NL8006955A - Tricyclische verbindingen. - Google Patents
Tricyclische verbindingen. Download PDFInfo
- Publication number
- NL8006955A NL8006955A NL8006955A NL8006955A NL8006955A NL 8006955 A NL8006955 A NL 8006955A NL 8006955 A NL8006955 A NL 8006955A NL 8006955 A NL8006955 A NL 8006955A NL 8006955 A NL8006955 A NL 8006955A
- Authority
- NL
- Netherlands
- Prior art keywords
- group
- alkyl
- hydrogen
- compounds
- acid
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 claims abstract description 12
- -1 methylenedioxy Chemical group 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 8
- 239000002253 acid Substances 0.000 claims abstract description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims abstract description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 4
- 150000003839 salts Chemical class 0.000 claims abstract description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 26
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- ZKALKRNFCIXQTL-UHFFFAOYSA-N 2H-oxazecine Chemical compound O1NC=CC=CC=CC=C1 ZKALKRNFCIXQTL-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- SDIWMYKQFRQDRI-UHFFFAOYSA-N 6,7,8,9-tetrahydro-5h-dibenz(b,i)(1,6)oxazecine Chemical compound C1=NC=CC2=CC=CC=C2OC2CCCCC2=C1 SDIWMYKQFRQDRI-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004043 oxo group Chemical group O=* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- BOYDSYCGWJXKMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-2-[2-(2-bromoethyl)phenoxy]benzene Chemical compound BrCCC1=CC=CC=C1OC1=CC=CC=C1CCBr BOYDSYCGWJXKMZ-UHFFFAOYSA-N 0.000 description 1
- MAVXYMHHIZLOJE-UHFFFAOYSA-N 1-(2-bromoethyl)-2-[2-(3-bromopropyl)phenoxy]benzene Chemical compound BrCCCC1=CC=CC=C1OC1=CC=CC=C1CCBr MAVXYMHHIZLOJE-UHFFFAOYSA-N 0.000 description 1
- XKZUBZVXDIGPRC-UHFFFAOYSA-N 1-(2-bromoethyl)-2-[2-(bromomethyl)phenoxy]benzene Chemical compound BrCCC1=CC=CC=C1OC1=CC=CC=C1CBr XKZUBZVXDIGPRC-UHFFFAOYSA-N 0.000 description 1
- PAAOQBVVKNXBQP-UHFFFAOYSA-N 1-[2-[2-(2-bromoethyl)phenoxy]phenyl]-n-methylmethanamine Chemical compound CNCC1=CC=CC=C1OC1=CC=CC=C1CCBr PAAOQBVVKNXBQP-UHFFFAOYSA-N 0.000 description 1
- KLIFRSHJPYKSKL-UHFFFAOYSA-N 1-oxa-2-azacycloundeca-2,4,6,8,10-pentaene Chemical compound O1N=CC=CC=CC=CC=C1 KLIFRSHJPYKSKL-UHFFFAOYSA-N 0.000 description 1
- XJHVULRFXZRBMG-UHFFFAOYSA-N 2,10-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaene Chemical compound C1NCCC2=CC=CC=C2NC2=CC=CC=C21 XJHVULRFXZRBMG-UHFFFAOYSA-N 0.000 description 1
- LQPCFNDUGHQYPW-UHFFFAOYSA-N 2,11-diazatricyclo[12.4.0.03,8]octadeca-1(14),3,5,7,10,12-hexaene Chemical compound N1C2=CC=CC=C2CC=NC=CC2=C1CCCC2 LQPCFNDUGHQYPW-UHFFFAOYSA-N 0.000 description 1
- FEDSUSSXDYBBPA-UHFFFAOYSA-N 2-[2-[2-(2-hydroxyethyl)phenoxy]phenyl]ethanol Chemical compound OCCC1=CC=CC=C1OC1=CC=CC=C1CCO FEDSUSSXDYBBPA-UHFFFAOYSA-N 0.000 description 1
