl.CCOC(=O)[C@H](C)N JCXLZWMDXJFOOI-WCCKRBBISA-N 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 229920001223 polyethylene glycol Polymers 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 229960001153 serine Drugs 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 5
- 206010029113 Neovascularisation Diseases 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- 239000012131 assay buffer Substances 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 239000006187 pill Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000007909 solid dosage form Substances 0.000 description 5
- 235000019698 starch Nutrition 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 239000001993 wax Substances 0.000 description 5
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 4
- NGGMYCMLYOUNGM-UHFFFAOYSA-N (-)-fumagillin Natural products O1C(CC=C(C)C)C1(C)C1C(OC)C(OC(=O)C=CC=CC=CC=CC(O)=O)CCC21CO2 NGGMYCMLYOUNGM-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 229930006000 Sucrose Natural products 0.000 description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- ZWXQYEZHIWVWBU-UHFFFAOYSA-N butanamide;dihydrochloride Chemical compound Cl.Cl.CCCC(N)=O ZWXQYEZHIWVWBU-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- NGGMYCMLYOUNGM-CSDLUJIJSA-N fumagillin Chemical compound C([C@H]([C@H]([C@@H]1[C@]2(C)[C@H](O2)CC=C(C)C)OC)OC(=O)\C=C\C=C\C=C\C=C\C(O)=O)C[C@@]21CO2 NGGMYCMLYOUNGM-CSDLUJIJSA-N 0.000 description 4
- 229960000936 fumagillin Drugs 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000011160 research Methods 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000005720 sucrose Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- PDAFIZPRSXHMCO-LURJTMIESA-N tert-butyl n-[(2s)-1-hydroxypropan-2-yl]carbamate Chemical compound OC[C@H](C)NC(=O)OC(C)(C)C PDAFIZPRSXHMCO-LURJTMIESA-N 0.000 description 4
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 3
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 3
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Polymers OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- MSHZHSPISPJWHW-UHFFFAOYSA-N O-(chloroacetylcarbamoyl)fumagillol Chemical compound O1C(CC=C(C)C)C1(C)C1C(OC)C(OC(=O)NC(=O)CCl)CCC21CO2 MSHZHSPISPJWHW-UHFFFAOYSA-N 0.000 description 3
- 235000010443 alginic acid Nutrition 0.000 description 3
- 229920000615 alginic acid Polymers 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229940024606 amino acid Drugs 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000006172 buffering agent Substances 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000003111 delayed effect Effects 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 210000002889 endothelial cell Anatomy 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- MAFQLJCYFMKEJJ-UHFFFAOYSA-N ethyl 4-aminobutanoate Chemical compound CCOC(=O)CCCN MAFQLJCYFMKEJJ-UHFFFAOYSA-N 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- PDAFIZPRSXHMCO-ZCFIWIBFSA-N tert-butyl n-[(2r)-1-hydroxypropan-2-yl]carbamate Chemical compound OC[C@@H](C)NC(=O)OC(C)(C)C PDAFIZPRSXHMCO-ZCFIWIBFSA-N 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- GSQBIOQCECCMOQ-UHFFFAOYSA-N β-alanine ethyl ester Chemical compound CCOC(=O)CCN GSQBIOQCECCMOQ-UHFFFAOYSA-N 0.000 description 3
- RTCUCQWIICFPOD-VIFPVBQESA-N (1s)-1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C([C@@H](N)C)=CC=CC2=C1 RTCUCQWIICFPOD-VIFPVBQESA-N 0.000 description 2
- IMUSLIHRIYOHEV-SSDOTTSWSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid Chemical compound CSCC[C@H](C(O)=O)NC(=O)OC(C)(C)C IMUSLIHRIYOHEV-SSDOTTSWSA-N 0.000 description 2
- SKPCTMWFLGENTL-BYPYZUCNSA-N (2s)-2-amino-n-ethylpropanamide Chemical compound CCNC(=O)[C@H](C)N SKPCTMWFLGENTL-BYPYZUCNSA-N 0.000 description 2
- BJFPYGGTDAYECS-UHFFFAOYSA-N (3-chlorophenyl)methanamine Chemical compound NCC1=CC=CC(Cl)=C1 BJFPYGGTDAYECS-UHFFFAOYSA-N 0.000 description 2
- RGXUCUWVGKLACF-UHFFFAOYSA-N (3-methylphenyl)methanamine Chemical compound CC1=CC=CC(CN)=C1 RGXUCUWVGKLACF-UHFFFAOYSA-N 0.000 description 2
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- HJORCZCMNWLHMB-UHFFFAOYSA-N 1-(3-aminopropyl)pyrrolidin-2-one Chemical compound NCCCN1CCCC1=O HJORCZCMNWLHMB-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- QHEZHWNFSVYUGT-UHFFFAOYSA-N 1h-benzimidazol-1-ium-2-ylmethylazanium;dichloride;hydrate Chemical compound O.Cl.Cl.C1=CC=C2NC(CN)=NC2=C1 QHEZHWNFSVYUGT-UHFFFAOYSA-N 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 2
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- FTZVRGDRIAPBKO-UHFFFAOYSA-N 2-(2-methyl-5-nitroimidazol-1-yl)ethanamine Chemical compound CC1=NC=C([N+]([O-])=O)N1CCN FTZVRGDRIAPBKO-UHFFFAOYSA-N 0.000 description 2
- JNHPLGDXCJAUBX-UHFFFAOYSA-N 2-(4-phenoxyphenyl)ethanamine Chemical compound C1=CC(CCN)=CC=C1OC1=CC=CC=C1 JNHPLGDXCJAUBX-UHFFFAOYSA-N 0.000 description 2
- QMLKQXIAPAAIEJ-UHFFFAOYSA-N 2-(phenylmethoxycarbonylamino)ethylazanium;chloride Chemical compound Cl.NCCNC(=O)OCC1=CC=CC=C1 QMLKQXIAPAAIEJ-UHFFFAOYSA-N 0.000 description 2
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 2
- ZVNNCIIFBSRHFE-UHFFFAOYSA-N 4-(phenylmethoxycarbonylamino)butylazanium;chloride Chemical compound Cl.NCCCCNC(=O)OCC1=CC=CC=C1 ZVNNCIIFBSRHFE-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 201000004569 Blindness Diseases 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 206010012689 Diabetic retinopathy Diseases 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 239000004705 High-molecular-weight polyethylene Substances 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 101710181812 Methionine aminopeptidase Proteins 0.000 description 2
- SASNBVQSOZSTPD-UHFFFAOYSA-N N-methyl-N-phenethyl amine Natural products CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 2
- MSHZHSPISPJWHW-PVDLLORBSA-N O-(chloroacetylcarbamoyl)fumagillol Chemical compound C([C@H]([C@H]([C@@H]1[C@]2(C)[C@H](O2)CC=C(C)C)OC)OC(=O)NC(=O)CCl)C[C@@]21CO2 MSHZHSPISPJWHW-PVDLLORBSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 239000000783 alginic acid Substances 0.000 description 2
- 229960001126 alginic acid Drugs 0.000 description 2
