NO127919B - - Google Patents
Download PDFInfo
- Publication number
- NO127919B NO127919B NO314268A NO314268A NO127919B NO 127919 B NO127919 B NO 127919B NO 314268 A NO314268 A NO 314268A NO 314268 A NO314268 A NO 314268A NO 127919 B NO127919 B NO 127919B
- Authority
- NO
- Norway
- Prior art keywords
- benzyl
- tetrahydropyridine
- hexahydro
- formula
- solution
- Prior art date
Links
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 7
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 6
- 239000012279 sodium borohydride Substances 0.000 claims description 6
- 238000003747 Grignard reaction Methods 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 239000002841 Lewis acid Substances 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 150000007517 lewis acids Chemical class 0.000 claims description 4
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical class C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 claims description 3
- 230000001476 alcoholic effect Effects 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- 239000000243 solution Substances 0.000 description 31
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- 239000000203 mixture Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000007787 solid Substances 0.000 description 15
- -1 methoxy, ethoxy Chemical group 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- 239000011777 magnesium Substances 0.000 description 7
- 229910052749 magnesium Inorganic materials 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- NURQLCJSMXZBPC-UHFFFAOYSA-N 3,4-dimethylpyridine Chemical compound CC1=CC=NC=C1C NURQLCJSMXZBPC-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YXFZCACEHYCPHA-UHFFFAOYSA-N 1,2-dibenzyl-3,4-dimethyl-2H-pyridine Chemical compound C(C1=CC=CC=C1)N1C(C(=C(C=C1)C)C)CC1=CC=CC=C1 YXFZCACEHYCPHA-UHFFFAOYSA-N 0.000 description 2
- OQKHDOZOAIDXNV-UHFFFAOYSA-N 1,6-dibenzyl-4,5-dimethyl-3,6-dihydro-2h-pyridine Chemical compound C=1C=CC=CC=1CN1CCC(C)=C(C)C1CC1=CC=CC=C1 OQKHDOZOAIDXNV-UHFFFAOYSA-N 0.000 description 2
- SPGJRQAEUMRKOO-UHFFFAOYSA-M 1-benzyl-3,4-dimethylpyridin-1-ium iodide Chemical compound [I-].C(C1=CC=CC=C1)[N+]1=CC(=C(C=C1)C)C SPGJRQAEUMRKOO-UHFFFAOYSA-M 0.000 description 2
- OWVMQHCIDREXSX-UHFFFAOYSA-M 1-benzyl-3,4-dimethylpyridin-1-ium;bromide Chemical compound [Br-].C1=C(C)C(C)=CC=[N+]1CC1=CC=CC=C1 OWVMQHCIDREXSX-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010520 demethylation reaction Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- AOCXXQNURLBPMB-UHFFFAOYSA-N 1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene Chemical compound C1C2=CC=CC=C2C2(C)C(C)C1NCC2 AOCXXQNURLBPMB-UHFFFAOYSA-N 0.000 description 1
- ZDZRSXDYPGEIBS-UHFFFAOYSA-N 1,6-dibenzyl-4,5-dimethyl-3,6-dihydro-2h-pyridine;oxalic acid Chemical compound OC(=O)C(O)=O.C=1C=CC=CC=1CN1CCC(C)=C(C)C1CC1=CC=CC=C1 ZDZRSXDYPGEIBS-UHFFFAOYSA-N 0.000 description 1
- KSKPCURZYVZTBP-UHFFFAOYSA-N 1-benzyl-2-[(4-methoxyphenyl)methyl]-3,4-dimethyl-2h-pyridine Chemical group C1=CC(OC)=CC=C1CC1C(C)=C(C)C=CN1CC1=CC=CC=C1 KSKPCURZYVZTBP-UHFFFAOYSA-N 0.000 description 1
- CWNOHDOVDQQNRN-UHFFFAOYSA-N 1-benzyl-3,4-dimethyl-2H-pyridine Chemical compound C(C1=CC=CC=C1)N1CC(=C(C=C1)C)C CWNOHDOVDQQNRN-UHFFFAOYSA-N 0.000 description 1
- LQJZTXYKZKEWHV-UHFFFAOYSA-N 1-benzyl-4,5-dimethyl-3,6-dihydro-2H-pyridine oxalic acid Chemical compound C(C(=O)O)(=O)O.C(C1=CC=CC=C1)N1CC(=C(CC1)C)C LQJZTXYKZKEWHV-UHFFFAOYSA-N 0.000 description 1
- SICFQRREHHVVBL-UHFFFAOYSA-N 1-benzyl-4-ethyl-3-methyl-2H-pyridine Chemical compound C(C1=CC=CC=C1)N1CC(=C(C=C1)CC)C SICFQRREHHVVBL-UHFFFAOYSA-N 0.000 description 1
- FHGJMCCUVVAWNM-UHFFFAOYSA-M 1-benzyl-4-ethyl-3-methylpyridin-1-ium;iodide Chemical compound [I-].C1=C(C)C(CC)=CC=[N+]1CC1=CC=CC=C1 FHGJMCCUVVAWNM-UHFFFAOYSA-M 0.000 description 1
- FGVXHUJLIAKCEK-UHFFFAOYSA-N 1-benzyl-6-[(4-methoxyphenyl)methyl]-4,5-dimethyl-3,6-dihydro-2h-pyridine Chemical compound C1=CC(OC)=CC=C1CC1C(C)=C(C)CCN1CC1=CC=CC=C1 FGVXHUJLIAKCEK-UHFFFAOYSA-N 0.000 description 1
