NO122070B - - Google Patents
Download PDFInfo
- Publication number
- NO122070B NO122070B NO165919A NO16591966A NO122070B NO 122070 B NO122070 B NO 122070B NO 165919 A NO165919 A NO 165919A NO 16591966 A NO16591966 A NO 16591966A NO 122070 B NO122070 B NO 122070B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- lower alkyl
- halogen
- hydrogen
- benzodiazepine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- -1 sodium hydroxide Chemical class 0.000 description 3
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 1
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical class N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 1
- PLZWYQYDWCXHTF-UHFFFAOYSA-N 1-methyl-5-phenyl-3h-1,4-benzodiazepin-2-one Chemical compound N=1CC(=O)N(C)C2=CC=CC=C2C=1C1=CC=CC=C1 PLZWYQYDWCXHTF-UHFFFAOYSA-N 0.000 description 1
- YIBUYDHSWMGPBG-UHFFFAOYSA-N 2-(benzenecarboximidoyl)-4-chloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C=C1C(=N)C1=CC=CC=C1 YIBUYDHSWMGPBG-UHFFFAOYSA-N 0.000 description 1
- FGQBDNROFQTSRT-UHFFFAOYSA-N 2-(benzenecarboximidoyl)-n-methyl-4-nitroaniline Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1C(=N)C1=CC=CC=C1 FGQBDNROFQTSRT-UHFFFAOYSA-N 0.000 description 1
- DLGOLDCIEHQIMN-UHFFFAOYSA-N 2-(benzenecarboximidoyl)aniline Chemical compound NC1=CC=CC=C1C(=N)C1=CC=CC=C1 DLGOLDCIEHQIMN-UHFFFAOYSA-N 0.000 description 1
- LKRZCUQFUCYWLZ-UHFFFAOYSA-N 2-chloroacetyl bromide Chemical compound ClCC(Br)=O LKRZCUQFUCYWLZ-UHFFFAOYSA-N 0.000 description 1
- WDFDOEZDEQJRHF-UHFFFAOYSA-N 2-chloroacetyl iodide Chemical compound ClCC(I)=O WDFDOEZDEQJRHF-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- VPAYQWRBBOGGPY-UHFFFAOYSA-N diclazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1Cl VPAYQWRBBOGGPY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US512773A US3376290A (en) | 1965-12-09 | 1965-12-09 | Process for preparing benzodiazepines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122070B true NO122070B (cs) | 1971-05-18 |
Family
ID=24040498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO165919A NO122070B (cs) | 1965-12-09 | 1966-12-08 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3376290A (cs) |
| BE (1) | BE690185A (cs) |
| BR (1) | BR6685044D0 (cs) |
| CH (1) | CH484163A (cs) |
| DE (1) | DE1695168A1 (cs) |
| DK (1) | DK122079B (cs) |
| ES (1) | ES334297A1 (cs) |
| FR (1) | FR1503276A (cs) |
| GB (1) | GB1164499A (cs) |
| IL (1) | IL26893A (cs) |
| MY (1) | MY7000087A (cs) |
| NL (2) | NL6617011A (cs) |
| NO (1) | NO122070B (cs) |
| SE (1) | SE319184B (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2016385C3 (de) * | 1969-04-16 | 1980-09-18 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 1 -Alkoxyalkyl-5-(o-fluorphenyl)-7chlor-13-dihydro-2H-benzodiazepin-2-onderivate |
| US3872089A (en) * | 1971-05-14 | 1975-03-18 | Hoffmann La Roche | Substituted thienodiazepines |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3297755A (en) * | 1960-12-02 | 1967-01-10 | Hoffmann La Roche | 2-chloro-5-trifluoromethylbenzo-phenone compounds |
| NL279830A (cs) * | 1961-06-20 |
-
0
- NL NL131731D patent/NL131731C/xx active
-
1965
