NO126682B - - Google Patents
Download PDFInfo
- Publication number
- NO126682B NO126682B NO04011/71A NO401171A NO126682B NO 126682 B NO126682 B NO 126682B NO 04011/71 A NO04011/71 A NO 04011/71A NO 401171 A NO401171 A NO 401171A NO 126682 B NO126682 B NO 126682B
- Authority
- NO
- Norway
- Prior art keywords
- cross
- tellurium
- stated
- oxide
- salt
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 37
- 239000002360 explosive Substances 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 229910001868 water Inorganic materials 0.000 claims description 19
- 239000003431 cross linking reagent Substances 0.000 claims description 16
- 239000002002 slurry Substances 0.000 claims description 16
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 16
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 15
- 229910052714 tellurium Inorganic materials 0.000 claims description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- 239000002562 thickening agent Substances 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229920002521 macromolecule Polymers 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- FXADMRZICBQPQY-UHFFFAOYSA-N orthotelluric acid Chemical compound O[Te](O)(O)(O)(O)O FXADMRZICBQPQY-UHFFFAOYSA-N 0.000 claims description 6
- -1 alkali metal salt Chemical class 0.000 claims description 5
- 239000006185 dispersion Substances 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 239000000243 solution Substances 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 230000008719 thickening Effects 0.000 claims description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 238000004132 cross linking Methods 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 150000003498 tellurium compounds Chemical class 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 2
- 229910000423 chromium oxide Inorganic materials 0.000 claims description 2
- 239000000084 colloidal system Substances 0.000 claims description 2
- XERQTZLDFHNZIC-UHFFFAOYSA-L disodium;tellurate Chemical compound [Na+].[Na+].[O-][Te]([O-])(=O)=O XERQTZLDFHNZIC-UHFFFAOYSA-L 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 150000002978 peroxides Chemical class 0.000 claims description 2
- 239000000499 gel Substances 0.000 description 25
- 239000000446 fuel Substances 0.000 description 10
- 229920002907 Guar gum Polymers 0.000 description 7
- 239000000665 guar gum Substances 0.000 description 7
- 235000010417 guar gum Nutrition 0.000 description 7
- 229960002154 guar gum Drugs 0.000 description 7
- 239000004615 ingredient Substances 0.000 description 7
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 238000005474 detonation Methods 0.000 description 3
- LAJZODKXOMJMPK-UHFFFAOYSA-N tellurium dioxide Chemical compound O=[Te]=O LAJZODKXOMJMPK-UHFFFAOYSA-N 0.000 description 3
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 229920000926 Galactomannan Polymers 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003721 gunpowder Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- OMDQUFIYNPYJFM-XKDAHURESA-N (2r,3r,4s,5r,6s)-2-(hydroxymethyl)-6-[[(2r,3s,4r,5s,6r)-4,5,6-trihydroxy-3-[(2s,3s,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O[C@H]2[C@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@H](O)[C@H](O)O1 OMDQUFIYNPYJFM-XKDAHURESA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- HZTVIZREFBBQMG-UHFFFAOYSA-N 2-methyl-1,3,5-trinitrobenzene;[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O HZTVIZREFBBQMG-UHFFFAOYSA-N 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910000519 Ferrosilicon Inorganic materials 0.000 description 1
- 229920002581 Glucomannan Polymers 0.000 description 1
- 229920000161 Locust bean gum Polymers 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 235000000380 Nyssa aquatica Nutrition 0.000 description 1
- 244000134552 Plantago ovata Species 0.000 description 1
- 235000003421 Plantago ovata Nutrition 0.000 description 1
