NO136091B - - Google Patents
Download PDFInfo
- Publication number
- NO136091B NO136091B NO2911/73A NO291173A NO136091B NO 136091 B NO136091 B NO 136091B NO 2911/73 A NO2911/73 A NO 2911/73A NO 291173 A NO291173 A NO 291173A NO 136091 B NO136091 B NO 136091B
- Authority
- NO
- Norway
- Prior art keywords
- oxide
- azide
- mixture
- gas
- silicon
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims abstract description 50
- 150000001540 azides Chemical class 0.000 claims abstract description 16
- 229910052751 metal Inorganic materials 0.000 claims abstract description 13
- 239000002184 metal Substances 0.000 claims abstract description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 30
- 239000007789 gas Substances 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 15
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 230000001590 oxidative effect Effects 0.000 claims description 12
- 229910052710 silicon Inorganic materials 0.000 claims description 12
- 239000010703 silicon Substances 0.000 claims description 12
- -1 alkali metal azide Chemical class 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- 239000000377 silicon dioxide Substances 0.000 claims description 7
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 239000004411 aluminium Substances 0.000 claims description 5
- 239000011135 tin Substances 0.000 claims description 5
- 229910052718 tin Inorganic materials 0.000 claims description 5
- 239000010936 titanium Substances 0.000 claims description 5
- 229910052719 titanium Inorganic materials 0.000 claims description 5
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 4
- 229910001873 dinitrogen Inorganic materials 0.000 claims description 4
- 239000002245 particle Substances 0.000 claims description 4
- 229910000077 silane Inorganic materials 0.000 claims description 4
- 235000012239 silicon dioxide Nutrition 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 239000010419 fine particle Substances 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 3
- 229910001887 tin oxide Inorganic materials 0.000 claims description 3
- 239000011787 zinc oxide Substances 0.000 claims description 3
- 239000005871 repellent Substances 0.000 claims description 2
- 239000004408 titanium dioxide Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical group [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 18
- 239000000463 material Substances 0.000 description 12
- 238000002485 combustion reaction Methods 0.000 description 11
- 229910052814 silicon oxide Inorganic materials 0.000 description 11
- 239000004615 ingredient Substances 0.000 description 10
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 7
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 7
- 239000000446 fuel Substances 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910001388 sodium aluminate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- UUXFWHMUNNXFHD-UHFFFAOYSA-N barium azide Chemical compound [Ba+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UUXFWHMUNNXFHD-UHFFFAOYSA-N 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 238000005474 detonation Methods 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- IIPYXGDZVMZOAP-UHFFFAOYSA-N lithium nitrate Chemical compound [Li+].[O-][N+]([O-])=O IIPYXGDZVMZOAP-UHFFFAOYSA-N 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000009972 noncorrosive effect Effects 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 description 1
- WHQOKFZWSDOTQP-UHFFFAOYSA-N 2,3-dihydroxypropyl 4-aminobenzoate Chemical compound NC1=CC=C(C(=O)OCC(O)CO)C=C1 WHQOKFZWSDOTQP-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 239000004343 Calcium peroxide Substances 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- MPCRDALPQLDDFX-UHFFFAOYSA-L Magnesium perchlorate Chemical compound [Mg+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O MPCRDALPQLDDFX-UHFFFAOYSA-L 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- OOULUYZFLXDWDQ-UHFFFAOYSA-L barium perchlorate Chemical compound [Ba+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O OOULUYZFLXDWDQ-UHFFFAOYSA-L 0.000 description 1
