NO117606B - - Google Patents
Download PDFInfo
- Publication number
- NO117606B NO117606B NO3056/68A NO305668A NO117606B NO 117606 B NO117606 B NO 117606B NO 3056/68 A NO3056/68 A NO 3056/68A NO 305668 A NO305668 A NO 305668A NO 117606 B NO117606 B NO 117606B
- Authority
- NO
- Norway
- Prior art keywords
- ammonia
- sulfur dioxide
- waste liquor
- alkaline earth
- wet
- Prior art date
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 78
- 229910021529 ammonia Inorganic materials 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 35
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 26
- 239000002699 waste material Substances 0.000 claims description 23
- 239000007788 liquid Substances 0.000 claims description 16
- 239000001913 cellulose Substances 0.000 claims description 11
- 229920002678 cellulose Polymers 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 10
- 239000002023 wood Substances 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 238000000605 extraction Methods 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000002244 precipitate Substances 0.000 claims description 8
- 238000002485 combustion reaction Methods 0.000 claims description 7
- 239000000463 material Substances 0.000 claims description 7
- DFNQEKIRKPNANW-UHFFFAOYSA-N azane;sulfur dioxide Chemical compound N.O=S=O DFNQEKIRKPNANW-UHFFFAOYSA-N 0.000 claims description 6
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 6
- 239000000920 calcium hydroxide Substances 0.000 claims description 6
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 6
- ZETCGWYACBNPIH-UHFFFAOYSA-N azane;sulfurous acid Chemical compound N.OS(O)=O ZETCGWYACBNPIH-UHFFFAOYSA-N 0.000 claims description 5
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 4
- 238000001354 calcination Methods 0.000 claims description 4
- 238000011084 recovery Methods 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 238000006386 neutralization reaction Methods 0.000 claims description 2
- 230000008929 regeneration Effects 0.000 claims description 2
- 238000011069 regeneration method Methods 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 235000011116 calcium hydroxide Nutrition 0.000 claims 2
- 239000007900 aqueous suspension Substances 0.000 claims 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 22
- 230000003647 oxidation Effects 0.000 description 16
- 238000007254 oxidation reaction Methods 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000007789 gas Substances 0.000 description 13
- 239000001569 carbon dioxide Substances 0.000 description 12
- 229910002092 carbon dioxide Inorganic materials 0.000 description 12
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 11
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 230000003472 neutralizing effect Effects 0.000 description 8
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 6
- 239000000292 calcium oxide Substances 0.000 description 6
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 6
- 238000010411 cooking Methods 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 229910000019 calcium carbonate Inorganic materials 0.000 description 4
- 239000003518 caustics Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 235000011132 calcium sulphate Nutrition 0.000 description 3
- -1 oxy- Chemical class 0.000 description 3
- 239000013049 sediment Substances 0.000 description 3
- 239000010802 sludge Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000001175 calcium sulphate Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012476 oxidizable substance Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47H—FURNISHINGS FOR WINDOWS OR DOORS
- A47H15/00—Runners or gliders for supporting curtains on rails or rods
- A47H15/04—Gliders
Landscapes
- Curtains And Furnishings For Windows Or Doors (AREA)
- Removal Of Specific Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1654051 | 1967-09-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117606B true NO117606B (enExample) | 1969-09-01 |
Family
ID=5685180