- DQRZVYFNUJPUPX-UHFFFAOYSA-N 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1OC1=CC=CC=C1CC(O)=O DQRZVYFNUJPUPX-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- RVWUCGLYSRZBRZ-UHFFFAOYSA-N 2h-1,6-thiazecine Chemical compound C1SC=CC=CN=CC=C1 RVWUCGLYSRZBRZ-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- NITXHZCPEOMGIW-UHFFFAOYSA-N 5,6,7,8,9,10-hexahydro-7-methyl dibenz(b,j)(1,6)oxaazacycloundecine Chemical compound C1CN(C)CCCC2=CC=CC=C2OC2=CC=CC=C21 NITXHZCPEOMGIW-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- MLNHQCARKGXEJU-BTJKTKAUSA-N 6,7,8,9-tetrahydro-7-methyl-5h-dibenz(b,i)(1,6)oxazecine (z)-2-butene dioate Chemical compound OC(=O)\C=C/C(O)=O.C1=NC=CC2=CC=CC=C2OC2CC(C)CCC2=C1 MLNHQCARKGXEJU-BTJKTKAUSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- 229910004809 Na2 SO4 Inorganic materials 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 150000001299 aldehydes Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000561 anti-psychotic effect Effects 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Natural products OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D281/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one sulfur atom as the only ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/44—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reduction and hydrolysis of nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D245/00—Heterocyclic compounds containing rings of more than seven members having two nitrogen atoms as the only ring hetero atoms
- C07D245/04—Heterocyclic compounds containing rings of more than seven members having two nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8006955A NL8006955A (nl) | 1980-12-22 | 1980-12-22 | Tricyclische verbindingen. |
| EP81201362A EP0057777B1 (en) | 1980-12-22 | 1981-12-12 | Dibenzoxazonine, dibenzoxazecine, dibenzoxaazacycloundecane derivatives and their corresponding thia- and aza derivatives, their preparation and pharmaceutical compositions |
| HU82110A HU185195B (en) | 1980-12-22 | 1981-12-12 | Process for the preparation of dibenzo-oxa-aza-, thia-aza-as well as diaza-cycloalkane derivatives |
| PCT/EP1981/000195 WO1982002199A1 (en) | 1980-12-22 | 1981-12-12 | Tricyclic compounds |
| DE8181201362T DE3166645D1 (en) | 1980-12-22 | 1981-12-12 | Dibenzoxazonine, dibenzoxazecine, dibenzoxaazacycloundecane derivatives and their corresponding thia- and aza derivatives, their preparation and pharmaceutical compositions |
| AU79341/82A AU547599B2 (en) | 1980-12-22 | 1981-12-12 | Tricyclic compounds |
| AT81201362T ATE9798T1 (de) | 1980-12-22 | 1981-12-12 | Dibenz-oxazonine, dibenz-oxazecine und dibenzoxaazacycloundekan-derivate und uebereinstimmende thia- und aza-verbindungen, ihre herstellung und pharmazeutische zusammensetzungen. |
| IE2957/81A IE51952B1 (en) | 1980-12-22 | 1981-12-16 | Dibenzoxazonine,dibenzoxazecine,dibenzoxaazacycloundecane derivatives and their corresponding thia-and aza derivatives,their preparation and pharmaceutical compositions containing them |
| US06/331,303 US4374133A (en) | 1980-12-22 | 1981-12-16 | Tricyclic compounds |
| ZA818782A ZA818782B (en) | 1980-12-22 | 1981-12-18 | Tricyclic compounds |
| ES508218A ES508218A0 (es) | 1980-12-22 | 1981-12-21 | Un procedimiento para la preparacion de nuevos derivados de dibenzoxazonina, dibenzoxazelina o dibenzooxaazacicloundeca-no y sus correspondientes derivados tia y aza. |
| PT74169A PT74169B (en) | 1980-12-22 | 1981-12-21 | Tricyclic compounds |
| CA000392881A CA1174236A (en) | 1980-12-22 | 1981-12-22 | Tricyclic compounds |
| GR66890A GR76976B (show.php) | 1980-12-22 | 1981-12-22 | |