- 239000009223 Psyllium Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 240000004584 Tamarindus indica Species 0.000 description 1
- 235000004298 Tamarindus indica Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000005273 aeration Methods 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000000711 locust bean gum Substances 0.000 description 1
- 235000010420 locust bean gum Nutrition 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052752 metalloid Inorganic materials 0.000 description 1
- 150000002738 metalloids Chemical class 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 229960001841 potassium permanganate Drugs 0.000 description 1
- 229940070687 psyllium Drugs 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000213 tara gum Substances 0.000 description 1
- 235000010491 tara gum Nutrition 0.000 description 1
- IIXQANVWKBCLEB-UHFFFAOYSA-N tellurium trioxide Chemical compound O=[Te](=O)=O IIXQANVWKBCLEB-UHFFFAOYSA-N 0.000 description 1
- NDKWCCLKSWNDBG-UHFFFAOYSA-N zinc;dioxido(dioxo)chromium Chemical compound [Zn+2].[O-][Cr]([O-])(=O)=O NDKWCCLKSWNDBG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Colloid Chemistry (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5669470 | 1970-11-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126682B true NO126682B (en:Method) | 1973-03-12 |
Family
ID=10477297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO04011/71A NO126682B (en:Method) | 1970-11-30 | 1971-10-29 |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US3734864A (en:Method) |
| AU (1) | AU3570671A (en:Method) |
| BE (1) | BE775302A (en:Method) |
| CA (1) | CA945764A (en:Method) |
| DE (1) | DE2159382A1 (en:Method) |
| ES (1) | ES397467A1 (en:Method) |
| FR (1) | FR2115993A5 (en:Method) |
| GB (1) | GB1317328A (en:Method) |
| IE (1) | IE35934B1 (en:Method) |
| NO (1) | NO126682B (en:Method) |
| OA (1) | OA03847A (en:Method) |
| PH (1) | PH9447A (en:Method) |
| SE (1) | SE386158B (en:Method) |
| ZA (1) | ZA717564B (en:Method) |
| ZM (1) | ZM15371A1 (en:Method) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1317328A (en) * | 1970-11-30 | 1973-05-16 | Ici Ltd | Slurry explosives |
| GB1317327A (en) * | 1970-11-30 | 1973-05-16 | Ici Ltd | Slurry explosives |
| US4439254A (en) * | 1982-04-05 | 1984-03-27 | Atlas Powder Company | Solid sensitizers in water gel explosives and method |
| US5189249A (en) * | 1991-11-14 | 1993-02-23 | E. I. Du Pont De Nemours And Company | Gel propellant ammunition |
| RU2180328C1 (ru) * | 2000-12-22 | 2002-03-10 | Общество с ограниченной ответственностью "Промтехвзрыв" | Взрывчатый состав |
| RU2237645C1 (ru) * | 2002-12-25 | 2004-10-10 | Смагин Николай Петрович | Взрывчатый состав |
| JP2006524897A (ja) * | 2003-03-26 | 2006-11-02 | オスラム・シルバニア・インコーポレイテッド | タングステンをベースとする電極触媒及びそれを含む燃料電池 |
| RU2591946C2 (ru) * | 2014-06-24 | 2016-07-20 | Владимир Эдуардович Анников | Способ изготовления гелеобразного водосодержащего взрывчатого состава |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3251781A (en) * | 1961-08-21 | 1966-05-17 | Gen Mills Inc | Organo-metallic gel-producing compositions and processes for preparing organo-metallic gels |
| US3400026A (en) * | 1967-01-16 | 1968-09-03 | Du Pont | Thickened aqueous inorganic oxidizer salt explosive composition containing dissolvedproteinaceous material |
| US3451868A (en) * | 1967-05-04 | 1969-06-24 | Du Pont | Water-bearing explosive compositions gelled with polymeric amide-aldehyde and method of making same |
| US3445305A (en) * | 1967-06-02 | 1969-05-20 | Du Pont | Gelation of galactomannan containing water-bearing explosives |
| US3728173A (en) * | 1969-10-17 | 1973-04-17 | Intermountain Res & Eng Co Inc | Dense explosive slurry compositions of high energy containing a gum mixture |
| GB1317328A (en) * | 1970-11-30 | 1973-05-16 | Ici Ltd | Slurry explosives |