- 150000004781 alginic acids Chemical class 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000012216 bentonite Nutrition 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- YGYLYUIRSJSFJS-QMMMGPOBSA-N benzyl (2s)-2-aminopropanoate Chemical compound C[C@H](N)C(=O)OCC1=CC=CC=C1 YGYLYUIRSJSFJS-QMMMGPOBSA-N 0.000 description 2
- RLMHWGDKMJIEHH-QRPNPIFTSA-N benzyl (2s)-2-aminopropanoate;hydrochloride Chemical compound Cl.C[C@H](N)C(=O)OCC1=CC=CC=C1 RLMHWGDKMJIEHH-QRPNPIFTSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 229920002988 biodegradable polymer Polymers 0.000 description 2
- 239000004621 biodegradable polymer Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 235000019437 butane-1,3-diol Nutrition 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000002702 enteric coating Substances 0.000 description 2
- 238000009505 enteric coating Methods 0.000 description 2
- JCXLZWMDXJFOOI-PGMHMLKASA-N ethyl (2r)-2-aminopropanoate;hydrochloride Chemical compound Cl.CCOC(=O)[C@@H](C)N JCXLZWMDXJFOOI-PGMHMLKASA-N 0.000 description 2
- JZJQCLZQSHLSFB-WCCKRBBISA-N ethyl (2s)-2-amino-3-hydroxypropanoate;hydrochloride Chemical compound Cl.CCOC(=O)[C@@H](N)CO JZJQCLZQSHLSFB-WCCKRBBISA-N 0.000 description 2
- YREPHXXOTHNLEV-UHFFFAOYSA-N ethyl 2-amino-2-methylpropanoate;hydrochloride Chemical compound Cl.CCOC(=O)C(C)(C)N YREPHXXOTHNLEV-UHFFFAOYSA-N 0.000 description 2
- MMXKVMNBHPAILY-UHFFFAOYSA-N ethyl laurate Chemical compound CCCCCCCCCCCC(=O)OCC MMXKVMNBHPAILY-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 235000001727 glucose Nutrition 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000008297 liquid dosage form Substances 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- NNUQENKCQXPGJG-FVGYRXGTSA-N methyl (2s)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride Chemical compound Cl.NCCCC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C NNUQENKCQXPGJG-FVGYRXGTSA-N 0.000 description 2
- 239000004530 micro-emulsion Substances 0.000 description 2
- MLEBFEHOJICQQS-UHFFFAOYSA-N monodansylcadaverine Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(=O)(=O)NCCCCCN MLEBFEHOJICQQS-UHFFFAOYSA-N 0.000 description 2
- ODHSPTHLPCXPTL-UHFFFAOYSA-N n'-(5-nitropyridin-2-yl)ethane-1,2-diamine Chemical compound NCCNC1=CC=C([N+]([O-])=O)C=N1 ODHSPTHLPCXPTL-UHFFFAOYSA-N 0.000 description 2
- GVWISOJSERXQBM-UHFFFAOYSA-N n-methylpropan-1-amine Chemical compound CCCNC GVWISOJSERXQBM-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 229960004063 propylene glycol Drugs 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000008159 sesame oil Substances 0.000 description 2
- 235000011803 sesame oil Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- AELCINSCMGFISI-DTWKUNHWSA-N (1R,2S)-tranylcypromine Chemical compound N[C@@H]1C[C@H]1C1=CC=CC=C1 AELCINSCMGFISI-DTWKUNHWSA-N 0.000 description 1
- KHSYYLCXQKCYQX-VIFPVBQESA-N (1s)-1-naphthalen-2-ylethanamine Chemical compound C1=CC=CC2=CC([C@@H](N)C)=CC=C21 KHSYYLCXQKCYQX-VIFPVBQESA-N 0.000 description 1
- SJUKJZSTBBSGHF-UHFFFAOYSA-N (2,4-dichlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1Cl SJUKJZSTBBSGHF-UHFFFAOYSA-N 0.000 description 1
- LRFWYBZWRQWZIM-UHFFFAOYSA-N (2-fluorophenyl)methanamine Chemical compound NCC1=CC=CC=C1F LRFWYBZWRQWZIM-UHFFFAOYSA-N 0.000 description 1
- ZYJPUMXJBDHSIF-LLVKDONJSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 ZYJPUMXJBDHSIF-LLVKDONJSA-N 0.000 description 1
- ZIOCIQJXEKFHJO-MRVPVSSYSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid Chemical compound CCCC[C@H](C(O)=O)NC(=O)OC(C)(C)C ZIOCIQJXEKFHJO-MRVPVSSYSA-N 0.000 description 1
- JZBKYJZIWJSOPA-MRVPVSSYSA-N (2r)-4-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CCSCC[C@H](C(O)=O)NC(=O)OC(C)(C)C JZBKYJZIWJSOPA-MRVPVSSYSA-N 0.000 description 1
- DQUHYEDEGRNAFO-MRVPVSSYSA-N (2r)-6-azaniumyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)CCCCN DQUHYEDEGRNAFO-MRVPVSSYSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- IMUSLIHRIYOHEV-ZETCQYMHSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid Chemical compound CSCC[C@@H](C(O)=O)NC(=O)OC(C)(C)C IMUSLIHRIYOHEV-ZETCQYMHSA-N 0.000 description 1
- IFVORPLRHYROAA-GFCCVEGCSA-N (2s)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)CSCC1=CC=CC=C1 IFVORPLRHYROAA-GFCCVEGCSA-N 0.000 description 1
- HNVIQLPOGUDBSU-OLQVQODUSA-N (2s,6r)-2,6-dimethylmorpholine Chemical compound C[C@H]1CNC[C@@H](C)O1 HNVIQLPOGUDBSU-OLQVQODUSA-N 0.000 description 1
- GRRIMVWABNHKBX-UHFFFAOYSA-N (3-methoxyphenyl)methanamine Chemical compound COC1=CC=CC(CN)=C1 GRRIMVWABNHKBX-UHFFFAOYSA-N 0.000 description 1
- BHTRKISIDQZUQX-JHJMLUEUSA-N (3r)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)C(O)=O)CC1=CC=CC=C1 BHTRKISIDQZUQX-JHJMLUEUSA-N 0.000 description 1
- DRRIMLRILAPHHY-GVHYBUMESA-N (3r)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid Chemical compound CSCC[C@H](C(O)C(O)=O)NC(=O)OC(C)(C)C DRRIMLRILAPHHY-GVHYBUMESA-N 0.000 description 1
- KRQDJBAPRVIAFS-VEDVMXKPSA-N (3r)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid Chemical compound CCCC[C@H](C(O)C(O)=O)NC(=O)OC(C)(C)C KRQDJBAPRVIAFS-VEDVMXKPSA-N 0.000 description 1
- YWLCXQYLZKPILF-GICMACPYSA-N (3r)-3-amino-1-(azepan-1-yl)-4-cyclohexyl-2-hydroxybutan-1-one Chemical compound C([C@@H](N)C(O)C(=O)N1CCCCCC1)C1CCCCC1 YWLCXQYLZKPILF-GICMACPYSA-N 0.000 description 1
- IOMAOMKYKZHZHG-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[[3-(trifluoromethyl)phenyl]methyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=C(C=CC=1)C(F)(F)F)C1CCCCC1 IOMAOMKYKZHZHG-AAFJCEBUSA-N 0.000 description 1
- OVNVAFAYNZFCQZ-AAFJCEBUSA-N (3r)-3-amino-4-cyclohexyl-2-hydroxy-n-[[4-(trifluoromethyl)phenyl]methyl]butanamide Chemical compound C([C@@H](N)C(O)C(=O)NCC=1C=CC(=CC=1)C(F)(F)F)C1CCCCC1 OVNVAFAYNZFCQZ-AAFJCEBUSA-N 0.000 description 1
- HNEFBUSUAJJTDY-QNSVNVJESA-N (3r)-3-amino-4-cyclohexyl-n-[(2,4-dichlorophenyl)methyl]-n-ethyl-2-hydroxybutanamide Chemical compound OC([C@H](N)CC1CCCCC1)C(=O)N(CC)CC1=CC=C(Cl)C=C1Cl HNEFBUSUAJJTDY-QNSVNVJESA-N 0.000 description 1
- ZQNAXOVXFQQIDC-KWCCSABGSA-N (3r)-3-amino-4-cyclohexyl-n-cyclopentyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1CCCC1)C1CCCCC1 ZQNAXOVXFQQIDC-KWCCSABGSA-N 0.000 description 1
