NO151785B - Lavbrisans energioverfoeringsanordning for sprengstoff - Google Patents
Lavbrisans energioverfoeringsanordning for sprengstoff Download PDFInfo
- Publication number
- NO151785B NO151785B NO802127A NO802127A NO151785B NO 151785 B NO151785 B NO 151785B NO 802127 A NO802127 A NO 802127A NO 802127 A NO802127 A NO 802127A NO 151785 B NO151785 B NO 151785B
- Authority
- NO
- Norway
- Prior art keywords
- self
- oxidizing material
- tube
- elongated tube
- explosive
- Prior art date
Links
- 230000005540 biological transmission Effects 0.000 title description 2
- 238000004880 explosion Methods 0.000 title description 2
- 239000000463 material Substances 0.000 claims description 59
- 239000002360 explosive Substances 0.000 claims description 34
- 238000005474 detonation Methods 0.000 claims description 23
- 230000000977 initiatory effect Effects 0.000 claims description 12
- 229920002678 cellulose Polymers 0.000 claims description 5
- 239000001913 cellulose Substances 0.000 claims description 5
- 239000003999 initiator Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 description 8
- 239000003721 gunpowder Substances 0.000 description 5
- 230000006378 damage Effects 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 238000005422 blasting Methods 0.000 description 3
- -1 polyethylene Polymers 0.000 description 3
- 239000000028 HMX Substances 0.000 description 2
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 238000005065 mining Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- UZGLIIJVICEWHF-UHFFFAOYSA-N octogen Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1 UZGLIIJVICEWHF-UHFFFAOYSA-N 0.000 description 2
- 239000002861 polymer material Substances 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229920005570 flexible polymer Polymers 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229920000554 ionomer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 238000009527 percussion Methods 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C5/00—Fuses, e.g. fuse cords
- C06C5/04—Detonating fuses
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Drilling And Exploitation, And Mining Machines And Methods (AREA)
- Air Bags (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Waste-Gas Treatment And Other Accessory Devices For Furnaces (AREA)
- Perforating, Stamping-Out Or Severing By Means Other Than Cutting (AREA)
- Communication Cables (AREA)
- Non-Insulated Conductors (AREA)
- Ropes Or Cables (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/057,898 US4290366A (en) | 1979-07-16 | 1979-07-16 | Energy transmission device |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO802127L NO802127L (no) | 1981-01-19 |
| NO151785B true NO151785B (no) | 1985-02-25 |
Family
ID=22013420
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO802127A NO151785B (no) | 1979-07-16 | 1980-07-15 | Lavbrisans energioverfoeringsanordning for sprengstoff |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4290366A (OSRAM) |
| JP (1) | JPS5637290A (OSRAM) |
| AT (1) | AT372069B (OSRAM) |
| AU (1) | AU537877B2 (OSRAM) |
| BR (1) | BR8004348A (OSRAM) |
| CA (1) | CA1146807A (OSRAM) |
| DE (1) | DE3025703A1 (OSRAM) |
| GB (1) | GB2054108B (OSRAM) |
| IN (1) | IN154239B (OSRAM) |
| MX (1) | MX148199A (OSRAM) |
| NO (1) | NO151785B (OSRAM) |
| SE (1) | SE8005077L (OSRAM) |
| ZA (1) | ZA803991B (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR8400206A (pt) * | 1984-01-13 | 1984-09-11 | Britanite Ind Quimicas Ltd | Unidade condutora de onda de percussao ou impacto |