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 description 1
- LHJQIRIGXXHNLA-UHFFFAOYSA-N calcium peroxide Chemical compound [Ca+2].[O-][O-] LHJQIRIGXXHNLA-UHFFFAOYSA-N 0.000 description 1
- 235000019402 calcium peroxide Nutrition 0.000 description 1
- AYTVLULEEPNWAX-UHFFFAOYSA-N cesium;azide Chemical compound [Cs+].[N-]=[N+]=[N-] AYTVLULEEPNWAX-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- BSUSEPIPTZNHMN-UHFFFAOYSA-L cobalt(2+);diperchlorate Chemical compound [Co+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O BSUSEPIPTZNHMN-UHFFFAOYSA-L 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- RXPAJWPEYBDXOG-UHFFFAOYSA-N hydron;methyl 4-methoxypyridine-2-carboxylate;chloride Chemical compound Cl.COC(=O)C1=CC(OC)=CC=N1 RXPAJWPEYBDXOG-UHFFFAOYSA-N 0.000 description 1
- 229910001484 inorganic perchlorate Inorganic materials 0.000 description 1
- LHOWRPZTCLUDOI-UHFFFAOYSA-K iron(3+);triperchlorate Chemical compound [Fe+3].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O LHOWRPZTCLUDOI-UHFFFAOYSA-K 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 1
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 1
- TWRAJPCQPHBABR-UHFFFAOYSA-N magnesium;diazide Chemical compound [Mg+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] TWRAJPCQPHBABR-UHFFFAOYSA-N 0.000 description 1
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910001960 metal nitrate Inorganic materials 0.000 description 1
- 150000004972 metal peroxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- XMMDVXFQGOEOKH-UHFFFAOYSA-N n'-dodecylpropane-1,3-diamine Chemical compound CCCCCCCCCCCCNCCCN XMMDVXFQGOEOKH-UHFFFAOYSA-N 0.000 description 1
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 1
- FYWSTUCDSVYLPV-UHFFFAOYSA-N nitrooxythallium Chemical compound [Tl+].[O-][N+]([O-])=O FYWSTUCDSVYLPV-UHFFFAOYSA-N 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 229910001489 rubidium perchlorate Inorganic materials 0.000 description 1
- GEWQYWRSUXOTOL-UHFFFAOYSA-N rubidium(1+);azide Chemical compound [Rb+].[N-]=[N+]=[N-] GEWQYWRSUXOTOL-UHFFFAOYSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- UHCGLDSRFKGERO-UHFFFAOYSA-N strontium peroxide Chemical compound [Sr+2].[O-][O-] UHCGLDSRFKGERO-UHFFFAOYSA-N 0.000 description 1
- PDEROVFZLWBVSG-UHFFFAOYSA-N strontium;diazide Chemical compound [Sr+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] PDEROVFZLWBVSG-UHFFFAOYSA-N 0.000 description 1
- MXRFIUHRIOLIIV-UHFFFAOYSA-L strontium;diperchlorate Chemical compound [Sr+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O MXRFIUHRIOLIIV-UHFFFAOYSA-L 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- YQMWDQQWGKVOSQ-UHFFFAOYSA-N trinitrooxystannyl nitrate Chemical compound [Sn+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O YQMWDQQWGKVOSQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B23/00—Compositions characterised by non-explosive or non-thermic constituents
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B35/00—Compositions containing a metal azide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Air Bags (AREA)
- Emergency Lowering Means (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
- Investigating Or Analyzing Materials By The Use Of Fluid Adsorption Or Reactions (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB3448172A GB1391310A (en) | 1972-07-24 | 1972-07-24 | Gas generating compositions |
Publications (2)
Publication Number | Publication Date |
---|---|
NO136091B true NO136091B (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1977-04-12 |
NO136091C NO136091C (no) | 1977-07-20 |
Family
ID=10366188
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO2911/73A NO136091C (no) | 1972-07-24 | 1973-07-17 | Gassproduserende metallazidholdig blanding. |
Country Status (10)
Families Citing this family (50)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS5040487A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) * | 1973-08-14 | 1975-04-14 | ||
GB1443547A (en) * | 1973-12-17 | 1976-07-21 | Canadian Ind | Metal oxide/azide gas generating compositions |
