NL8104076A - Carbaminezuurderivaten. - Google Patents
Carbaminezuurderivaten. Download PDFInfo
- Publication number
- NL8104076A NL8104076A NL8104076A NL8104076A NL8104076A NL 8104076 A NL8104076 A NL 8104076A NL 8104076 A NL8104076 A NL 8104076A NL 8104076 A NL8104076 A NL 8104076A NL 8104076 A NL8104076 A NL 8104076A
- Authority
- NL
- Netherlands
- Prior art keywords
- methyl
- ethyl
- phenoxy
- ethyl ester
- acid ethyl
- Prior art date
Links
- 150000004657 carbamic acid derivatives Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 46
- 239000001257 hydrogen Substances 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- -1 [2- (p-benzylphenoxy) ethyl] methyl Chemical group 0.000 claims description 28
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 22
- 150000002431 hydrogen Chemical class 0.000 claims description 21
- 239000003795 chemical substances by application Substances 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 125000004494 ethyl ester group Chemical group 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- SURZCVYFPAXNGN-UHFFFAOYSA-N methyl-carbamic acid ethyl ester Chemical compound CCOC(=O)NC SURZCVYFPAXNGN-UHFFFAOYSA-N 0.000 claims description 6
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Chemical group 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- ULAWOHLWYXVGDU-UHFFFAOYSA-N O(C1=CC=CC=C1)C1=C(C=C(C=C1)C)OCCN(C(OCC)=O)C Chemical compound O(C1=CC=CC=C1)C1=C(C=C(C=C1)C)OCCN(C(OCC)=O)C ULAWOHLWYXVGDU-UHFFFAOYSA-N 0.000 claims description 3
- ALZKJZOPMNJCSF-UHFFFAOYSA-N ethyl n-[2-[4-(3-chlorophenoxy)phenoxy]ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC(Cl)=C1 ALZKJZOPMNJCSF-UHFFFAOYSA-N 0.000 claims description 3
- VQKLFTCOCMEKPN-UHFFFAOYSA-N ethyl n-[2-[4-(3-fluorophenoxy)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1OC1=CC=CC(F)=C1 VQKLFTCOCMEKPN-UHFFFAOYSA-N 0.000 claims description 3
- DPFDNJCEPOFAKL-UHFFFAOYSA-N ethyl n-[2-[4-(4-fluorophenoxy)phenoxy]ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=C(F)C=C1 DPFDNJCEPOFAKL-UHFFFAOYSA-N 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- QATJNZBPMBEADK-UHFFFAOYSA-N methyl n-methyl-n-[2-(4-phenoxyphenoxy)ethyl]carbamate Chemical compound C1=CC(OCCN(C)C(=O)OC)=CC=C1OC1=CC=CC=C1 QATJNZBPMBEADK-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- QZTHYNMPFSYGKG-UHFFFAOYSA-N ethyl n-[2-(4-benzoylphenoxy)ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1C(=O)C1=CC=CC=C1 QZTHYNMPFSYGKG-UHFFFAOYSA-N 0.000 claims description 2
- SUWHBIABGCPPTQ-UHFFFAOYSA-N ethyl n-[2-(4-benzoylphenoxy)propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1C(=O)C1=CC=CC=C1 SUWHBIABGCPPTQ-UHFFFAOYSA-N 0.000 claims description 2
- TVSAKJCIIHYSSY-UHFFFAOYSA-N ethyl n-[2-[4-(2-fluorophenoxy)phenoxy]ethyl]-n-methylcarbamate Chemical class C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC=C1F TVSAKJCIIHYSSY-UHFFFAOYSA-N 0.000 claims description 2
- OIOAWVCIKNVYKR-UHFFFAOYSA-N ethyl n-[2-[4-(3-bromophenoxy)phenoxy]ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC(Br)=C1 OIOAWVCIKNVYKR-UHFFFAOYSA-N 0.000 claims description 2
- XJNIOLWFUXZZGG-UHFFFAOYSA-N ethyl n-[2-[4-(3-chlorophenoxy)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1OC1=CC=CC(Cl)=C1 XJNIOLWFUXZZGG-UHFFFAOYSA-N 0.000 claims description 2
