NO131075B - - Google Patents
Download PDFInfo
- Publication number
- NO131075B NO131075B NO359573A NO359573A NO131075B NO 131075 B NO131075 B NO 131075B NO 359573 A NO359573 A NO 359573A NO 359573 A NO359573 A NO 359573A NO 131075 B NO131075 B NO 131075B
- Authority
- NO
- Norway
- Prior art keywords
- radical
- amino
- trimethoxyquinazoline
- compound
- atom
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 23
- -1 alkoxy radical Chemical class 0.000 claims description 13
- 150000003254 radicals Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- DRYRBWIFRVMRPV-UHFFFAOYSA-N quinazolin-4-amine Chemical class C1=CC=C2C(N)=NC=NC2=C1 DRYRBWIFRVMRPV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- BIICRHXSGPYQOV-UHFFFAOYSA-N 4-chloro-6,7,8-trimethoxyquinazoline Chemical compound N1=CN=C2C(OC)=C(OC)C(OC)=CC2=C1Cl BIICRHXSGPYQOV-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 241000282472 Canis lupus familiaris Species 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 208000001953 Hypotension Diseases 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000017531 blood circulation Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 208000021822 hypotensive Diseases 0.000 description 3
- 230000001077 hypotensive effect Effects 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- OBDYSGOCSNRPCY-UHFFFAOYSA-N 4,6,7,8-tetramethoxyquinazoline Chemical compound COC1=NC=NC2=C(C(=C(C=C12)OC)OC)OC OBDYSGOCSNRPCY-UHFFFAOYSA-N 0.000 description 2
- ORRMRZIJVLFOOZ-UHFFFAOYSA-N 6,7,8-trimethoxy-1h-quinazolin-4-one Chemical compound COC1=C(OC)C(OC)=CC2=C1NC=NC2=O ORRMRZIJVLFOOZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004004 anti-anginal agent Substances 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 229940124345 antianginal agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000036284 oxygen consumption Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FKJVYOFPTRGCSP-UHFFFAOYSA-N 2-[3-aminopropyl(2-hydroxyethyl)amino]ethanol Chemical compound NCCCN(CCO)CCO FKJVYOFPTRGCSP-UHFFFAOYSA-N 0.000 description 1
- AEXIWWWIKQCOEC-UHFFFAOYSA-N 3,4,5-trimethoxy-2-methyl-6-nitrobenzoic acid Chemical compound COC1=C(C)C(C(O)=O)=C([N+]([O-])=O)C(OC)=C1OC AEXIWWWIKQCOEC-UHFFFAOYSA-N 0.000 description 1
- OPSKOPGEUCGTFA-UHFFFAOYSA-N 3-[(6,7,8-trimethoxyquinazolin-4-yl)amino]propane-1,2-diol Chemical compound OC(CNC1=NC=NC2=C(C(=C(C=C12)OC)OC)OC)CO OPSKOPGEUCGTFA-UHFFFAOYSA-N 0.000 description 1
- FNPJDUCODAMBPS-UHFFFAOYSA-N 4-[(6,7,8-trimethoxyquinazolin-4-yl)amino]butan-1-ol Chemical compound N1=CN=C2C(OC)=C(OC)C(OC)=CC2=C1NCCCCO FNPJDUCODAMBPS-UHFFFAOYSA-N 0.000 description 1
- CZTMNUBTDJQTJY-UHFFFAOYSA-N 5-(2-amino-6,7,8-triethoxyquinazolin-4-yl)pentan-1-ol Chemical compound OCCCCCC1=NC(=NC2=C(C(=C(C=C12)OCC)OCC)OCC)N CZTMNUBTDJQTJY-UHFFFAOYSA-N 0.000 description 1
- SSDALMNYCZFGTO-UHFFFAOYSA-N 5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentan-1-ol Chemical compound N1=CN=C2C(OC)=C(OC)C(OC)=CC2=C1NCCCCCO SSDALMNYCZFGTO-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010047289 Ventricular extrasystoles Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO359573A NO131075C (th) | 1969-12-05 | 1973-09-14 |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US87043969A | 1969-12-05 | 1969-12-05 | |
