MY7900103A - A novel pleuromutilin derivative - Google Patents
A novel pleuromutilin derivativeInfo
- Publication number
- MY7900103A MY7900103A MY7900103A MY7900103A MY7900103A MY 7900103 A MY7900103 A MY 7900103A MY 7900103 A MY7900103 A MY 7900103A MY 7900103 A MY7900103 A MY 7900103A MY 7900103 A MY7900103 A MY 7900103A
- Authority
- MY
- Malaysia
- Prior art keywords
- pleuromutilin derivative
- novel pleuromutilin
- novel
- derivative
- pleuromutilin
- Prior art date
Links
- ZRZNJUXESFHSIO-VYTKZBNOSA-N pleuromutilin Chemical class C([C@H]([C@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CO)C)C[C@]32[C@H]1C(=O)CC3 ZRZNJUXESFHSIO-VYTKZBNOSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1445071A CH560180A5 (en) | 1971-10-05 | 1971-10-05 | Pleuromutilin derivs - with antibacterial activity |
| CH773872A CH572893A5 (en) | 1972-05-25 | 1972-05-25 | Pleuromutilin derivs - with antibacterial activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY7900103A true MY7900103A (en) | 1979-12-31 |
Family
ID=25702060
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MY7900103A MY7900103A (en) | 1971-10-05 | 1979-12-30 | A novel pleuromutilin derivative |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT335054B (pl) |
| CS (1) | CS219306B2 (pl) |
| CY (1) | CY987A (pl) |
| GB (1) | GB1410506A (pl) |
| HK (1) | HK25379A (pl) |
| IE (1) | IE37700B1 (pl) |
| IL (1) | IL47262A (pl) |
| MY (1) | MY7900103A (pl) |
| PL (1) | PL85200B1 (pl) |
| YU (1) | YU37125B (pl) |
-
1972
- 1972-10-02 GB GB1633875A patent/GB1410506A/en not_active Expired
- 1972-10-02 CY CY98772A patent/CY987A/xx unknown
- 1972-10-03 PL PL15805172A patent/PL85200B1/pl unknown
- 1972-10-03 IE IE218872A patent/IE37700B1/xx unknown
- 1972-10-03 AT AT845872A patent/AT335054B/de not_active IP Right Cessation
- 1972-10-04 IL IL4726272A patent/IL47262A/en unknown
- 1972-10-04 CS CS670172A patent/CS219306B2/cs unknown
- 1972-10-04 YU YU249772A patent/YU37125B/xx unknown
-
1979
- 1979-04-19 HK HK25379A patent/HK25379A/xx unknown
- 1979-12-30 MY MY7900103A patent/MY7900103A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CY987A (en) | 1979-08-02 |
| YU37125B (en) | 1984-08-31 |
| CS219306B2 (en) | 1983-03-25 |
| GB1410506A (en) | 1975-10-15 |
| IE37700B1 (en) | 1977-09-28 |
| IL47262A (en) | 1976-01-30 |
| HK25379A (en) | 1979-04-27 |
| ATA845872A (de) | 1976-06-15 |
| AT335054B (de) | 1977-02-25 |
| PL85200B1 (en) | 1976-04-30 |
| YU249772A (en) | 1983-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1362627A (en) | Capsules comprising a coronary-dilating compound | |
| CA968491A (en) | Compositions fluorees a caractere oleofuge et hydrofuge | |
| YU196072A (en) | Process for preparing a novel primidinyl-pyrazolinone derivative | |
| ZA721334B (en) | Novel imidazo-pyridine derivatives | |
| IL48288A0 (en) | A novel d-6-methyl-ergoline derivative | |
| BG25034A1 (en) | A tooth-gear | |
| IL37125A0 (en) | A new tensiometer | |
| IL40790A0 (en) | Novel pregnadiones | |
| YU44872A (en) | Process for obtainig a novel antibiotc | |
| MY7900103A (en) | A novel pleuromutilin derivative | |
| CS474372A1 (en) | Zapojeni k rozeznavani a regeneraci casove delenych impulsu | |
| IE36711L (en) | A hydrazino-pyrimido-pyridazine derivative | |
| HK66178A (en) | A hydrazino-pyrimido-pyridazine derivative | |
| ZA722426B (en) | Novel aminophenylketone derivatives | |
| ZA70627B (en) | A novel game | |
| CA965706A (en) | Vehicules sportifs a servo-guidage | |
| CA882508A (en) | Alesage a chaud des billettes metalliques | |
| CS788671A1 (en) | Zpusob vyroby vsadek pro pestovani cukrovky a jinych rostlin | |
| IE34998B1 (en) | A benzocycloheptathiophene derivative | |
| ZA713280B (en) | A novel toy | |
| CA863757A (en) | Vehicules routiers a projecteurs pivotants | |
| ZA711066B (en) | A novel shoe | |
| AU436728B2 (en) | A novel substituted 1-phenoxy-2-aminopropane | |
| AU4740572A (en) | Pleuromutilin derivatives | |
| IL38131A0 (en) | A hinge assembly |