NL144348B - Kabelstrengmachine. - Google Patents
Kabelstrengmachine.Info
- Publication number
- NL144348B NL144348B NL656504607A NL6504607A NL144348B NL 144348 B NL144348 B NL 144348B NL 656504607 A NL656504607 A NL 656504607A NL 6504607 A NL6504607 A NL 6504607A NL 144348 B NL144348 B NL 144348B
- Authority
- NL
- Netherlands
- Prior art keywords
- cable twist
- twist machine
- machine
- cable
- twist
- Prior art date
Links
- ONCZDRURRATYFI-QTCHDTBASA-N methyl (2z)-2-methoxyimino-2-[2-[[(e)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate Chemical compound CO\N=C(/C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-QTCHDTBASA-N 0.000 title 1
Classifications
-
- D—TEXTILES; PAPER
- D07—ROPES; CABLES OTHER THAN ELECTRIC
- D07B—ROPES OR CABLES IN GENERAL
- D07B3/00—General-purpose machines or apparatus for producing twisted ropes or cables from component strands of the same or different material
- D07B3/02—General-purpose machines or apparatus for producing twisted ropes or cables from component strands of the same or different material in which the supply reels rotate about the axis of the rope or cable or in which a guide member rotates about the axis of the rope or cable to guide the component strands away from the supply reels in fixed position
- D07B3/04—General-purpose machines or apparatus for producing twisted ropes or cables from component strands of the same or different material in which the supply reels rotate about the axis of the rope or cable or in which a guide member rotates about the axis of the rope or cable to guide the component strands away from the supply reels in fixed position and are arranged in tandem along the axis of the machine, e.g. tubular or high-speed type stranding machine
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEST022330 | 1964-06-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NL6504607A NL6504607A (enExample) | 1965-12-31 |
| NL144348B true NL144348B (nl) | 1974-12-16 |
Family
ID=7459322
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL656504607A NL144348B (nl) | 1964-06-30 | 1965-04-12 | Kabelstrengmachine. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3347034A (enExample) |
| AT (1) | AT271270B (enExample) |
| BE (1) | BE661125A (enExample) |
| CH (1) | CH443066A (enExample) |
| DE (1) | DE1292539C2 (enExample) |
| DK (1) | DK125101B (enExample) |
| GB (1) | GB1107409A (enExample) |
| NL (1) | NL144348B (enExample) |
| SE (1) | SE333528B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3109756C2 (de) * | 1980-04-25 | 1986-05-22 | Char'kovskij politechničeskij institut imeni V.I. Lenina, Char'kov | Vertikale Verseilmaschine |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US443491A (en) * | 1890-12-30 | Signments | ||
| DE600390C (de) * | 1934-07-21 | Kruschel & Goerke Maschinenfab | Schnellverseilmaschine | |
| US555146A (en) * | 1896-02-25 | Wire-twisting machine | ||
| GB563378A (en) * | 1943-01-13 | 1944-08-11 | Hanson & Edwards Ltd | Improvements relating to tubular wire stranding machines |
| US2457402A (en) * | 1947-04-18 | 1948-12-28 | Wire Machinery Corp Of America | Wire-stranding machine |
| US2485348A (en) * | 1947-11-26 | 1949-10-18 | Arnason Arni | Wire rope machine |
| US2633692A (en) * | 1948-11-17 | 1953-04-07 | William T Maccreadie | Wire rope-making machine |
| US2534696A (en) * | 1949-06-25 | 1950-12-19 | Syncro Mach Co | Stranding machine |
| US2723525A (en) * | 1953-06-23 | 1955-11-15 | Edmands Company | Wire twisting machine |
| CH338383A (de) * | 1954-11-22 | 1959-05-15 | Eisen & Stahlind Ag | Umlaufkörper für Schnellverseilmaschinen |
| NL108820C (enExample) * | 1955-06-13 | |||
| US2877620A (en) * | 1956-10-08 | 1959-03-17 | Edmands Company | Wire twisting machine |
| US2897646A (en) * | 1958-01-15 | 1959-08-04 | United States Steel Corp | Reversible universal stranding and laying machine |
| FR1225837A (fr) * | 1959-02-20 | 1960-07-04 | Le Materiel De Cablerie | Perfectionnement aux toronneuses et câbleuses tubulaires |
| US3095686A (en) * | 1961-05-31 | 1963-07-02 | Kreidler Werke Gmbh | Speed-stranding machine |
| GB1030480A (enExample) * | 1962-12-29 |
-
1964
- 1964-06-30 DE DE19641292539 patent/DE1292539C2/de not_active Expired
-
1965
- 1965-03-15 BE BE661125D patent/BE661125A/xx unknown
- 1965-03-23 DK DK149065AA patent/DK125101B/da unknown
- 1965-04-07 SE SE04542/65A patent/SE333528B/xx unknown
- 1965-04-12 GB GB15550/65A patent/GB1107409A/en not_active Expired
- 1965-04-12 NL NL656504607A patent/NL144348B/xx unknown
- 1965-04-14 CH CH521965A patent/CH443066A/de unknown
- 1965-04-14 US US448092A patent/US3347034A/en not_active Expired - Lifetime
- 1965-04-14 AT AT345265A patent/AT271270B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| AT271270B (de) | 1969-05-27 |
| BE661125A (enExample) | 1965-07-01 |
| DE1292539B (enExample) | 1974-04-11 |
| GB1107409A (en) | 1968-03-27 |
| DK125101B (da) | 1972-12-27 |
| SE333528B (enExample) | 1971-03-15 |
| CH443066A (de) | 1967-08-31 |
| DE1292539C2 (de) | 1974-04-11 |
| US3347034A (en) | 1967-10-17 |
| NL6504607A (enExample) | 1965-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL144212B (nl) | Vulmachine. | |
| DK111132B (da) | Høstmaskine. | |
| DK140248B (da) | Poleremaskine. | |
| DK107087C (da) | Trådbøjemaskine. | |
| CH427593A (de) | Spinnmaschine | |
| FR1435605A (fr) | Cireuse | |
| FI45874C (fi) | Jauhinkone. | |
| DK124811B (da) | Indpakningsmaskine. | |
| CH421571A (de) | Rechenmaschine | |
| CH438476A (de) | Kommutatormaschine | |
| DK118828B (da) | Softicemaskine. | |
| DK116416B (da) | Kapslemaskine. | |
| CH436053A (de) | Mehrfachdraht-Zwirnspindel | |
| AT248827B (de) | Abkantmaschine | |
| FR1434422A (fr) | Machine de remplissage | |
| FR1423154A (fr) | Machines hydrauliques | |
| NL144348B (nl) | Kabelstrengmachine. | |
| DK109914C (da) | Høstmaskine. | |
| DK132341B (da) | Snoet polypropylensnor. | |
| DK108667C (da) | Vaskemaskine. | |
| FR1457077A (fr) | Machine hydraulique | |
| FR1401339A (fr) | Perfectionnements aux toroneuses | |
| FR1408363A (fr) | Machine sécheuse-repasseuse-réceptrice | |
| CH415389A (it) | Macchina torcitrice aspatrice | |
| FR1427145A (fr) | Machine à sertir |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| VJC | Lapsed due to non-payment of the due maintenance fee for the patent or patent application | ||
| NL80 | Information provided on patent owner name for an already discontinued patent |
Owner name: STEPPUHN |