- 1965-12-09 US US512773A patent/US3376290A/en not_active Expired - Lifetime
-
1966
- 1966-11-18 IL IL26893A patent/IL26893A/xx unknown
- 1966-11-21 CH CH1667166A patent/CH484163A/de not_active IP Right Cessation
- 1966-11-24 DE DE19661695168 patent/DE1695168A1/de active Pending
- 1966-11-25 BE BE690185D patent/BE690185A/xx unknown
- 1966-12-02 NL NL6617011A patent/NL6617011A/xx unknown
- 1966-12-02 BR BR185044/66A patent/BR6685044D0/pt unknown
- 1966-12-02 SE SE16540/66A patent/SE319184B/xx unknown
- 1966-12-05 DK DK629966AA patent/DK122079B/da unknown
- 1966-12-06 FR FR86239A patent/FR1503276A/fr not_active Expired
- 1966-12-07 ES ES334297A patent/ES334297A1/es not_active Expired
- 1966-12-08 NO NO165919A patent/NO122070B/no unknown
- 1966-12-08 GB GB54953/66A patent/GB1164499A/en not_active Expired
-
1970
- 1970-12-31 MY MY197087A patent/MY7000087A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE690185A (cs) | 1967-05-25 |
| CH484163A (de) | 1970-01-15 |
| FR1503276A (fr) | 1967-11-24 |
| NL6617011A (cs) | 1967-06-12 |
| IL26893A (en) | 1970-10-30 |
| DE1695168A1 (de) | 1970-12-10 |
| SE319184B (cs) | 1970-01-12 |
| MY7000087A (en) | 1970-12-31 |
| ES334297A1 (es) | 1968-02-01 |
| US3376290A (en) | 1968-04-02 |
| GB1164499A (en) | 1969-09-17 |
| DK122079B (da) | 1972-01-17 |
| NL131731C (cs) | |
| BR6685044D0 (pt) | 1973-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Carpino | Oxidative reactions of hydrazines. IV. Elimination of nitrogen from 1, 1-disubstituted-2-arenesulfonhydrazides1-4 | |
| NO135173B (cs) | ||
| Boyer et al. | Pyrido-2, 3-furoxane1 | |
| US3121077A (en) | Substituted-1, 4-benzodiazepine-2-one compounds | |
| NO118914B (cs) | ||
| NO152064B (no) | Utvidet stiveranordning for en selvreisende vinge | |
| NO122070B (cs) | ||
| NO117366B (cs) | ||
| US3340253A (en) | Preparation of certain benzodiazepine compounds | |
| US3567710A (en) | Process for the preparation of 1,3-dihydro-2h-1,4-benzodiazepin-2-ones | |
| Ogata et al. | 5-Aryl-1, 5-dihydro-2H-1, 4-benzodiazepin-2-one derivatives as antianxiety agents | |
| US3297698A (en) | Process for the preparation of quinazoline 3-oxides | |
| US3371083A (en) | Process for preparing therapeutically useful 3-substituted benzodiazepines | |
| US3872089A (en) | Substituted thienodiazepines | |
| US3215737A (en) | Preparation of 2-amino-5-nitro-benzophenone and derivatives thereof | |
| NO119593B (cs) | ||
| NO132800B (cs) | ||
| SU430552A1 (ru) | Способ получения производных бензодиазепина | |
| NO165419B (no) | Innretning for laasing og frigjoering av gjenstander beregnet for offentlig bruk, saasom bagasjetraller. | |
| US3513158A (en) | Process for preparing 5-aryl benzodiazepines and intermediates | |
| US3371084A (en) | Process for preparing halogen-substituted-1, 4-benzodiazepines | |
| IL24192A (en) | 1-phenylsulfonyl-2-benzimidazolinones and 1-phenylsulfonyl-2-benzimidazolinethiones and process for their preparation | |
| DE1965980A1 (de) | 2-(Dioxopiperazino)-benzophenone und Verfahren zu ihrer Herstellung | |
| US3579580A (en) | Process for preparing 1,4-benzodiazepines | |
| US3849434A (en) | Process for preparing triazolobenzodiazepines |