| FI821944A FI74957C (fi) | 1980-12-22 | 1982-06-01 | Foerfarande foer framstaellning av nya, antipsykotiskt verkande dibensoxazonin-, dibensoxazesin- och dibensoxazacykloundekanderivat och motsvarande tiaderivat. |
| DK272482A DK151332C (da) | 1980-12-22 | 1982-06-17 | Analogifremgangsmaade til fremstilling af dibenzoxazonin-, dibenzoxazecin- eller dibenzoxaazacykloundecanderivater eller de tilsvarende thia- eller azaderivater eller farmaceutisk acceptable syreadditionssalte deraf |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8006955A NL8006955A (nl) | 1980-12-22 | 1980-12-22 | Tricyclische verbindingen. |
| NL8006955 | 1980-12-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8006955A true NL8006955A (nl) | 1982-07-16 |
Family
ID=19836358
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8006955A NL8006955A (nl) | 1980-12-22 | 1980-12-22 | Tricyclische verbindingen. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4374133A (show.php) |
| EP (1) | EP0057777B1 (show.php) |
| AT (1) | ATE9798T1 (show.php) |
| AU (1) | AU547599B2 (show.php) |
| CA (1) | CA1174236A (show.php) |
| DE (1) | DE3166645D1 (show.php) |
| DK (1) | DK151332C (show.php) |
| ES (1) | ES508218A0 (show.php) |
| FI (1) | FI74957C (show.php) |
| GR (1) | GR76976B (show.php) |
| HU (1) | HU185195B (show.php) |
| IE (1) | IE51952B1 (show.php) |
| NL (1) | NL8006955A (show.php) |
| PT (1) | PT74169B (show.php) |
| WO (1) | WO1982002199A1 (show.php) |
| ZA (1) | ZA818782B (show.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4818416A (en) * | 1987-07-20 | 1989-04-04 | Eberhardt Thomas E | Method and apparatus for treating bodies of water |
| ES2058761T3 (es) * | 1989-10-20 | 1994-11-01 | Akzo Nv | Proceso para la preparacion de derivados de dibenzodioxazecina y dibenzodioxaazacicloundecina. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3452046A (en) * | 1966-04-29 | 1969-06-24 | Squibb & Sons Inc | Dibenzoazathiacycloalkane carboxamides and related oxa compounds |
| US3497499A (en) * | 1967-03-15 | 1970-02-24 | Sandoz Ag | Dibenzo(b,h)(1,5)diazecines |
| US3803143A (en) * | 1969-09-08 | 1974-04-09 | Eisai Co Ltd | 6-amino alkylene 6,7-dihydro-5h-dibenzo (b,g),(1,5)thiazocines |
| FR2128097A1 (en) * | 1971-03-04 | 1972-10-20 | Squibb & Sons Inc | Guanidinoalkyl-dibenzo-heterocyclics - useful as ataractics sedatives and hypotensives |
-
1980
- 1980-12-22 NL NL8006955A patent/NL8006955A/nl not_active Application Discontinuation
-
1981
- 1981-12-12 AU AU79341/82A patent/AU547599B2/en not_active Ceased
- 1981-12-12 HU HU82110A patent/HU185195B/hu not_active IP Right Cessation
- 1981-12-12 DE DE8181201362T patent/DE3166645D1/de not_active Expired
- 1981-12-12 AT AT81201362T patent/ATE9798T1/de not_active IP Right Cessation
- 1981-12-12 WO PCT/EP1981/000195 patent/WO1982002199A1/en not_active Ceased
- 1981-12-12 EP EP81201362A patent/EP0057777B1/en not_active Expired
- 1981-12-16 US US06/331,303 patent/US4374133A/en not_active Expired - Fee Related
- 1981-12-16 IE IE2957/81A patent/IE51952B1/en not_active IP Right Cessation
- 1981-12-18 ZA ZA818782A patent/ZA818782B/xx unknown
- 1981-12-21 PT PT74169A patent/PT74169B/pt not_active IP Right Cessation
- 1981-12-21 ES ES508218A patent/ES508218A0/es active Granted
- 1981-12-22 GR GR66890A patent/GR76976B/el unknown
- 1981-12-22 CA CA000392881A patent/CA1174236A/en not_active Expired