FR2288721A1 (fr) * | 1974-10-25 | 1976-05-21 | Thiokol Corp | Composition pouvant engendrer des gaz non toxiques, non corrosifs et inodores, et son obtention |
GB1520497A (en) * | 1975-04-23 | 1978-08-09 | Daicel Ltd | Gas-generating agent for air bag |
JPS52121291A (en) * | 1976-04-01 | 1977-10-12 | Nippon Oil & Fats Co Ltd | Automatically inflated rescue buoyant apparatus |
US4214438A (en) * | 1978-02-03 | 1980-07-29 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable device |
US4244758A (en) * | 1978-05-15 | 1981-01-13 | Allied Chemical Corporation | Ignition enhancer coating compositions for azide propellant |
US4386979A (en) * | 1979-07-19 | 1983-06-07 | Jackson Jr Charles H | Gas generating compositions |
US4533416A (en) * | 1979-11-07 | 1985-08-06 | Rockcor, Inc. | Pelletizable propellant |
DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
US4547235A (en) * | 1984-06-14 | 1985-10-15 | Morton Thiokol, Inc. | Gas generant for air bag inflators |
US4604151A (en) * | 1985-01-30 | 1986-08-05 | Talley Defense Systems, Inc. | Method and compositions for generating nitrogen gas |
EP0198665B1 (en) * | 1985-04-16 | 1989-06-28 | Kidde-Graviner Limited | Cooling apparatus |
US4698107A (en) * | 1986-12-24 | 1987-10-06 | Trw Automotive Products, Inc. | Gas generating material |
JPH0737357B2 (ja) * | 1987-03-10 | 1995-04-26 | 日本工機株式会社 | ガス発生剤組成物 |
US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
SE8703743L (sv) * | 1987-09-29 | 1989-03-30 | Bofors Ab | Pyroteknisk foerdroejningssats |
US4806180A (en) * | 1987-12-10 | 1989-02-21 | Trw Vehicle Safety Systems Inc. | Gas generating material |
US4920743A (en) * | 1988-07-25 | 1990-05-01 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
US5034070A (en) * | 1990-06-28 | 1991-07-23 | Trw Vehicle Safety Systems Inc. | Gas generating material |
US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
US5178696A (en) * | 1990-09-03 | 1993-01-12 | Nippon Kayaku Kabushiki Kaisha | Gas generating composition for automobile air bag |
US5035757A (en) * | 1990-10-25 | 1991-07-30 | Automotive Systems Laboratory, Inc. | Azide-free gas generant composition with easily filterable combustion products |
EP0579781A4 (en) * | 1991-04-11 | 1994-12-07 | Talley Defence Systems Inc | AZIDAL PROPELLER COMPOSITIONS FOR EMERGENCY DEBALLASTING OF SUBMERSIBLE VESSELS. |
US5104466A (en) * | 1991-04-16 | 1992-04-14 | Morton International, Inc. | Nitrogen gas generator |
US5143567A (en) * | 1991-08-23 | 1992-09-01 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
US5387296A (en) * | 1991-08-23 | 1995-02-07 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
JPH0648880A (ja) * | 1992-06-05 | 1994-02-22 | Trw Inc | ガス発生器用の多層型ガス発生ディスク |
EP0584899A3 (en) * | 1992-08-05 | 1995-08-02 | Morton Int Inc | Approach by incorporating additives into azide-based gas-generating compositions to adjust the melting point of slag and the rate of combustion. |
US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
US5376352A (en) * | 1993-10-05 | 1994-12-27 | The Penn State Research Foundation | Oxygen storage and retrieval system |
US20050067074A1 (en) * | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
ES2393665T3 (es) * | 1994-01-19 | 2012-12-27 | Alliant Techsystems Inc. | Complejos de metales como generadores de gas |
US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
US5557062A (en) * | 1994-12-13 | 1996-09-17 | United Technologies Corporation | Breathable gas generators |
US5780768A (en) * | 1995-03-10 | 1998-07-14 | Talley Defense Systems, Inc. | Gas generating compositions |
US6860951B2 (en) * | 1995-03-10 | 2005-03-01 | Talley Defense Systems, Inc. | Gas generating compositions |
US6235132B1 (en) | 1995-03-10 | 2001-05-22 | Talley Defense Systems, Inc. | Gas generating compositions |
AU4898296A (en) * | 1995-03-14 | 1996-10-08 | Thiokol Corporation | Infrared tracer compositions |
DE749946T1 (de) * | 1995-06-22 | 1997-09-04 | Nippon Koki Kk | Gaserzeugende Zusammensetzung |
US5959242A (en) * | 1996-05-14 | 1999-09-28 | Talley Defense Systems, Inc. | Autoignition composition |