- IZFDWAYTSFTLRX-PZORYLMUSA-N (3r)-3-amino-n-cyclobutyl-4-cyclohexyl-2-hydroxybutanamide Chemical compound C([C@@H](N)C(O)C(=O)NC1CCC1)C1CCCCC1 IZFDWAYTSFTLRX-PZORYLMUSA-N 0.000 description 1
- UNBJOAYNIMWSCZ-VEDVMXKPSA-N (3r)-5-ethylsulfanyl-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CCSCC[C@H](C(O)C(O)=O)NC(=O)OC(C)(C)C UNBJOAYNIMWSCZ-VEDVMXKPSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- XRNVSPDQTPVECU-UHFFFAOYSA-N (4-bromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1 XRNVSPDQTPVECU-UHFFFAOYSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- PTDVPWWJRCOIIO-UHFFFAOYSA-N (4-methoxyphenyl)methanethiol Chemical compound COC1=CC=C(CS)C=C1 PTDVPWWJRCOIIO-UHFFFAOYSA-N 0.000 description 1
- HMTSWYPNXFHGEP-UHFFFAOYSA-N (4-methylphenyl)methanamine Chemical compound CC1=CC=C(CN)C=C1 HMTSWYPNXFHGEP-UHFFFAOYSA-N 0.000 description 1
- MPWSRGAWRAYBJK-UHFFFAOYSA-N (4-tert-butylphenyl)methanamine Chemical compound CC(C)(C)C1=CC=C(CN)C=C1 MPWSRGAWRAYBJK-UHFFFAOYSA-N 0.000 description 1
- NUSVDASTCPBUIP-UHFFFAOYSA-N (5-bromo-1,3-thiazol-2-yl)azanium;bromide Chemical compound [Br-].BrC1=C[NH2+]C(=N)S1 NUSVDASTCPBUIP-UHFFFAOYSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- JRZGPXSSNPTNMA-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-1-amine Chemical compound C1=CC=C2C(N)CCCC2=C1 JRZGPXSSNPTNMA-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 1
- ZILSBZLQGRBMOR-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethanamine Chemical compound NCC1=CC=C2OCOC2=C1 ZILSBZLQGRBMOR-UHFFFAOYSA-N 0.000 description 1
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- UBCHPRBFMUDMNC-UHFFFAOYSA-N 1-(1-adamantyl)ethanamine Chemical compound C1C(C2)CC3CC2CC1(C(N)C)C3 UBCHPRBFMUDMNC-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- DIWGZVQKFSFNLH-UHFFFAOYSA-N 1-(2-chlorophenyl)-n-methylmethanamine Chemical compound CNCC1=CC=CC=C1Cl DIWGZVQKFSFNLH-UHFFFAOYSA-N 0.000 description 1
- JITFIYFVPMQJOK-UHFFFAOYSA-N 1-(4-fluorophenyl)-2-methylpropan-2-amine Chemical compound CC(C)(N)CC1=CC=C(F)C=C1 JITFIYFVPMQJOK-UHFFFAOYSA-N 0.000 description 1
- QGCLEUGNYRXBMZ-UHFFFAOYSA-N 1-(4-fluorophenyl)ethanamine Chemical compound CC(N)C1=CC=C(F)C=C1 QGCLEUGNYRXBMZ-UHFFFAOYSA-N 0.000 description 1
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 1
- SYNKYJKCQBVGSL-UHFFFAOYSA-N 1-(benzenesulfonylmethyl)-2-(bromomethyl)benzene Chemical compound BrCC1=CC=CC=C1CS(=O)(=O)C1=CC=CC=C1 SYNKYJKCQBVGSL-UHFFFAOYSA-N 0.000 description 1
- IKSNDOVDVVPSMA-UHFFFAOYSA-N 1-(bromomethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CBr)C=C1 IKSNDOVDVVPSMA-UHFFFAOYSA-N 0.000 description 1
- QZNQSIHCDAGZIA-UHFFFAOYSA-N 1-(bromomethyl)-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(CBr)C=C1 QZNQSIHCDAGZIA-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- MLBHFBKZUPLWBD-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]-2-propanamine Chemical compound CC(N)CC1=CC=CC(C(F)(F)F)=C1 MLBHFBKZUPLWBD-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- WRAZHLRMDRTLOZ-UHFFFAOYSA-N 1-isocyanato-2,4-dimethoxybenzene Chemical compound COC1=CC=C(N=C=O)C(OC)=C1 WRAZHLRMDRTLOZ-UHFFFAOYSA-N 0.000 description 1
- MCQHGMXGVNLZGC-UHFFFAOYSA-N 1-isocyanato-2-[4-(trifluoromethoxy)phenyl]benzene Chemical compound C1=CC(OC(F)(F)F)=CC=C1C1=CC=CC=C1N=C=O MCQHGMXGVNLZGC-UHFFFAOYSA-N 0.000 description 1
- RTCUCQWIICFPOD-UHFFFAOYSA-N 1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C(C(N)C)=CC=CC2=C1 RTCUCQWIICFPOD-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- BZKOZYWGZKRTIB-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-6-amine Chemical compound O1CCOC2=CC(N)=CC=C21 BZKOZYWGZKRTIB-UHFFFAOYSA-N 0.000 description 1
- XJEVHMGJSYVQBQ-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-amine Chemical compound C1=CC=C2C(N)CCC2=C1 XJEVHMGJSYVQBQ-UHFFFAOYSA-N 0.000 description 1
- HEZIOZBMPKPOER-UHFFFAOYSA-N 2,3-dimethoxyaniline Chemical compound COC1=CC=CC(N)=C1OC HEZIOZBMPKPOER-UHFFFAOYSA-N 0.000 description 1
- QIJIUJYANDSEKG-UHFFFAOYSA-N 2,4,4-trimethylpentan-2-amine Chemical compound CC(C)(C)CC(C)(C)N QIJIUJYANDSEKG-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 1
- XPKFTIYOZUJAGA-UHFFFAOYSA-N 2,5-diethoxyaniline Chemical compound CCOC1=CC=C(OCC)C(N)=C1 XPKFTIYOZUJAGA-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- VHJKDOLGYMULOP-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)ethanamine Chemical compound NCCC1=CC=C(Cl)C=C1Cl VHJKDOLGYMULOP-UHFFFAOYSA-N 0.000 description 1
- RZBOMSOHMOVUES-UHFFFAOYSA-N 2-(2-chlorophenyl)ethanamine Chemical compound NCCC1=CC=CC=C1Cl RZBOMSOHMOVUES-UHFFFAOYSA-N 0.000 description 1
- WSWPCNMLEVZGSM-UHFFFAOYSA-N 2-(2-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC=C1CCN WSWPCNMLEVZGSM-UHFFFAOYSA-N 0.000 description 1
- NRHVNPYOTNGECT-UHFFFAOYSA-N 2-(3-chlorophenyl)ethanamine Chemical compound NCCC1=CC=CC(Cl)=C1 NRHVNPYOTNGECT-UHFFFAOYSA-N 0.000 description 1
- AUCVZEYHEFAWHO-UHFFFAOYSA-N 2-(3-fluorophenyl)ethanamine Chemical compound NCCC1=CC=CC(F)=C1 AUCVZEYHEFAWHO-UHFFFAOYSA-N 0.000 description 1
- WJBMRZAHTUFBGE-UHFFFAOYSA-N 2-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC(CCN)=C1 WJBMRZAHTUFBGE-UHFFFAOYSA-N 0.000 description 1
- ZSZCXAOQVBEPME-UHFFFAOYSA-N 2-(4-bromophenyl)ethanamine Chemical compound NCCC1=CC=C(Br)C=C1 ZSZCXAOQVBEPME-UHFFFAOYSA-N 0.000 description 1
- SRXFXCKTIGELTI-UHFFFAOYSA-N 2-(4-chlorophenyl)ethanamine Chemical compound NCCC1=CC=C(Cl)C=C1 SRXFXCKTIGELTI-UHFFFAOYSA-N 0.000 description 1
- CKLFJWXRWIQYOC-UHFFFAOYSA-N 2-(4-fluorophenyl)ethanamine Chemical compound NCCC1=CC=C(F)C=C1 CKLFJWXRWIQYOC-UHFFFAOYSA-N 0.000 description 1
- XSGMGAINOILNJR-UHFFFAOYSA-N 2-(9h-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1COC(=O)NC(C(O)=O)C(C)(C)SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 XSGMGAINOILNJR-UHFFFAOYSA-N 0.000 description 1
- ZFCOUBUSGHLCDT-UHFFFAOYSA-N 2-(trifluoromethoxy)aniline Chemical compound NC1=CC=CC=C1OC(F)(F)F ZFCOUBUSGHLCDT-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- JXPQMHIXNPWEEK-UHFFFAOYSA-N 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine Chemical compound C=1C=CC=CC=1COC1=CC(CCN)=CC=C1OCC1=CC=CC=C1 JXPQMHIXNPWEEK-UHFFFAOYSA-N 0.000 description 1