- ZCDCAOSQFJWUJV-UHFFFAOYSA-N ethyl n-[2-[4-(3-nitrophenoxy)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1OC1=CC=CC([N+]([O-])=O)=C1 ZCDCAOSQFJWUJV-UHFFFAOYSA-N 0.000 claims description 2
- SLRYJTZOOZUBHW-UHFFFAOYSA-N ethyl n-[2-[4-(4-fluorobenzoyl)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1C(=O)C1=CC=C(F)C=C1 SLRYJTZOOZUBHW-UHFFFAOYSA-N 0.000 claims description 2
- VHXJMPYHQAIMAL-UHFFFAOYSA-N ethyl n-[2-[4-(4-fluorophenoxy)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1OC1=CC=C(F)C=C1 VHXJMPYHQAIMAL-UHFFFAOYSA-N 0.000 claims description 2
- UDJNEQOLPBOPAO-UHFFFAOYSA-N ethyl n-butyl-n-[2-(4-phenoxyphenoxy)ethyl]carbamate Chemical compound C1=CC(OCCN(CCCC)C(=O)OCC)=CC=C1OC1=CC=CC=C1 UDJNEQOLPBOPAO-UHFFFAOYSA-N 0.000 claims description 2
- ALUUIWAPTJRPQV-UHFFFAOYSA-N ethyl n-methyl-n-[2-(4-phenoxyphenoxy)ethyl]carbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC=C1 ALUUIWAPTJRPQV-UHFFFAOYSA-N 0.000 claims description 2
- NKOBTXJYUJYFIH-UHFFFAOYSA-N ethyl n-methyl-n-[2-[4-(4-nitrophenoxy)phenoxy]ethyl]carbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 NKOBTXJYUJYFIH-UHFFFAOYSA-N 0.000 claims description 2
- GTOKAWYXANYGFG-UHFFFAOYSA-N ethyl n-propylcarbamate Chemical compound CCCNC(=O)OCC GTOKAWYXANYGFG-UHFFFAOYSA-N 0.000 claims description 2
- HHIQZQQZNFMPGW-UHFFFAOYSA-N methyl n-[2-(4-phenoxyphenoxy)propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OC)=CC=C1OC1=CC=CC=C1 HHIQZQQZNFMPGW-UHFFFAOYSA-N 0.000 claims description 2
- XFCKYGSNYZDWJE-UHFFFAOYSA-N propan-2-yl n-[2-(4-benzoylphenoxy)ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=CC=C1 XFCKYGSNYZDWJE-UHFFFAOYSA-N 0.000 claims description 2
- OJRHAUSLVRVYNR-UHFFFAOYSA-N propan-2-yl n-[2-(4-phenoxyphenoxy)propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OC(C)C)=CC=C1OC1=CC=CC=C1 OJRHAUSLVRVYNR-UHFFFAOYSA-N 0.000 claims description 2
- SYNGJIGLJNATFW-UHFFFAOYSA-N propan-2-yl n-[2-[4-(3-bromophenoxy)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OC(C)C)=CC=C1OC1=CC=CC(Br)=C1 SYNGJIGLJNATFW-UHFFFAOYSA-N 0.000 claims description 2
- IIIKOPQLCZLAHK-UHFFFAOYSA-N 2-[4-(3-fluorophenoxy)phenoxy]ethyl-methylcarbamic acid Chemical compound C1=CC(OCCN(C)C(O)=O)=CC=C1OC1=CC=CC(F)=C1 IIIKOPQLCZLAHK-UHFFFAOYSA-N 0.000 claims 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims 1
- YSWDEVNKRZTYQZ-UHFFFAOYSA-N C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC(Cl)=CC=C1C Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC(Cl)=CC=C1C YSWDEVNKRZTYQZ-UHFFFAOYSA-N 0.000 claims 1
- XLPFLCTZNRMTQB-UHFFFAOYSA-N ethyl n-ethyl-n-methylcarbamate Chemical compound CCOC(=O)N(C)CC XLPFLCTZNRMTQB-UHFFFAOYSA-N 0.000 claims 1
- HJUFTIJOISQSKQ-UHFFFAOYSA-N fenoxycarb Chemical compound C1=CC(OCCNC(=O)OCC)=CC=C1OC1=CC=CC=C1 HJUFTIJOISQSKQ-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000013543 active substance Substances 0.000 description 20
- ZSBDGXGICLIJGD-UHFFFAOYSA-N 4-phenoxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC=C1 ZSBDGXGICLIJGD-UHFFFAOYSA-N 0.000 description 18
- 238000009835 boiling Methods 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 12
