NO131006B - - Google Patents
Download PDFInfo
- Publication number
- NO131006B NO131006B NO02827/73A NO282773A NO131006B NO 131006 B NO131006 B NO 131006B NO 02827/73 A NO02827/73 A NO 02827/73A NO 282773 A NO282773 A NO 282773A NO 131006 B NO131006 B NO 131006B
- Authority
- NO
- Norway
- Prior art keywords
- metal
- fatty acid
- lubricating grease
- grease according
- soap
- Prior art date
Links
- 239000004519 grease Substances 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 20
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 19
- 229930195729 fatty acid Natural products 0.000 claims description 19
- 239000000194 fatty acid Substances 0.000 claims description 19
- 230000001050 lubricating effect Effects 0.000 claims description 19
- 239000000344 soap Substances 0.000 claims description 19
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- 239000002562 thickening agent Substances 0.000 claims description 15
- 150000004665 fatty acids Chemical class 0.000 claims description 11
- -1 hydroxy fatty acid Chemical class 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 239000004359 castor oil Substances 0.000 claims description 8
- 235000019438 castor oil Nutrition 0.000 claims description 8
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 claims description 8
- ULQISTXYYBZJSJ-UHFFFAOYSA-N 12-hydroxyoctadecanoic acid Chemical compound CCCCCCC(O)CCCCCCCCCCC(O)=O ULQISTXYYBZJSJ-UHFFFAOYSA-N 0.000 claims description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 239000010687 lubricating oil Substances 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- 239000004411 aluminium Substances 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- 239000010688 mineral lubricating oil Substances 0.000 claims description 4
- 229940114072 12-hydroxystearic acid Drugs 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 150000001721 carbon Chemical class 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 claims description 2
- 150000004692 metal hydroxides Chemical class 0.000 claims description 2
- 239000003921 oil Substances 0.000 description 11
- 239000003925 fat Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229940114069 12-hydroxystearate Drugs 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 2
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 2
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 2
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 240000005020 Acaciella glauca Species 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- FPLIHVCWSXLMPX-UHFFFAOYSA-M lithium 12-hydroxystearate Chemical compound [Li+].CCCCCCC(O)CCCCCCCCCCC([O-])=O FPLIHVCWSXLMPX-UHFFFAOYSA-M 0.000 description 1
- LPRVNTWNHMSTPR-UHFFFAOYSA-M lithium;2-hydroxyoctadecanoate Chemical compound [Li+].CCCCCCCCCCCCCCCCC(O)C([O-])=O LPRVNTWNHMSTPR-UHFFFAOYSA-M 0.000 description 1
- AZVCGYPLLBEUNV-UHFFFAOYSA-N lithium;ethanolate Chemical compound [Li+].CC[O-] AZVCGYPLLBEUNV-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 235000003499 redwood Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C02—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F1/00—Treatment of water, waste water, or sewage
- C02F1/48—Treatment of water, waste water, or sewage with magnetic or electric fields
- C02F1/481—Treatment of water, waste water, or sewage with magnetic or electric fields using permanent magnets
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Hydrology & Water Resources (AREA)
- Engineering & Computer Science (AREA)
- Environmental & Geological Engineering (AREA)
- Water Supply & Treatment (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Water Treatment By Electricity Or Magnetism (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Lubricants (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO2827/73A NO131006C (Direct) | 1973-07-10 | 1973-07-10 | |
| SE7408967A SE392262B (sv) | 1973-07-10 | 1974-07-08 | Apparat for magnetisk paverkan av en strommande vetska |