- BPVYCXMGJPKOTQ-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]ethanamine Chemical compound NCCC1=CC=CC(C(F)(F)F)=C1 BPVYCXMGJPKOTQ-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- AQLHMGFXKIZXGY-UHFFFAOYSA-N 2-ethyl-1,3-thiazol-3-ium;chloride Chemical compound [Cl-].CCC1=[NH+]C=CS1 AQLHMGFXKIZXGY-UHFFFAOYSA-N 0.000 description 1
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 description 1
- FSJOLBAFVKSQQJ-UHFFFAOYSA-N 2-ethylpyrazol-3-amine Chemical compound CCN1N=CC=C1N FSJOLBAFVKSQQJ-UHFFFAOYSA-N 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- PSLCQHFPBXQZLI-UHFFFAOYSA-N 2-methoxy-4-n-phenylbenzene-1,4-diamine Chemical compound C1=C(N)C(OC)=CC(NC=2C=CC=CC=2)=C1 PSLCQHFPBXQZLI-UHFFFAOYSA-N 0.000 description 1
- MKAPTOAKEPIGOA-UHFFFAOYSA-N 2-methoxy-5-(trifluoromethoxy)aniline Chemical compound COC1=CC=C(OC(F)(F)F)C=C1N MKAPTOAKEPIGOA-UHFFFAOYSA-N 0.000 description 1
- NIPDVSLAMPAWTP-UHFFFAOYSA-N 2-methoxy-5-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C=C1N NIPDVSLAMPAWTP-UHFFFAOYSA-N 0.000 description 1
- DTYBRSLINXBXMP-UHFFFAOYSA-N 2-methoxy-5-phenylaniline Chemical compound C1=C(N)C(OC)=CC=C1C1=CC=CC=C1 DTYBRSLINXBXMP-UHFFFAOYSA-N 0.000 description 1
- IBZKBSXREAQDTO-UHFFFAOYSA-N 2-methoxy-n-(2-methoxyethyl)ethanamine Chemical compound COCCNCCOC IBZKBSXREAQDTO-UHFFFAOYSA-N 0.000 description 1
- SGQVWNYSHWQNOS-UHFFFAOYSA-N 2-methoxydibenzofuran-3-amine Chemical compound O1C2=CC=CC=C2C2=C1C=C(N)C(OC)=C2 SGQVWNYSHWQNOS-UHFFFAOYSA-N 0.000 description 1
- NMFFUUFPJJOWHK-UHFFFAOYSA-N 2-phenoxyaniline Chemical compound NC1=CC=CC=C1OC1=CC=CC=C1 NMFFUUFPJJOWHK-UHFFFAOYSA-N 0.000 description 1
- NAHHNSMHYCLMON-UHFFFAOYSA-N 2-pyridin-3-ylethanamine Chemical compound NCCC1=CC=CN=C1 NAHHNSMHYCLMON-UHFFFAOYSA-N 0.000 description 1
- IDLHTECVNDEOIY-UHFFFAOYSA-N 2-pyridin-4-ylethanamine Chemical compound NCCC1=CC=NC=C1 IDLHTECVNDEOIY-UHFFFAOYSA-N 0.000 description 1
- XPQIPUZPSLAZDV-UHFFFAOYSA-N 2-pyridylethylamine Chemical compound NCCC1=CC=CC=N1 XPQIPUZPSLAZDV-UHFFFAOYSA-N 0.000 description 1
- HVLUYXIJZLDNIS-UHFFFAOYSA-N 2-thiophen-2-ylethanamine Chemical compound NCCC1=CC=CS1 HVLUYXIJZLDNIS-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- KISZTEOELCMZPY-UHFFFAOYSA-N 3,3-diphenylpropylamine Chemical compound C=1C=CC=CC=1C(CCN)C1=CC=CC=C1 KISZTEOELCMZPY-UHFFFAOYSA-N 0.000 description 1
- XEFRNCLPPFDWAC-UHFFFAOYSA-N 3,4,5-trimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1OC XEFRNCLPPFDWAC-UHFFFAOYSA-N 0.000 description 1
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 1
- RSJSYCZYQNJQPY-UHFFFAOYSA-N 3,4-dimethoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1OC RSJSYCZYQNJQPY-UHFFFAOYSA-N 0.000 description 1
- WNRGWPVJGDABME-UHFFFAOYSA-N 3,5-Dimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1 WNRGWPVJGDABME-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- REJGIEGOYWEWPR-UHFFFAOYSA-N 3-(2-methylpropoxy)propan-1-amine Chemical compound CC(C)COCCCN REJGIEGOYWEWPR-UHFFFAOYSA-N 0.000 description 1
- SADHVOSOZBAAGL-UHFFFAOYSA-N 3-(trifluoromethoxy)aniline Chemical compound NC1=CC=CC(OC(F)(F)F)=C1 SADHVOSOZBAAGL-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- ONCAZCNPWWQQMW-UHFFFAOYSA-N 3-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=CC(S(Cl)(=O)=O)=C1 ONCAZCNPWWQQMW-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- WEZAHYDFZNTGKE-UHFFFAOYSA-N 3-ethoxyaniline Chemical compound CCOC1=CC=CC(N)=C1 WEZAHYDFZNTGKE-UHFFFAOYSA-N 0.000 description 1
- KDHWOCLBMVSZPG-UHFFFAOYSA-N 3-imidazol-1-ylpropan-1-amine Chemical compound NCCCN1C=CN=C1 KDHWOCLBMVSZPG-UHFFFAOYSA-N 0.000 description 1
- ONADZNBSLRAJFW-UHFFFAOYSA-N 3-methoxy-4-methylaniline Chemical compound COC1=CC(N)=CC=C1C ONADZNBSLRAJFW-UHFFFAOYSA-N 0.000 description 1
- VTFGJEYZCUWSAM-UHFFFAOYSA-N 3-methoxy-5-(trifluoromethyl)aniline Chemical compound COC1=CC(N)=CC(C(F)(F)F)=C1 VTFGJEYZCUWSAM-UHFFFAOYSA-N 0.000 description 1
- JOZZAIIGWFLONA-UHFFFAOYSA-N 3-methylbutan-2-amine Chemical compound CC(C)C(C)N JOZZAIIGWFLONA-UHFFFAOYSA-N 0.000 description 1
- GUERDLPJJJMIEU-UHFFFAOYSA-N 3-methylphenethylamine Chemical compound CC1=CC=CC(CCN)=C1 GUERDLPJJJMIEU-UHFFFAOYSA-N 0.000 description 1
- CWNPOQFCIIFQDM-UHFFFAOYSA-N 3-nitrobenzyl alcohol Chemical compound OCC1=CC=CC([N+]([O-])=O)=C1 CWNPOQFCIIFQDM-UHFFFAOYSA-N 0.000 description 1
- 150000000499 3-oxazolines Chemical class 0.000 description 1
- UCSYVYFGMFODMY-UHFFFAOYSA-N 3-phenoxyaniline Chemical compound NC1=CC=CC(OC=2C=CC=CC=2)=C1 UCSYVYFGMFODMY-UHFFFAOYSA-N 0.000 description 1
- IGPFOKFDBICQMC-UHFFFAOYSA-N 3-phenylmethoxyaniline Chemical compound NC1=CC=CC(OCC=2C=CC=CC=2)=C1 IGPFOKFDBICQMC-UHFFFAOYSA-N 0.000 description 1
- VHYUNSUGCNKWSO-UHFFFAOYSA-N 3-propan-2-yloxypropan-1-amine Chemical compound CC(C)OCCCN VHYUNSUGCNKWSO-UHFFFAOYSA-N 0.000 description 1
- AWRIOTVUTPLWLF-UHFFFAOYSA-N 4-(2-aminoethyl)-2-methoxyphenol;hydron;chloride Chemical compound Cl.COC1=CC(CCN)=CC=C1O AWRIOTVUTPLWLF-UHFFFAOYSA-N 0.000 description 1
- DNHFPNOBPGKAEA-UHFFFAOYSA-N 4-(2-aminoethyl)-2-methylperoxyphenol;hydrochloride Chemical compound Cl.COOC1=CC(CCN)=CC=C1O DNHFPNOBPGKAEA-UHFFFAOYSA-N 0.000 description 1
- FXNSVEQMUYPYJS-UHFFFAOYSA-N 4-(2-aminoethyl)benzenesulfonamide Chemical compound NCCC1=CC=C(S(N)(=O)=O)C=C1 FXNSVEQMUYPYJS-UHFFFAOYSA-N 0.000 description 1
- MOOUWXDQAUXZRG-UHFFFAOYSA-N 4-(trifluoromethyl)benzyl alcohol Chemical compound OCC1=CC=C(C(F)(F)F)C=C1 MOOUWXDQAUXZRG-UHFFFAOYSA-N 0.000 description 1
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical class CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 1
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 1
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- YGUFQYGSBVXPMC-UHFFFAOYSA-N 4-chloro-2,5-dimethoxyaniline Chemical compound COC1=CC(Cl)=C(OC)C=C1N YGUFQYGSBVXPMC-UHFFFAOYSA-N 0.000 description 1