- KQXIITSXVXNHJX-UHFFFAOYSA-N ethyl n-(2-chloroethyl)-n-methylcarbamate Chemical compound CCOC(=O)N(C)CCCl KQXIITSXVXNHJX-UHFFFAOYSA-N 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N Vilsmeier-Haack reagent Natural products CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 239000007921 spray Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- SXSZFJUGNJWCNB-UHFFFAOYSA-N 1-(ethoxycarbonylamino)propan-2-yl methanesulfonate Chemical compound CCOC(=O)NCC(C)OS(C)(=O)=O SXSZFJUGNJWCNB-UHFFFAOYSA-N 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 4
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000012876 carrier material Substances 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XQVUQRPTZAUIOS-UHFFFAOYSA-N 4-(3-bromophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC(Br)=C1 XQVUQRPTZAUIOS-UHFFFAOYSA-N 0.000 description 3
- NZHLVKVLXNJORY-UHFFFAOYSA-N 4-(3-nitrophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC([N+]([O-])=O)=C1 NZHLVKVLXNJORY-UHFFFAOYSA-N 0.000 description 3
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 3
- 241000238876 Acari Species 0.000 description 3
- 241000255789 Bombyx mori Species 0.000 description 3
- 241000258937 Hemiptera Species 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000526145 Psylla Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- MNZMECMQTYGSOI-UHFFFAOYSA-N acetic acid;hydron;bromide Chemical compound Br.CC(O)=O MNZMECMQTYGSOI-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- GPAFVMVMCVTSPO-UHFFFAOYSA-N propan-2-yl n-(2-chloroethyl)-n-methylcarbamate Chemical compound CC(C)OC(=O)N(C)CCCl GPAFVMVMCVTSPO-UHFFFAOYSA-N 0.000 description 3
- 239000008262 pumice Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- BCZCUKRMBXFWRB-UHFFFAOYSA-N 1-(methoxycarbonylamino)propan-2-yl methanesulfonate Chemical compound COC(=O)NCC(C)OS(C)(=O)=O BCZCUKRMBXFWRB-UHFFFAOYSA-N 0.000 description 2
- UHSDQKXCMYGOTF-UHFFFAOYSA-N 1-(propan-2-yloxycarbonylamino)propan-2-yl methanesulfonate Chemical compound CC(C)OC(=O)NCC(C)OS(C)(=O)=O UHSDQKXCMYGOTF-UHFFFAOYSA-N 0.000 description 2
- NCTBMVAIKUNJFJ-UHFFFAOYSA-N 1-methoxy-4-(3-methylphenoxy)benzene Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC(C)=C1 NCTBMVAIKUNJFJ-UHFFFAOYSA-N 0.000 description 2
- BNMNQSSEFSCQJH-UHFFFAOYSA-N 4-(3-methylphenoxy)phenol Chemical compound CC1=CC=CC(OC=2C=CC(O)=CC=2)=C1 BNMNQSSEFSCQJH-UHFFFAOYSA-N 0.000 description 2
- PNRWPTBVLWWBCW-UHFFFAOYSA-N 4-(5-chloro-2-methylphenoxy)phenol Chemical compound CC1=CC=C(Cl)C=C1OC1=CC=C(O)C=C1 PNRWPTBVLWWBCW-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- 241000254173 Coleoptera Species 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 241000256602 Isoptera Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001491877 Operophtera brumata Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- QSXFDLABPQCEBQ-UHFFFAOYSA-N ethyl n-[2-(4-benzylphenoxy)propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1CC1=CC=CC=C1 QSXFDLABPQCEBQ-UHFFFAOYSA-N 0.000 description 2
- ANLVALXNMZTXGX-UHFFFAOYSA-N ethyl n-butyl-n-(2-chloroethyl)carbamate Chemical compound CCCCN(CCCl)C(=O)OCC ANLVALXNMZTXGX-UHFFFAOYSA-N 0.000 description 2
- VAMUBMXKZDWUKN-UHFFFAOYSA-N ethyl n-butyl-n-(2-hydroxyethyl)carbamate Chemical compound CCCCN(CCO)C(=O)OCC VAMUBMXKZDWUKN-UHFFFAOYSA-N 0.000 description 2
