NO159377B - Sprengstoffblanding av emulsjonstypen. - Google Patents
Sprengstoffblanding av emulsjonstypen. Download PDFInfo
- Publication number
- NO159377B NO159377B NO832125A NO832125A NO159377B NO 159377 B NO159377 B NO 159377B NO 832125 A NO832125 A NO 832125A NO 832125 A NO832125 A NO 832125A NO 159377 B NO159377 B NO 159377B
- Authority
- NO
- Norway
- Prior art keywords
- oil
- mixtures
- mixture
- water
- explosive
- Prior art date
Links
- 239000000839 emulsion Substances 0.000 title claims description 34
- 238000004880 explosion Methods 0.000 title 1
- 239000000203 mixture Substances 0.000 claims abstract description 128
- 239000002360 explosive Substances 0.000 claims abstract description 56
- 239000003995 emulsifying agent Substances 0.000 claims abstract description 19
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 16
- 239000012074 organic phase Substances 0.000 claims abstract description 16
- 239000001301 oxygen Substances 0.000 claims abstract description 16
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 239000008346 aqueous phase Substances 0.000 claims abstract description 8
- 239000000446 fuel Substances 0.000 claims description 18
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 239000007762 w/o emulsion Substances 0.000 abstract description 15
- 230000035945 sensitivity Effects 0.000 abstract description 10
- 239000005662 Paraffin oil Substances 0.000 abstract description 5
- 239000003921 oil Substances 0.000 description 33
- -1 distillate Substances 0.000 description 19
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 16
- 238000000034 method Methods 0.000 description 12
- 238000003860 storage Methods 0.000 description 11
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 8
- 239000004317 sodium nitrate Substances 0.000 description 8
- 235000010344 sodium nitrate Nutrition 0.000 description 8
- 238000005474 detonation Methods 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000002562 thickening agent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 150000002334 glycols Chemical class 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000012266 salt solution Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 230000001590 oxidative effect Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 3
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 239000000787 lecithin Substances 0.000 description 3
- 235000010445 lecithin Nutrition 0.000 description 3
- 229940067606 lecithin Drugs 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000001593 sorbitan monooleate Substances 0.000 description 3
- 235000011069 sorbitan monooleate Nutrition 0.000 description 3
- 229940035049 sorbitan monooleate Drugs 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- ULQISTXYYBZJSJ-UHFFFAOYSA-N 12-hydroxyoctadecanoic acid Chemical compound CCCCCCC(O)CCCCCCCCCCC(O)=O ULQISTXYYBZJSJ-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000000295 fuel oil Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 229940114072 12-hydroxystearic acid Drugs 0.000 description 1
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- MWRWFPQBGSZWNV-UHFFFAOYSA-N Dinitrosopentamethylenetetramine Chemical compound C1N2CN(N=O)CN1CN(N=O)C2 MWRWFPQBGSZWNV-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 241000589634 Xanthomonas Species 0.000 description 1
- 241000589636 Xanthomonas campestris Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- KHPLPBHMTCTCHA-UHFFFAOYSA-N ammonium chlorate Chemical compound N.OCl(=O)=O KHPLPBHMTCTCHA-UHFFFAOYSA-N 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 229920001222 biopolymer Polymers 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 229940013317 fish oils Drugs 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229920013818 hydroxypropyl guar gum Polymers 0.000 description 1