- XBAPOWUMJRIKAV-UHFFFAOYSA-N 4-chloro-2-methoxy-5-methylaniline Chemical compound COC1=CC(Cl)=C(C)C=C1N XBAPOWUMJRIKAV-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- BGKLFAQCHHCZRZ-UHFFFAOYSA-N 4-iodo-2-methylaniline Chemical compound CC1=CC(I)=CC=C1N BGKLFAQCHHCZRZ-UHFFFAOYSA-N 0.000 description 1
- SFKZPTYRENGBTJ-UHFFFAOYSA-N 4-methoxynaphthalen-2-amine Chemical compound C1=CC=C2C(OC)=CC(N)=CC2=C1 SFKZPTYRENGBTJ-UHFFFAOYSA-N 0.000 description 1
- UNBMPKNTYKDYCG-UHFFFAOYSA-N 4-methylpentan-2-amine Chemical compound CC(C)CC(C)N UNBMPKNTYKDYCG-UHFFFAOYSA-N 0.000 description 1
- PHNDZBFLOPIMSM-UHFFFAOYSA-N 4-morpholin-4-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCOCC1 PHNDZBFLOPIMSM-UHFFFAOYSA-N 0.000 description 1
- JKTYGPATCNUWKN-UHFFFAOYSA-N 4-nitrobenzyl alcohol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1 JKTYGPATCNUWKN-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- POGWXTJNUCZEPR-UHFFFAOYSA-N 4-phenyl-1,2,3,6-tetrahydropyridin-1-ium;chloride Chemical compound Cl.C1NCCC(C=2C=CC=CC=2)=C1 POGWXTJNUCZEPR-UHFFFAOYSA-N 0.000 description 1
- WRDWWAVNELMWAM-UHFFFAOYSA-N 4-tert-butylaniline Chemical compound CC(C)(C)C1=CC=C(N)C=C1 WRDWWAVNELMWAM-UHFFFAOYSA-N 0.000 description 1
- BGNLXETYTAAURD-UHFFFAOYSA-N 4-tert-butylcyclohexan-1-amine Chemical compound CC(C)(C)C1CCC(N)CC1 BGNLXETYTAAURD-UHFFFAOYSA-N 0.000 description 1
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- OLCMNCWEUMBNIS-UHFFFAOYSA-N 5-chloro-2,4-dimethoxyaniline Chemical compound COC1=CC(OC)=C(Cl)C=C1N OLCMNCWEUMBNIS-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- IZCBXLKODYZSDJ-UHFFFAOYSA-N 5-methylhexan-2-amine Chemical compound CC(C)CCC(C)N IZCBXLKODYZSDJ-UHFFFAOYSA-N 0.000 description 1
- DSBIJCMXAIKKKI-UHFFFAOYSA-N 5-nitro-o-toluidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N DSBIJCMXAIKKKI-UHFFFAOYSA-N 0.000 description 1
- PWSZRRFDVPMZGM-UHFFFAOYSA-N 5-phenyl-1h-pyrazol-3-amine Chemical compound N1N=C(N)C=C1C1=CC=CC=C1 PWSZRRFDVPMZGM-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- QAJYCQZQLVENRZ-UHFFFAOYSA-N 6-chloropyridin-3-amine Chemical compound NC1=CC=C(Cl)N=C1 QAJYCQZQLVENRZ-UHFFFAOYSA-N 0.000 description 1
- QUXLCYFNVNNRBE-UHFFFAOYSA-N 6-methylpyridin-2-amine Chemical compound CC1=CC=CC(N)=N1 QUXLCYFNVNNRBE-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- IRCWWVUBJYUYAT-CHPOKUKFSA-N C(CCC)(=O)NCCC1(CC(OOC)=C(O)C=C1)C([C@@H](N)C)=O Chemical compound C(CCC)(=O)NCCC1(CC(OOC)=C(O)C=C1)C([C@@H](N)C)=O IRCWWVUBJYUYAT-CHPOKUKFSA-N 0.000 description 1
- OKMCXPFCUJPMMU-LBPRGKRZSA-N C(CCC)(=O)NCCC1=CN(C2=CC=C(C=C12)OC)C([C@@H](N)C)=O Chemical compound C(CCC)(=O)NCCC1=CN(C2=CC=C(C=C12)OC)C([C@@H](N)C)=O OKMCXPFCUJPMMU-LBPRGKRZSA-N 0.000 description 1
- IJHHVIURGUSVPY-UVTUNJGPSA-N CCCC(NC(C(C)N1CCCC1)C([C@H](C)N)=O)=O.Cl Chemical compound CCCC(NC(C(C)N1CCCC1)C([C@H](C)N)=O)=O.Cl IJHHVIURGUSVPY-UVTUNJGPSA-N 0.000 description 1
- LWMFFPAPYPANTJ-MCNHTDSKSA-N CCCC(NC(CC(N=C(C)N1)=C1[N+]([O-])=O)C([C@H](C)N)=O)=O.Cl Chemical compound CCCC(NC(CC(N=C(C)N1)=C1[N+]([O-])=O)C([C@H](C)N)=O)=O.Cl LWMFFPAPYPANTJ-MCNHTDSKSA-N 0.000 description 1
- XURPZODCXIHMEC-RDZSRHKNSA-N CCCC(NC(CNC(C=C1)=NC=C1[N+]([O-])=O)C([C@H](C)N)=O)=O.Cl.Cl Chemical compound CCCC(NC(CNC(C=C1)=NC=C1[N+]([O-])=O)C([C@H](C)N)=O)=O.Cl.Cl XURPZODCXIHMEC-RDZSRHKNSA-N 0.000 description 1
- ZBCMKJFEXIRJQR-UHFFFAOYSA-N CCCC(NCCCC1=NC=CN1)=O.Cl.Cl Chemical compound CCCC(NCCCC1=NC=CN1)=O.Cl.Cl ZBCMKJFEXIRJQR-UHFFFAOYSA-N 0.000 description 1
- AVOPLTINPMMMRD-UHFFFAOYSA-N CCCC(NCCCCN)=O.Cl.Cl Chemical compound CCCC(NCCCCN)=O.Cl.Cl AVOPLTINPMMMRD-UHFFFAOYSA-N 0.000 description 1
- DKVZYJJWWTZSJH-UHFFFAOYSA-N CCCC(NCCCCNS(C1=CC=C(C)C=C1)(=O)=O)=O.Cl Chemical compound CCCC(NCCCCNS(C1=CC=C(C)C=C1)(=O)=O)=O.Cl DKVZYJJWWTZSJH-UHFFFAOYSA-N 0.000 description 1
- CXAPDMFLUHZSDF-UHFFFAOYSA-N CCCC(NCCN)=O.Cl.Cl Chemical compound CCCC(NCCN)=O.Cl.Cl CXAPDMFLUHZSDF-UHFFFAOYSA-N 0.000 description 1
- OOCNAYLIQYERTA-UHFFFAOYSA-N CCCC(NCCNS(C1=CC=C(C)C=C1)(=O)=O)=O.Cl Chemical compound CCCC(NCCNS(C1=CC=C(C)C=C1)(=O)=O)=O.Cl OOCNAYLIQYERTA-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 108010016626 Dipeptides Proteins 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical group F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- CEVCTNCUIVEQOY-UHFFFAOYSA-N Fumagillol Natural products O1C(CC=C(C)C)C1(C)C1C(OC)C(O)CCC21CO2 CEVCTNCUIVEQOY-UHFFFAOYSA-N 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 1
- 108010008292 L-Amino Acid Oxidase Proteins 0.000 description 1
- 102000007070 L-amino-acid oxidase Human genes 0.000 description 1
- IFQSXNOEEPCSLW-DKWTVANSSA-N L-cysteine hydrochloride Chemical compound Cl.SC[C@H](N)C(O)=O IFQSXNOEEPCSLW-DKWTVANSSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- WXHHTBVYQOSYSL-FXQIFTODSA-N Met-Ala-Ser Chemical compound CSCC[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(O)=O WXHHTBVYQOSYSL-FXQIFTODSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 241000276498 Pollachius virens Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920000954 Polyglycolide Polymers 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- 239000005700 Putrescine Substances 0.000 description 1
- 235000019485 Safflower oil Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- SSZBUIDZHHWXNJ-UHFFFAOYSA-N Stearinsaeure-hexadecylester Natural products CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCCCC SSZBUIDZHHWXNJ-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 1
- ZOMVAHSEDGIBBR-ZETCQYMHSA-N [(2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] acetate Chemical compound CC(=O)OC[C@H](C)NC(=O)OC(C)(C)C ZOMVAHSEDGIBBR-ZETCQYMHSA-N 0.000 description 1
- FYXMMFFZMQMXCQ-UHFFFAOYSA-N [2-(trifluoromethoxy)phenyl]methanamine Chemical compound NCC1=CC=CC=C1OC(F)(F)F FYXMMFFZMQMXCQ-UHFFFAOYSA-N 0.000 description 1
- ZSKQIFWUTUZAGF-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC=C1C(F)(F)F ZSKQIFWUTUZAGF-UHFFFAOYSA-N 0.000 description 1
- TUPUHSXMDIWJQT-UHFFFAOYSA-N [3-(trifluoromethoxy)phenyl]methanamine Chemical compound NCC1=CC=CC(OC(F)(F)F)=C1 TUPUHSXMDIWJQT-UHFFFAOYSA-N 0.000 description 1
- XRGSSROOYSFMMS-UHFFFAOYSA-N [3-(trifluoromethoxy)phenyl]methanol Chemical compound OCC1=CC=CC(OC(F)(F)F)=C1 XRGSSROOYSFMMS-UHFFFAOYSA-N 0.000 description 1