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3056/68A NO117606B (enExample) | 1967-09-16 | 1968-08-02 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3530528A (enExample) |
| AT (1) | AT275784B (enExample) |
| BE (1) | BE719018A (enExample) |
| CH (1) | CH477194A (enExample) |
| DK (1) | DK119794B (enExample) |
| FI (1) | FI46320C (enExample) |
| FR (1) | FR1575094A (enExample) |
| GB (1) | GB1230008A (enExample) |
| NO (1) | NO117606B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1288926B (de) * | 1964-05-21 | 1969-02-06 | Sigmatex Ag | Gurtschloss fuer einen Dreipunkt-Sicherheitsgurt |
| US3682226A (en) * | 1971-03-22 | 1972-08-08 | Kirsch Co | Unitary traverse rod |
| US20040232148A1 (en) * | 2003-05-19 | 2004-11-25 | Gl&V Management Hungary Kft. | Slide guide assembly and slider kit for floating cover of digester tank and associated method |
| GB2458075B (en) * | 2006-12-13 | 2011-07-06 | John Dewees | Track and curtain system |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1332904A (fr) * | 1962-08-30 | 1963-07-19 | Perfectionnements aux crochets coulissants pour rideaux et analogues |
-
1968
- 1968-07-18 AT AT690668A patent/AT275784B/de active
- 1968-07-19 CH CH1087068A patent/CH477194A/de not_active IP Right Cessation
- 1968-07-23 FR FR1575094D patent/FR1575094A/fr not_active Expired
- 1968-07-29 FI FI682149A patent/FI46320C/fi active
- 1968-08-02 BE BE719018D patent/BE719018A/xx unknown
- 1968-08-02 NO NO3056/68A patent/NO117606B/no unknown
- 1968-08-19 GB GB1230008D patent/GB1230008A/en not_active Expired
- 1968-09-10 US US758783A patent/US3530528A/en not_active Expired - Lifetime
- 1968-09-12 DK DK439268AA patent/DK119794B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK119794B (da) | 1971-02-22 |
| FR1575094A (enExample) | 1969-07-18 |
| CH477194A (de) | 1969-08-31 |
| GB1230008A (enExample) | 1971-04-28 |
| BE719018A (enExample) | 1969-01-16 |
| US3530528A (en) | 1970-09-29 |
| FI46320C (fi) | 1973-03-12 |
| FI46320B (enExample) | 1972-11-30 |
| AT275784B (de) | 1969-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0908554B1 (en) | Process for recovering alkali and energy from black liquor containing silicate | |
| CA2880041A1 (en) | Method for recovering pulping chemicals and reducing the concentration of potassium and chloride therein | |
| US3560329A (en) | Process for low sulfide chemical recovery | |
| US2238456A (en) | Purification of magnesium base liquors | |
| US3935100A (en) | Process for the treatment of waste waters containing sulfuric acid and/or ammonium sulfate | |
| US2752243A (en) | Ammonia-sulfur dioxide cooking acid regeneration | |
| JPH04241185A (ja) | 硫酸セルロース処理過程の硫化度の調節方法 | |
| US3650888A (en) | Pollution controlled polysulfide recovery process | |
| US2696424A (en) | Preparation of calcium bisulfite cooking acid from waste sulfite liquor | |
| NO117606B (enExample) | ||
| CA1163424A (en) | Method for ammonia recovery | |
| US3619350A (en) | Chlorine dioxide pulp bleaching system | |
| JP4105171B2 (ja) | クラフトパルプ黒液のガス化方法と水素製造方法 | |
| US4208245A (en) | Pyrolysis of spent pulping liquors | |
| US3650889A (en) | Pollution controlled polysulfide recovery process | |
| US3525666A (en) | Process for preparing kraft pulping liquor from black liquor including separate carbonation with combustion gases and evaporation steps | |
| CA2103664C (en) | Method of recovering energy and chemicals from black liquor | |
| US3705077A (en) | Waste disposal process for spent wood-pulping liquors | |
| US2392435A (en) | Process of disposal of sulphite waste liquor | |
| US4253911A (en) | Process for maintaining a low sodium chloride content in recycled sodium chemicals of sodium-based pulp manufacturing processes | |
| US4131508A (en) | Recovery system for oxygen bleaching of pulp | |
| US2947656A (en) | Processing of spent cooking liquors | |
| CA1053412A (en) | Process and apparatus for recovery of sulfur from a polysulfide pulping operation | |
| CA1172808A (en) | Kraft overload recovery process | |
| NO762084L (enExample) |