- 150000002462 imidazolines Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- 239000010705 motor oil Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 150000004005 nitrosamines Chemical class 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 244000000003 plant pathogen Species 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- IIQJBVZYLIIMND-UHFFFAOYSA-J potassium;antimony(3+);2,3-dihydroxybutanedioate Chemical compound [K+].[Sb+3].[O-]C(=O)C(O)C(O)C([O-])=O.[O-]C(=O)C(O)C(O)C([O-])=O IIQJBVZYLIIMND-UHFFFAOYSA-J 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 239000000015 trinitrotoluene Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- NDKWCCLKSWNDBG-UHFFFAOYSA-N zinc;dioxido(dioxo)chromium Chemical compound [Zn+2].[O-][Cr]([O-])(=O)=O NDKWCCLKSWNDBG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Cosmetics (AREA)
- Colloid Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AUPF441182 | 1982-06-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO832125L NO832125L (no) | 1983-12-12 |
| NO159377B true NO159377B (no) | 1988-09-12 |
Family
ID=3769583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO832125A NO159377B (no) | 1982-06-11 | 1983-06-10 | Sprengstoffblanding av emulsjonstypen. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4448619A (fi) |
| AT (1) | ATE23985T1 (fi) |
| CA (1) | CA1193102A (fi) |
| DE (1) | DE3368044D1 (fi) |
| FI (1) | FI76065C (fi) |
| GB (1) | GB2122983B (fi) |
| MW (1) | MW2483A1 (fi) |
| NO (1) | NO159377B (fi) |
| NZ (1) | NZ204344A (fi) |
| PH (1) | PH19691A (fi) |
| ZA (1) | ZA833964B (fi) |
| ZM (1) | ZM4483A1 (fi) |
| ZW (1) | ZW12183A1 (fi) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MW2884A1 (en) * | 1984-02-08 | 1986-08-13 | Aeci Ltd | An explosive which includes an explosive emulsion |
| US4548659A (en) * | 1984-04-05 | 1985-10-22 | Ireco Incorporated | Cast emulsion explosive composition |
| AU578460B2 (en) * | 1984-04-19 | 1988-10-27 | Ici Australia Limited | Water in oil emulsion explosives and stabilizers therefor |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
| US4844756A (en) * | 1985-12-06 | 1989-07-04 | The Lubrizol Corporation | Water-in-oil emulsions |
| IN171629B (fi) * | 1986-07-07 | 1992-11-28 | Aeci Ltd | |
| US4863534A (en) * | 1987-12-23 | 1989-09-05 | The Lubrizol Corporation | Explosive compositions using a combination of emulsifying salts |
| US5527491A (en) * | 1986-11-14 | 1996-06-18 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| US4828633A (en) * | 1987-12-23 | 1989-05-09 | The Lubrizol Corporation | Salt compositions for explosives |
| US5047175A (en) * | 1987-12-23 | 1991-09-10 | The Lubrizol Corporation | Salt composition and explosives using same |
| US4840687A (en) * | 1986-11-14 | 1989-06-20 | The Lubrizol Corporation | Explosive compositions |
| AU605625B2 (en) * | 1987-09-23 | 1991-01-17 | Ici Australia Operations Proprietary Limited | Method for preparing explosive composition |
| NZ226043A (en) * | 1987-09-23 | 1991-05-28 | Ici Australia Operations | Explosive composition: ammonium nitrate prills |
| AU2607688A (en) * | 1987-09-30 | 1989-04-18 | Mining Services International Corporation | Methods and compositions related to emulsified gassing agents for sensitizing explosive compositions |
| US5129972A (en) * | 1987-12-23 | 1992-07-14 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| US4872929A (en) * | 1988-08-29 | 1989-10-10 | Atlas Powder Company | Composite explosive utilizing water-soluble fuels |
| US5159153A (en) * | 1990-06-07 | 1992-10-27 | Cranney Don H | Emulsion that is compatible with reactive sulfide/pyrite ores |
| IN179760B (fi) * | 1991-02-11 | 1997-11-29 | Tech Resources Pty Ltd | |
| US5920031A (en) * | 1992-03-17 | 1999-07-06 | The Lubrizol Corporation | Water-in-oil emulsions |
| CA2064609C (en) * | 1992-04-01 | 1996-10-29 | Sydney Oliver Smith | Explosive composition |
| US5920030A (en) * | 1996-05-02 | 1999-07-06 | Mining Services International | Methods of blasting using nitrogen-free explosives |
| US6451920B1 (en) | 1999-11-09 | 2002-09-17 | Chevron Chemical Company Llc | Process for making polyalkylene/maleic anhydride copolymer |