- YKNZTUQUXUXTLE-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(C(F)(F)F)=C1 YKNZTUQUXUXTLE-UHFFFAOYSA-N 0.000 description 1
- PRDBLLIPPDOICK-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=C(C(F)(F)F)C=C1 PRDBLLIPPDOICK-UHFFFAOYSA-N 0.000 description 1
- HZDVQEUISWBXPV-UHFFFAOYSA-N [4-fluoro-3-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=C(F)C(C(F)(F)F)=C1 HZDVQEUISWBXPV-UHFFFAOYSA-N 0.000 description 1
- FFDLFRPNHOKSQG-SSDOTTSWSA-N [acetyl-[(2R)-1-hydroxypropan-2-yl]amino] tert-butyl carbonate Chemical compound C(C)(C)(C)OC(=O)ON([C@H](C)CO)C(C)=O FFDLFRPNHOKSQG-SSDOTTSWSA-N 0.000 description 1
- PDRJSPJSVKHPDE-LLVKDONJSA-N [benzoyl-[(2R)-1-hydroxypropan-2-yl]amino] tert-butyl carbonate Chemical compound C(C)(C)(C)OC(=O)ON([C@H](C)CO)C(C1=CC=CC=C1)=O PDRJSPJSVKHPDE-LLVKDONJSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000003655 absorption accelerator Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- ORWKVZNEPHTCQE-UHFFFAOYSA-N acetic formic anhydride Chemical compound CC(=O)OC=O ORWKVZNEPHTCQE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 125000005076 adamantyloxycarbonyl group Chemical group C12(CC3CC(CC(C1)C3)C2)OC(=O)* 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 206010064930 age-related macular degeneration Diseases 0.000 description 1
- 125000001980 alanyl group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 description 1
- 229960003805 amantadine Drugs 0.000 description 1
- 150000003862 amino acid derivatives Chemical class 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 230000002491 angiogenic effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 210000001188 articular cartilage Anatomy 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- DPEATBWCWKCPRX-UHFFFAOYSA-N benzyl 2-amino-2-methylpropanoate Chemical compound CC(C)(N)C(=O)OCC1=CC=CC=C1 DPEATBWCWKCPRX-UHFFFAOYSA-N 0.000 description 1
- SQYBQQYHYIDXHS-UHFFFAOYSA-N benzyl 3-(butanoylamino)propanoate hydrochloride Chemical compound Cl.C(C1=CC=CC=C1)OC(CCNC(CCC)=O)=O SQYBQQYHYIDXHS-UHFFFAOYSA-N 0.000 description 1
- CANCPUBPPUIWPX-UHFFFAOYSA-N benzyl 3-aminopropanoate Chemical compound NCCC(=O)OCC1=CC=CC=C1 CANCPUBPPUIWPX-UHFFFAOYSA-N 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- JEPPYVOSGKWVSJ-UHFFFAOYSA-N bicyclo[2.2.1]heptan-3-amine Chemical compound C1CC2C(N)CC1C2 JEPPYVOSGKWVSJ-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000036770 blood supply Effects 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- ONDMKQWGMAVUNZ-UHFFFAOYSA-N butyl 2-aminoacetate Chemical compound CCCCOC(=O)CN ONDMKQWGMAVUNZ-UHFFFAOYSA-N 0.000 description 1
- ICXXXLGATNSZAV-UHFFFAOYSA-N butylazanium;chloride Chemical compound [Cl-].CCCC[NH3+] ICXXXLGATNSZAV-UHFFFAOYSA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000022131 cell cycle Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 150000005827 chlorofluoro hydrocarbons Chemical class 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 239000007819 coupling partner Substances 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000012228 culture supernatant Substances 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- NZAWHYMFBXOGHQ-FJXQXJEOSA-N cyclohexyl (2s)-2-aminopropanoate;hydrochloride Chemical compound Cl.C[C@H](N)C(=O)OC1CCCCC1 NZAWHYMFBXOGHQ-FJXQXJEOSA-N 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002711 cysteinyl group Chemical group 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- MHFMYGHRYRSFIG-UHFFFAOYSA-L dilithium;dihydroxide Chemical compound [Li+].[Li+].[OH-].[OH-] MHFMYGHRYRSFIG-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229950010030 dl-alanine Drugs 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 239000003221 ear drop Substances 0.000 description 1
- 229940047652 ear drops Drugs 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ROBXZHNBBCHEIQ-BYPYZUCNSA-N ethyl (2s)-2-aminopropanoate Chemical compound CCOC(=O)[C@H](C)N ROBXZHNBBCHEIQ-BYPYZUCNSA-N 0.000 description 1
- NIDZUMSLERGAON-UHFFFAOYSA-N ethyl 2-(methylamino)acetate;hydron;chloride Chemical compound Cl.CCOC(=O)CNC NIDZUMSLERGAON-UHFFFAOYSA-N 0.000 description 1
- HCTJHQFFNDLDPF-UHFFFAOYSA-N ethyl 3-(benzylamino)propanoate Chemical compound CCOC(=O)CCNCC1=CC=CC=C1 HCTJHQFFNDLDPF-UHFFFAOYSA-N 0.000 description 1
- GQQQULCEHJQUJT-UHFFFAOYSA-N ethyl 4-aminopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(N)CC1 GQQQULCEHJQUJT-UHFFFAOYSA-N 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 208000030533 eye disease Diseases 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- CEVCTNCUIVEQOY-STXHBLNNSA-N fumagillol Chemical compound C([C@@H](O)[C@H](C1[C@]2(C)[C@H](O2)CC=C(C)C)OC)C[C@@]21CO2 CEVCTNCUIVEQOY-STXHBLNNSA-N 0.000 description 1
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 1
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- NESRXFGQJARQNM-OWYFMNJBSA-N graphinone Chemical compound O=C([C@H]([C@]1(O)[C@]2(C)[C@H](O2)CC=C(C)C)OC)CC[C@@]21CO2 NESRXFGQJARQNM-OWYFMNJBSA-N 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 229950003188 isovaleryl diethylamide Drugs 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000001998 leucyl group Chemical group 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 208000002780 macular degeneration Diseases 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000002073 methionyl group Chemical group 0.000 description 1
- 108010016686 methionyl-alanyl-serine Proteins 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- CEMZBWPSKYISTN-YFKPBYRVSA-N methyl (2s)-2-amino-3-methylbutanoate Chemical compound COC(=O)[C@@H](N)C(C)C CEMZBWPSKYISTN-YFKPBYRVSA-N 0.000 description 1
- TVZNFYXAPXOARC-LURJTMIESA-N methyl (2s)-2-aminohexanoate Chemical compound CCCC[C@H](N)C(=O)OC TVZNFYXAPXOARC-LURJTMIESA-N 0.000 description 1
- YXMMTUJDQTVJEN-WDSKDSINSA-N methyl (2s,3s)-2-amino-3-methylpentanoate Chemical compound CC[C@H](C)[C@H](N)C(=O)OC YXMMTUJDQTVJEN-WDSKDSINSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- NLWBJPPMPLPZIE-UHFFFAOYSA-N methyl 4-(bromomethyl)benzoate Chemical compound COC(=O)C1=CC=C(CBr)C=C1 NLWBJPPMPLPZIE-UHFFFAOYSA-N 0.000 description 1