- QXJGQKUZHWGJCU-UHFFFAOYSA-N ethyl n-ethyl-n-[2-(4-phenoxyphenoxy)ethyl]carbamate Chemical compound C1=CC(OCCN(CC)C(=O)OCC)=CC=C1OC1=CC=CC=C1 QXJGQKUZHWGJCU-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- NYXHSRNBKJIQQG-UHFFFAOYSA-N methyl n-methylcarbamate Chemical compound CNC(=O)OC NYXHSRNBKJIQQG-UHFFFAOYSA-N 0.000 description 2
- XZYVHUPTGIUTKS-UHFFFAOYSA-N methyl-[2-(4-phenoxyphenoxy)ethyl]carbamothioic S-acid Chemical compound C1=CC(OCCN(C)C(S)=O)=CC=C1OC1=CC=CC=C1 XZYVHUPTGIUTKS-UHFFFAOYSA-N 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 229940031826 phenolate Drugs 0.000 description 2
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 2
- IMIXKFVLHCOHCZ-UHFFFAOYSA-N propan-2-yl n-methyl-n-[2-(4-phenoxyphenoxy)ethyl]carbamate Chemical compound C1=CC(OCCN(C)C(=O)OC(C)C)=CC=C1OC1=CC=CC=C1 IMIXKFVLHCOHCZ-UHFFFAOYSA-N 0.000 description 2
- ZLQUUMARLOVRLO-UHFFFAOYSA-N propan-2-yl n-methylcarbamate Chemical compound CNC(=O)OC(C)C ZLQUUMARLOVRLO-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CSYDROGXZKHHQE-UHFFFAOYSA-N 1-(4-methoxyphenoxy)-3-nitrobenzene Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC([N+]([O-])=O)=C1 CSYDROGXZKHHQE-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- QDFKKJYEIFBEFC-UHFFFAOYSA-N 1-bromo-3-fluorobenzene Chemical compound FC1=CC=CC(Br)=C1 QDFKKJYEIFBEFC-UHFFFAOYSA-N 0.000 description 1
- YTCGOUNVIAWCMG-UHFFFAOYSA-N 1-chloro-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(Cl)=C1 YTCGOUNVIAWCMG-UHFFFAOYSA-N 0.000 description 1
- NISKOWODFMZRJH-UHFFFAOYSA-N 1-fluoro-3-(4-methoxyphenoxy)benzene Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC(F)=C1 NISKOWODFMZRJH-UHFFFAOYSA-N 0.000 description 1
- LJDSTRZHPWMDPG-UHFFFAOYSA-N 2-(butylamino)ethanol Chemical compound CCCCNCCO LJDSTRZHPWMDPG-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- HINVSEIUDPOQIP-UHFFFAOYSA-N 4-(3-chlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC(Cl)=C1 HINVSEIUDPOQIP-UHFFFAOYSA-N 0.000 description 1
- CSELFPNBUAQDMK-UHFFFAOYSA-N 4-[(4-chlorophenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=C(Cl)C=C1 CSELFPNBUAQDMK-UHFFFAOYSA-N 0.000 description 1
- HJSPWKGEPDZNLK-UHFFFAOYSA-N 4-benzylphenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1 HJSPWKGEPDZNLK-UHFFFAOYSA-N 0.000 description 1
- RHPUJHQBPORFGV-UHFFFAOYSA-N 4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=CC=C1O RHPUJHQBPORFGV-UHFFFAOYSA-N 0.000 description 1
- ZSSUJRQWYAQBHN-UHFFFAOYSA-N 4-methoxy-2-methyl-1-phenoxybenzene Chemical compound CC1=CC(OC)=CC=C1OC1=CC=CC=C1 ZSSUJRQWYAQBHN-UHFFFAOYSA-N 0.000 description 1
- PKDVWOVKDPEBQF-UHFFFAOYSA-N 4-methoxy-2-methylphenol Chemical compound COC1=CC=C(O)C(C)=C1 PKDVWOVKDPEBQF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241001672675 Adoxophyes Species 0.000 description 1
- 241000256111 Aedes <genus> Species 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- 241001414900 Anopheles stephensi Species 0.000 description 1
- 241001414828 Aonidiella aurantii Species 0.000 description 1
- 241000294569 Aphelenchoides Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241000387313 Aspidiotus Species 0.000 description 1
- 241001503477 Athalia rosae Species 0.000 description 1
- 241000726103 Atta Species 0.000 description 1