- RPMPAQXGZYLEST-UHFFFAOYSA-N 3-benzyl-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol Chemical compound CC1C2CC3=CC=C(O)C=C3C1(C)CCN2CC1=CC=CC=C1 RPMPAQXGZYLEST-UHFFFAOYSA-N 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000004694 iodide salts Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- DXESFJJJWBHLJX-UHFFFAOYSA-N norcyclazocine Chemical compound C1C2=CC=C(O)C=C2C2(C)C(C)C1NCC2 DXESFJJJWBHLJX-UHFFFAOYSA-N 0.000 description 1
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229960000482 pethidine Drugs 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000012450 pharmaceutical intermediate Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
Landscapes
- Other In-Based Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US67039167A | 1967-09-25 | 1967-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO127919B true NO127919B (cs) | 1973-09-03 |
Family
ID=24690222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO314268A NO127919B (cs) | 1967-09-25 | 1968-08-09 |
Country Status (4)
| Country | Link |
|---|---|
| JP (2) | JPS5317596B1 (cs) |
| AT (1) | AT285615B (cs) |
| IL (1) | IL30338A (cs) |
| NO (1) | NO127919B (cs) |
-
1968
- 1968-07-09 IL IL30338A patent/IL30338A/xx unknown
- 1968-07-24 AT AT717468A patent/AT285615B/de not_active IP Right Cessation
- 1968-08-09 NO NO314268A patent/NO127919B/no unknown
-
1971
- 1971-11-09 JP JP8874571A patent/JPS5317596B1/ja active Pending
- 1971-11-09 JP JP8874471A patent/JPS4833751B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL30338A0 (en) | 1968-09-26 |
| AT285615B (de) | 1970-11-10 |
| JPS5317596B1 (cs) | 1978-06-09 |
| JPS4833751B1 (cs) | 1973-10-16 |
| IL30338A (en) | 1972-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Boekelheide et al. | Reissert Compounds. Further Alkylation Studies and a Novel Rearrangement1 | |
| US3132147A (en) | ||
| US3267107A (en) | 3-(4'-5'-methylenedioxy-phenyl)-7, 8-dimethoxy-1, 2, 3, 4,-tetrahydroisoquinolines | |
| Bailey et al. | The Mannich Reaction with 1, 2-Dibenzoylethane1, 2 | |
| IL25213A (en) | 4-hydroxy-piperidine derivatives and their preparation | |
| IL29467A (en) | N-phenyl indoline derivatives | |
| US3225031A (en) | Phenyl-benzazepines and methods for their manufacture | |
| EP0077536B1 (en) | 2'-substituted-spiro(benzofuran-2(3h),1'-cycloalkanes), a process for preparing same, pharmaceutical compositions containing such compounds and their use as medicaments | |
| Gassman et al. | The synthesis of 2-azabicyclo [2.2. 1] heptanes by the Hofmann-Löffler-Freytag reaction | |
| SU1301311A3 (ru) | Способ получени производных гексагидроазепина или пиперидина, или пирролидина (его варианты) | |
| US3037986A (en) | 2-(para-methoxyphenylcarbinol)-1-(phenylalkyl) piperidinium hydrobromide | |
| CA1148150A (en) | Phenylmorphans, intermediates and method of preparation | |
| IL36239A (en) | 4-hydroxy-4-) 2-oxo-3-tetrahydroporil (piperidine and its preparation | |
| US3644373A (en) | Method for the production of 3-substituted-1 2 3 4 5 6-hexahydro-6 11-dimethyl-8-hydroxy-2 6-methano-3-benzazocines | |
| Greer et al. | The Beckmann rearrangement. VII. The isolation and rearrangement of 2, 4, 6-trimethylacetophenone oxime | |
| US3006925A (en) | J-pyrrolidyl ethanols | |
| US3876644A (en) | Process for the production of 6,7-benzomorphanes | |
| TW294666B (cs) | ||
| US3678056A (en) | Process for the preparation of 1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocines | |
| Kisaki et al. | Chemistry of the N′-Oxides of Nicotine and Myosmine | |
| US3313822A (en) | Diphenyl substituted aminoalkyl pyridines | |
| NO137695B (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive n-tienylmetyl-heterocykliske forbindelser | |
| Gilman et al. | Quinazolines and 1, 4-benzodiazepines. LIV. Base-catalyzed rearrangement of 2-dimethylamino-5-phenyl-7-chloro-3H-1, 4-benzodiazepine 4-oxide | |
| US3953458A (en) | 1-Substituted amino-2-alkyl-5-hydroxy-7,8-cyclopentano[h]-1,2,3,4-tetrahydroisoquinolines | |
| US3462427A (en) | Novel 1-(cycloalkylidene-ethyl-4-phenyl-piperidines |