- ORESWLWJNGSSQI-UYUUDJTFSA-N methyl 4-[[(3r)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]thiophene-3-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=CSC=C1NC(=O)C(O)[C@H](N)CC1CCCCC1 ORESWLWJNGSSQI-UYUUDJTFSA-N 0.000 description 1
- BUFZZXCVOFBHLS-UHFFFAOYSA-N methyl 4-aminothiophene-3-carboxylate Chemical compound COC(=O)C1=CSC=C1N BUFZZXCVOFBHLS-UHFFFAOYSA-N 0.000 description 1
- QVDXUKJJGUSGLS-LURJTMIESA-N methyl L-leucinate Chemical compound COC(=O)[C@@H](N)CC(C)C QVDXUKJJGUSGLS-LURJTMIESA-N 0.000 description 1
- VSDUZFOSJDMAFZ-VIFPVBQESA-N methyl L-phenylalaninate Chemical compound COC(=O)[C@@H](N)CC1=CC=CC=C1 VSDUZFOSJDMAFZ-VIFPVBQESA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- MAJQQCVMLVPMIW-UHFFFAOYSA-N n-[(2,4-dichlorophenyl)methyl]ethanamine Chemical compound CCNCC1=CC=C(Cl)C=C1Cl MAJQQCVMLVPMIW-UHFFFAOYSA-N 0.000 description 1
- STJJVNNQIAHWNN-UCLNMNFYSA-N n-[(2r)-2-amino-3-hydroxy-4-(4-phenylbutanoyl)cyclohexyl]butanamide;hydrochloride Chemical compound Cl.OC1[C@H](N)C(NC(=O)CCC)CCC1C(=O)CCCC1=CC=CC=C1 STJJVNNQIAHWNN-UCLNMNFYSA-N 0.000 description 1
- HIPXPABRMMYVQD-UHFFFAOYSA-N n-benzylbutan-1-amine Chemical compound CCCCNCC1=CC=CC=C1 HIPXPABRMMYVQD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 1
- FPKGTVXPIULTIP-UHFFFAOYSA-N n-ethyl-1,3-benzodioxol-5-amine Chemical compound CCNC1=CC=C2OCOC2=C1 FPKGTVXPIULTIP-UHFFFAOYSA-N 0.000 description 1
- XWCCTMBMQUCLSI-UHFFFAOYSA-N n-ethyl-n-propylpropan-1-amine Chemical compound CCCN(CC)CCC XWCCTMBMQUCLSI-UHFFFAOYSA-N 0.000 description 1
- MQRIUFVBEVFILS-UHFFFAOYSA-N n-methyl-1-naphthalen-1-ylmethanamine Chemical compound C1=CC=C2C(CNC)=CC=CC2=C1 MQRIUFVBEVFILS-UHFFFAOYSA-N 0.000 description 1
- OLLZXQIFCRIRMH-UHFFFAOYSA-N n-methylbutanamide Chemical compound CCCC(=O)NC OLLZXQIFCRIRMH-UHFFFAOYSA-N 0.000 description 1
- NVSYANRBXPURRQ-UHFFFAOYSA-N naphthalen-1-ylmethanamine Chemical compound C1=CC=C2C(CN)=CC=CC2=C1 NVSYANRBXPURRQ-UHFFFAOYSA-N 0.000 description 1
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 230000010046 negative regulation of endothelial cell proliferation Effects 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- QNIVIMYXGGFTAK-UHFFFAOYSA-N octodrine Chemical compound CC(C)CCCC(C)N QNIVIMYXGGFTAK-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000000668 oral spray Substances 0.000 description 1
- 229940041678 oral spray Drugs 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- YNOGYQAEJGADFJ-UHFFFAOYSA-N oxolan-2-ylmethanamine Chemical compound NCC1CCCO1 YNOGYQAEJGADFJ-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- BFNSCWHOEBHMEA-UHFFFAOYSA-N pentanamide;dihydrochloride Chemical compound Cl.Cl.CCCCC(N)=O BFNSCWHOEBHMEA-UHFFFAOYSA-N 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- BUQPIKAEKYNDAS-UHFFFAOYSA-N phenacyl 2-[4-(bromomethyl)phenyl]acetate Chemical compound C1=CC(CBr)=CC=C1CC(=O)OCC(=O)C1=CC=CC=C1 BUQPIKAEKYNDAS-UHFFFAOYSA-N 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 125000000405 phenylalanyl group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 230000037081 physical activity Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical class NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- SBMSLRMNBSMKQC-UHFFFAOYSA-N pyrrolidin-1-amine Chemical class NN1CCCC1 SBMSLRMNBSMKQC-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 239000003340 retarding agent Substances 0.000 description 1
- 210000001525 retina Anatomy 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000003813 safflower oil Substances 0.000 description 1
- 235000005713 safflower oil Nutrition 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 125000002072 seryl group Chemical group 0.000 description 1
- 229930004725 sesquiterpene Natural products 0.000 description 1
- 150000004354 sesquiterpene derivatives Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- SJMDMGHPMLKLHQ-UHFFFAOYSA-N tert-butyl 2-aminoacetate Chemical compound CC(C)(C)OC(=O)CN SJMDMGHPMLKLHQ-UHFFFAOYSA-N 0.000 description 1
- QQWYQAQQADNEIC-RVDMUPIBSA-N tert-butyl [(z)-[cyano(phenyl)methylidene]amino] carbonate Chemical compound CC(C)(C)OC(=O)O\N=C(/C#N)C1=CC=CC=C1 QQWYQAQQADNEIC-RVDMUPIBSA-N 0.000 description 1
- NUZPFVAHOYILMB-MRVPVSSYSA-N tert-butyl [[(2R)-1-hydroxypropan-2-yl]-propanoylamino] carbonate Chemical compound C(C)(C)(C)OC(=O)ON([C@H](C)CO)C(CC)=O NUZPFVAHOYILMB-MRVPVSSYSA-N 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical group CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BVWMROSCGYTJLB-ZDUSSCGKSA-N tert-butyl n-[(2s)-1-benzylsulfanyl-3-oxopropan-2-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H](C=O)CSCC1=CC=CC=C1 BVWMROSCGYTJLB-ZDUSSCGKSA-N 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- 150000003549 thiazolines Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 1
- 125000001239 threonyl group Chemical group 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 229940035339 tri-chlor Drugs 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VSRBKQFNFZQRBM-UHFFFAOYSA-N tuaminoheptane Chemical compound CCCCCC(C)N VSRBKQFNFZQRBM-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000005740 tumor formation Effects 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- QFKMMXYLAPZKIB-UHFFFAOYSA-N undecan-1-amine Chemical compound CCCCCCCCCCCN QFKMMXYLAPZKIB-UHFFFAOYSA-N 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 125000002114 valyl group Chemical group 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 235000014692 zinc oxide Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/16—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