- 241000254127 Bemisia tabaci Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- 235000005039 Brassica rapa var. dichotoma Nutrition 0.000 description 1
- VXJVJGYKHGWOTC-UHFFFAOYSA-N CS(=O)(=O)OC(C)CNC(O)=O Chemical compound CS(=O)(=O)OC(C)CNC(O)=O VXJVJGYKHGWOTC-UHFFFAOYSA-N 0.000 description 1
- 241000776777 Cacopsylla mali Species 0.000 description 1
- 241000257160 Calliphora Species 0.000 description 1
- 241000252254 Catostomidae Species 0.000 description 1
- 241000255945 Choristoneura Species 0.000 description 1
- 241000254137 Cicadidae Species 0.000 description 1
- 241001465977 Coccoidea Species 0.000 description 1
- 241001478240 Coccus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000256059 Culex pipiens Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000586568 Diaspidiotus perniciosus Species 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241000399949 Ditylenchus dipsaci Species 0.000 description 1
- 241001425477 Dysdercus Species 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000630736 Ephestia Species 0.000 description 1
- 241000825555 Eurydema gebleri Species 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241001442498 Globodera Species 0.000 description 1
- 241001466007 Heteroptera Species 0.000 description 1
- 241001417351 Hoplocampa Species 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001470016 Laodelphax Species 0.000 description 1
- 241001177160 Lasioderma Species 0.000 description 1
- 241001268491 Laspeyresia Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241001414826 Lygus Species 0.000 description 1
- 241000721703 Lymantria dispar Species 0.000 description 1
- 241001581015 Lyonetia clerkella Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241000952627 Monomorium pharaonis Species 0.000 description 1
- 241000721621 Myzus persicae Species 0.000 description 1
- 241000238834 Nauphoeta cinerea Species 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 241000359016 Nephotettix Species 0.000 description 1
- 241000258913 Oncopeltus fasciatus Species 0.000 description 1
- 241001465800 Orgyia Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241001147398 Ostrinia nubilalis Species 0.000 description 1
- 241000488583 Panonychus ulmi Species 0.000 description 1
- 241000238661 Periplaneta Species 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- 241000595626 Plodia Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000193940 Pratylenchus penetrans Species 0.000 description 1
- 241001417458 Pristiphora Species 0.000 description 1
- 241001058123 Rhizoecus Species 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- VHLNVLPCKBNNBB-UHFFFAOYSA-N S-ethyl N-(2-chloroethyl)-N-methylcarbamothioate Chemical compound CCSC(=O)N(C)CCCl VHLNVLPCKBNNBB-UHFFFAOYSA-N 0.000 description 1
- 241001450655 Saissetia Species 0.000 description 1
- 241001635185 Sciara Species 0.000 description 1
- 241000254152 Sitophilus oryzae Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 241000736128 Solenopsis invicta Species 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241000254109 Tenebrio molitor Species 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- 241001238451 Tortrix viridana Species 0.000 description 1
- 241000018137 Trialeurodes vaporariorum Species 0.000 description 1
- 241000254113 Tribolium castaneum Species 0.000 description 1