| US4756250A (en) * | 1985-01-14 | 1988-07-12 | Britanite Industrias Quimicas Ltda. | Non-electric and non-explosive time delay fuse |
| US4757764A (en) * | 1985-12-20 | 1988-07-19 | The Ensign-Bickford Company | Nonelectric blasting initiation signal control system, method and transmission device therefor |
| US4817673A (en) * | 1986-05-08 | 1989-04-04 | Atlas Powder Company | Fuse tube with reinforcing element |
| GB8802329D0 (en) * | 1988-02-03 | 1988-03-02 | Ici Plc | Low energy fuse & method of manufacture |
| US5317974A (en) * | 1988-02-03 | 1994-06-07 | Imperial Chemical Industries Plc | Low energy fuse and method and manufacture |
| US4917017A (en) * | 1988-05-27 | 1990-04-17 | Atlas Powder Company | Multi-strand ignition systems |
| GB8905747D0 (en) * | 1989-03-13 | 1989-04-26 | Secr Defence | Pyrotechnic material |
| GB9017715D0 (en) * | 1990-08-13 | 1990-09-26 | Ici Plc | Low energy fuse |
| GB9119217D0 (en) * | 1991-09-09 | 1991-10-23 | Ici Plc | Low energy fuse |
| SE500323C2 (sv) * | 1992-11-17 | 1994-06-06 | Dyno Industrier As | Lågenergistubin och sätt för dess framställning |
| US5333550A (en) * | 1993-07-06 | 1994-08-02 | Teledyne Mccormick Selph | Tin alloy sheath material for explosive-pyrotechnic linear products |
| US5501154A (en) * | 1993-07-06 | 1996-03-26 | Teledyne Industries, Inc. | Substantially lead-free tin alloy sheath material for explosive-pyrotechnic linear products |
| US5597973A (en) * | 1995-01-30 | 1997-01-28 | The Ensign-Bickford Company | Signal transmission fuse |
| US5939661A (en) * | 1997-01-06 | 1999-08-17 | The Ensign-Bickford Company | Method of manufacturing an explosive carrier material, and articles containing the same |
| US6170398B1 (en) * | 1997-08-29 | 2001-01-09 | The Ensign-Bickford Company | Signal transmission fuse |
| US6513437B2 (en) | 2000-04-28 | 2003-02-04 | Orica Explosives Technology Pty Ltd. | Blast initiation device |
| US6601516B2 (en) | 2001-03-30 | 2003-08-05 | Goodrich Corporation | Low energy fuse |
| WO2002097359A2 (en) * | 2001-05-31 | 2002-12-05 | Universal Propulsion Company, Inc. | Linear ignition fuze with shaped sheath |
| US20040055495A1 (en) * | 2002-04-23 | 2004-03-25 | Hannagan Harold W. | Tin alloy sheathed explosive device |
| CA2523641A1 (en) * | 2003-04-30 | 2005-01-20 | Dyno Nobel Inc. | Energetic linear timing element |
| AU2004237159A1 (en) * | 2003-04-30 | 2004-11-18 | Dyno Nobel Inc. | Tubular signal transmission device and method of manufacture |
| DE102006007483B4 (de) * | 2006-02-17 | 2010-02-11 | Atc Establishment | Zündschlauch |
| US7434515B2 (en) * | 2006-06-14 | 2008-10-14 | Detotec North America, Inc. | Signal transmission fuse |
| DE202017102257U1 (de) | 2017-04-13 | 2017-06-20 | Fr. Sobbe Gmbh | Zündvorrichtung in Kompaktausführung |
| EP3903017B1 (en) * | 2019-03-12 | 2023-03-22 | Nikola Corporation | Pressurized vessel heat shield and thermal pressure relief system |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE90126C (OSRAM) * | ||||
| DE88117C (OSRAM) * | ||||
| DE1853C (de) * | W. H. EALES in Dresden | Zündschnur | ||
| US2774306A (en) * | 1951-11-06 | 1956-12-18 | Norman A Macleod | Means for initiating explosion |
| GB849133A (en) * | 1957-07-26 | 1960-09-21 | Ensign Bickford Co | Ignition transmission cord and assemblies including the same and methods for their use |
| US3320883A (en) * | 1965-09-03 | 1967-05-23 | Canadian Safety Fuse Company L | Explosive tape |
| SE374198B (OSRAM) * | 1972-03-03 | 1975-02-24 | Foerenade Fabriksverken | |