| GB3015474A GB1423927A (en) | 1973-07-10 | 1974-07-08 | Apparatus for magnetic treatment of a flowing liquid |
| DE2432909A DE2432909A1 (de) | 1973-07-10 | 1974-07-09 | Vorrichtung zur magnetischen behandlung von fliessenden fluessigkeiten |
| US05/486,848 US3941700A (en) | 1973-07-10 | 1974-07-09 | Apparatus for magnetic treatment of a flowing liquid |
| BE146432A BE817500A (fr) | 1973-07-10 | 1974-07-10 | Dispositif pour le traitement magnetique d'un liquide en mouvement |
| AU71071/74A AU486507B2 (en) | 1973-07-10 | 1974-07-10 | Apparatus for magnetic treatment ofa flowing liquid |
| JP49079043A JPS5076647A (Direct) | 1973-07-10 | 1974-07-10 | |
| BR5677/74A BR7405677D0 (pt) | 1973-07-10 | 1974-07-10 | Aparelho para tratamento magnetico de liquido em escoamento |
| FR7423989A FR2236788B1 (Direct) | 1973-07-10 | 1974-07-10 | |
| IN1541/CAL/1974A IN142603B (Direct) | 1973-07-10 | 1974-07-10 | |
| JP1977152364U JPS5381480U (Direct) | 1973-07-10 | 1977-11-15 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO2827/73A NO131006C (Direct) | 1973-07-10 | 1973-07-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131006B true NO131006B (Direct) | 1974-12-09 |
| NO131006C NO131006C (Direct) | 1975-03-19 |
Family
ID=19879178
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2827/73A NO131006C (Direct) | 1973-07-10 | 1973-07-10 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3941700A (Direct) |
| JP (2) | JPS5076647A (Direct) |
| BE (1) | BE817500A (Direct) |
| BR (1) | BR7405677D0 (Direct) |
| DE (1) | DE2432909A1 (Direct) |
| FR (1) | FR2236788B1 (Direct) |
| GB (1) | GB1423927A (Direct) |
| IN (1) | IN142603B (Direct) |
| NO (1) | NO131006C (Direct) |
| SE (1) | SE392262B (Direct) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4151090A (en) * | 1974-05-30 | 1979-04-24 | Brigante Miguel F | Unitary package for water treatment for attachment to home hot water heater |
| US3998741A (en) * | 1976-02-26 | 1976-12-21 | Councell Graham D | Magnetically attractable particle separator |
| GB2023116B (en) | 1978-05-30 | 1982-10-27 | Strutt Agencies Ltd B | Apparatus for the magnetic treatment of liquids |
| EP0041945A1 (en) * | 1978-05-30 | 1981-12-23 | Bernard Strutt Agencies Ltd. | Improvements in apparatus for use in the magnetic treatment of liquids |
| NO145209C (no) * | 1979-10-29 | 1982-02-03 | Fjeldsend As Olaf | Apparat for magnetisk paavirkning av en stroemmende vaeske |
| CA1184532A (en) * | 1981-06-19 | 1985-03-26 | Severin F. Sverre | Magnetic water conditioning device |
| DE3309021A1 (de) * | 1983-03-14 | 1984-09-20 | Hana Dr. 5000 Köln Krizek | Verfahren und vorrichtung zur aufbereitung von wasser |
| NO159162C (no) * | 1986-07-29 | 1988-12-07 | Fjeldsend As Olaf | Apparat for magnetisk paavirkning av stroemmende vaeske. |
| GB2198665B (en) * | 1986-08-13 | 1991-02-13 | Rolls Royce Plc | Magnetic particle detection |
| DK158576C (da) * | 1987-04-09 | 1990-11-12 | Nordrill As | Apparat til magnetisk paavirkning af stroemmende vaeske |
| US6537817B1 (en) | 1993-05-31 | 2003-03-25 | Packard Instrument Company | Piezoelectric-drop-on-demand technology |
| EP1237665B1 (en) * | 1999-10-15 | 2004-06-16 | Packard Instrument Company, Inc. | Piezoelectric-drop-on-demand technology and cleaning of capillaries |
| EP4210854A4 (en) * | 2020-09-11 | 2024-06-05 | Evoqua Water Technologies LLC | MAGNETIC RECOVERY IN CHANNEL |
| WO2023146409A1 (en) * | 2022-01-28 | 2023-08-03 | Firespear Protection Systems As | Fluid treatment arrangement |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE58797C (de) * | W. B. BULL in Quincy, Grfsch. Adams, Illinois, V. St. A | Vorrichtung zum Abscheiden von Verunreinigungen aus nicht alkoholhaltigen Flüssigkeiten | ||
| CA517069A (en) * | 1955-10-04 | Spodig Heinrich | Oil sump filter systems | |
| LU29833A1 (Direct) * | 1945-10-06 | |||
| US2464628A (en) * | 1945-10-20 | 1949-03-15 | Donald E Stem | Device for magnetically trapping metal particles |
| US2635754A (en) * | 1946-08-13 | 1953-04-21 | Donald E Stem | Magnetic plate |