- 241000267822 Trogoderma granarium Species 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- GNHQSAUHXKRQMC-UHFFFAOYSA-N benzene;chlorine Chemical class [Cl].C1=CC=CC=C1 GNHQSAUHXKRQMC-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 244000130745 brown sarson Species 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- PVRURSUNJSVMEZ-UHFFFAOYSA-N ethyl n-(2-chloroethyl)-n-propan-2-ylcarbamate Chemical compound CCOC(=O)N(C(C)C)CCCl PVRURSUNJSVMEZ-UHFFFAOYSA-N 0.000 description 1
- HQLMZQGNFIHLMS-UHFFFAOYSA-N ethyl n-[2-(4-phenoxyphenoxy)propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1OC1=CC=CC=C1 HQLMZQGNFIHLMS-UHFFFAOYSA-N 0.000 description 1
- HGLZTTFGCFUDCZ-UHFFFAOYSA-N ethyl n-[2-[4-(3-bromophenoxy)phenoxy]propyl]carbamate Chemical compound C1=CC(OC(C)CNC(=O)OCC)=CC=C1OC1=CC=CC(Br)=C1 HGLZTTFGCFUDCZ-UHFFFAOYSA-N 0.000 description 1
- UXKQFXIPMZYKKH-UHFFFAOYSA-N ethyl n-[2-[4-(3-fluorophenoxy)phenoxy]ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC(F)=C1 UXKQFXIPMZYKKH-UHFFFAOYSA-N 0.000 description 1
- GNKDINGSDUZNOU-UHFFFAOYSA-N ethyl n-[2-[4-[(4-chlorophenyl)methyl]phenoxy]ethyl]-n-methylcarbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1CC1=CC=C(Cl)C=C1 GNKDINGSDUZNOU-UHFFFAOYSA-N 0.000 description 1
- IEYJTEMOBSSRTK-UHFFFAOYSA-N ethyl n-ethyl-n-propan-2-ylcarbamate Chemical compound CCOC(=O)N(CC)C(C)C IEYJTEMOBSSRTK-UHFFFAOYSA-N 0.000 description 1
- YJAWTZOTZMCVMU-UHFFFAOYSA-N ethyl n-methyl-n-[2-[4-(3-methylphenoxy)phenoxy]ethyl]carbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC(C)=C1 YJAWTZOTZMCVMU-UHFFFAOYSA-N 0.000 description 1
- OFGAFZRAAARIQN-UHFFFAOYSA-N ethyl n-methyl-n-[2-[4-(3-nitrophenoxy)phenoxy]ethyl]carbamate Chemical compound C1=CC(OCCN(C)C(=O)OCC)=CC=C1OC1=CC=CC([N+]([O-])=O)=C1 OFGAFZRAAARIQN-UHFFFAOYSA-N 0.000 description 1
- JGRPZAGOYKNIAC-UHFFFAOYSA-N ethyl n-propan-2-ylcarbamate Chemical compound CCOC(=O)NC(C)C JGRPZAGOYKNIAC-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- RASAJAJIGMQFBL-UHFFFAOYSA-N methyl n-(2-chloroethyl)-n-methylcarbamate Chemical compound COC(=O)N(C)CCCl RASAJAJIGMQFBL-UHFFFAOYSA-N 0.000 description 1
- OGRXQUOJBCQAGA-UHFFFAOYSA-N methyl n-(2-hydroxypropyl)carbamate Chemical compound COC(=O)NCC(C)O OGRXQUOJBCQAGA-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- QXKBVUYEKUTPEH-UHFFFAOYSA-N propan-2-yl n-(2-hydroxypropyl)carbamate Chemical compound CC(C)OC(=O)NCC(C)O QXKBVUYEKUTPEH-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- VPLLUBZAGDWQQT-UHFFFAOYSA-N s-ethyl n-(2-hydroxyethyl)-n-methylcarbamothioate Chemical compound CCSC(=O)N(C)CCO VPLLUBZAGDWQQT-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/295—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings containing hydroxy or O-metal groups
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/12—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof containing a —O—CO—N< group, or a thio analogue thereof, neither directly attached to a ring nor the nitrogen atom being a member of a heterocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/38—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to a carbon atom of a six-membered aromatic ring, e.g. nitrodiphenyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/263—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings the aromatic rings being non-condensed
