NL7613659A - Hydroxybenzylmalonzuurderivaten. - Google Patents
Hydroxybenzylmalonzuurderivaten.Info
- Publication number
- NL7613659A NL7613659A NL7613659A NL7613659A NL7613659A NL 7613659 A NL7613659 A NL 7613659A NL 7613659 A NL7613659 A NL 7613659A NL 7613659 A NL7613659 A NL 7613659A NL 7613659 A NL7613659 A NL 7613659A
- Authority
- NL
- Netherlands
- Prior art keywords
- acid derivatives
- hydroxybenzylmalonic acid
- hydroxybenzylmalonic
- derivatives
- acid
- Prior art date
Links
- GHQOUFDDPQNBDR-UHFFFAOYSA-N 2-benzyl-2-hydroxypropanedioic acid Chemical class OC(=O)C(O)(C(O)=O)CC1=CC=CC=C1 GHQOUFDDPQNBDR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1591575A CH601232A5 (cg-RX-API-DMAC7.html) | 1975-12-08 | 1975-12-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL7613659A true NL7613659A (nl) | 1977-06-10 |
Family
ID=4413008
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL7613659A NL7613659A (nl) | 1975-12-08 | 1976-12-08 | Hydroxybenzylmalonzuurderivaten. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4148783A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5271477A (cg-RX-API-DMAC7.html) |
| BE (1) | BE849119A (cg-RX-API-DMAC7.html) |
| CH (1) | CH601232A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2654058A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2334672A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1518449A (cg-RX-API-DMAC7.html) |
| HK (1) | HK44980A (cg-RX-API-DMAC7.html) |
| MY (1) | MY8100161A (cg-RX-API-DMAC7.html) |
| NL (1) | NL7613659A (cg-RX-API-DMAC7.html) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4191683A (en) * | 1975-05-28 | 1980-03-04 | Ciba-Geigy Corporation | Derivatives of 4-aminopiperidine as stabilizers for polymers |
| US4374991A (en) * | 1976-12-17 | 1983-02-22 | Rohm And Haas Company | 2,6-Dimethylpiperidinyl-N-carbobutoxymethyl urea |
| US4400512A (en) * | 1976-12-17 | 1983-08-23 | Rohm And Haas Company | Azaspiro compounds |
| US4357471A (en) * | 1976-12-17 | 1982-11-02 | Rohm And Haas Company | Azaspiro compounds |
| EP0002260B1 (de) * | 1977-12-02 | 1982-07-14 | Ciba-Geigy Ag | Malonsäurederivate von sterisch gehinderten Piperidinen, Verfahren zu ihrer Herstellung und mit ihnen stabilisiertes organisches Material |
| EP0007533B1 (de) * | 1978-07-21 | 1982-09-22 | Ciba-Geigy Ag | Piperidin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren für synthetische Polymere |
| EP0011051B1 (de) * | 1978-11-06 | 1982-09-15 | Ciba-Geigy Ag | Farbphotographisches Aufzeichnungsmaterial, Verfahren zu seiner Stabilisierung und Herstellung photographischer Farbbilder |
| US4405630A (en) * | 1980-12-29 | 1983-09-20 | Rohm And Haas Company | Arthropod repellent compositions and methods |
| DE3364971D1 (en) * | 1982-09-21 | 1986-09-04 | Ciba Geigy Ag | Colour-photographic recording material |
| DE3375431D1 (en) * | 1982-11-18 | 1988-02-25 | Ciba Geigy Ag | Colour-photographic recording material |
| DE3375432D1 (en) * | 1982-11-26 | 1988-02-25 | Ciba Geigy Ag | Colour-photographic recording material |
| EP0111447B1 (de) * | 1982-12-03 | 1988-01-07 | Ciba-Geigy Ag | Farbphotographisches Aufzeichnungsmaterial |
| DE3375231D1 (en) * | 1982-12-16 | 1988-02-11 | Ciba Geigy Ag | Colour-photographic recording material |
| DE3373720D1 (en) * | 1982-12-16 | 1987-10-22 | Ciba Geigy Ag | Colour-photographic recording material |
| JPS60197775A (ja) | 1984-03-21 | 1985-10-07 | Adeka Argus Chem Co Ltd | 熱硬化性合成樹脂塗料組成物 |
| DE3416594C2 (de) * | 1984-05-04 | 1986-03-13 | Alexander Schoeller & Co AG, Volketswil, Schwerzenbach | Verfahren zum Bestimmen von oxidationsabhängigen Eigenschaften gleichartiger Kunststoffkörper sowie Verwendungen des Verfahrens und Vorrichtung zum Ausführen des Verfahrens an Spritzgußgroßteilen, insbesondere Flaschenkästen |
