NO116483B - - Google Patents
Download PDFInfo
- Publication number
- NO116483B NO116483B NO167102A NO16710267A NO116483B NO 116483 B NO116483 B NO 116483B NO 167102 A NO167102 A NO 167102A NO 16710267 A NO16710267 A NO 16710267A NO 116483 B NO116483 B NO 116483B
- Authority
- NO
- Norway
- Prior art keywords
- dimethyl
- acetylene
- parts
- aldehyde
- condensation
- Prior art date
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 16
- 238000009833 condensation Methods 0.000 claims description 9
- 230000005494 condensation Effects 0.000 claims description 9
- 239000007859 condensation product Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 7
- -1 lithium aldehyde Chemical class 0.000 claims description 7
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 5
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 5
- VWWMOACCGFHMEV-UHFFFAOYSA-N dicarbide(2-) Chemical compound [C-]#[C-] VWWMOACCGFHMEV-UHFFFAOYSA-N 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000006053 organic reaction Methods 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- 239000000203 mixture Substances 0.000 description 6
- ARNWQMJQALNBBV-UHFFFAOYSA-N lithium carbide Chemical compound [Li+].[Li+].[C-]#[C-] ARNWQMJQALNBBV-UHFFFAOYSA-N 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 238000010653 organometallic reaction Methods 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 238000003747 Grignard reaction Methods 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- ZUQAPLKKNAQJAU-UHFFFAOYSA-N acetylenediol Chemical compound OC#CO ZUQAPLKKNAQJAU-UHFFFAOYSA-N 0.000 description 2
- 150000001339 alkali metal compounds Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CIHXIRAAMAUYLZ-UHFFFAOYSA-N [K+].[K+].[C-]#[C-] Chemical compound [K+].[K+].[C-]#[C-] CIHXIRAAMAUYLZ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000004791 alkyl magnesium halides Chemical class 0.000 description 1
- OENHQHLEOONYIE-UKMVMLAPSA-N all-trans beta-carotene Natural products CC=1CCCC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C OENHQHLEOONYIE-UKMVMLAPSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- TUPZEYHYWIEDIH-WAIFQNFQSA-N beta-carotene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C=CC=C(/C)C=CC2=CCCCC2(C)C TUPZEYHYWIEDIH-WAIFQNFQSA-N 0.000 description 1
- 235000013734 beta-carotene Nutrition 0.000 description 1
- 239000011648 beta-carotene Substances 0.000 description 1
- 229960002747 betacarotene Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- UIXRSLJINYRGFQ-UHFFFAOYSA-N calcium carbide Chemical compound [Ca+2].[C-]#[C-] UIXRSLJINYRGFQ-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical compound [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 1
- YWTONQSCZFNWCK-UHFFFAOYSA-J dimagnesium acetylene tetrabromide Chemical compound [Mg+2].[Mg+2].[Br-].[Br-].[Br-].[Br-].C#C YWTONQSCZFNWCK-UHFFFAOYSA-J 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- OENHQHLEOONYIE-JLTXGRSLSA-N β-Carotene Chemical compound CC=1CCCC(C)(C)C=1\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C OENHQHLEOONYIE-JLTXGRSLSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US53322366A | 1966-03-10 | 1966-03-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO116483B true NO116483B (cs) | 1969-03-31 |
Family
ID=24125028
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO167102A NO116483B (cs) | 1966-03-10 | 1967-03-03 |
Country Status (14)
| Country | Link |
|---|---|
| AT (1) | AT272751B (cs) |
| BE (1) | BE695265A (cs) |
| BR (1) | BR6787564D0 (cs) |
| CH (1) | CH485404A (cs) |