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/29—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings containing halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH712080 | 1980-09-23 | ||
| CH712080A CH645345A5 (en) | 1980-09-23 | 1980-09-23 | Carbamic acid derivatives and their use as pesticides |
| CH430781 | 1981-06-30 | ||
| CH430781 | 1981-06-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8104076A true NL8104076A (nl) | 1982-04-16 |
Family
ID=25695169
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8104076A NL8104076A (nl) | 1980-09-23 | 1981-09-02 | Carbaminezuurderivaten. |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4413010A (OSRAM) |
| DE (1) | DE3136428A1 (OSRAM) |
| ES (1) | ES505679A0 (OSRAM) |
| FR (1) | FR2490636A1 (OSRAM) |
| GB (1) | GB2084574B (OSRAM) |
| IL (1) | IL63871A (OSRAM) |
| IT (1) | IT1138193B (OSRAM) |
| NL (1) | NL8104076A (OSRAM) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL8104076A (nl) * | 1980-09-23 | 1982-04-16 | Hoffmann La Roche | Carbaminezuurderivaten. |
| EP0113831A3 (de) * | 1982-12-17 | 1984-11-07 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Carbaminsäureester, Verfahren zu deren Herstellung und deren Verwendung |
| US4554290A (en) * | 1983-06-17 | 1985-11-19 | Ciba-Geigy Corporation | Oxamic acid derivatives |
| JPS6056947A (ja) * | 1983-09-07 | 1985-04-02 | Sumitomo Chem Co Ltd | カ−バメ−ト誘導体およびそれを有効成分として含有する有害生物防除剤 |
| CA1249993A (en) * | 1983-10-18 | 1989-02-14 | Paul Winternitz | Aryloxyphenoxy(acyloxy)alkyloximes, -carbamates and-phosphonates |
| NZ221262A (en) * | 1986-08-06 | 1990-08-28 | Ciba Geigy Ag | Preventing the reinfestation of dogs and cats by fleas by administering to the host a flea growth inhibiting substance orally, parenterally or by implant |
| US4886899A (en) * | 1988-07-05 | 1989-12-12 | Pitman-Moore, Inc. | Housefly chemosterilants |
| EP0390740A1 (de) * | 1989-03-30 | 1990-10-03 | Ciba-Geigy Ag | Schädlingsbekämpfung |
| EP0390741A1 (de) * | 1989-03-30 | 1990-10-03 | Ciba-Geigy Ag | Schädlingsbekämpfung |
| US5192803A (en) * | 1989-04-14 | 1993-03-09 | Ciba-Geigy Corporation | Sulfenylated carbamic esters and their use in pesticides |
| TR24635A (tr) * | 1989-04-24 | 1992-01-01 | Ciba Geigy Ag | Acillenmis karbamit asit esterleri |
| EP0395582A3 (de) * | 1989-04-27 | 1991-01-09 | Ciba-Geigy Ag | Bisacyläthylamine |
| ES2084016T3 (es) * | 1989-06-21 | 1996-05-01 | Ciba Geigy Ag | Preparado pesticida. |
| ZA913759B (en) * | 1990-06-06 | 1992-02-26 | Sumitomo Chemical Co | Carbamic acid derivatives and their production and use |
| US5346920A (en) * | 1990-06-06 | 1994-09-13 | Sumitomo Chemical Company, Limited | Carbamic acid derivatives, and their production and use |
| CH680827A5 (OSRAM) * | 1991-03-14 | 1992-11-30 | Ciba Geigy Ag | |
| US5439924A (en) * | 1991-12-23 | 1995-08-08 | Virbac, Inc. | Systemic control of parasites |
| TW242109B (OSRAM) * | 1992-08-20 | 1995-03-01 | Ciba Geigy | |
| CN116602309A (zh) * | 2023-05-31 | 2023-08-18 | 河南农王实业有限公司 | 一种含苯氧威和有机磷农药的农用组合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1137506A (en) * | 1978-03-17 | 1982-12-14 | Ulf Fischer | Carbamic acid derivatives |
