NO130584B - - Google Patents
Download PDFInfo
- Publication number
- NO130584B NO130584B NO01898/69A NO189869A NO130584B NO 130584 B NO130584 B NO 130584B NO 01898/69 A NO01898/69 A NO 01898/69A NO 189869 A NO189869 A NO 189869A NO 130584 B NO130584 B NO 130584B
- Authority
- NO
- Norway
- Prior art keywords
- dinitrile
- reaction
- malonic
- acid dinitrile
- malonic acid
- Prior art date
Links
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 45
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 claims description 33
- 239000011541 reaction mixture Substances 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 238000005984 hydrogenation reaction Methods 0.000 claims description 15
- 238000005698 Diels-Alder reaction Methods 0.000 claims description 13
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 7
- IAHFWCOBPZCAEA-UHFFFAOYSA-N succinonitrile Chemical compound N#CCCC#N IAHFWCOBPZCAEA-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 238000005194 fractionation Methods 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 8
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 8
- KYPOHTVBFVELTG-OWOJBTEDSA-N (e)-but-2-enedinitrile Chemical compound N#C\C=C\C#N KYPOHTVBFVELTG-OWOJBTEDSA-N 0.000 description 7
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 7
- 239000011976 maleic acid Substances 0.000 description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 101150046432 Tril gene Proteins 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 2
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 2
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- CJSBUWDGPXGFGA-UHFFFAOYSA-N dimethyl-butadiene Natural products CC(C)=CC=C CJSBUWDGPXGFGA-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- -1 nitro- Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000526 short-path distillation Methods 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH696468A CH493473A (de) | 1968-05-09 | 1968-05-09 | Verfahren zur Herstellung von Malonsäuredinitril |
| CH905968A CH493475A (de) | 1968-06-18 | 1968-06-18 | Verfahren zur Reinigung von Malonsäuredinitril |
| CH938368A CH493474A (de) | 1968-06-24 | 1968-06-24 | Verfahren zur Reinigung von Malonsäuredinitril |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO130584B true NO130584B (OSRAM) | 1974-09-30 |
| NO130584C NO130584C (OSRAM) | 1975-01-08 |
Family
ID=27175654
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1898/69A NO130584C (OSRAM) | 1968-05-09 | 1969-05-08 |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US3655721A (OSRAM) |
| JP (1) | JPS50646B1 (OSRAM) |
| BE (1) | BE732687A (OSRAM) |
| CS (1) | CS157061B2 (OSRAM) |
| ES (1) | ES366851A1 (OSRAM) |
| FR (1) | FR2008128A1 (OSRAM) |
| GB (1) | GB1222343A (OSRAM) |
| NL (1) | NL164553C (OSRAM) |
| NO (1) | NO130584C (OSRAM) |
| RO (1) | RO56619A (OSRAM) |
| SE (2) | SE385474B (OSRAM) |
| YU (1) | YU32949B (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4136108A (en) * | 1968-04-05 | 1979-01-23 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Process for the production of malononitrile |
| US3975422A (en) * | 1972-11-21 | 1976-08-17 | Johnson & Johnson | Preparation of bis (2-cyanoacrylate)monomers |
| DE2260126C2 (de) * | 1972-12-08 | 1983-12-01 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von reinem, stabilem Malonsäuredinitril |
| CH582655A5 (OSRAM) * | 1973-10-18 | 1976-12-15 | Lonza Ag | |
| US5153351A (en) * | 1992-01-06 | 1992-10-06 | E. I. Du Pont De Nemours And Company | Removal of tetrahydroazepine (tha) from 6-aminocapronitrile by reaction with reactive methylene compounds |
| US5312959A (en) * | 1993-07-12 | 1994-05-17 | E. I. Du Pont De Nemours And Company | Purification of 2-methylglutaronitrile or adiponitrile |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2799697A (en) * | 1954-09-15 | 1957-07-16 | Chase Chemical Company | Process for the manufacture and purification of malononitrile |