- C07C237/12—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atom of at least one of the carboxamide groups bound to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/14—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being saturated and containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/18—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/19—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/60—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton with the carbon atom of at least one of the carboxyl groups bound to nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/76—Two oxygen atoms, e.g. hydantoin with substituted hydrocarbon radicals attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/95—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by nitrogen atoms, attached to other ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/14—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/66—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/04—Systems containing only non-condensed rings with a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/56—Ring systems containing bridged rings
- C07C2603/58—Ring systems containing bridged rings containing three rings
- C07C2603/70—Ring systems containing bridged rings containing three rings containing only six-membered rings
- C07C2603/74—Adamantanes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Enzymes And Modification Thereof (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US7171498A | 1998-05-01 | 1998-05-01 | |
PCT/US1999/009641 WO1999057098A2 (fr) | 1998-05-01 | 1999-04-30 | INHIBITEURS β-AMINO-ACIDE SUBSTITUES DE LA METHIONINE AMINOPEPTIDASE-2 |
US09/303,807 US6242494B1 (en) | 1998-05-01 | 1999-04-30 | Substituted β-amino acid inhibitors of methionine aminopeptidase-2 |
Publications (2)
Publication Number | Publication Date |
---|---|
NO20005506D0 NO20005506D0 (no) | 2000-11-01 |
NO20005506L true NO20005506L (no) | 2000-12-29 |
Family
ID=26752577
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO20005506A NO20005506L (no) | 1998-05-01 | 2000-11-01 | Substituerte beta-aminosyre-inhibitorer for metionin- aminopeptidase-2 |
Country Status (5)
Country | Link |
---|---|
BG (1) | BG104981A (fr) |
BR (1) | BR9910092A (fr) |
NO (1) | NO20005506L (fr) |
SK (1) | SK16282000A3 (fr) |
WO (1) | WO1999057098A2 (fr) |
Families Citing this family (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB9929297D0 (en) * | 1999-12-11 | 2000-02-02 | Glaxo Group Ltd | Process |
US20020002152A1 (en) | 2000-04-14 | 2002-01-03 | Craig Richard A. | Hydrazide and alkoxyamide angiogenesis inhibitors |
CN100357283C (zh) * | 2002-04-02 | 2007-12-26 | 中国科学院上海药物研究所 | 一类甲硫氨酰氨肽酶抑制剂 |
US7030262B2 (en) | 2002-08-06 | 2006-04-18 | Abbott Laboratories | 3-Amino-2-hydroxyalkanoic acids and their prodrugs |
EP1546087A1 (fr) * | 2002-08-06 | 2005-06-29 | Abbott Laboratories | Acides 3-amino-2-hrydroxyalkanoiques et leurs promedicaments |
AU2003265068A1 (en) * | 2002-10-09 | 2004-05-04 | Pfizer Products Inc. | Thiazole compounds for the treatment of neurodegenerative disorders |
WO2005009344A2 (fr) | 2003-06-05 | 2005-02-03 | Elan Pharmaceuticals, Inc. | Amino acide amidyle pyrazoles acyles et composes relatifs |
JP7022066B2 (ja) | 2016-01-11 | 2022-02-17 | シンデブルックス,インコーポレイティド | 代謝機能不全によって引き起こされる腫瘍の治療 |
EP3870231A1 (fr) | 2018-10-26 | 2021-09-01 | Syndevrx, Inc. | Biomarqueurs d'inhibiteurs de metap2 et leurs applications |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB1510477A (en) * | 1975-07-22 | 1978-05-10 | Microbial Chem Res Found | Peptides and to amino acid intermediates thereof |
US5442044A (en) * | 1991-01-04 | 1995-08-15 | Pfizer Inc. | Orally active renin inhibitors |
-
1999
- 1999-04-30 WO PCT/US1999/009641 patent/WO1999057098A2/fr not_active Application Discontinuation
- 1999-04-30 BR BR9910092-4A patent/BR9910092A/pt not_active Application Discontinuation
- 1999-04-30 SK SK1628-2000A patent/SK16282000A3/sk unknown
-
2000
- 2000-11-01 NO NO20005506A patent/NO20005506L/no not_active Application Discontinuation
- 2000-11-24 BG BG104981A patent/BG104981A/xx unknown
Also Published As
Publication number | Publication date |
---|---|
SK16282000A3 (sk) | 2001-05-10 |
WO1999057098A2 (fr) | 1999-11-11 |
BG104981A (en) | 2001-07-31 |
WO1999057098A3 (fr) | 2000-07-27 |
BR9910092A (pt) | 2002-01-22 |
NO20005506D0 (no) | 2000-11-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US6242494B1 (en) | Substituted β-amino acid inhibitors of methionine aminopeptidase-2 | |
CA2817784C (fr) | Procede de traitement d'une nephropathie induite par les produits de contraste | |
DE69728375T2 (de) | Substituierte (aryl, heteroaryl, arylmethyl oder heteroarylmethyl) hydroxamisaeureverbindungen | |
EP0445796B1 (fr) | Dérivés de l'acide acétique contenant des liaisons peptidiques | |
AU620820B2 (en) | N-acylamino acid derivatives and their use | |
US7166590B2 (en) | Amino acid derivatives | |
US6455502B1 (en) | Compounds and compositions as protease inhibitors | |
US6506733B1 (en) | Compounds and compositions as protease inhibitors | |
US20020103192A1 (en) | Inhibitors of histone deacetylase | |
US11999695B2 (en) | YAP1 inhibitors that target the interaction of YAP1 with OCT4 | |
US20020193614A1 (en) | Anthranilic acid derivatives as inhibitors of the CGMP-phosphodiesterase | |
SK94196A3 (en) | Metalloproteinase inhibitors, pharmaceutical compositions containing them, manufacturing process thereof and their use | |
MX2007008238A (es) | Derivados de adamantilo como inhibidores de la enzima 11-beta-hidroxiesteroide deshidrogenasa tipo 1. | |
JP2006521305A (ja) | ノイラミニダーゼ阻害剤r6を調製するためのアジドを含まない方法 | |
KR20010023001A (ko) | 관절염 치료용 아그레카나제 및 기질 메탈로프로테나제의 신규 억제제 | |
NO20005506L (no) | Substituerte beta-aminosyre-inhibitorer for metionin- aminopeptidase-2 | |
SK65097A3 (en) | Metalloproteinase inhibitors, manufacturing process thereof and pharmaceutical composition containing the same | |
MXPA06011826A (es) | Derivados de bis-fenil sulfinilo triciclicos aromaticos. | |
EP1073633A2 (fr) | INHIBITEURS $g(b)-AMINO-ACIDE SUBSTITUES DE LA METHIONINE AMINOPEPTIDASE-2 | |
WO1997003783A1 (fr) | Inhibiteurs de metalloproteinases | |
WO1997003783A9 (fr) | Inhibiteurs de metalloproteinases | |
KR20020038951A (ko) | 베타 이치환된 메탈로프로테아제 저해제 | |
MXPA00010791A (en) | Substituted beta-amino acid inhibitors of methionine aminopeptidase-2 | |
CZ20003967A3 (cs) | Substituované beta-aminokyselinové inhibitory methioninaminopeptidasy-2 | |
DE60106740T2 (de) | Hydrazid und alkoxyamid angiogeneseinhibitoren |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FC2A | Withdrawal, rejection or dismissal of laid open patent application |