| GB1317327A (en) * | 1970-11-30 | 1973-05-16 | Ici Ltd | Slurry explosives |
-
1970
- 1970-11-30 GB GB5669470A patent/GB1317328A/en not_active Expired
-
1971
- 1971-10-26 IE IE1355/71A patent/IE35934B1/xx unknown
- 1971-10-29 NO NO04011/71A patent/NO126682B/no unknown
- 1971-11-04 ZM ZM153/71*UA patent/ZM15371A1/xx unknown
- 1971-11-08 US US00196797A patent/US3734864A/en not_active Expired - Lifetime
- 1971-11-10 ZA ZA717564A patent/ZA717564B/xx unknown
- 1971-11-10 CA CA127,402A patent/CA945764A/en not_active Expired
- 1971-11-11 SE SE7114436A patent/SE386158B/xx unknown
- 1971-11-12 BE BE775302A patent/BE775302A/xx not_active IP Right Cessation
- 1971-11-15 AU AU35706/71A patent/AU3570671A/en not_active Expired
- 1971-11-17 PH PH13024*UA patent/PH9447A/en unknown
- 1971-11-24 FR FR7142058A patent/FR2115993A5/fr not_active Expired
- 1971-11-29 OA OA54426A patent/OA03847A/xx unknown
- 1971-11-29 ES ES397467A patent/ES397467A1/es not_active Expired
- 1971-11-30 DE DE19712159382 patent/DE2159382A1/de not_active Withdrawn
-
1972
- 1972-09-18 US US00289637A patent/US3784421A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ZM15371A1 (en) | 1973-07-23 |
| ZA717564B (en) | 1973-06-27 |
| SE386158B (sv) | 1976-08-02 |
| IE35934B1 (en) | 1976-07-07 |
| US3734864A (en) | 1973-05-22 |
| DE2159382A1 (de) | 1972-06-29 |
| GB1317328A (en) | 1973-05-16 |
| ES397467A1 (es) | 1975-03-16 |
| FR2115993A5 (en:Method) | 1972-07-07 |
| IE35934L (en) | 1972-05-30 |
| US3784421A (en) | 1974-01-08 |
| OA03847A (fr) | 1971-12-24 |
| AU3570671A (en) | 1973-05-24 |
| BE775302A (fr) | 1972-05-12 |
| PH9447A (en) | 1975-11-26 |
| CA945764A (en) | 1974-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3355336A (en) | Thickened water-bearing inorganic oxidizer salt explosive containing crosslinked galactomannan and polyacrylamide | |
| US3190777A (en) | Fluidizing agents for water-bearing explosive compositions | |
| AU677634B2 (en) | An explosive composition suitable for cartridging in paper and its method of manufacture | |
| NO126682B (en:Method) | ||
| US3431155A (en) | Water-bearing explosive containing nitrogen-base salt and method of preparing same | |
| CA1170837A (en) | Compositions | |
| US3445305A (en) | Gelation of galactomannan containing water-bearing explosives | |
| US3485686A (en) | Aqueous explosive slurry containing oxidizer-reducer cross-linking agent | |
| US4976793A (en) | Explosive composition | |
| US4456492A (en) | Melt explosive composition | |
| US3341383A (en) | Aqueous ammonium nitrate explosive slurries containing partially hydrolyzed acrylamide polymer | |
| IE42393B1 (en) | Blasting composition containing calcium nitrate and sulfur | |
| US4198253A (en) | Explosive compositions containing sulphonated guar gum derivatives | |
| US3617407A (en) | Aqueous slurry explosive containing a thickener of cross-linked galactomannan with psyllium flour | |
| US3629021A (en) | Slurry explosive composition containing nitrogen-base salt and tnt, smokeless powder or composition b | |
| US3409484A (en) | Thickened inorganic oxidizer salt slurried explosive containing an alkylamine nitrate and an air-entrapping material | |
| US6214140B1 (en) | Development of new high energy blasting products using demilitarized ammonium picrate | |
| US20060243362A1 (en) | Explosive compositions | |
| US3668027A (en) | Method of making nitrocellulose-nitroglycerine water-bearing explosive compositions | |
| US3653996A (en) | Controlled gelation in aqueous explosives containing boric acid | |
| US3639184A (en) | Method for preparing gelled slurry explosive composition containing distinct liuqid and solid phases | |
| US3511726A (en) | Slurried ammonium nitrate explosive composition containing a chrome-lignin | |
| NO126362B (en:Method) | ||
| US3728175A (en) | Slurry explosives | |
| US3475238A (en) | Method for preparing gelled slurry explosive compositions containing distinct liquid and solid phases |