US6878221B1 (en) * | 2003-01-30 | 2005-04-12 | Olin Corporation | Lead-free nontoxic explosive mix |
US20220371970A1 (en) * | 2021-05-21 | 2022-11-24 | Lawrence Livermore National Security, Llc | Dial-a-drive explosive formulations |
WO2024206755A2 (en) * | 2023-03-31 | 2024-10-03 | Joyson Safety Systems Acquisition Llc | Gas generating compositions |
Family Cites Families (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2981616A (en) * | 1956-10-01 | 1961-04-25 | North American Aviation Inc | Gas generator grain |
US3122462A (en) * | 1961-11-24 | 1964-02-25 | Martin H Kaufman | Novel pyrotechnics |
US3797854A (en) * | 1971-06-14 | 1974-03-19 | Rocket Research Corp | Crash restraint air generating inflation system |
US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
-
1972
- 1972-07-24 GB GB3448172A patent/GB1391310A/en not_active Expired
-
1973
- 1973-06-28 CA CA175,211A patent/CA997933A/en not_active Expired
- 1973-07-02 US US375654A patent/US3883373A/en not_active Expired - Lifetime
- 1973-07-17 NO NO2911/73A patent/NO136091C/no unknown
- 1973-07-18 BE BE133624A patent/BE802514A/xx unknown
- 1973-07-20 NL NL7310133A patent/NL7310133A/xx not_active Application Discontinuation
- 1973-07-23 FR FR7326881A patent/FR2193801B1/fr not_active Expired
- 1973-07-23 IT IT26931/73A patent/IT995049B/it active
- 1973-07-23 SE SE7310254A patent/SE409451B/xx unknown
- 1973-07-24 JP JP8281173A patent/JPS532156B2/ja not_active Expired
Also Published As
Publication number | Publication date |
---|---|
JPS49131977A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1974-12-18 |
BE802514A (fr) | 1974-01-18 |
FR2193801A1 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1974-02-22 |
NO136091C (no) | 1977-07-20 |
JPS532156B2 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1978-01-25 |
US3883373A (en) | 1975-05-13 |
DE2336853A1 (de) | 1974-02-21 |
GB1391310A (en) | 1975-04-23 |
NL7310133A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1974-01-28 |
SE409451B (sv) | 1979-08-20 |
DE2336853B2 (de) | 1976-08-12 |
CA997933A (en) | 1976-10-05 |
FR2193801B1 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1977-05-13 |
IT995049B (it) | 1975-11-10 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO136091B (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | ||
AU639657B2 (en) | Composition and process for inflating a safety crash bag | |
US5089069A (en) | Gas generating composition for air bags | |
JP3419773B2 (ja) | 化学的酸素発生器 | |
AU625577B2 (en) | Process for inflating a safety crash bag | |
CA2052966C (en) | Azide-free gas generant composition with easily filterable combustion products | |
US4370181A (en) | Pyrotechnic non-azide gas generants based on a non-hydrogen containing tetrazole compound | |
CA1146756A (en) | Multi-ingredient gas generants | |
CA2063374C (en) | Composition for controlling oxides of nitrogen | |
US4604151A (en) | Method and compositions for generating nitrogen gas | |
US3895098A (en) | Method and composition for generating nitrogen gas | |
US5673935A (en) | Metal complexes for use as gas generants | |
US5536339A (en) | Air bag inflator gas compositions and inflator containing the same | |
JPH0660079B2 (ja) | アジドガス発生組成物 | |
EA001261B1 (ru) | Способ тушения пожара, огнетушащий состав и система пожаротушения | |
GB1406002A (en) | Pyrotechnic compositions for gas generation | |
CA2254903A1 (en) | Autoignition composition | |
WO1995021805A1 (fr) | Composition gazogene, procede de fabrication de comprimes de ladite composition et procede de transport associe | |
US6007647A (en) | Autoignition compositions for inflator gas generators | |
AU775547B2 (en) | Gas generator and method for the generation of low-temperature gas | |
US4490274A (en) | Oxygen-generating chemical composition | |
USRE32584E (en) | Method and composition for generating nitrogen gas | |
WO1995018780A1 (en) | Non-azide gas generant compositions containing dicyanamide salts | |
EP0944562B1 (en) | Autoignition compositions for inflator gas generators | |
RU2056341C1 (ru) | Пиротехнический состав для получения кислорода |