| US2648438A (en) * | 1947-10-15 | 1953-08-11 | Bendix Aviat Corp | Filter |
| FR1022864A (fr) * | 1949-05-12 | 1953-03-11 | Filtre pour fonds de carter, à magnétisme permanent et à action mécanique | |
| US2732943A (en) * | 1953-06-11 | 1956-01-31 | Apparatus for removing impurities | |
| FR1126782A (fr) * | 1954-07-21 | 1956-11-30 | Argo Feinmechanik | Filtre à liquide, dans lequel le courant du liquide se ramifie en un courant principal et un courant secondaire |
| US2830705A (en) * | 1954-08-09 | 1958-04-15 | Eriez Mfg Co | Magnetic trap |
| BE566307A (Direct) * | 1957-04-02 | |||
| DE1642524A1 (de) * | 1967-06-07 | 1971-05-06 | Heinrich Schechner | Vorrichtung zum Aufbereiten von stroemendem Wasser mittels elektromagnetischer Feldlinien |
-
1973
- 1973-07-10 NO NO2827/73A patent/NO131006C/no unknown
-
1974
- 1974-07-08 SE SE7408967A patent/SE392262B/xx not_active IP Right Cessation
- 1974-07-08 GB GB3015474A patent/GB1423927A/en not_active Expired
- 1974-07-09 US US05/486,848 patent/US3941700A/en not_active Expired - Lifetime
- 1974-07-09 DE DE2432909A patent/DE2432909A1/de active Pending
- 1974-07-10 BR BR5677/74A patent/BR7405677D0/pt unknown
- 1974-07-10 JP JP49079043A patent/JPS5076647A/ja active Pending
- 1974-07-10 FR FR7423989A patent/FR2236788B1/fr not_active Expired
- 1974-07-10 IN IN1541/CAL/1974A patent/IN142603B/en unknown
- 1974-07-10 BE BE146432A patent/BE817500A/xx not_active IP Right Cessation
-
1977
- 1977-11-15 JP JP1977152364U patent/JPS5381480U/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2236788A1 (Direct) | 1975-02-07 |
| IN142603B (Direct) | 1977-07-30 |
| SE392262B (sv) | 1977-03-21 |
| US3941700A (en) | 1976-03-02 |
| DE2432909A1 (de) | 1975-01-30 |
| FR2236788B1 (Direct) | 1976-12-24 |
| JPS5381480U (Direct) | 1978-07-06 |
| SE7408967L (sv) | 1975-01-13 |
| BE817500A (fr) | 1974-11-04 |
| NO131006C (Direct) | 1975-03-19 |
| JPS5076647A (Direct) | 1975-06-23 |
| BR7405677D0 (pt) | 1975-05-20 |
| GB1423927A (en) | 1976-02-04 |
| AU7107174A (en) | 1976-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO131006B (Direct) | ||
| US4376060A (en) | Process for preparing lithium soap greases containing borate salt with high dropping point | |
| DE947420C (de) | Schmierfette und Verfahren zu ihrer Herstellung | |
| US2434539A (en) | Lubricants | |
| CN105925356A (zh) | 一种低温极压润滑脂组合物及其制备方法 | |
| US3167570A (en) | Process for the manufacture of esters of hydroxy-alkane-sulfo-acids | |
| US3985662A (en) | High dropping point greases comprising a lithium soap of an epoxy-substituted and/or an ethylenically unsaturated fatty acid | |
| US2695878A (en) | Greases containing a lithium soap of polymerized 12-hydroxy stearic acid and their method of manufacture | |
| US2188863A (en) | Grease and method of making the same | |
| US2442828A (en) | Lubricating greases | |
| US2303558A (en) | Premium cup grease of improved heat and texture stability | |
| US2957826A (en) | Grease composition thickened with a metal n-substituted carbamate | |
| US3001938A (en) | Lubricants containing salts of organic-substituted phosphorus - containing acids | |
| US2822331A (en) | Anhydrous calcium 12-hydroxy stearate grease | |
| CN114163326A (zh) | 结构油脂的制备方法、由该方法制备的结构油脂 | |
| US5585335A (en) | Imide and pyrrolidone grease thickeners with terephthalate complexing agent | |
| US3009878A (en) | Lubricating greases prepared from epoxy fatty acid materials | |
| US2589973A (en) | Lubricating grease composition | |
| US3121728A (en) | Production of monocarboxylic acids from large ring alicyclic alcohols | |
| US2697693A (en) | Manufacture of lithium hydroxy carboxylic acid soap greases | |
| US2600058A (en) | Lubricant containing soap of phosphated hydroxy fatty acid or glyceride | |
| US3062742A (en) | Lubricating greases | |
| RU2804800C1 (ru) | Способ получения жирового солидола | |
| US2867519A (en) | Herbicidal grease composition | |
| GB669947A (en) | Improvements in or relating to lubricating grease compositions |