| DE (1) | DE1642316A1 (cs) |
| DK (1) | DK117417B (cs) |
| ES (1) | ES337646A1 (cs) |
| FR (1) | FR1514528A (cs) |
| GB (1) | GB1157164A (cs) |
| IL (1) | IL27465A (cs) |
| NL (1) | NL6703068A (cs) |
| NO (1) | NO116483B (cs) |
| OA (1) | OA02348A (cs) |
| SE (1) | SE348187B (cs) |
-
1967
- 1967-02-21 IL IL27465A patent/IL27465A/en unknown
- 1967-02-27 NL NL6703068A patent/NL6703068A/xx unknown
- 1967-03-03 NO NO167102A patent/NO116483B/no unknown
- 1967-03-06 BR BR187564/67A patent/BR6787564D0/pt unknown
- 1967-03-06 ES ES337646A patent/ES337646A1/es not_active Expired
- 1967-03-07 CH CH329267A patent/CH485404A/de not_active IP Right Cessation
- 1967-03-08 AT AT220467A patent/AT272751B/de active
- 1967-03-09 SE SE03264/67A patent/SE348187B/xx unknown
- 1967-03-09 DE DE19671642316 patent/DE1642316A1/de active Pending
- 1967-03-09 BE BE695265D patent/BE695265A/xx unknown
- 1967-03-09 FR FR98136A patent/FR1514528A/fr not_active Expired
- 1967-03-09 OA OA52803A patent/OA02348A/xx unknown
- 1967-03-09 DK DK124867AA patent/DK117417B/da unknown
- 1967-03-10 GB GB11434/67A patent/GB1157164A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK117417B (da) | 1970-04-27 |
| AT272751B (de) | 1969-07-25 |
| ES337646A1 (es) | 1968-03-01 |
| BR6787564D0 (pt) | 1973-12-26 |
| IL27465A (en) | 1971-01-28 |
| SE348187B (cs) | 1972-08-28 |
| BE695265A (cs) | 1967-09-11 |
| CH485404A (de) | 1970-02-15 |
| FR1514528A (fr) | 1968-02-23 |
| OA02348A (fr) | 1970-05-05 |
| GB1157164A (en) | 1969-07-02 |
| NL6703068A (cs) | 1967-09-11 |
| DE1642316A1 (de) | 1971-05-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Clayton et al. | Reaction of paraffin hydrocarbons with phosphorus trichloride and oxygen to produce alkanephosphonyl chlorides | |
| CN109970534B (zh) | 一种合成桃小食心虫性信息素的方法 | |
| Prugh et al. | The Synthesis and Proton Magnetic Resonance Spectra of Some Brominated Furans1 | |
| Curtin et al. | Preparation of Stereoisomeric Alkenyllithium Compounds. II. cis-and trans-1, 2-Diphenylvinyllithium and α-and β-Styryllithium1 | |
| US1945183A (en) | Manufacture of alkoxy derivatives of phosphorous acid chlorides | |
| NO116483B (cs) | ||
| Seyferth et al. | The reaction of gem-dichloroallyllithium with halides of silicon, germanium, tin and mercury, and with triphenylborane. Equilibrium vs. kinetic control of regioselectivity | |
| Lewis et al. | Solvent Effects in the Grignard Reaction1 | |
| US2456316A (en) | Method for producing alpha-ethylpiperonyl ethers | |
| CA2842696A1 (en) | Methods of isolating 4-chloro-2-fluoro-3-substituted-phenylboronic acids | |
| US2780658A (en) | Preparation of unsaturated acyclic halides | |
| CN101932545B (zh) | 取代的环己烯酮 | |
| US2082568A (en) | Vinylethinyl derivatives and processes for producing same | |
| US4286108A (en) | Process for preparing hydrazines | |
| US2954411A (en) | Process for the preparation of cyclopropanes | |
| US2852569A (en) | Preparation of perfluoroaldehydes and aldehydrols | |
| US3592594A (en) | Process for the manufacture of phosphorus pentafluoride | |
| JPS5944315B2 (ja) | 2−ペンチニルエ−テルの製造法 | |
| US3953530A (en) | Process for making o- and p-chlorophenols | |
| SU814280A3 (ru) | Способ получени 0,0-диметил- 0-2,2-диХлОРВиНилфОСфАТА | |
| US2741622A (en) | Preparation of thiophene-2-aldehydes | |
| US2783281A (en) | Ethyl-chloromethyl-propargylcarbinol | |
| SU891655A1 (ru) | Способ получени бис-(алкоксиметил)-селенидов | |
| US4026954A (en) | Method for preparing hexyn-3-ol-1 | |
| US2783280A (en) | Methyl-(2-chloroethyl)-propargylcarbinol |