| US3867884A (en) * | 1973-02-19 | 1975-02-25 | Ici Ltd | Explosive fuse-cord |
| US3908509A (en) * | 1973-10-29 | 1975-09-30 | Eb Ind Inc | Fuse and its method of manufacture |
| US3968724A (en) * | 1974-10-03 | 1976-07-13 | The United States Of America As Represented By The Secretary Of The Army | Method for accurately varying the density of a powder or powder charge, and shrink tubes for use therewith |
| US4024817A (en) * | 1975-06-02 | 1977-05-24 | Austin Powder Company | Elongated flexible detonating device |
| GB1586496A (en) * | 1977-06-01 | 1981-03-18 | Cxa Ltd | Explosives initiation assembly and system |
-
1979
- 1979-07-16 US US06/057,898 patent/US4290366A/en not_active Ceased
-
1980
- 1980-07-01 GB GB8021525A patent/GB2054108B/en not_active Expired
- 1980-07-02 IN IN493/DEL/80A patent/IN154239B/en unknown
- 1980-07-02 ZA ZA00803991A patent/ZA803991B/xx unknown
- 1980-07-07 DE DE19803025703 patent/DE3025703A1/de active Granted
- 1980-07-07 CA CA000355608A patent/CA1146807A/en not_active Expired
- 1980-07-10 SE SE8005077A patent/SE8005077L/ unknown
- 1980-07-14 BR BR8004348A patent/BR8004348A/pt not_active IP Right Cessation
- 1980-07-15 AU AU60409/80A patent/AU537877B2/en not_active Ceased
- 1980-07-15 AT AT0367880A patent/AT372069B/de not_active IP Right Cessation
- 1980-07-15 NO NO802127A patent/NO151785B/no unknown
- 1980-07-16 JP JP9632080A patent/JPS5637290A/ja active Granted
- 1980-07-16 MX MX183183A patent/MX148199A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU6040980A (en) | 1982-01-21 |
| SE8005077L (sv) | 1981-01-17 |
| GB2054108A (en) | 1981-02-11 |
| GB2054108B (en) | 1983-09-14 |
| IN154239B (OSRAM) | 1984-10-06 |
| AU537877B2 (en) | 1984-07-19 |
| US4290366A (en) | 1981-09-22 |
| DE3025703C2 (OSRAM) | 1989-06-15 |
| NO802127L (no) | 1981-01-19 |
| CA1146807A (en) | 1983-05-24 |
| AT372069B (de) | 1983-08-25 |
| MX148199A (es) | 1983-03-24 |
| ZA803991B (en) | 1982-02-24 |
| DE3025703A1 (de) | 1981-02-19 |
| BR8004348A (pt) | 1981-01-27 |
| JPH0251874B2 (OSRAM) | 1990-11-08 |
| JPS5637290A (en) | 1981-04-10 |
| ATA367880A (de) | 1983-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO151785B (no) | Lavbrisans energioverfoeringsanordning for sprengstoff | |
| US3590739A (en) | Fuse | |
| US2923239A (en) | Ignition transmission line and systems including the same | |
| US4335652A (en) | Non-electric delay detonator | |
| US4314508A (en) | Device with incendiary fusecord ignited by detonation | |
| KR860002143B1 (ko) | 비전기식 폭발물 조립체 | |
| NO134110B (OSRAM) | ||
| CN101978238A (zh) | 装有火药的岩石爆破筒 | |
| US5012741A (en) | Initiator for a transmission tube | |
| NO144807B (no) | Ikke-elektrisk fenghette. | |
| US2891476A (en) | Delay blasting devices | |
| CN203259076U (zh) | 一种简易的导爆管击发计及起爆系统 | |
| CA1094390A (en) | Explosives initiation assembly and system | |
| US5710390A (en) | Shock tube initiating system for display fireworks | |
| US5665932A (en) | Initiation of blasting | |
| GB708422A (en) | Improvements in or relating to delay blasting devices | |
| USRE33202E (en) | Energy transmission device | |
| US2618221A (en) | Delay blasting device | |
| CN101629795A (zh) | 点火升压器装置的起爆 | |
| EP0015697A1 (en) | Non-electric delay detonator and assembly of a detonating cord and a delay detonator | |
| US3792660A (en) | Flexible pyrotechnic relay | |
| CN100578136C (zh) | 导爆管式无起爆药雷管及其非电引爆系统 | |
| US3207073A (en) | Explosive cord and assembly | |
| NO117322B (OSRAM) | ||
| US3640222A (en) | Booster-cap assembly |