-
1982
- 1982-06-01 FI FI821944A patent/FI74957C/fi not_active IP Right Cessation
- 1982-06-17 DK DK272482A patent/DK151332C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU547599B2 (en) | 1985-10-24 |
| FI821944A0 (fi) | 1982-06-01 |
| IE812957L (en) | 1982-06-22 |
| ES8304098A1 (es) | 1983-02-16 |
| US4374133A (en) | 1983-02-15 |
| HU185195B (en) | 1984-12-28 |
| FI74957B (fi) | 1987-12-31 |
| ES508218A0 (es) | 1983-02-16 |
| CA1174236A (en) | 1984-09-11 |
| DK151332B (da) | 1987-11-23 |
| EP0057777B1 (en) | 1984-10-10 |
| PT74169B (en) | 1983-05-17 |
| DK151332C (da) | 1988-06-06 |
| AU7934182A (en) | 1982-07-20 |
| WO1982002199A1 (en) | 1982-07-08 |
| ZA818782B (en) | 1982-11-24 |
| EP0057777A1 (en) | 1982-08-18 |
| DE3166645D1 (en) | 1984-11-15 |
| DK272482A (da) | 1982-07-08 |
| IE51952B1 (en) | 1987-04-29 |
| GR76976B (show.php) | 1984-09-04 |
| PT74169A (en) | 1982-01-01 |
| FI74957C (fi) | 1988-04-11 |
| ATE9798T1 (de) | 1984-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0054951B1 (en) | Dibenz(b,f)(1,4)oxazepine derivatives, process for preparing the same, and pharmaceutical compositions comprising the same | |
| FR2512024A1 (fr) | Ethers tricycliques, leur preparation et les compositions pharmaceutiques les contenant | |
| EP0096838B1 (en) | 1-aryloxy-2,3,4,5-tetrahydro-3-benzazepines, a process for preparing the same and their use as medicaments | |
| CN1121072A (zh) | 乙酰胺 | |
| US4339384A (en) | Benzofuran derivatives and their therapeutic applications | |
| US4002632A (en) | Tetracyclic piperidino derivatives | |
| NL8006955A (nl) | Tricyclische verbindingen. | |
| IE48915B1 (en) | Aminoalkoxyphenylpyrrolidones,process for their manufacture and their use | |
| US3227716A (en) | Therapeutically-active dibenzocycloheptane derivatives | |
| US3811026A (en) | Process for benzothiepins | |
| HU201308B (en) | Process for producing benzodiazepine derivatives and pharmaceutical compositions containing them | |
| US3370058A (en) | 5-acyl morphanthridine derivatives | |
| US3282942A (en) | Substituted cycloalkanoindoles | |
| NL8005754A (nl) | Benzo 4,5 pyrano 2,3-c pyrrool derivaten. | |
| US4002611A (en) | Preparation of benzodiazepines | |
| US4327091A (en) | N,N-Di and N,N,N-tri(hydroxy-lower alkyl) ammonium salts of substituted 3,4-dihydro-2H-1,2-benzothiazine 1,1 dioxide and pharmaceutical compositions thereof | |
| US4631277A (en) | Hexahydrodibenzodioxane compounds and pharmaceutical compositions | |
| DE1235327B (de) | Verfahren zur Herstellung von in 11-Stellung basisch substituierten Dibenzo [b, f] thiepin- bzw. -oxepin-10(11H)-onen | |
| US3297709A (en) | Certain substituted tetrazole derivatives | |
| CA1036596A (en) | Oxazinoindole-and thiazinoindole derivatives | |
| US3912729A (en) | Oxazinoindole- and thiazinoindole derivatives | |
| US3910901A (en) | Oxazinoindole- and thiazinoindole derivatives | |
| EP0015786B1 (fr) | Imidazo et pyrimido-pyrido-indoles, leur préparation et médicaments les contenant | |
| US3325510A (en) | Substituted cycloalkanoindoles | |
| NL8803218A (nl) | Dioxazocinederivaten, hun bereiding en samenstellingen die ze bevatten. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1B | A search report has been drawn up | ||
| BV | The patent application has lapsed |