| DE4211603A1 (de) * | 1992-04-07 | 1993-10-14 | Basf Ag | Polyalkylpiperidin-Gruppen enthaltende Essigsäure- und 3-Aminoacrylsäure-Derivate |
| DE4327297B4 (de) * | 1992-08-17 | 2007-05-24 | Clariant Finance (Bvi) Ltd. | Verwendung von Piperidinverbindungen |
| KR100550224B1 (ko) * | 1998-12-14 | 2006-02-08 | 시바 스폐셜티 케미칼스 홀딩 인코포레이티드 | 입체장애 아민 화합물 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3640928A (en) * | 1968-06-12 | 1972-02-08 | Sankyo Co | Stabilization of synthetic polymers |
| US4021432A (en) * | 1971-11-30 | 1977-05-03 | Ciba-Geigy Corporation | Piperidine derivatives |
| CH589056A5 (cg-RX-API-DMAC7.html) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag | |
| JPS5848580B2 (ja) * | 1975-05-28 | 1983-10-29 | 三共株式会社 | ゴウセイコウブンシザイリヨウヨウアンテイザイ |
| US4069196A (en) * | 1976-04-13 | 1978-01-17 | Ciba-Geigy Corporation | Piperidyl esters of higher di-tri-, and polybasic aliphatic carboxylic acids as stabilizers for polymeric materials |
-
1975
- 1975-12-08 CH CH1591575A patent/CH601232A5/xx not_active IP Right Cessation
-
1976
- 1976-11-29 DE DE19762654058 patent/DE2654058A1/de not_active Ceased
- 1976-12-06 US US05/747,758 patent/US4148783A/en not_active Expired - Lifetime
- 1976-12-07 GB GB50926/76A patent/GB1518449A/en not_active Expired
- 1976-12-07 FR FR7636758A patent/FR2334672A1/fr active Granted
- 1976-12-07 BE BE173010A patent/BE849119A/xx unknown
- 1976-12-08 NL NL7613659A patent/NL7613659A/xx not_active Application Discontinuation
- 1976-12-08 JP JP51147627A patent/JPS5271477A/ja active Granted
-
1980
- 1980-08-21 HK HK449/80A patent/HK44980A/xx unknown
-
1981
- 1981-12-30 MY MY161/81A patent/MY8100161A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH601232A5 (cg-RX-API-DMAC7.html) | 1978-06-30 |
| HK44980A (en) | 1980-08-29 |
| US4148783A (en) | 1979-04-10 |
| FR2334672A1 (fr) | 1977-07-08 |
| JPS5271477A (en) | 1977-06-14 |
| GB1518449A (en) | 1978-07-19 |
| BE849119A (fr) | 1977-06-07 |
| DE2654058A1 (de) | 1977-06-23 |
| FR2334672B1 (cg-RX-API-DMAC7.html) | 1978-06-30 |
| JPS6340786B2 (cg-RX-API-DMAC7.html) | 1988-08-12 |
| MY8100161A (en) | 1981-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7612365L (sv) | L-fenyl-2-oxo-pyrrolidin-4-karbonsyraderivat | |
| SE7608840L (sv) | Prostansyraderivat | |
| NL7612248A (nl) | Nieuwe hydroxybenzylmalonzuurderivaten. | |
| NL7606654A (nl) | Imidylbenzeencarbonzuurderivaten. | |
| NL7503553A (nl) | 16-geoxygeneerde prostaanzuurderivaten. | |
| NL178089C (nl) | Windmotor. | |
| NL7603397A (nl) | Markies. | |
| NL7611582A (nl) | Anodeschneider. | |
| NL7704210A (nl) | Fenoxy-fenoxypropionzuurderivaten. | |
| NL7606655A (nl) | Imidylbenzeendi- en -tricarbonzuurderivaten. | |
| NL7612201A (nl) | Retinezuurderivaten. | |
| NL7613659A (nl) | Hydroxybenzylmalonzuurderivaten. | |
| SE7600224L (sv) | Lopare for blixtlas. | |
| NL7609137A (nl) | Fenoxyalkylcarbonzuurderivaten. | |
| NL7607993A (nl) | Ortho-aminobutyrofenonderivaten. | |
| NO141839C (no) | Enkeltpunkts-fortoeyningsboeye. | |
| NL7505481A (nl) | 13-thiaprostaanzuurderivaten. | |
| NL7608892A (nl) | 1-carbamoyl-5-fluoruracilderivaten. | |
| NL7607800A (nl) | Prostaglandinederivaten. | |
| NL7705896A (nl) | Polyprenylcarbonzuurderivaten. | |
| NL7606236A (nl) | Gesubstitueerde pyridazonen. | |
| NL7605297A (nl) | Jodofor-oplossing. | |
| NL7605292A (nl) | Jodofor-oplossing. | |
| HU173879B (hu) | Sposob poluchenija proizvodnykh tetrazolil- i tetrazolilalkil-imidazola i benzimidazola i farmacepticheskikh preparatov, soderzhahhikh ehti soedinenija v kachestve aktivnykh vehhestv | |
| FI762516A7 (fi) | Behaollare. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BV | The patent application has lapsed |