NO122616B - - Google Patents
Download PDFInfo
- Publication number
- NO122616B NO122616B NO68732A NO73268A NO122616B NO 122616 B NO122616 B NO 122616B NO 68732 A NO68732 A NO 68732A NO 73268 A NO73268 A NO 73268A NO 122616 B NO122616 B NO 122616B
- Authority
- NO
- Norway
- Prior art keywords
- phenthiazine
- formula
- hydrogen
- dimethylamino
- methylation
- Prior art date
Links
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical class C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 claims description 16
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 230000011987 methylation Effects 0.000 claims description 4
- 238000007069 methylation reaction Methods 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- -1 phenthiazine compound Chemical class 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 108010021119 Trichosanthin Proteins 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000002048 spasmolytic effect Effects 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YIUIVFFUEVPRIU-UHFFFAOYSA-N 8-chlorotheophylline Chemical compound O=C1N(C)C(=O)N(C)C2=NC(Cl)=N[C]21 YIUIVFFUEVPRIU-UHFFFAOYSA-N 0.000 description 1
- 206010001985 Amoebic colitis Diseases 0.000 description 1
- 206010007645 Cardiospasm Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000000289 Esophageal Achalasia Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- DJEQZVQFEPKLOY-UHFFFAOYSA-N N,N-dimethylbutylamine Chemical compound CCCCN(C)C DJEQZVQFEPKLOY-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 201000000621 achalasia Diseases 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 208000010227 enterocolitis Diseases 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-L ethane-1,2-disulfonate Chemical compound [O-]S(=O)(=O)CCS([O-])(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-L 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000012022 methylating agents Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000009291 secondary effect Effects 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003459 sulfonic acid esters Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G2/00—Addition polymers of aldehydes or cyclic oligomers thereof or of ketones; Addition copolymers thereof with less than 50 molar percent of other substances
- C08G2/08—Polymerisation of formaldehyde
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0053028 | 1967-05-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122616B true NO122616B (de) | 1971-07-19 |
Family
ID=7054645
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO68732A NO122616B (de) | 1967-05-09 | 1968-02-28 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3595926A (de) |
| AT (1) | AT280233B (de) |
| BE (1) | BE714869A (de) |
| CH (1) | CH498065A (de) |
| CS (1) | CS158217B2 (de) |
| DE (1) | DE1720472B1 (de) |
| FR (1) | FR1565223A (de) |
| GB (1) | GB1185258A (de) |
| NL (1) | NL6806145A (de) |
| NO (1) | NO122616B (de) |
| SE (1) | SE330526B (de) |
| YU (1) | YU33106B (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4036891A (en) * | 1975-12-29 | 1977-07-19 | Moller Jens C T | Process for preparing paraformaldehyde |
| US4550213A (en) * | 1984-06-29 | 1985-10-29 | Celanese Corporation | Method of manufacture for paraformaldehyde prills |
| DD272576A3 (de) * | 1987-01-30 | 1989-10-18 | Leuna Werke Veb | Verfahren zur herstellung von koernigem paraformaldehyd |
| US20110250264A1 (en) | 2010-04-09 | 2011-10-13 | Pacira Pharmaceuticals, Inc. | Method for formulating large diameter synthetic membrane vesicles |
| CN103335495B (zh) * | 2013-06-25 | 2015-05-06 | 国药控股星鲨制药（厦门）有限公司 | 一种快捷式器具干燥机 |
| CN113061219A (zh) * | 2021-03-29 | 2021-07-02 | 无锡熙源工程技术有限公司 | 一种多聚甲醛生产工艺 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1208887B (de) * | 1963-11-14 | 1966-01-13 | Degussa | Verfahren zum Herstellen von freifliessendem Paraformaldehyd |
-
1967
- 1967-05-09 DE DE19671720472 patent/DE1720472B1/de active Pending
- 1967-06-14 SE SE08357/67A patent/SE330526B/xx unknown
-
1968
- 1968-02-28 NO NO68732A patent/NO122616B/no unknown
- 1968-03-19 YU YU623/68A patent/YU33106B/xx unknown
- 1968-04-25 CS CS307968A patent/CS158217B2/cs unknown
- 1968-05-01 NL NL6806145A patent/NL6806145A/xx unknown
- 1968-05-02 AT AT424968A patent/AT280233B/de not_active IP Right Cessation
- 1968-05-07 GB GB21573/68A patent/GB1185258A/en not_active Expired
- 1968-05-08 CH CH687868A patent/CH498065A/de not_active IP Right Cessation
- 1968-05-08 BE BE714869D patent/BE714869A/xx not_active IP Right Cessation
- 1968-05-09 FR FR1565223D patent/FR1565223A/fr not_active Expired
-
1969
- 1969-10-24 US US869393A patent/US3595926A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR1565223A (de) | 1969-04-25 |
| YU33106B (en) | 1976-04-30 |
| SE330526B (de) | 1970-11-23 |
| AT280233B (de) | 1970-04-10 |
| BE714869A (de) | 1968-11-08 |
| GB1185258A (en) | 1970-03-25 |
| US3595926A (en) | 1971-07-27 |
| YU62368A (en) | 1975-10-31 |
| DE1720472B1 (de) | 1971-10-07 |
| CH498065A (de) | 1970-10-31 |
| CS158217B2 (de) | 1974-10-15 |
| NL6806145A (de) | 1968-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO122614B (de) | ||
| US3201470A (en) | Chsx c cech | |
| NO154116B (no) | Fremgangsm¨te og lamellsepareringsapparat for tilf¯rsel og fordeling av en sammensatt v|ske til et lamellseparerings apparat. | |
| NO122616B (de) | ||
| NO121337B (de) | ||
| US2595405A (en) | Their production | |
| US3433804A (en) | Basic-substituted dithienylmethyl- and thienylphenylmethyl ethers and a process of making same | |
| US2970149A (en) | Certain 1-[(2-pyridyl)-lower alkyl]-2-(tertamino-lower alkyl)-indan-1-ols, and acid addition salts | |
| US2970144A (en) | Esters of 9-alkyl-3-oxa and 3-thia-9-azabicyclo [3. 3. 1]-nonan-7-ol | |
| US2894033A (en) | Antispasmodic 1, 1-diphenyl-3-dialkylaminopropane, and its tertiary and quaternary salts | |
| US3093650A (en) | Alternative synthesis of | |
| US3963778A (en) | Basic oximes and their preparation | |
| US3974285A (en) | 10,11-Furo-derivatives of cyproheptadine | |
| US3436391A (en) | Dihydroanthracene compounds | |
| US3256332A (en) | Method for the production of 5 (3'-aminopropylidene) dibenzo [a, d] cyclohepta [1, 4] dienes | |
| US3989717A (en) | Indolobenzazepine derivatives | |
| US3374245A (en) | Unsaturated oxacycles | |
| NO118975B (de) | ||
| NO157421B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 3,7-diazabicyclo-(3.3.1)-nonan-derivater. | |
| US4044143A (en) | 10,11-Bis-(hydroxyalkyl) derivatives of cyproheptadine | |
| US3989844A (en) | Basic oximes and their preparation | |
| US3462447A (en) | Certain azadibenzocycloheptene-5-ols and ethers derivatives thereof | |
| SU503523A3 (ru) | Способ получени -(гетероарилметил)- -дезокси-нормофинов или -норкодеинов | |
| US3978129A (en) | Alkenyl- and alkanylamines | |
| US3950346A (en) | Novel process for producing 2-ketoethylbenzomorphan derivatives and salts thereof |