| JP4227526B2 (ja) * | 2002-02-11 | 2009-02-18 | ロディア・シミ | 単一油中水型エマルジョンの安定性又は液滴寸法の制御方法及び安定化された単一油中水型エマルジョン |
| FR2918661B1 (fr) * | 2007-07-13 | 2012-02-03 | Snpe Materiaux Energetiques | Composes solides generateurs d'hydrogene et procede de generation d'hydrogene |
| CN115160092B (zh) * | 2022-07-29 | 2024-01-26 | 合肥综合性国家科学中心能源研究院(安徽省能源实验室) | 含硼镁混合粉的金属化乳化炸药及制备方法 |
| CN117024232B (zh) * | 2023-08-31 | 2024-10-18 | 湖南雷鸣西部民爆有限公司 | 一种高稳定性乳化炸药及其制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4181546A (en) * | 1977-09-19 | 1980-01-01 | Clay Robert B | Water resistant blasting agent and method of use |
| US4111727A (en) * | 1977-09-19 | 1978-09-05 | Clay Robert B | Water-in-oil blasting composition |
| US4294633A (en) * | 1979-06-07 | 1981-10-13 | Clay Robert B | Blasting composition |
-
1983
- 1983-05-24 NZ NZ204344A patent/NZ204344A/en unknown
- 1983-05-25 US US06/498,173 patent/US4448619A/en not_active Expired - Fee Related
- 1983-05-30 ZW ZW121/83A patent/ZW12183A1/xx unknown
- 1983-06-01 ZA ZA833964A patent/ZA833964B/xx unknown
- 1983-06-03 PH PH29013A patent/PH19691A/en unknown
- 1983-06-06 FI FI832026A patent/FI76065C/fi not_active IP Right Cessation
- 1983-06-09 DE DE8383303340T patent/DE3368044D1/de not_active Expired
- 1983-06-09 GB GB08315830A patent/GB2122983B/en not_active Expired
- 1983-06-09 CA CA000430011A patent/CA1193102A/en not_active Expired
- 1983-06-09 AT AT83303340T patent/ATE23985T1/de not_active IP Right Cessation
- 1983-06-10 MW MW24/83A patent/MW2483A1/xx unknown
- 1983-06-10 ZM ZM44/83A patent/ZM4483A1/xx unknown
- 1983-06-10 NO NO832125A patent/NO159377B/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI76065B (fi) | 1988-05-31 |
| US4448619A (en) | 1984-05-15 |
| DE3368044D1 (en) | 1987-01-15 |
| ATE23985T1 (de) | 1986-12-15 |
| NO832125L (no) | 1983-12-12 |
| PH19691A (en) | 1986-06-13 |
| FI76065C (fi) | 1988-09-09 |
| ZM4483A1 (en) | 1985-04-22 |
| NZ204344A (en) | 1985-12-13 |
| FI832026L (fi) | 1983-12-12 |
| MW2483A1 (en) | 1985-02-13 |
| ZA833964B (en) | 1984-01-25 |
| ZW12183A1 (en) | 1985-04-17 |
| CA1193102A (en) | 1985-09-10 |
| GB2122983A (en) | 1984-01-25 |
| GB2122983B (en) | 1985-11-13 |
| FI832026A0 (fi) | 1983-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO159377B (no) | Sprengstoffblanding av emulsjonstypen. | |
| EP0161821B1 (en) | Gas bubble-sensitized water-in-oil emulsion explosive compositions | |
| US4818309A (en) | Primer composition | |
| EP0004160A1 (en) | Explosive compositions and method for their manufacture | |
| CA1188898A (en) | Water-in-wax emulsion blasting agents | |
| CA2049628C (en) | Vegetable oil emulsion explosive | |
| US5074939A (en) | Explosive composition | |
| NO148552B (no) | Fenghettefoelsomt vann-i-olje-emulsjonssprengstoff | |
| NO127704B (fi) | ||
| GB2096590A (en) | Water-in-oil emulsion blasting agent | |
| AU639562B2 (en) | Emulsion that is compatible with reactive sulfide/pyrite ores | |
| US4936932A (en) | Aromatic hydrocarbon-based emulsion explosive composition | |
| US5000802A (en) | Water-in-oil type emulsion explosive | |
| US4547232A (en) | Sensitization of water-in-oil emulsion explosives | |
| EP0097030B1 (en) | A water-in-oil emulsion explosive composition and a process for the preparation thereof | |
| EP0372739A2 (en) | Nitroalkane - based emulsion explosive composition | |
| NO890869L (no) | Sprengstoffblanding, samt fremgangsmaate for dens fremstilling. | |
| US5507889A (en) | Precompression resistant emulsion explosive | |
| AU615597B2 (en) | Emulsion explosive | |
| NO882865L (no) | Fremgangsmaate for fremstilling av et emulsjon-sprengstoff. | |
| NO174501B (no) | Stoetmotstandsdyktig emulsjonssprengstoff med lav densitet | |
| AU618156B2 (en) | Emulsion explosive | |
| AU605625B2 (en) | Method for preparing explosive composition | |
| MXPA96001070A (en) | Explosive in resistant emulsion to laprecompres | |
| NO852178L (no) | Blandinger. |