MY101947A - Herbicidal compositions based on a glyphosate herbicide - Google Patents
Herbicidal compositions based on a glyphosate herbicideInfo
- Publication number
- MY101947A MY101947A MYPI87003004A MYPI19873004A MY101947A MY 101947 A MY101947 A MY 101947A MY PI87003004 A MYPI87003004 A MY PI87003004A MY PI19873004 A MYPI19873004 A MY PI19873004A MY 101947 A MY101947 A MY 101947A
- Authority
- MY
- Malaysia
- Prior art keywords
- herbicidal compositions
- type herbicide
- compositions based
- glyphosate herbicide
- glyphosate
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title abstract 7
- 239000004009 herbicide Substances 0.000 title abstract 5
- 239000005562 Glyphosate Substances 0.000 title abstract 3
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 title abstract 3
- 229940097068 glyphosate Drugs 0.000 title abstract 3
- 239000000203 mixture Substances 0.000 title abstract 2
- KNGWEAQJZJKFLI-UHFFFAOYSA-N 2,2-dimethyl-4h-1,3-benzodioxine-6-carbaldehyde Chemical compound O=CC1=CC=C2OC(C)(C)OCC2=C1 KNGWEAQJZJKFLI-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US92707086A | 1986-11-04 | 1986-11-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY101947A true MY101947A (en) | 1992-02-15 |
Family
ID=25454123
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MYPI87003004A MY101947A (en) | 1986-11-04 | 1987-11-02 | Herbicidal compositions based on a glyphosate herbicide |
Country Status (16)
| Country | Link |
|---|---|
| CN (1) | CN1025142C (cs) |
| CS (1) | CS268540B2 (cs) |
| DD (1) | DD262791A5 (cs) |
| EG (1) | EG18496A (cs) |
| ES (1) | ES2007741A6 (cs) |
| GR (1) | GR871682B (cs) |
| IE (1) | IE61109B1 (cs) |
| IL (1) | IL84166A (cs) |
| MA (1) | MA21092A1 (cs) |
| MY (1) | MY101947A (cs) |
| PH (1) | PH23765A (cs) |
| PL (1) | PL152636B1 (cs) |
| PT (1) | PT86064B (cs) |
| TR (1) | TR25883A (cs) |
| YU (1) | YU46084B (cs) |
| ZA (1) | ZA878216B (cs) |
-
1987
- 1987-10-12 PH PH35919A patent/PH23765A/en unknown
- 1987-10-13 IL IL84166A patent/IL84166A/xx not_active IP Right Cessation
- 1987-10-26 MA MA21333A patent/MA21092A1/fr unknown
- 1987-10-28 CN CN 87107479 patent/CN1025142C/zh not_active Expired - Fee Related
- 1987-11-02 MY MYPI87003004A patent/MY101947A/en unknown
- 1987-11-02 CS CS877847A patent/CS268540B2/cs unknown
- 1987-11-02 PL PL26856087A patent/PL152636B1/pl unknown
- 1987-11-02 ZA ZA878216A patent/ZA878216B/xx unknown
- 1987-11-02 YU YU199187A patent/YU46084B/sh unknown
- 1987-11-02 IE IE294987A patent/IE61109B1/en not_active IP Right Cessation
- 1987-11-03 GR GR871682A patent/GR871682B/el unknown
- 1987-11-03 DD DD30861587A patent/DD262791A5/de not_active IP Right Cessation
- 1987-11-03 EG EG63387A patent/EG18496A/xx active
- 1987-11-03 ES ES8703135A patent/ES2007741A6/es not_active Expired
- 1987-11-03 PT PT8606487A patent/PT86064B/pt not_active IP Right Cessation
- 1987-11-04 TR TR77187A patent/TR25883A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| TR25883A (tr) | 1993-09-02 |
| GR871682B (en) | 1988-03-04 |
| CN87107479A (zh) | 1988-08-10 |
| CS784787A2 (en) | 1989-06-13 |
| ZA878216B (en) | 1989-06-28 |
| IE61109B1 (en) | 1994-10-05 |
| PT86064A (en) | 1987-12-01 |
| PL268560A1 (en) | 1988-08-18 |
| IE872949L (en) | 1988-05-04 |
| EG18496A (en) | 1993-02-28 |
| YU46084B (sh) | 1992-12-21 |
| CS268540B2 (en) | 1990-03-14 |
| ES2007741A6 (es) | 1989-07-01 |
| YU199187A (en) | 1990-06-30 |
| DD262791A5 (de) | 1988-12-14 |
| IL84166A0 (en) | 1988-03-31 |
| CN1025142C (zh) | 1994-06-29 |
| PH23765A (en) | 1989-11-03 |
| IL84166A (en) | 1992-06-21 |
| PL152636B1 (en) | 1991-01-31 |
| MA21092A1 (fr) | 1988-07-01 |
| PT86064B (pt) | 1990-11-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG103075A (en) | Sugar-beet plants, resistant to imidazoline herbicide | |
| CA2006816C (en) | IMPROVED GLYPHOSATE FORMULAS | |
| AU590950B2 (en) | Biocidal, particulatly virucidal, compositions | |
| AR242027A1 (es) | N-fenilsulfonil-n'-pirimidinil- y -triacinil-ureas, procedimiento para su preparacion, composicion herbicida y reguladora del crecimiento vegetal que los contiene. | |
| UA32526C2 (uk) | 2-ціано-1,3-діони, що мають гербіцидну активність, спосіб їх одержання, гербіцидна композиція і спосіб боротьби з ростом бур'янів | |
| IL58744A0 (en) | Insecticidal cyclopropanecarboxylates from substituted(1,1'-biphenyl)-3-ylmethyl compounds | |
| GB2233229B (en) | Herbicidal compositions based on n-phosphonomethylglycine | |
| EP0152229A3 (en) | A new class of pesticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo(2.2.2)octanes | |
| ZA827618B (en) | Herbicide | |
| EP0181311A3 (en) | Substituted 4,6-alkoxy pyridinecarboxylate compounds | |
| MY101947A (en) | Herbicidal compositions based on a glyphosate herbicide | |
| GB2187098C (en) | Biocidal, particularly virucidal, compositions | |
| AU8178887A (en) | Compositions including herbicidal combinations of the glyphosate type and the phenoxybenzoic type | |
| BG102827A (en) | Selective maize herbicide | |
| BG102610A (en) | Herbicidal compositions containing 4-benzoyloxazoles and hydroxybenzonitrile | |
| AU2623384A (en) | 1,2,4 triazin-5-ones as herbicides | |
| IL57758A0 (en) | N,n-dimethyl-n'-phenylurea derivative,processes for the preparation thereof,herbicidal compositions containing the same and method for destroying weeds by said compositions | |
| GB2203942B (en) | Use of 2,2-dibromo-3-nitrilopropionamide as a crop sporicide or fungicide e.g. by fumigation | |
| IE801734L (en) | Composition | |
| OA09355A (en) | Thickened fumigant compositions. | |
| ZA85734B (en) | Pesticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo(2.2.2)octanes | |
| JPS57109778A (en) | 2,3-dihydro-3-methyl-6-phenyl-4-pyrone derivative, manufacture, herbicidal composition and weed repulsion | |
| AU572332B2 (en) | 1,2,5 - oxadiazole-urea herbicidal compositions | |
| DE2965684D1 (en) | Insecticidal cyclopropanecarboxylates from substituted (1,1'-biphenyl)-3-ylmethyl compounds | |
| BG37833A3 (en) | Herbicide means and method for control of unwanted vegetation |