| US2809986A (en) * | 1955-11-17 | 1957-10-15 | Kay Fries Chemicals Inc | Method for the purification of malononitrile |
| US3206500A (en) * | 1962-11-30 | 1965-09-14 | Exxon Research Engineering Co | Separation of acrylonitrile |
| US3322814A (en) * | 1964-09-10 | 1967-05-30 | Universal Oil Prod Co | Purification of nitriles |
| US3417126A (en) * | 1966-01-14 | 1968-12-17 | Nissan Chemical Ind Ltd | Method of producing malononitrile |
| US3541133A (en) * | 1969-04-03 | 1970-11-17 | Little Inc A | Method for synthesizing malononitrile |
| US3616269A (en) * | 1969-07-10 | 1971-10-26 | Ashland Oil Inc | Method for the purification of malononitrile by the addition of cyclopentadiene followed by distillation |
-
1969
- 1969-04-30 CS CS308669A patent/CS157061B2/cs unknown
- 1969-05-06 ES ES366851A patent/ES366851A1/es not_active Expired
- 1969-05-06 RO RO59900A patent/RO56619A/ro unknown
- 1969-05-07 BE BE732687D patent/BE732687A/xx not_active IP Right Cessation
- 1969-05-07 FR FR6914577A patent/FR2008128A1/fr not_active Withdrawn
- 1969-05-07 YU YU1127/69A patent/YU32949B/xx unknown
- 1969-05-07 US US822724A patent/US3655721A/en not_active Expired - Lifetime
- 1969-05-08 SE SE7115884A patent/SE385474B/xx unknown
- 1969-05-08 SE SE7115883A patent/SE385473B/xx unknown
- 1969-05-08 JP JP44034898A patent/JPS50646B1/ja active Pending
- 1969-05-08 NO NO1898/69A patent/NO130584C/no unknown
- 1969-05-09 NL NL6907129.A patent/NL164553C/xx not_active IP Right Cessation
- 1969-05-09 GB GB23712/69A patent/GB1222343A/en not_active Expired
-
1971
- 1971-04-26 US US00137593A patent/US3742020A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SE385473B (sv) | 1976-07-05 |
| CS157061B2 (OSRAM) | 1974-08-23 |
| FR2008128A1 (OSRAM) | 1970-01-16 |
| RO56619A (OSRAM) | 1974-04-29 |
| BE732687A (OSRAM) | 1969-10-16 |
| JPS50646B1 (OSRAM) | 1975-01-10 |
| NL164553B (nl) | 1980-08-15 |
| NO130584C (OSRAM) | 1975-01-08 |
| ES366851A1 (es) | 1971-06-16 |
| US3742020A (en) | 1973-06-26 |
| YU32949B (en) | 1975-12-31 |
| SE385474B (sv) | 1976-07-05 |
| DE1921662B2 (de) | 1976-02-19 |
| DE1921662A1 (de) | 1969-11-13 |
| GB1222343A (en) | 1971-02-10 |
| NL164553C (nl) | 1981-01-15 |
| YU112769A (en) | 1975-06-30 |
| NL6907129A (OSRAM) | 1969-11-11 |
| US3655721A (en) | 1972-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4105688A (en) | Process for the production of malonic acid dinitrile and purification thereof | |
| US2526676A (en) | Process for producing acrylonitrile | |
| JPH02286635A (ja) | フルオロアルキルビニル化合物の製造法 | |
| SU1151202A3 (ru) | Способ получени 2,3-дихлор-5-трихлорметилпиридина | |
| US3109005A (en) | Process for making 2-pyrrolidone from maleic anhydride | |
| NO130584B (OSRAM) | ||
| US6392106B1 (en) | Process for producing 1,1,1,2,2-pentafluoroethane | |
| US7217849B2 (en) | Method for the preparation of n-propyl bromide | |
| CN112409145A (zh) | 一种1-四氢萘酮的制备方法 | |
| US2519803A (en) | Preparation of ethylene diamines | |
| US2649472A (en) | Process for producing acrylonitrile | |
| US2921098A (en) | Process for the preparation of 1, 1, 1-trifluoro-2-bromo-2-chloroethane | |
| US3252997A (en) | Purification of sulfolane compounds | |
| US9102582B2 (en) | Method of producing alcohols | |
| CN107641067B (zh) | 一种邻二酮的α位溴化方法 | |
| US3300531A (en) | Process for preparing dimethylacetamide | |
| US4221921A (en) | Monochloroacetic acid from hydroxyacetic acid | |
| GB2065698A (en) | Production of anthracene | |
| US4351778A (en) | Process for the recovery of malonodinitrile | |
| JP5100945B2 (ja) | ピロリドンおよびn−ビニルピロリドン残留物を処理するための方法 | |
| SU300993A1 (OSRAM) | ||
| US3318955A (en) | Production of formaldehyde | |
| US20230183161A1 (en) | Continuous process to make trifluoroacetyl iodide from trifluoroacetyl chloride and hydrogen iodide by reactive distillation | |
| US3321539A (en) | Cyclohexene production | |
| US2424841A (en) | Separation of alkyl and alkylene naphthalene isomers |