| NO3285/70A NO130477C (th) | 1969-12-05 | 1970-08-28 | |
| NO359573A NO131075C (th) | 1969-12-05 | 1973-09-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131075B true NO131075B (th) | 1974-12-23 |
| NO131075C NO131075C (th) | 1975-04-02 |
Family
ID=27352634
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO359573A NO131075C (th) | 1969-12-05 | 1973-09-14 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO131075C (th) |
-
1973
- 1973-09-14 NO NO359573A patent/NO131075C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO131075C (th) | 1975-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66372B (fi) | Foerfarande foer framstaellning av farmakologiskt verkande i 5- eller 6-staellning med en pyridazinonring substituerade besimidazoler | |
| Chern et al. | Studies on quinazolines. 5. 2, 3-Dihydroimidazo [1, 2-c] quinazoline derivatives: a novel class of potent and selective. alpha. 1-adrenoceptor antagonists and antihypertensive agents | |
| US3254088A (en) | Morphine derivative | |
| FI78097C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara (2-oxo-1,2,3,5-tetrahydroimidazo/2,1-b/ kinazolinyl)oxialkylamider. | |
| US4696931A (en) | Imidazole derivatives and pharmaceutical compositions containing them | |
| US4735956A (en) | Certain 1,4-dihydro-2,6-di-lower hydrocarbyl-4-heterocyclic-3,5-pyridine dicarboxylates which are useful as calcium channel blockers | |
| US4761416A (en) | N-N-disubstituted-ω-[2-amino-3-(carbonylmethyl)-3, 4-dihydroquinazolinyl]oxyalkylamides and related compounds | |
| US4783530A (en) | 8-arylxanthines | |
| JPS62167752A (ja) | フエニルアセトニトリル誘導体その医薬組成物および哺乳動物におけるカルシウムイオンきつ抗作用または抗高圧作用促進方法 | |
| US4610987A (en) | Imidazoquinazolin-2-one compounds | |
| NO813066L (no) | Isokinolinderivater, fremgangsmaate til deres fremstilling, farmasoeytiske tilberedninger, innhold og deres anvendelse | |
| US3944549A (en) | Amino derivatives of 1,4-benzodioxan | |
| US4960773A (en) | Xanthine derivatives | |
| CS202011B2 (en) | Process for preparing new pyridylaminoalkylethers | |
| Hermecz et al. | Nitrogen bridgehead compounds. 66. Bronchodilator nitrogen bridgehead compounds with a pyrimidinone moiety | |
| FI57758B (fi) | Foerfarande foer framstaellning av terapeutiskt verksamt racematiskt eller optiskt aktivt 2-(furylmetyl)-2'-hydroxi-alfa-5,9-dialkyl-6,7-benzomorfan och dess syraadditionssalter | |
| PL100079B1 (pl) | Sposob wytwarzania nowych pirydobenzodwuazepinonow | |
| NO143459B (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive 2-fenylimino-imidazolidin-derivater | |
| NO161220B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktivt 7-piperidin-1,2,3,5-tetrahydroimidazo-(2,1-b)-kinazolin-2-on. | |
| NO131075B (th) | ||
| NO174548B (no) | Analogifremangsmaate for fremstilling av terapeutisk aktive benzo - og tieno- 3,4-dihydro- pyridinderivater | |
| US4176184A (en) | Imidazoisoquinoline-diones and salts thereof | |
| US3542787A (en) | 10,11-dihydro-5,10-(iminomethano)-5h-dibenzo(a,d)cyclohepten-13-imine | |
| NO159273B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive benzotriazol-derivater. | |
| CN116768798A (zh) | 一种甲磺酸酚妥拉明的制备方法 |