| NL8104076A (nl) * | 1980-09-23 | 1982-04-16 | Hoffmann La Roche | Carbaminezuurderivaten. |
-
1981
- 1981-09-02 NL NL8104076A patent/NL8104076A/nl not_active Application Discontinuation
- 1981-09-03 IT IT23771/81A patent/IT1138193B/it active
- 1981-09-14 DE DE19813136428 patent/DE3136428A1/de active Granted
- 1981-09-14 US US06/301,612 patent/US4413010A/en not_active Expired - Lifetime
- 1981-09-17 IL IL63871A patent/IL63871A/xx not_active IP Right Cessation
- 1981-09-21 FR FR8117786A patent/FR2490636A1/fr active Granted
- 1981-09-22 GB GB8128552A patent/GB2084574B/en not_active Expired
- 1981-09-22 ES ES505679A patent/ES505679A0/es active Granted
-
1983
- 1983-08-04 US US06/520,393 patent/US4607051A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4413010A (en) | 1983-11-01 |
| US4607051A (en) | 1986-08-19 |
| DE3136428A1 (de) | 1982-06-24 |
| IL63871A0 (en) | 1981-12-31 |
| ES8300692A1 (es) | 1982-11-16 |
| FR2490636A1 (fr) | 1982-03-26 |
| DE3136428C2 (OSRAM) | 1992-02-06 |
| GB2084574A (en) | 1982-04-15 |
| GB2084574B (en) | 1984-11-07 |
| IT1138193B (it) | 1986-09-17 |
| IL63871A (en) | 1984-10-31 |
| IT8123771A0 (it) | 1981-09-03 |
| FR2490636B1 (OSRAM) | 1985-01-11 |
| ES505679A0 (es) | 1982-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8104076A (nl) | Carbaminezuurderivaten. | |
| US4215139A (en) | Carbamic acid derivatives | |
| CA1095052A (en) | .alpha.,.alpha.-PHENYL-ISOPROPYLACETIC ACID .alpha.-CYANO-3'- PYRIDYL-2'-OXYBENZYL ESTERS | |
| CA1048046A (en) | Esters | |
| CA1093088A (en) | Pesticidal compositions | |
| US4625048A (en) | Carbamic acid esters | |
| EP0072475A2 (de) | Carbaminsäureester, Verfahren zu deren Herstellung, Schädlingsbekämpfungsmittel, die diese Verbindungen als Wirkstoffe enthalten, sowie Verwendung solcher Verbindungen und Mittel zur Bekämpfung von Schädlingen | |
| JPS6113459B2 (OSRAM) | ||
| CA1048047A (en) | Esters | |
| EP0071463B1 (en) | Thiolcarbamate compounds, and their production and use | |
| GB1567692A (en) | Pesticidal cyclopropane carboxylicesters | |
| US3856972A (en) | Carbamate pesticides | |
| US3761506A (en) | Cyclopropane carboxylic acid esters | |
| CA1129435A (en) | CYCLOPROPANECARBOXYLIC ACID-PHENOXY-.alpha.-VINYL-BENZYL ESTERS, PROCESSES FOR PRODUCING THEM, AND THEIR USE IN COMBATING PESTS | |
| CA1080743A (en) | Spiroheptenyl carboxylate | |
| CH645345A5 (en) | Carbamic acid derivatives and their use as pesticides | |
| DE2249462B2 (OSRAM) | ||
| CA1197519A (en) | Organotin compounds | |
| US4908383A (en) | N-phenyl-N-carboxythioureas and their use in the control of pests | |
| DE2719561A1 (de) | Chrysanthemumsaeureester, verfahren zu ihrer herstellung und schaedlingsbekaempfungsmittel | |
| CA1053238A (en) | O-ethyl-s-alkyl-s-picolyl-phosphoric thiolates | |
| EP0035971A2 (de) | Oximphosphate, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung | |
| JPH0258259B2 (OSRAM) | ||
| EP0114045A1 (de) | Pyrimidinderivate und deren Verwendung als Schädlingsbekämpfungsmittel | |
| EP0025014A1 (de) | N-(2-isobutyronitrilsulfenyl)-N-methyl-carbamate, Verfahren zu ihrer Herstellung, ihre Verwendung in der Schädlingsbekämpfung und sie enthaltende Schädlingsbekämpfungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |