KR20240042887A - 고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 - Google Patents
고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 Download PDFInfo
- Publication number
- KR20240042887A KR20240042887A KR1020220121707A KR20220121707A KR20240042887A KR 20240042887 A KR20240042887 A KR 20240042887A KR 1020220121707 A KR1020220121707 A KR 1020220121707A KR 20220121707 A KR20220121707 A KR 20220121707A KR 20240042887 A KR20240042887 A KR 20240042887A
- Authority
- KR
- South Korea
- Prior art keywords
- adherent
- human
- cell
- cells
- mouse
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 48
- 239000000203 mixture Substances 0.000 title claims abstract description 36
- 230000010261 cell growth Effects 0.000 title claims abstract description 23
- 238000004458 analytical method Methods 0.000 title claims description 20
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims abstract description 27
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 claims abstract description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 26
- 239000012153 distilled water Substances 0.000 claims abstract description 25
- PQUXFUBNSYCQAL-UHFFFAOYSA-N 1-(2,3-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(F)=C1F PQUXFUBNSYCQAL-UHFFFAOYSA-N 0.000 claims abstract description 24
- 238000005345 coagulation Methods 0.000 claims abstract description 24
- 229940047670 sodium acrylate Drugs 0.000 claims abstract description 24
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 claims abstract description 23
- 238000004519 manufacturing process Methods 0.000 claims abstract description 20
- 230000015271 coagulation Effects 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 18
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 16
- 238000012258 culturing Methods 0.000 claims description 16
- 238000010186 staining Methods 0.000 claims description 5
- 238000000799 fluorescence microscopy Methods 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 238000012545 processing Methods 0.000 claims description 3
- 238000007789 sealing Methods 0.000 claims description 3
- 238000010191 image analysis Methods 0.000 abstract description 5
- 230000001464 adherent effect Effects 0.000 description 440
- 210000004027 cell Anatomy 0.000 description 202
- 239000000725 suspension Substances 0.000 description 89
- 239000000017 hydrogel Substances 0.000 description 65
- 239000000243 solution Substances 0.000 description 57
- 210000002950 fibroblast Anatomy 0.000 description 56
- 210000004698 lymphocyte Anatomy 0.000 description 44
- 210000003734 kidney Anatomy 0.000 description 42
- 210000004556 brain Anatomy 0.000 description 37
- 210000004072 lung Anatomy 0.000 description 31
- 210000001161 mammalian embryo Anatomy 0.000 description 31
- 210000001672 ovary Anatomy 0.000 description 30
- 241000699800 Cricetinae Species 0.000 description 27
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 25
- 239000002953 phosphate buffered saline Substances 0.000 description 25
- 210000000481 breast Anatomy 0.000 description 24
- 210000004185 liver Anatomy 0.000 description 23
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 22
- 210000004369 blood Anatomy 0.000 description 20
- 239000008280 blood Substances 0.000 description 20
- 206010029260 Neuroblastoma Diseases 0.000 description 19
- 238000003384 imaging method Methods 0.000 description 18
- 210000003205 muscle Anatomy 0.000 description 18
- 210000003491 skin Anatomy 0.000 description 16
- 238000003860 storage Methods 0.000 description 16
- 210000002540 macrophage Anatomy 0.000 description 13
- 239000003755 preservative agent Substances 0.000 description 13
- 241000287828 Gallus gallus Species 0.000 description 12
- 241000283973 Oryctolagus cuniculus Species 0.000 description 12
- 210000001185 bone marrow Anatomy 0.000 description 12
- 210000001072 colon Anatomy 0.000 description 12
- 210000000496 pancreas Anatomy 0.000 description 12
- 241000288906 Primates Species 0.000 description 11
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 11
- 210000000709 aorta Anatomy 0.000 description 11
- 210000000988 bone and bone Anatomy 0.000 description 11
- 241000238631 Hexapoda Species 0.000 description 10
- 210000003679 cervix uteri Anatomy 0.000 description 10
- 241000283690 Bos taurus Species 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 210000002510 keratinocyte Anatomy 0.000 description 9
- 201000001441 melanoma Diseases 0.000 description 9
- 210000002569 neuron Anatomy 0.000 description 9
- 210000000952 spleen Anatomy 0.000 description 9
- 210000002216 heart Anatomy 0.000 description 8
- 238000001727 in vivo Methods 0.000 description 8
- 239000011521 glass Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
- 210000001130 astrocyte Anatomy 0.000 description 6
- 230000003511 endothelial effect Effects 0.000 description 6
- 210000003953 foreskin Anatomy 0.000 description 6
- 230000002518 glial effect Effects 0.000 description 6
- 230000007774 longterm Effects 0.000 description 6
- 230000001817 pituitary effect Effects 0.000 description 6
- 210000002307 prostate Anatomy 0.000 description 6
- 210000001550 testis Anatomy 0.000 description 6
- 241000894006 Bacteria Species 0.000 description 5
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 5
- 241000196324 Embryophyta Species 0.000 description 5
- 241001529936 Murinae Species 0.000 description 5
- 229930040373 Paraformaldehyde Natural products 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 210000001744 T-lymphocyte Anatomy 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 239000000499 gel Substances 0.000 description 5
- 210000000963 osteoblast Anatomy 0.000 description 5
- 229920002866 paraformaldehyde Polymers 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 4
- 241000286209 Phasianidae Species 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 4
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 4
- 210000001671 embryonic stem cell Anatomy 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 238000011534 incubation Methods 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 210000001616 monocyte Anatomy 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 210000000130 stem cell Anatomy 0.000 description 4
- 210000001541 thymus gland Anatomy 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 4
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 3
- 241000272525 Anas platyrhynchos Species 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 210000004100 adrenal gland Anatomy 0.000 description 3
- 210000003837 chick embryo Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 210000004748 cultured cell Anatomy 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 210000002919 epithelial cell Anatomy 0.000 description 3
- 210000003494 hepatocyte Anatomy 0.000 description 3
- 210000003098 myoblast Anatomy 0.000 description 3
- 210000004303 peritoneum Anatomy 0.000 description 3
- 230000002335 preservative effect Effects 0.000 description 3
- 210000001938 protoplast Anatomy 0.000 description 3
- 210000001525 retina Anatomy 0.000 description 3
- 238000007711 solidification Methods 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 210000004988 splenocyte Anatomy 0.000 description 3
- 210000004291 uterus Anatomy 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- GVJHHUAWPYXKBD-IEOSBIPESA-N α-tocopherol Chemical compound OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-IEOSBIPESA-N 0.000 description 3
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 241000224489 Amoeba Species 0.000 description 2
- QFOHBWFCKVYLES-UHFFFAOYSA-N Butylparaben Chemical compound CCCCOC(=O)C1=CC=C(O)C=C1 QFOHBWFCKVYLES-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 2
- 241000938605 Crocodylia Species 0.000 description 2
- 241000238424 Crustacea Species 0.000 description 2
- 241000289427 Didelphidae Species 0.000 description 2
- 241000255601 Drosophila melanogaster Species 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000772415 Neovison vison Species 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 2
- 108010026552 Proteome Proteins 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 210000001789 adipocyte Anatomy 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000000843 anti-fungal effect Effects 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 229940121375 antifungal agent Drugs 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 210000002403 aortic endothelial cell Anatomy 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 2
- 210000004413 cardiac myocyte Anatomy 0.000 description 2
- 238000004113 cell culture Methods 0.000 description 2
- 229960002798 cetrimide Drugs 0.000 description 2
- 239000002738 chelating agent Substances 0.000 description 2
- 229960004926 chlorobutanol Drugs 0.000 description 2
- 239000000701 coagulant Substances 0.000 description 2
- 230000001054 cortical effect Effects 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- SMVRDGHCVNAOIN-UHFFFAOYSA-L disodium;1-dodecoxydodecane;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC SMVRDGHCVNAOIN-UHFFFAOYSA-L 0.000 description 2
- 229960001484 edetic acid Drugs 0.000 description 2
- 210000002257 embryonic structure Anatomy 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 210000004024 hepatic stellate cell Anatomy 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 201000006512 mast cell neoplasm Diseases 0.000 description 2
- 208000006971 mastocytoma Diseases 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- 229960002216 methylparaben Drugs 0.000 description 2
- 210000000107 myocyte Anatomy 0.000 description 2
- 229960003742 phenol Drugs 0.000 description 2
- 229940067107 phenylethyl alcohol Drugs 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- RWPGFSMJFRPDDP-UHFFFAOYSA-L potassium metabisulfite Chemical compound [K+].[K+].[O-]S(=O)S([O-])(=O)=O RWPGFSMJFRPDDP-UHFFFAOYSA-L 0.000 description 2
- 229940043349 potassium metabisulfite Drugs 0.000 description 2
- 235000010263 potassium metabisulphite Nutrition 0.000 description 2
- 229910000160 potassium phosphate Inorganic materials 0.000 description 2
- 235000011009 potassium phosphates Nutrition 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 229940001584 sodium metabisulfite Drugs 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 235000010199 sorbic acid Nutrition 0.000 description 2
- 239000004334 sorbic acid Substances 0.000 description 2
- 229940075582 sorbic acid Drugs 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 210000002536 stromal cell Anatomy 0.000 description 2
- 210000001685 thyroid gland Anatomy 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- DTOUUUZOYKYHEP-UHFFFAOYSA-N 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine Chemical compound CCCCC(CC)CN1CN(CC(CC)CCCC)CC(C)(N)C1 DTOUUUZOYKYHEP-UHFFFAOYSA-N 0.000 description 1
- VUDQSRFCCHQIIU-UHFFFAOYSA-N 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one Chemical compound CCCCCC(=O)C1=C(O)C(Cl)=C(OC)C(Cl)=C1O VUDQSRFCCHQIIU-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- CHHHXKFHOYLYRE-UHFFFAOYSA-M 2,4-Hexadienoic acid, potassium salt (1:1), (2E,4E)- Chemical compound [K+].CC=CC=CC([O-])=O CHHHXKFHOYLYRE-UHFFFAOYSA-M 0.000 description 1
- YQNRVGJCPCNMKT-LFVJCYFKSA-N 2-[(e)-[[2-(4-benzylpiperazin-1-ium-1-yl)acetyl]hydrazinylidene]methyl]-6-prop-2-enylphenolate Chemical compound [O-]C1=C(CC=C)C=CC=C1\C=N\NC(=O)C[NH+]1CCN(CC=2C=CC=CC=2)CC1 YQNRVGJCPCNMKT-LFVJCYFKSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- FWBHETKCLVMNFS-UHFFFAOYSA-N 4',6-Diamino-2-phenylindol Chemical compound C1=CC(C(=N)N)=CC=C1C1=CC2=CC=C(C(N)=N)C=C2N1 FWBHETKCLVMNFS-UHFFFAOYSA-N 0.000 description 1
- CYDQOEWLBCCFJZ-UHFFFAOYSA-N 4-(4-fluorophenyl)oxane-4-carboxylic acid Chemical compound C=1C=C(F)C=CC=1C1(C(=O)O)CCOCC1 CYDQOEWLBCCFJZ-UHFFFAOYSA-N 0.000 description 1
- OSDLLIBGSJNGJE-UHFFFAOYSA-N 4-chloro-3,5-dimethylphenol Chemical compound CC1=CC(O)=CC(C)=C1Cl OSDLLIBGSJNGJE-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 208000036762 Acute promyelocytic leukaemia Diseases 0.000 description 1
- 241000254175 Anthonomus grandis Species 0.000 description 1
- 241000880621 Ascarina lucida Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- LVDKZNITIUWNER-UHFFFAOYSA-N Bronopol Chemical compound OCC(Br)(CO)[N+]([O-])=O LVDKZNITIUWNER-UHFFFAOYSA-N 0.000 description 1
- 241001260012 Bursa Species 0.000 description 1
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 1
- 239000004322 Butylated hydroxytoluene Substances 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 101100462537 Caenorhabditis elegans pac-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 241000549177 Catha Species 0.000 description 1
- 206010008342 Cervix carcinoma Diseases 0.000 description 1
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 1
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 1
- 208000032494 Clear cell adenocarcinoma of the ovary Diseases 0.000 description 1
- 241000699802 Cricetulus griseus Species 0.000 description 1
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 description 1
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 239000004287 Dehydroacetic acid Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000224495 Dictyostelium Species 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- QZKRHPLGUJDVAR-UHFFFAOYSA-K EDTA trisodium salt Chemical compound [Na+].[Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O QZKRHPLGUJDVAR-UHFFFAOYSA-K 0.000 description 1
- 101100157134 Enterobacteria phage T4 y06A gene Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 208000006168 Ewing Sarcoma Diseases 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- 206010062767 Hypophysitis Diseases 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- 239000011786 L-ascorbyl-6-palmitate Substances 0.000 description 1
- QAQJMLQRFWZOBN-LAUBAEHRSA-N L-ascorbyl-6-palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](O)[C@H]1OC(=O)C(O)=C1O QAQJMLQRFWZOBN-LAUBAEHRSA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- 102100020870 La-related protein 6 Human genes 0.000 description 1
- 108050008265 La-related protein 6 Proteins 0.000 description 1
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 208000006552 Lewis Lung Carcinoma Diseases 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 101100117764 Mus musculus Dusp2 gene Proteins 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- 241000221961 Neurospora crassa Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 241000927735 Penaeus Species 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 208000002151 Pleural effusion Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- HLCFGWHYROZGBI-JJKGCWMISA-M Potassium gluconate Chemical compound [K+].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O HLCFGWHYROZGBI-JJKGCWMISA-M 0.000 description 1
- 208000033826 Promyelocytic Acute Leukemia Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000235347 Schizosaccharomyces pombe Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 102000006601 Thymidine Kinase Human genes 0.000 description 1
- 108020004440 Thymidine kinase Proteins 0.000 description 1
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 description 1
- 244000042314 Vigna unguiculata Species 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 229930003268 Vitamin C Natural products 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 208000008383 Wilms tumor Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000008351 acetate buffer Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 229940048053 acrylate Drugs 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 210000004404 adrenal cortex Anatomy 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- OENHQHLEOONYIE-UKMVMLAPSA-N all-trans beta-carotene Natural products CC=1CCCC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C OENHQHLEOONYIE-UKMVMLAPSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 1
- 229940087168 alpha tocopherol Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229940024545 aluminum hydroxide Drugs 0.000 description 1
- 210000001132 alveolar macrophage Anatomy 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000010385 ascorbyl palmitate Nutrition 0.000 description 1
- 210000003719 b-lymphocyte Anatomy 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- 229960001950 benzethonium chloride Drugs 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 239000011648 beta-carotene Substances 0.000 description 1
- 235000013734 beta-carotene Nutrition 0.000 description 1
- TUPZEYHYWIEDIH-WAIFQNFQSA-N beta-carotene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C=CC=C(/C)C=CC2=CCCCC2(C)C TUPZEYHYWIEDIH-WAIFQNFQSA-N 0.000 description 1
- 229960002747 betacarotene Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 210000002798 bone marrow cell Anatomy 0.000 description 1
- 229960003168 bronopol Drugs 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 1
- 229940043253 butylated hydroxyanisole Drugs 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 229940095259 butylated hydroxytoluene Drugs 0.000 description 1
- 229940067596 butylparaben Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229960005069 calcium Drugs 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000001465 calcium Nutrition 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- FNAQSUUGMSOBHW-UHFFFAOYSA-H calcium citrate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FNAQSUUGMSOBHW-UHFFFAOYSA-H 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- 229940078512 calcium gluceptate Drugs 0.000 description 1
- 239000004227 calcium gluconate Substances 0.000 description 1
- 235000013927 calcium gluconate Nutrition 0.000 description 1
- 229960004494 calcium gluconate Drugs 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- MKJXYGKVIBWPFZ-UHFFFAOYSA-L calcium lactate Chemical compound [Ca+2].CC(O)C([O-])=O.CC(O)C([O-])=O MKJXYGKVIBWPFZ-UHFFFAOYSA-L 0.000 description 1
- 239000001527 calcium lactate Substances 0.000 description 1
- 235000011086 calcium lactate Nutrition 0.000 description 1
- 229960002401 calcium lactate Drugs 0.000 description 1
- 229940078480 calcium levulinate Drugs 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- FATUQANACHZLRT-XBQZYUPDSA-L calcium;(2r,3r,4s,5r,6r)-2,3,4,5,6,7-hexahydroxyheptanoate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C([O-])=O FATUQANACHZLRT-XBQZYUPDSA-L 0.000 description 1
- NEEHYRZPVYRGPP-UHFFFAOYSA-L calcium;2,3,4,5,6-pentahydroxyhexanoate Chemical compound [Ca+2].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O NEEHYRZPVYRGPP-UHFFFAOYSA-L 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000000845 cartilage Anatomy 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 201000006662 cervical adenocarcinoma Diseases 0.000 description 1
- 201000010881 cervical cancer Diseases 0.000 description 1
- 229960001927 cetylpyridinium chloride Drugs 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229960003260 chlorhexidine Drugs 0.000 description 1
- 229960002242 chlorocresol Drugs 0.000 description 1
- 229960005443 chloroxylenol Drugs 0.000 description 1
- 210000001612 chondrocyte Anatomy 0.000 description 1
- 210000003737 chromaffin cell Anatomy 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229960002303 citric acid monohydrate Drugs 0.000 description 1
- AGOYDEPGAOXOCK-KCBOHYOISA-N clarithromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@](C)([C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)OC)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 AGOYDEPGAOXOCK-KCBOHYOISA-N 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 210000004087 cornea Anatomy 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 229940013361 cresol Drugs 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 235000019258 dehydroacetic acid Nutrition 0.000 description 1
- PGRHXDWITVMQBC-UHFFFAOYSA-N dehydroacetic acid Natural products CC(=O)C1C(=O)OC(C)=CC1=O PGRHXDWITVMQBC-UHFFFAOYSA-N 0.000 description 1
- 229940061632 dehydroacetic acid Drugs 0.000 description 1
- JEQRBTDTEKWZBW-UHFFFAOYSA-N dehydroacetic acid Chemical compound CC(=O)C1=C(O)OC(C)=CC1=O JEQRBTDTEKWZBW-UHFFFAOYSA-N 0.000 description 1
- 210000004443 dendritic cell Anatomy 0.000 description 1
- 229940111685 dibasic potassium phosphate Drugs 0.000 description 1
- 229940061607 dibasic sodium phosphate Drugs 0.000 description 1
- CGMRCMMOCQYHAD-UHFFFAOYSA-J dicalcium hydroxide phosphate Chemical compound [OH-].[Ca++].[Ca++].[O-]P([O-])([O-])=O CGMRCMMOCQYHAD-UHFFFAOYSA-J 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 229940095079 dicalcium phosphate anhydrous Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- WSDISUOETYTPRL-UHFFFAOYSA-N dmdm hydantoin Chemical compound CC1(C)N(CO)C(=O)N(CO)C1=O WSDISUOETYTPRL-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002357 endometrial effect Effects 0.000 description 1
- 229960004756 ethanol Drugs 0.000 description 1
- 229960001617 ethyl hydroxybenzoate Drugs 0.000 description 1
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004403 ethyl p-hydroxybenzoate Substances 0.000 description 1
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 238000007667 floating Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 210000000609 ganglia Anatomy 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 210000001914 gastric parietal cell Anatomy 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 208000005017 glioblastoma Diseases 0.000 description 1
- 230000001434 glomerular Effects 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229950006191 gluconic acid Drugs 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229960005150 glycerol Drugs 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 210000002503 granulosa cell Anatomy 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 230000002440 hepatic effect Effects 0.000 description 1
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 1
- 229960004867 hexetidine Drugs 0.000 description 1
- 230000000971 hippocampal effect Effects 0.000 description 1
- 210000002287 horizontal cell Anatomy 0.000 description 1
- 210000004754 hybrid cell Anatomy 0.000 description 1
- 210000004408 hybridoma Anatomy 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- ZCTXEAQXZGPWFG-UHFFFAOYSA-N imidurea Chemical compound O=C1NC(=O)N(CO)C1NC(=O)NCNC(=O)NC1C(=O)NC(=O)N1CO ZCTXEAQXZGPWFG-UHFFFAOYSA-N 0.000 description 1
- 229940113174 imidurea Drugs 0.000 description 1
- 210000004263 induced pluripotent stem cell Anatomy 0.000 description 1
- 101150032953 ins1 gene Proteins 0.000 description 1
- 210000005061 intracellular organelle Anatomy 0.000 description 1
- 210000004153 islets of langerhan Anatomy 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 210000003292 kidney cell Anatomy 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 101150048732 lap1 gene Proteins 0.000 description 1
- 210000002429 large intestine Anatomy 0.000 description 1
- 235000005772 leucine Nutrition 0.000 description 1
- 201000005296 lung carcinoma Diseases 0.000 description 1
- 208000003747 lymphoid leukemia Diseases 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 229960000816 magnesium hydroxide Drugs 0.000 description 1
- 229940037627 magnesium lauryl sulfate Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- HBNDBUATLJAUQM-UHFFFAOYSA-L magnesium;dodecyl sulfate Chemical compound [Mg+2].CCCCCCCCCCCCOS([O-])(=O)=O.CCCCCCCCCCCCOS([O-])(=O)=O HBNDBUATLJAUQM-UHFFFAOYSA-L 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 210000002901 mesenchymal stem cell Anatomy 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 210000004088 microvessel Anatomy 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229940045641 monobasic sodium phosphate Drugs 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- PJUIMOJAAPLTRJ-UHFFFAOYSA-N monothioglycerol Chemical compound OCC(O)CS PJUIMOJAAPLTRJ-UHFFFAOYSA-N 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- 201000000050 myeloid neoplasm Diseases 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 201000008026 nephroblastoma Diseases 0.000 description 1
- 210000000933 neural crest Anatomy 0.000 description 1
- 210000001178 neural stem cell Anatomy 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000001582 osteoblastic effect Effects 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 201000001649 ovarian clear cell adenocarcinoma Diseases 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 210000005105 peripheral blood lymphocyte Anatomy 0.000 description 1
- 210000003819 peripheral blood mononuclear cell Anatomy 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- PDTFCHSETJBPTR-UHFFFAOYSA-N phenylmercuric nitrate Chemical compound [O-][N+](=O)O[Hg]C1=CC=CC=C1 PDTFCHSETJBPTR-UHFFFAOYSA-N 0.000 description 1
- 208000028591 pheochromocytoma Diseases 0.000 description 1
- 239000008055 phosphate buffer solution Substances 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 235000002949 phytic acid Nutrition 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 210000003635 pituitary gland Anatomy 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229960004109 potassium acetate Drugs 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000010235 potassium benzoate Nutrition 0.000 description 1
- 239000004300 potassium benzoate Substances 0.000 description 1
- 229940103091 potassium benzoate Drugs 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 229960002816 potassium chloride Drugs 0.000 description 1
- 239000004224 potassium gluconate Substances 0.000 description 1
- 235000013926 potassium gluconate Nutrition 0.000 description 1
- 229960003189 potassium gluconate Drugs 0.000 description 1
- 235000010241 potassium sorbate Nutrition 0.000 description 1
- 239000004302 potassium sorbate Substances 0.000 description 1
- 229940069338 potassium sorbate Drugs 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- 210000000229 preadipocyte Anatomy 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 239000000473 propyl gallate Substances 0.000 description 1
- 235000010388 propyl gallate Nutrition 0.000 description 1
- 229940075579 propyl gallate Drugs 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 210000000512 proximal kidney tubule Anatomy 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 239000002510 pyrogen Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 206010038038 rectal cancer Diseases 0.000 description 1
- 208000020615 rectal carcinoma Diseases 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 201000006845 reticulosarcoma Diseases 0.000 description 1
- 208000029922 reticulum cell sarcoma Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 210000002027 skeletal muscle Anatomy 0.000 description 1
- 210000001626 skin fibroblast Anatomy 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- 229960003885 sodium benzoate Drugs 0.000 description 1
- 229940001607 sodium bisulfite Drugs 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000011083 sodium citrates Nutrition 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 229940037001 sodium edetate Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000001540 sodium lactate Substances 0.000 description 1
- 235000011088 sodium lactate Nutrition 0.000 description 1
- 229940005581 sodium lactate Drugs 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- JXKPEJDQGNYQSM-UHFFFAOYSA-M sodium propionate Chemical compound [Na+].CCC([O-])=O JXKPEJDQGNYQSM-UHFFFAOYSA-M 0.000 description 1
- 235000010334 sodium propionate Nutrition 0.000 description 1
- 239000004324 sodium propionate Substances 0.000 description 1
- 229960003212 sodium propionate Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 206010041823 squamous cell carcinoma Diseases 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 210000002222 superior cervical ganglion Anatomy 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 229940033663 thimerosal Drugs 0.000 description 1
- 229960000984 tocofersolan Drugs 0.000 description 1
- 235000010384 tocopherol Nutrition 0.000 description 1
- 229930003799 tocopherol Natural products 0.000 description 1
- 239000011732 tocopherol Substances 0.000 description 1
- 229960001295 tocopherol Drugs 0.000 description 1
- 229940042585 tocopherol acetate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 235000013337 tricalcium citrate Nutrition 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 229960005066 trisodium edetate Drugs 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 210000001113 umbilicus Anatomy 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- 235000004835 α-tocopherol Nutrition 0.000 description 1
- 239000002076 α-tocopherol Substances 0.000 description 1
- OENHQHLEOONYIE-JLTXGRSLSA-N β-Carotene Chemical compound CC=1CCCC(C)(C)C=1\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C OENHQHLEOONYIE-JLTXGRSLSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F220/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride ester, amide, imide or nitrile thereof
- C08F220/02—Monocarboxylic acids having less than ten carbon atoms; Derivatives thereof
- C08F220/52—Amides or imides
- C08F220/54—Amides, e.g. N,N-dimethylacrylamide or N-isopropylacrylamide
- C08F220/56—Acrylamide; Methacrylamide
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12M—APPARATUS FOR ENZYMOLOGY OR MICROBIOLOGY; APPARATUS FOR CULTURING MICROORGANISMS FOR PRODUCING BIOMASS, FOR GROWING CELLS OR FOR OBTAINING FERMENTATION OR METABOLIC PRODUCTS, i.e. BIOREACTORS OR FERMENTERS
- C12M1/00—Apparatus for enzymology or microbiology
- C12M1/12—Apparatus for enzymology or microbiology with sterilisation, filtration or dialysis means
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12M—APPARATUS FOR ENZYMOLOGY OR MICROBIOLOGY; APPARATUS FOR CULTURING MICROORGANISMS FOR PRODUCING BIOMASS, FOR GROWING CELLS OR FOR OBTAINING FERMENTATION OR METABOLIC PRODUCTS, i.e. BIOREACTORS OR FERMENTERS
- C12M21/00—Bioreactors or fermenters specially adapted for specific uses
- C12M21/08—Bioreactors or fermenters specially adapted for specific uses for producing artificial tissue or for ex-vivo cultivation of tissue
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12M—APPARATUS FOR ENZYMOLOGY OR MICROBIOLOGY; APPARATUS FOR CULTURING MICROORGANISMS FOR PRODUCING BIOMASS, FOR GROWING CELLS OR FOR OBTAINING FERMENTATION OR METABOLIC PRODUCTS, i.e. BIOREACTORS OR FERMENTERS
- C12M25/00—Means for supporting, enclosing or fixing the microorganisms, e.g. immunocoatings
- C12M25/14—Scaffolds; Matrices
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12M—APPARATUS FOR ENZYMOLOGY OR MICROBIOLOGY; APPARATUS FOR CULTURING MICROORGANISMS FOR PRODUCING BIOMASS, FOR GROWING CELLS OR FOR OBTAINING FERMENTATION OR METABOLIC PRODUCTS, i.e. BIOREACTORS OR FERMENTERS
- C12M3/00—Tissue, human, animal or plant cell, or virus culture apparatus
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N5/00—Undifferentiated human, animal or plant cells, e.g. cell lines; Tissues; Cultivation or maintenance thereof; Culture media therefor
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N5/00—Undifferentiated human, animal or plant cells, e.g. cell lines; Tissues; Cultivation or maintenance thereof; Culture media therefor
- C12N5/0062—General methods for three-dimensional culture
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- Biomedical Technology (AREA)
- Biotechnology (AREA)
- Genetics & Genomics (AREA)
- General Health & Medical Sciences (AREA)
- Microbiology (AREA)
- Biochemistry (AREA)
- General Engineering & Computer Science (AREA)
- Sustainable Development (AREA)
- Medicinal Chemistry (AREA)
- Cell Biology (AREA)
- Polymers & Plastics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Virology (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Molecular Biology (AREA)
- Immunology (AREA)
Abstract
본 발명은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 세포 필름 제조용 조성물, 세포 필름 제조 방법, 세포 필름 및 세포 확대 방법에 관한 것으로, 구체적으로는 본 발명의 최적의 조성을 이용하는 경우, 세포 확대 방법으로 하이드로겔화와 재응고 과정을 통해 세포를 최대 20배 이상 확대가 가능하여 현미경에서 고해상도 이미지 분석을 진행하기에 우수하다.
Description
본 발명은 제한된 현미경 배율에서 더 높은 배율로 세포를 관찰하기 위한 세포 시료의 준비와 관련된 기법으로 세포를 하이드로겔화하고 하이드로겔화된 세포를 최소 5~5.5배 최대 22~24배까지 확대 가능한 하이드로겔 세포 필름 제조 방법에 관한 기술이다.
현재의 세포 이미징 분석하기 위한 방법은 현미경의 렌즈 배율(4~100 배율)에 의존하고 있으며, 그 이상의 배율로 관찰하기 위해서는 수 억원 상당의 고가 이미징 장비에 의존하거나, 이 또한 배율의 한계점을 지니고 있다. 따라서, 배율의 한계점을 지닌 현미경에서 더 큰 이미지 분석을 위해서는, 시료의 크기를 더 크게 만들면 현미경 분석에서의 배율의 한계를 극복할 수 있다.
MAP (magnified analysis of proteome) 기법은 조직 및 세포를 최대 4배 확대하는 기술로, 8-mm 둥근 커버슬립 위에 세포 배양 후, MAP 용액을 도포하여 하이드로겔을 제작하여 이루어진다. 다만, dH2O에서 4배 커진 결과물은 볼록렌즈 형태의 하이드로겔로 이미징 분석을 위한 하이드로겔을 고정하기 어려우며, 또한 하이드로겔 두께가 3-mm 이상으로 부피가 상당히 컷다.
이후, 조직 및 세포를 최대 8배 확대 가능한 ZOOM 기법이 개발되었으며, 2가지의 ZOOM 용액을 사용하여 하이드로겔 배양을 총 4번의 round cycle을 걸쳐 최대 8배 커지게 하였다.
최근, 얇은 조직을 10배 확대 가능한 Epitope-preserving magnified analysis of proteome (eMAP) 기법이 보고되었으며, 총 3번의 round cycle을 걸쳐 약 10배 커지게 하였다. eMAP은 오직 조직을 대상으로 평가하였으며 세포를 대상으로 적용하지 않았다.
따라서, 세포의 크기를 흡수성이 있는 하이드로겔로 만들어 세포를 더 커지게 하고, 세포가 포함된 시료가 커지더라도 두께를 얇게하여 현미경에서 이미지 분석이 용이한 기술의 개발이 요구되었다.
따라서, 본 발명의 목적은 증류수에 용해된 아크릴아마이드(acrylamide), 비스-아크릴아마이드(bis-acrylamide), 소듐아크릴레이트(sodium acrylate) 및 TEMED를 포함하는 세포 필름 제조용 조성물을 제공하는 것이다.
본 발명의 또다른 목적은 세포에 제1용액과 제2용액을 도포하여 응고반응을 진행하는 단계를 포함하는 세포 필름 제조 방법으로서, 상기 제1용액은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 조성물이고, 상기 제2용액은 증류수에 용해된 5 내지 20% APS인, 세포 필름 제조 방법을 제공하는 것이다.
본 발명의 또 다른 목적은 항의 상기 세포 필름 제조 방법으로 제조된 세포 필름을 제공하는 것이다.
본 발명은 또한, (a) 상기 세포 필름을 제1용액에서 배양하는 단계; (b) 상기 (a) 단계에서 배양된 세포 필름에 제3용액을 도포하여 응고반응을 진행하는 단계;를 포함하는 세포 확대 방법으로서, 상기 제1용액은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 조성물이고, 상기 제3용액은 증류수에 용해된 0.5 내지 2% APS인, 세포 확대 방법을 제공한다.
그러나, 본 발명이 이루고자 하는 기술적 과제는 이상에서 언급한 과제에 제한되지 않으며, 언급되지 않은 또 다른 과제들은 아래의 기재로부터 당업자에게 명확하게 이해될 수 있을 것이다.
본 명세서에서 사용한 용어는 단지 설명을 목적으로 사용된 것으로, 한정하려는 의도로 해석되어서는 안 된다. 단수의 표현은 문맥상 명백하게 다르게 뜻하지 않는 한, 복수의 표현을 포함한다. 본 명세서에서, "포함하다" 또는 "가지다" 등의 용어는 명세서 상에 기재된 특징, 숫자, 단계, 동작, 구성요소, 부품 또는 이들을 조합한 것이 존재함을 지정하려는 것이지, 하나 또는 그 이상의 다른 특징들이나 숫자, 단계, 동작, 구성요소, 부품 또는 이들을 조합한 것들의 존재 또는 부가 가능성을 미리 배제하지 않는 것으로 이해되어야 한다. 다르게 정의되지 않는 한, 기술적이거나 과학적인 용어를 포함해서 여기서 사용되는 모든 용어들은 실시예가 속 하는 기술 분야에서 통상의 지식을 가진 자에 의해 일반적으로 이해되는 것과 동일한 의미를 가지고 있다. 일반적으로 사용되는 사전에 정의되어 있는 것과 같은 용어들은 관련 기술의 문맥 상 가지는 의미와 일치하는 의미를 가지는 것으로 해석되어야 하며, 본 출원에서 명백하게 정의하지 않는 한, 이상적이거나 과도하게 형식적인 의미로 해석되지 않는다.
본 발명은 하이드로겔 조성을 최적화하여 기본 베이스 용액을 증류수 (dH2O)로 바꿔주어 세포 이미징에 활용할 수 있는 세포 필름 제조에 관한 것이다. 이러한 dH2O 기반 조성으로 0.17-mm 두께의 커버슬립들을 이용하여 0.17-mm 두께의 5배 확대 가능한 얇은 하이드로겔 세포 필름을 제작하였다(도 2). 또한, dH2O 기반 조성의 하이드로겔화 용액(이하 "필름"액)과 1% APS (응고액-2)를 이용한 배양 및 응고 과정을 총 5회에 걸쳐서 순차적으로 최대 약 22배 이상 커질 수 있게 하였음을 확인하였으며, 필름용액에서의 배양 횟수에 따른 세포의 크기들을 비교 분석하여 제시하였다(1회: 6.2~6.8배, 2회: 8.2~9배, 3회: 10.6~11.8배, 4회: 16.7~18.5배, 5회: 22~24배)([표 3] 및 도 3 내지 6 참조). 파라필름으로 밀봉하여 가위로 절단하기 쉽고, 간편하게 비닐 지퍼백에 넣어 상온에서 보관하기 용이하다. 따라서, 실험자가 세포 관찰 실험을 위하여 하이드로겔 세포 필름을 절단하고 원하는 세포 확대 비율에 따라 세포를 확장하여 현미경을 활용한 고해상도 이미지 분석을 진행하기에 용이하다. 또한, 이를 바탕으로 다양한 세포주들과 줄기세포 플라그, 인체 유래물, 박테리아 등을 대상으로 하이드겔 세포 필름들을 선택적으로 제작할 수 있으며, 초고해상도 이미징 분석용 하이드로겔 세포 필름으로 이용가능하다.
따라서, 본 발명은 증류수에 용해된 아크릴아마이드(acrylamide), 비스-아크릴아마이드(bis-acrylamide), 소듐아크릴레이트(sodium acrylate) 및 TEMED를 포함하는 세포 필름 제조용 조성물을 제공한다.
본 명세서에서 용어 "세포 필름"은 세포를 4배 내지 22배 확대/확장시켜 현미경으로 세포의 고해상도 이미징 분석을 수행하기 위한 하이드로겔화 된 고정된 세포 시료를 의미한다. 하이드로겔"세포 필름"은 액체 흡수성 특성을 지니며 세포 필름 제조용 조성물에 배양 및 응고 반응을 반복 시행을 통해 세포 형태 및 세포내 소기관들을 확장시키는 특성을 지닌다. 기존 현미경의 렌즈 배율에만 의존하던 부분을 관찰 시료의 확대로 배율을 증가시켜 극복할 수 있으며, 세포의 구조를 고해상도의 이미지로 관찰할 수 있다. 또한, 세포, 박테리아, 곰팡이, 효모 등 다양한 세포 및 미생물을 대상으로 얇은 세포 필름으로 제작이 가능하며, 보관이 편리하고 사용이 매우 간편한 장점을 지닌다. 본 명세서에 있어서 "세포 필름"은 "하이드로겔 세포 필름"과 동일한 의미로 사용된다.
상기 조성물의 아크릴아마이드와 비스-아크릴아마이드는 크로스 링킹 구조를 이루어 하이드로겔화 하는 성분이고, 소듐아크릴레이트는 수분을 흡수하여 확장하는 특성을 지닌다.
본 발명의 조성물은 PBS가 아닌 증류수에 각각의 성분을 용해시켜 이미징 분석에 이용하기 위한 조성물이며, 구체적인 일실시예에서는 각각의 성분을 PBS와 증류수에 용해시켰을 때의 배율을 비교하였고, 이 때 증류수에 용해시킨 하이드로겔 조성물을 이용한 경우 확대 배율이 확실히 더 큰 것을 확인하였다(도 1 및 표 2). 0.1M PBS 용액 기반으로 0-round 경우 PBS에서 4배 확대 가능하지만, 본 발명을 이용한 dH2O 기반 조성물을 사용한 경우 0-round 경우 5~5.5배 확대가 가능한 것을 확인하였으며, 배양 및 응고 반응을 순차적으로 5회 round cycle까지 진행해주었을 경우 최대 22배 세포 확대가 가능함을 확인하였다.
본 발명의 세포 필름 제조용 조성물에 허용되는 부형제는 특정한 처리 형태 목적에 적합한 임의의 모든 용매, 분산 매질, 희석제, 또는 다른 액체 비히클, 분산액 또는 현탁 보조제, 표면 활성제, 등장화제, 증점제 또는 유화제, 보존제, 고체 결합제, 윤활제 등을 포함한다.
세포 필름 제조용 조성물에 포함되는 예시적인 보존제는 항산화제, 킬레이트화제, 항미생물 보존제, 항진균 보존제, 알콜 보존제, 산성 보존제, 및 다른 보존제를 포함할 수도 있다. 예시적인 항산화제는 알파 토코페롤, 아스코르브산, 아스코르빌 팔미테이트, 부틸화 히드록시아니솔, 부틸화 히드록시톨루엔, 모노티오글리세롤, 메타중아황산칼륨, 프로피온산, 프로필 갈레이트, 아스코르브산나트륨, 중아황산나트륨, 메타중아황산나트륨, 및 아황산나트륨을 포함하지만 이에 제한되지 않는다. 예시적인 킬레이트화제는 에틸렌디아민테트라아세트산 (EDTA), 시트르산 1수화물, 이나트륨 에데테이트, 이칼륨 에데테이트, 에데트산, 푸마르산, 말산, 인산, 소듐 에데테이트, 타르타르산, 및 트리소듐 에데테이트를 포함한다. 예시적인 항미생물 보존제는 벤즈알코늄 클로라이드, 벤제토늄 클로라이드, 벤질 알콜, 브로노폴, 세트리미드, 세틸피리디늄 클로라이드, 클로르헥시딘, 클로로부탄올, 클로로크레졸, 클로로크실레놀, 크레졸, 에틸 알콜, 글리세린, 헥세티딘, 이미드우레아, 페놀, 페녹시에탄올, 페닐에틸 알콜, 페닐질산수은 (phenylmercuric nitrate), 프로필렌 글리콜, 및 티메로살을 포함하지만 이에 제한되지 않는다. 예시적인 항진균 보존제는 부틸 파라벤, 메틸 파라벤, 에틸 파라벤, 프로필 파라벤, 벤조산, 히드록시벤조산, 칼륨 벤조에이트, 소르브산칼륨, 벤조산나트륨, 프로피온산나트륨, 및 소르브산을 포함하지만 이에 제한되지 않는다. 예시적인 알콜 보존제는 에탄올, 폴리에틸렌 글리콜, 페놀, 페놀계 화합물, 비스페놀, 클로로부탄올, 히드록시벤조에이트, 및 페닐에틸 알콜을 포함하지만 이에 제한되지 않는다. 예시적인 산성 보존제는 비타민 A, 비타민 C, 비타민 E, 베타-카로틴, 시트르산, 아세트산, 데히드로아세트산, 아스코르브산, 소르브산, 및 피트산을 포함하지만 이에 제한되지 않는다. 다른 보존제는 토코페롤, 토코페롤 아세테이트, 데테록시메 메실레이트, 세트리미드, 부틸화 히드록시아니솔 (BHA), 부틸화 히드록시톨루엔드 (BHT), 에틸렌디아민, 소듐 라우릴 술페이트 (SLS), 소듐 라우릴 에테르 술페이트 (SLES), 중아황산나트륨, 메타중아황산나트륨, 칼륨 술파이트, 메타중아황산칼륨, 글리단트 플러스, 페노닙, 메틸파라벤, 저몰 115, 게르마벤 II, 네올론, 카톤, 및 에욱실을 포함하지만 이에 제한되지 않는다.
예시적인 완충제는 시트레이트 완충 용액, 아세테이트 완충 용액, 포스페이트 완충제 용액, 염화암모늄, 탄산칼슘, 염화칼슘, 칼슘 시트레이트, 칼슘 글루비오네이트, 칼슘 글루셉테이트, 칼슘 글루코네이트, D-글루콘산, 글리세로인산칼슘, 락트산칼슘, 프로판산, 칼슘 레불리네이트, 펜탄산, 이염기성 인산칼슘, 인산, 삼염기성 인산칼슘, 수산화칼슘 포스페이트, 아세트산칼륨, 염화칼륨, 글루콘산칼륨, 칼륨 혼합물, 이염기성 인산칼륨, 일염기성 인산칼륨, 인산칼륨 혼합물, 아세트산나트륨, 중탄산나트륨, 염화나트륨, 시트르산나트륨, 락트산나트륨, 이염기성 인산나트륨, 일염기성 인산나트륨, 인산나트륨 혼합물, 트로메타민, 수산화마그네슘, 수산화알루미늄, 알긴산, 피로겐-자유수, 등장성 염수, 링거(Ringer's) 용액, 에틸 알콜, 및 이들의 조합을 포함하지만 이에 제한되지 않는다.
예시적인 윤활제는 스테아르산마그네슘, 스테아르산칼슘, 스테아르산, 실리카, 활석, 맥아, 글리세릴 베하네이트, 수소화 식물성 오일, 폴리에틸렌 글리콜, 벤조산나트륨, 아세트산나트륨, 염화나트륨, 류신, 마그네슘 라우릴 술페이트, 소듐 라우릴 술페이트, 및 이들의 조합을 포함하지만 이에 제한되지 않는다.
일양태에 있어서, 상기 아크릴아마이드의 농도는 20 내지 40 % (w/v)이고, 비스아크릴아마이드는 0.01 내지 0.1 % (v/v), 소듐아크릴레이트의 농도는 5 내지 20% (w/v), TEMED의 농도는 0.5 내지 0.8 % (v/v)일 수 있다. 더욱 바람직하게는, 아크릴아마이드의 농도는 30%, 비스아크릴아마이드의 농도는 0.02%, 소듐아크릴레이트의 농도는 10%일 수 있으며, TEMED의 농도는 0.65 %일 수 있다. 상기 범위를 벗어나는 경우, 세포 확대가 원하는 만큼 이루어지지 않을 수 있다(도 1 참조).
본 발명의 세포 필름 제조에 이용될 수 있는 상기 세포는 동물, 원생동물, 갑각류, 파충류, 식물, 곤충 유래 세포, 박테리아, 효모 및 곰팡이로 이루어진 군에서 선택되는 어느 1종으로부터 유래된 세포일 수 있다. 상기 동물은 마우스, 랫트, 주머니쥐, 메추라기, 햄스터, 토끼, 개, 돼지, 기니피그, 양, 소, 고양이, 밍크, 오리, 닭 등일 수 있으며, 이에 제한되지 않는다.
상기 세포는 피부, 혈액, 뼈, 골수, 배아, 대식세포, 폐, 혈관, 뇌, 심장, 췌장, 정소, 난소, 근육, 연골, 간, 비장, 자궁경관,유방, 신경모세포종, 대장, 뇌하수체, 각막, 망막, 이자, 멜라노마, 감상선, 방광, 점액, 전립선, 성상세포, 신경교세포, 복막, 지방세포 및 흉선으로 이루어진 군에서 선택되는 어느 1종으로부터 유래된 세포일 수 있으나, 이에 제한되지 않는다.
또한, 상기 세포는 부착성(adherent) 세포, 부유성(suspension) 세포, 지방 줄기세포, 유도만능 줄기세포, 줄기세포로부터 유도 분화된 세포, 293T, HeLa, 섬유아세포(fibroblast), 바이러스 및 박테리아에 감염된 세포일 수 있으나, 이에 제한되지 않는다.
여기서, 상기 부착성 세포는 1차적으로 세포배양 된 피부 섬유아세포(skin fibroblast), 배아 섬유아세포(embryonic fibroblast), HEK293T 세포(human embryonic kidney cell), A549 폐암세포(lung carcinoma cell), Hela 자궁경부암세포(cervix adenocarcinoma cell), Raw 264.7 대식세포, U87 교모세포종세포(glioblastoma cell) 등을 포함한 하기 표 1의 세포일 수 있으나, 이에 제한되지 않는다.
또한, 상기 부유성 세포는 HL-60 전골수성 백혈병 세포(peripheral blood acute promyelocytic leukemia cell), U-937 단핵구 백혈별 세포(pleural effusion histiocytic lymphoma cell) 등을 포함한 하기 표 1의 세포일 수 있으나, 이에 제한되지 않는다.
일실시예에 있어서, 상기 세포는 하기 표 1에서 선택되는 어느 1종 이상일 수 있으나, 이에 제한되지 않는다.
| 세포이름 | 유래 | 조직 | 표현형 |
| k46 | Mouse | Lymphocyte | Suspension |
| kt-3 | Human | Lymphocyte | Suspension |
| ks cells | Human | Skin | Adherent |
| kmst-6 | Human | Skin | Adherent |
| kb | Human | Fibroblast | Adherent |
| keratinocytes | Human | Keratinocyte | Adherent |
| keratinocytes | Mouse | Keratinocyte | Adherent |
| knrk | Rat | Epithelial | Either |
| kc1 | Drosophila melanogaster | Default | Adherent |
| kc18-2-40 cells | Human | Keratinocyte | Adherent |
| kd83 | Mouse | Blood | Suspension |
| kg-1 cells | Human | Bone marrow | Suspension |
| k562 | Human | Bone | Suspension |
| p19 cells | Mouse | Embryo | Adherent |
| pc-3 | Human | Prostate | Either |
| pu5-1.8 cells | Mouse | Macrophage | Suspension |
| pc 6 (pheochromocytoma-6 ) | Rat | Glial | Adherent |
| ps120, an nhe-deficient clone derived from ccl39 cells | Hamster | Lung | Adherent |
| p815, mastocytoma cells | Mouse | Macrophage | Adherent |
| p825, mastocytoma cells | Mouse | Macrophage | Adherent |
| pancreatic islets | Rat | Pancreas | Adherent |
| plb985 | Human | Blood | Suspension |
| per.c6® | Human | Retina | Either |
| p3.653 x ag8 murine myeloma cells | Mouse | Bone marrow | Adherent |
| peripheral blood mononuclear cells (pbmc) | Human | Blood | Suspension |
| pci-13 | Human | Skin | Adherent |
| pac-1 | Rat | Aorta | Adherent |
| peripheral blood lymphocytes | Human | Blood | Either |
| p388d1 | Mouse | Macrophage | Adherent |
| paju, human neural crest-derived cell line | Human | Brain | Adherent |
| pc-12 | Rat | Brain | Adherent |
| parp-/- mouse embryonic fibroblasts | Mouse | Fibroblast | Suspension |
| pam212, mouse keratinocytes | Mouse | Keratinocyte | Adherent |
| p19cl6 | Mouse | Heart | Adherent |
| phoenix-eco cells | Human | Embryo | Adherent |
| primary lymphoid (oka) organ from penaeus shrimp | Shrimp | Lymphocyte | Adherent |
| pa 317 or pt67 mouse fibroblast with herpes thymidine kinase (tk) gene | Mouse | Fibroblast | Adherent |
| panc1 | Human | Pancreas | Adherent |
| ht4 | Human | Testes | Adherent |
| hela t4 | Human | Blood | Suspension |
| huvec, huaec | Human | Umbilicus | Adherent |
| hit-t15 cells | Hamster | Epithelial | Adherent |
| h19-7/igf-ir | Rat | Brain | Suspension |
| h187 | Human | Lung | Adherent |
| hm-1 embryonic stem cells | Mouse | Other | Adherent |
| hitb5 | Human | Muscle | Adherent |
| hut 78 | Human | Skin | Suspension |
| hsy-eb | Human | Other | Adherent |
| hos | Human | Osteoblast | Adherent |
| hpb-all | Human | Lymphocyte | Suspension |
| h-7 | Mouse | Bone marrow | Suspension |
| hl-60 | Human | Lymphocyte | Suspension |
| hs-578t | Human | Breast/Mammary | Adherent |
| has-p | Mouse | Breast/Mammary | Adherent |
| h1299 | Human | Lung | Adherent |
| h9c2 | Rat | Myoblast | Adherent |
| hc11 | Mouse | Breast/Mammary | Adherent |
| hitb5 | Human | Muscle | Adherent |
| hepatic stellate cells | Rat | Liver | Adherent |
| hb60-5 cells | Mouse | Spleen | Adherent |
| ht1080 | Human | Fibroblast | Adherent |
| hbl100 cells | Human | Breast/Mammary | Adherent |
| hl-1 | Mouse | Heart | Adherent |
| hmec-1 | Human | Endothelial | Adherent |
| hep2 | Human | Epithelial | Adherent |
| hfff2 | Human | Foreskin | Adherent |
| hepatocytes | Rat | Liver | Adherent |
| hmcb | Human | Skin | Adherent |
| h441 | Human | Lung | Adherent |
| hybridoma | Mouse | Spleen | Suspension |
| hmn 1 | Mouse | Neuroblastoma | Adherent |
| haecs | Human | Aorta | Adherent |
| hib5 | Rat | Brain | Adherent |
| high 5 (bti-tn-5b1-4) | Insect | Embryo | Adherent |
| hl-5 | Mouse | Heart | Adherent |
| hep3b | Human | Liver | Adherent |
| h4iie | Rat | Liver | Adherent |
| htlm2 | Mouse | Breast/Mammary | Adherent |
| hela s3 | Human | Cervix | Adherent |
| hbec-90 | Human | Brain | Adherent |
| hela cells | Human | Cervix | Adherent |
| h35 | Rat | Liver | Adherent |
| hcd57 | Mouse | Blood | Suspension |
| htla230 | Human | Neuroblastoma | Adherent |
| huh 7 | Human | Liver | Adherent |
| hi299 | Human | Lung | Adherent |
| ht-29 | Human | Colon | Adherent |
| hel | Human | Lymphocyte | Suspension |
| hela 229 cells | Human | Cervix | Either |
| hca-7 | Human | Colon | Adherent |
| hepg2 | Human | Liver | Adherent |
| hct116 | Human | Colon | Adherent |
| hs68 | Human | Foreskin | Adherent |
| h4 | Human | Glial | Adherent |
| hela-cd4 | Human | Epithelial | Adherent |
| hasmcs | Human | Muscle | Adherent |
| hepatocytes | Mouse | Liver | Adherent |
| hutu 80 | Human | Colon | Adherent |
| ht22 | Mouse | Brain | Adherent |
| hre h9 | Rabbit | Uterus | Adherent |
| hmvec-l | Human | Lung | Adherent |
| hnscc | Human | Skin | Adherent |
| hacat | Human | Keratinocyte | Adherent |
| human skeletal muscle | Human | Muscle | Adherent |
| h-500, leydig tumor cell | Rat | Testes | Adherent |
| quail embryos | Quail | Embryo | Either |
| qt6 | Quail | Fibroblast | Adherent |
| a1.1 | Mouse | Lymphocyte | Adherent |
| ab1 | Mouse | Embryo | Adherent |
| alpha t3 | Human | Pituitary | Adherent |
| ae-1 | Mouse | Spleen | Suspension |
| att-20 | Mouse | Pituitary | Adherent |
| a498 | Human | Kidney | Adherent |
| a6 | Frog | Kidney | Adherent |
| a-431 | Human | Skin | Adherent |
| aortic endothelial cells | Human | Aorta | Adherent |
| am12 | Mouse | Blood | Suspension |
| arpe-19 | Human | Retina | Adherent |
| a10 | Rat | Muscle | Adherent |
| a204 | Human | Muscle | Adherent |
| adventitial fibroblasts | Human | Aorta | Adherent |
| achn | Human | Kidney | Adherent |
| a549 | Human | Lung | Adherent |
| a20 | Mouse | Lymphocyte | Suspension |
| as52 | Hamster | Ovary | Adherent |
| anjou 65 | Human | Default | Either |
| ar4-2j | Rat | Pancreas | Adherent |
| anterior pituitary gonadotropes | Human | Pituitary | Adherent |
| a72 | Dog | Connective | Adherent |
| a875 | Human | Melanoma | Adherent |
| akr | Mouse | Spleen | Adherent |
| a172 | Human | Brain | Adherent |
| imr-90 | Human | Lung | Adherent |
| imdf | Mouse | Skin | Adherent |
| ins-1 | Rat | Pancreas | Adherent |
| ib3-1 | Human | Lung | Adherent |
| in vivo mouse brain | Mouse | Bone | Either |
| in vivo pig | Pig | Other | Either |
| ivec cells | Human | Endothelial | Adherent |
| in vivo rat liver | Rat | Liver | Either |
| iec-6 rie | Rat | Epithelial | Adherent |
| imr-32 | Human | Neuroblastoma | Adherent |
| in vivo rat lung | Rat | Lung | Either |
| in vivo mouse | Mouse | Other | Either |
| in vivo rabbit eye | Rabbit | Other | Either |
| ic11 | Mouse | Testes | Adherent |
| in vivo rat brain | Rat | Brain | Either |
| 4t1 | Mouse | Breast/Mammary | Adherent |
| 4de4 | Mouse | Bone marrow | Either |
| vero | Primate - Non Human | Kidney | Adherent |
| foreskin fibroblast | Human | Foreskin | Adherent |
| fgc-4 | Rat | Liver | Adherent |
| fibroblasts | Chicken | Skin | Adherent |
| fl5.12 | Mouse | Liver | Suspension |
| f442-a | Mouse | Preadipocyte | Adherent |
| fibroblasts (cardiac) | Rat | Fibroblast | Adherent |
| flp-in t-rex 293 | Human | Kidney | Adherent |
| fetal neurons | Rat | Brain | Adherent |
| f9 | Mouse | Testes | Adherent |
| fibroblasts (normal) | Human | Fibroblast | Adherent |
| flp-in jurkat | Human | Lymphocyte | Suspension |
| flp-in cho | Hamster | Ovary | Adherent |
| flp-in 293 | Human | Kidney | Adherent |
| fibroblasts (embryo) | Rat | Fibroblast | Adherent |
| fm3a | Mouse | Breast/Mammary | Adherent |
| fak -/- | Mouse | Embryo | Adherent |
| freestyle 293 | Human | Kidney | Suspension |
| fsdc, murine dendritic cell | Mouse | Blood | Either |
| fr | Rat | Fibroblast | Adherent |
| fto-2b (rat hepatoma) cells | Rat | Liver | Suspension |
| frt | Rat | Thyroid | Suspension |
| fibroblasts (neonatal dermal) | Human | Skin | Adherent |
| flp-in cv-1 | Primate - Non Human | Kidney | Adherent |
| neurons (cortical) | Mouse | Other | Adherent |
| neurospora crassa | Fungi | Embryo | Adherent |
| nb324k | Human | Kidney | Adherent |
| nhdf | Human | Fibroblast | Adherent |
| nci-h358 | Human | Lung | Adherent |
| nhbe | Human | Lung | Adherent |
| nih 3t3, 3t3-l1 | Mouse | Fibroblast | Adherent |
| n2a | Mouse | Neuroblastoma | Adherent |
| nih 3t3-l1, nih 3t3 () | Mouse | Embryo | Adherent |
| nt2-d1 | Human | Testes | Adherent |
| nci-h23 | Human | Lung | Adherent |
| nhf3 | Human | Fibroblast | Adherent |
| neurons (post-natal/adult) | Rat | Brain | Adherent |
| n1e-115 | Mouse | Brain | Adherent |
| neuroblastoma | Human | Brain | Adherent |
| n18tg cells | Mouse | Neuroblastoma | Adherent |
| nci-h295 | Human | Kidney | Adherent |
| nih 3t6 | Mouse | Fibroblast | Adherent |
| nt2 | Human | Fibroblast | Adherent |
| nrk | Rat | Fibroblast | Adherent |
| neural stem cells | Rat | Brain | Either |
| ng108-15 | Mouse | Neuroblastoma | Adherent |
| neuons (astrocytes) | Rat | Astrocyte | Adherent |
| nbt-ii | Rat | Bladder | Adherent |
| nmumg | Mouse | Breast/Mammary | Adherent |
| neurons | Mouse | Brain | Adherent |
| neurons (astrocytes) | Rat | Brain | Adherent |
| ns20y | Mouse | Neuroblastoma | Adherent |
| neuons (hippocampal & septal) | Rat | Brain | Adherent |
| neurons (embryonic cortical) | Rat | Brain | Adherent |
| nhff | Human | Foreskin | Adherent |
| neurons (ganglia) | Frog | Brain | Either |
| neuro 2a, a murine neuroblastoma cell line | Mouse | Neuroblastoma | Adherent |
| n13 | Mouse | Brain | Adherent |
| ng 125 | Human | Neuroblastoma | Adherent |
| ncb20 | Mouse | Neuroblastoma | Adherent |
| nih 3t3-l1, nih 3t3 | Mouse | Embryo | Adherent |
| nalm6 | Human | Other | Suspension |
| nci-h460 | Human | Lung | Adherent |
| neurons (superior cervical ganglia - scg) | Rat | Brain | Adherent |
| 5637 | Human | Bladder | Adherent |
| wit49 wilms tumor | Human | Lung | Either |
| guinea pig endometrial stromal cells | Guinea Pig | Ovary | Adherent |
| granta-519 | Human | Blood | Suspension |
| gc-2spd (ts) | Mouse | Epithelial | Adherent |
| glya | Hamster | Ovary | Adherent |
| g401 | Human | Connective | Adherent |
| goto | Human | Neuroblastoma | Adherent |
| glomeruli | Rat | Lung | Adherent |
| gt1 | Mouse | Brain | Adherent |
| gh4c1 | Rat | Pituitary | Adherent |
| griptite? 293 msr | Human | Kidney | Adherent |
| gamma 3t3 | Mouse | Fibroblast | Adherent |
| granulosa cells | Mouse | Ovary | Either |
| gh3 | Rat | Pituitary | Adherent |
| 293-h | Human | Kidney | Either |
| 293 ebna | Human | Kidney | Adherent |
| 293t | Human | Kidney | Either |
| 293s | Human | Kidney | Either |
| 2pk3 | Mouse | Lymphocyte | Suspension |
| 208f | Rat | Fibroblast | Adherent |
| 2008 | Human | Ovary | Adherent |
| 2774 | Human | Ovary | Adherent |
| 293 | Human | Kidney | Either |
| 293-f | Human | Kidney | Either |
| 2780 | Human | Ovary | Adherent |
| ok, derived from renal proximal tubules | Opossum | Kidney | Adherent |
| osteoblasts | Rat | Bone | Adherent |
| o23 | Hamster | Fibroblast | Adherent |
| orbital fibroblast | Human | Fibroblast | Adherent |
| opaec cells | Sheep | Endothelial | Adherent |
| ovcar-3 | Human | Ovary | Adherent |
| ovarian surface epithelial (ose) | Human | Ovary | Adherent |
| omega e | Mouse | Embryo | Adherent |
| ohio helas | Human | Cervix | Suspension |
| ta3 | Mouse | Breast/Mammary | Adherent |
| t lymphocytes (t cells) | Mouse | Lymphocyte | Adherent |
| thp-1 | Human | Blood | Suspension |
| t47d,t-47d | Human | Breast/Mammary | Adherent |
| tsa201 | Human | Embryo | Adherent |
| t-rex-cho | Hamster | Ovary | Adherent |
| tr2 | Mouse | Brain | Adherent |
| tib-90 | Mouse | Fibroblast | Adherent |
| tig | Human | Fibroblast | Adherent |
| t lymphocytes (t cells) | Human | Lymphocyte | Adherent |
| tgw-nu-1 | Human | Bladder | Adherent |
| tobacco protoplasts | Plant | Other | Suspension |
| t-rex-293 | Human | Kidney | Adherent |
| tk.1 | Mouse | Lymphocyte | Suspension |
| t lymphocytes cytotoxic (ctl) cells | Mouse | Lymphocyte | Either |
| t-rex hela | Human | Cervix | Adherent |
| t24 | Human | Bladder | Adherent |
| tyknu cells | Human | Ovary | Adherent |
| t3cho/at1a | Hamster | Ovary | Either |
| t98g | Human | Brain | Adherent |
| dictyostelium | Amoeba | Other | Suspension |
| daoy | Human | Other | Adherent |
| dgz | Plant | Other | Adherent |
| d3 embryonic stem cells | Mouse | Embryo | Adherent |
| d.mel-2 | Insect | Embryo | Either |
| drosophila kc | Insect | Embryo | Adherent |
| dt40 | Chicken | Bursa | Suspension |
| duck (in vivo) | Duck | Other | Suspension |
| du145 | Human | Prostate | Adherent |
| df1 | Chicken | Fibroblast | Adherent |
| d10 | Mouse | Lymphocyte | Suspension |
| do-11.10 | Mouse | Lymphocyte | Suspension |
| daudi | Human | Lymphocyte | Suspension |
| dc 2.4 cells | Mouse | Blood | Either |
| 32d | Mouse | Bone marrow | Either |
| 3t3-f442a | Mouse | Other | Adherent |
| 3.l2 | Mouse | Lymphocyte | Either |
| 33.1.1 | Mouse | Lymphocyte | Suspension |
| 3y1 | Rat | Fibroblast | Adherent |
| l6e9 | Rat | Muscle | Adherent |
| lap1 | Mouse | Lymphocyte | Suspension |
| l1210 | Mouse | Monocyte | Suspension |
| l-m(tk-) | Mouse | Connective | Adherent |
| lan-5 | Human | Brain | Adherent |
| lmh | Chicken | Liver | Adherent |
| lk35.2 | Mouse | Lymphocyte | Suspension |
| lymphoid cell line | Rat | Lymphocyte | Suspension |
| l6 cells | Rat | Muscle | Adherent |
| l929 | Mouse | Fibroblast | Adherent |
| lncap | Human | Prostate | Adherent |
| ltk | Mouse | Connective | Adherent |
| lap3 | Mouse | Embryo | Adherent |
| l1210-fas | Mouse | Myoblast | Suspension |
| lisn c4 (nih 3t3 derivative overexpressing egf) | Mouse | Fibroblast | Adherent |
| l8 cells | Rat | Myoblast | Adherent |
| llc-pk1 | Pig | Kidney | Adherent |
| lsv5 | Human | Keratinocyte | Adherent |
| lewis lung carcinoma, llc | Mouse | Lung | Either |
| lovo | Human | Colon | Adherent |
| umrc6 | Human | Kidney | Adherent |
| uok257 | Human | Kidney | Adherent |
| u-937 | Human | Macrophage | Suspension |
| umr 106-01 | Rat | Bone | Adherent |
| u2os | Human | Bone | Adherent |
| u9737 | Human | Lymphocyte | Suspension |
| u251 cells | Human | Glial | Adherent |
| uc729-6 | Human | Lymphocyte | Either |
| u87, u87mg | Human | Astrocyte | Adherent |
| u373mg | Human | Astrocyte | Adherent |
| e14tg2a | Mouse | Embryo | Adherent |
| endothelial cells (aortic) | Pig | Aorta | Adherent |
| embryonic stem cells | Mouse | Embryo | Adherent |
| e36 | Hamster | Lung | Adherent |
| endothelial cells (pulmonary aorta) | Rat | Aorta | Adherent |
| ebc-1 | Human | Lung | Adherent |
| ewing sarcoma coh cells | Human | Bone | Suspension |
| ef88 | Mouse | Fibroblast | Adherent |
| e1-ts20 | Human | Breast/Mammary | Adherent |
| el-4 | Mouse | Thymus | Suspension |
| es-d3 | Mouse | Embryo | Adherent |
| e. histolytica | Amoeba | Other | Suspension |
| ecv | Human | Endothelial | Adherent |
| epithelial cells (sra01/04) | Human | Epithelial | Adherent |
| ecr-293 | Human | Kidney | Adherent |
| epithelial cells (rte) | Rat | Trachael | Adherent |
| es-2 ovarian clear cell adenocarcinoma | Human | Ovary | Adherent |
| rat-1, rat fibroblasts | Rat | Fibroblast | Adherent |
| rin 1046-38 | Rat | Pancreas | Suspension |
| rj2.2.5 | Human | Lymphocyte | Suspension |
| raw cells | Rat | Peritoneum | Suspension |
| raec, rat aortic endothelial cells | Rat | Aorta | Adherent |
| ros, rat osteoblastic cell line | Rat | Osteoblast | Adherent |
| rat-6 (r6), rat embryo fibroblast | Rat | Fibroblast | Adherent |
| rk13 | Rabbit | Kidney | Adherent |
| rabbit pleural mesothelial | Rabbit | Lung | Adherent |
| rat epithelial cells | Rat | Epithelial | Adherent |
| rat c5, glioma cells | Rat | Glial | Adherent |
| rcme, rabbit coronary microvessel endothelial | Rabbit | Endothelial | Adherent |
| rw-4 | Mouse | Embryo | Adherent |
| rh18 | Human | Muscle | Adherent |
| raw 264.7 cells, murine macrophage cells | Mouse | Macrophage | Adherent |
| ramos | Human | Lymphocyte | Suspension |
| rccd1 | Rat | Kidney | Adherent |
| rpe.40 | Hamster | Kidney | Adherent |
| rat 2, rat fibroblasts | Rat | Fibroblast | Adherent |
| rcho | Rat | Default | Adherent |
| r1 embryonic stem cell, es | Mouse | Embryo | Either |
| rat hepatic ito cells | Rat | Liver | Adherent |
| rat adipocyte | Rat | Adipose | Adherent |
| rko, rectal carcinoma cell line | Human | Colon | Adherent |
| remc | Rat | Breast/Mammary | Adherent |
| raji | Human | Lymphocyte | Suspension |
| rat glomerular mesangial mc cells | Rat | Kidney | Adherent |
| rabbit vsmc, vascular smooth muscle cells | Rabbit | Muscle | Adherent |
| mv1lu | Mink | Lung | Adherent |
| m12.4 | Mouse | Lymphocyte | Adherent |
| mewo | Human | Melanoma | Adherent |
| ms1 | Mouse | Pancreas | Adherent |
| mono-mac-6 cells | Human | Blood | Suspension |
| mouse embryonic fibroblasts | Mouse | Fibroblast | Adherent |
| m21-l4 | Human | Melanoma | Adherent |
| mcf-10 | Human | Breast/Mammary | Adherent |
| mtd-1a | Mouse | Epithelial | Adherent |
| msc human mesenchymal stem cell | Human | Bone marrow | Adherent |
| mca-rh7777 | Rat | Liver | Adherent |
| monocytes | Human | Blood | Suspension |
| mutu i | Human | Lymphocyte | Suspension |
| m3z | Human | Breast/Mammary | Adherent |
| mel | Mouse | Other | Adherent |
| mcf-7 | Human | Breast/Mammary | Adherent |
| magi-ccr5 | Human | Epithelial | Adherent |
| maize protoplasts | Plant | Other | Adherent |
| mutu group3, b-cell line | Human | Lymphocyte | Suspension |
| mtln3 | Rat | Breast/Mammary | Adherent |
| m-imcd | Mouse | Kidney | Adherent |
| mda-mb-468 | Human | Breast/Mammary | Adherent |
| mf4/4 | Mouse | Macrophage | Adherent |
| mdck | Dog | Kidney | Adherent |
| mc3t3-e1 | Mouse | Osteoblast | Adherent |
| m21 | Human | Melanoma | Adherent |
| mt-2 | Human | Lymphocyte | Adherent |
| min6 | Mouse | Default | Either |
| myocytes (ventricular) | Rat | Heart | Adherent |
| mrc-5 | Human | Lung | Adherent |
| mda-mb-231 | Human | Breast/Mammary | Adherent |
| m21-l | Human | Melanoma | Adherent |
| mes-sa | Human | Uterus | Adherent |
| molt4 (human acute t lymphoblastic leukaemia) | Human | Blood | Suspension |
| mg87 | Mouse | Fibroblast | Adherent |
| mtsv1-7 | Human | Epithelial | Adherent |
| mt4 | Human | Lymphocyte | Suspension |
| ma104 | Primate - Non Human | Kidney | Adherent |
| macrophages | Human | Blood | Either |
| murine alveolar macrophages cell line mhs | Rat | Lung | Adherent |
| mg-63 cells | Human | Bone | Adherent |
| me-180 | Human | Cervix | Adherent |
| mob cells | Mouse | Osteoblast | Adherent |
| melenoma cells | Human | Melanoma | Adherent |
| mr1 | Rat | Embryo | Adherent |
| mda-mb-453 | Human | Breast/Mammary | Adherent |
| macrophages | Mouse | Peritoneum | Adherent |
| mnt1 | Human | Skin | Adherent |
| mat b iii | Rat | Breast/Mammary | Adherent |
| mkn45 gastric cancer | Human | Stomach | Adherent |
| mc ardle 7777 | Rat | Liver | Either |
| m1 | Rat | Embryo | Adherent |
| mdbk | Cow | Kidney | Adherent |
| 82-6 | Human | Fibroblast | Adherent |
| bjab | Human | Lymphocyte | Suspension |
| baec | Cow | Aorta | Adherent |
| b-tc3 | Mouse | Pancreas | Adherent |
| bs-c-1, bsc-1 | Primate - Non Human | Kidney | Adherent |
| b82 | Mouse | Fibroblast | Adherent |
| bsc-40 | Primate - Non Human | Kidney | Adherent |
| bcec | Human | Brain | Adherent |
| b35 | Rat | Neuroblastoma | Adherent |
| bowes melanoma cells | Human | Skin | Adherent |
| beas-2b | Human | Lung | Adherent |
| bc3h1 | Mouse | Brain | Adherent |
| bm5 | Insect | Ovary | Suspension |
| bac | Cow | Adrenal Gland | Adherent |
| bewo | Human | Uterus | Adherent |
| b65 | Rat | Neuroblastoma | Adherent |
| bovine chromaffin cells | Cow | Adrenal Gland | Adherent |
| bone marrow cells | Mouse | Bone marrow | Suspension |
| bfc012 | Mouse | Embryo | Adherent |
| b16-f10 | Mouse | Melanoma | Adherent |
| boll weevil brl-ag-3c | Insect | Other | Adherent |
| b82 m721 | Mouse | Fibroblast | Adherent |
| balb/mk | Mouse | Epithelial | Adherent |
| bms-black mexican sweet protoplasts | Default | Default | Suspension |
| b lymphocytes | Human | Blood | Suspension |
| bone marrow derived stromal cells | Human | Bone marrow | Adherent |
| bhk-21 | Hamster | Kidney | Either |
| balb/c 3t3, 3t3-a31 | Mouse | Fibroblast | Adherent |
| be(2)-c | Human | Neuroblastoma | Adherent |
| bnl cl.2 (cl2) | Mouse | Liver | Adherent |
| b-lcl | Human | Blood | Suspension |
| b4.14 | Primate - Non Human | Kidney | Adherent |
| bcl-1 | Mouse | Lymphocyte | Adherent |
| baf3, ba/f3 | Mouse | Lymphocyte | Suspension |
| bt cells | Cow | Fibroblast | Adherent |
| bewo | Human | Other | Adherent |
| bt549 | Human | Breast/Mammary | Adherent |
| btm (bovine trachael myocytes) | Cow | Muscle | Adherent |
| b11 | Mouse | Spleen | Suspension |
| bosc 23 | Human | Kidney | Adherent |
| j82 | Human | Bladder | Adherent |
| jeg-3 | Human | Other | Adherent |
| j774 cells | Mouse | Macrophage | Adherent |
| jy | Human | Lymphocyte | Suspension |
| jb6 rt101 | Mouse | Epithelial | Either |
| jurkat | Human | Lymphocyte | Suspension |
| jcam1.6 | Human | Lymphocyte | Suspension |
| j558l | Mouse | Blood | Suspension |
| jb6 p+ c141 | Mouse | Skin | Adherent |
| 1064sk | Human | Foreskin | Adherent |
| 143b | Human | Bone marrow | Either |
| 16-9 | Human hamster hybrid cell line - transfected with two human genes | Other | Adherent |
| sw620 | Human | Colon | Adherent |
| sk-hep-1 cells | Human | Skin | Either |
| saos-2 | Human | Bone | Adherent |
| sw480 | Human | Colon | Adherent |
| smooth muscle cells (aortic) | Rat | Muscle | Adherent |
| sk-n-sh, neuronal cells | Human | Brain | Adherent |
| smooth muscle cells (vascular) | Human | Muscle | Adherent |
| sknmc | Human | Brain | Adherent |
| svr | Mouse | Pancreas | Adherent |
| sk-ut-1 | Human | Muscle | Adherent |
| sf21ae | Insect | Other | Either |
| sk-lms-1 | Human | Other | Adherent |
| splenocytes | Mouse | Spleen | Suspension |
| stem | Rat | Bone | Suspension |
| splenocytes (b cells t2) | Mouse | Spleen | Suspension |
| s194 cells | Mouse | Lymphocyte | Adherent |
| spoc-1 | Rat | Trachael | Adherent |
| sf21 | Insect | Other | Either |
| sl2 | Drosophila melanogaster | Default | Either |
| sk-n-be(2) | Human | Neuroblastoma | Adherent |
| shep | Human | Brain | Adherent |
| splenocytes (resting b cells) | Mouse | Spleen | Suspension |
| sk-n-as | Human | Neuroblastoma | Adherent |
| smooth muscle cells (vascular) | Rat | Muscle | Adherent |
| sw13 | Human | Adrenal gland/cortex | Adherent |
| sh-sy5y | Human | Brain | Either |
| smooth muscle cells (vascular) | Rabbit | Aorta | Adherent |
| snb19 | Human | Brain | Adherent |
| smmc7721 | Human | Liver | Adherent |
| smooth muscle cells (aortic) rasmc (a7-r5) | Rat | Aorta | Adherent |
| sf9 | Insect | Ovary | Suspension |
| sp1 | Mouse | Breast/Mammary | Adherent |
| schizosaccharomyces pombe | Yeast | Other | Either |
| skov3 | Human | Ovary | Adherent |
| siha | Human | Cervix | Adherent |
| s49.1 | Mouse | Thymus | Suspension |
| scc12, human squamous cell carcinoma line (c12c20) | Human | Skin | Adherent |
| s2-013 | Human | Pancreas | Either |
| stem cells | Human | Bone marrow | Suspension |
| sk-br-3 | Human | Breast/Mammary | Adherent |
| 9hte | Human | Trachael | Adherent |
| c6 cells | Rat | Brain | Adherent |
| ca77 | Rat | Thyroid | Adherent |
| calu-6 | Human | Lung | Adherent |
| chick embryo chondrocytes | Chicken | Embryo | Adherent |
| colo205 | Human | Colon | Adherent |
| cho-trvb | Hamster | Ovary | Adherent |
| cho k1 | Hamster | Ovary | Adherent |
| chicken sperm | Chicken | Sperm | Adherent |
| c1c12 | Mouse | Muscle | Adherent |
| ch12f3-2a | Mouse | Lymphocyte | Suspension |
| cho -b53 | Hamster | Ovary | Adherent |
| ccl-16-b9 | Hamster | Lung | Adherent |
| cho-lec2 | Hamster | Ovary | Adherent |
| cho dg44 | Hamster | Ovary | Either |
| chick embryo blastodermal cells | Chicken | Embryo | Adherent |
| cho 58 | Hamster | Ovary | Adherent |
| ctll-2 | Mouse | Lymphocyte | Suspension |
| cf2th | Dog | Thymus | Adherent |
| cho - b53 jf7 | Hamster | Ovary | Adherent |
| clone a | Human | Colon | Adherent |
| c57bl/6 cells | Mouse | Heart | Adherent |
| canine gastric parietal cells | Dog | Stomach | Adherent |
| cwr22rv1 | Human | Prostate | Adherent |
| ct26 | Mouse | Colon | Either |
| cv-1 | Primate - Non Human | Kidney | Adherent |
| cell.220(b8) | Human | Default | Suspension |
| cem | Human | Blood | Suspension |
| cj7 | Mouse | Embryo | Adherent |
| cg-4 | Rat | Glial | Adherent |
| capan-2 | Human | Pancreas | Adherent |
| cos-gs1 | Primate - Non Human | Kidney | Adherent |
| c33 | Human | Cervix | Adherent |
| caco-2 cells | Human | Colon | Adherent |
| cardiomyocytes | Rat | Heart | Adherent |
| c3h 10t1/2 | Mouse | Fibroblast | Adherent |
| c1.39t | Human | Fibroblast | Adherent |
| cos-1 | Primate - Non Human | Kidney | Adherent |
| cho-leu c2gnt | Hamster | Ovary | Adherent |
| calu-3 | Human | Lung | Adherent |
| c13-nj | Human | Glial | Adherent |
| cho-b7 | Hamster | Ovary | Adherent |
| cmt-93 | Mouse | Rectum | Adherent |
| c3a | Human | Liver | Adherent |
| c127 | Mouse | Epithelial | Adherent |
| c4-2 | Human | Prostate | Adherent |
| cfk2 | Rat | Bone | Adherent |
| caski | Human | Cervix | Adherent |
| c1r, hmy2.c1r | Human | Lymphocyte | Adherent |
| crl6467 | Mouse | Liver | Adherent |
| cho-lec1 | Hamster | Ovary | Adherent |
| crfk | Cat | Kidney | Adherent |
| ct60 | Hamster | Ovary | Adherent |
| cowpea plant embryos | Fungi | Embryo | Adherent |
| cerebellar | Mouse | Brain | Adherent |
| chinese hamster lung | Hamster | Lung | Adherent |
| cos-m6 | Primate - Non Human | Kidney | Adherent |
| cho-s | Hamster | Ovary | Suspension |
| c2c12 | Mouse | Muscle | Adherent |
| catha, cath.a | Mouse | Brain | Either |
| cos-7 | Primate - Non Human | Kidney | Adherent |
| cardiomyocytes | Human | Heart | Adherent |
| chicken hepatocytes | Chicken | Liver | Adherent |
| cd34+ monocytes | Human | Monocyte | Suspension |
| clone-13, mutant b lymphoblastoid | Human | Lymphocyte | Suspension |
| cak | Mouse | Fibroblast | Adherent |
| chu-2 | Human | Epithelial | Adherent |
| chick embryo fibroblasts | Chicken | Embryo | Adherent |
구체적인 일 양태에서, 상기 조성물에 아자이드화나트륨(sodium azide)을 추가로 포함할 수 있다. 하이드로겔 세포 필름은 보관 기간에 따라 단기 보관용 및 장기 보관용으로 나뉘며 장기보관용은 방부제 특성의 0.01% 아자이드화나트륨이 추가로 포함될 수 있다.
본 발명은 또한, 세포에 제1용액과 제2용액을 도포하여 응고반응을 진행하는 단계를 포함하는 세포 필름 제조 방법으로서, 상기 제1용액은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 조성물이고, 상기 제2용액은 증류수에 용해된 5 내지 20% APS인, 세포 필름 제조 방법을 제공한다.
본 명세서에 있어서 상기 "제1용액"은 본 명세서에서 "필름액"과 동일한 의미로 사용되며, 상기 "제2용액"은 실시예상 "응고액-1"과 같은 의미로 사용될 수 있고, 제1용액인 "필름액"과 혼합시 화학 반응으로 폴리-하이드로겔화 반응을 진행시킬 수 있다.
구체적인 세포 필름 제조 방법은 도 2a 및 도 2b에 나타난 순서도와 같으며, 본발명의 세포 필름 제조 방법에 있어서, 상기 아크릴아마이드의 농도는 20 내지 40 % (w/v)이고, 비스아크릴아마이드는 0.01 내지 0.1 % (v/v), 소듐아크릴레이트의 농도는 5 내지 20% (w/v), TEMED의 농도는 0.5 내지 0.8 % (v/v)일 수 있다. 더욱 바람직하게는, 아크릴아마이드의 농도는 30%, 비스아크릴아마이드의 농도는 0.02%, 소듐아크릴레이트의 농도는 10%일 수 있으며, TEMED의 농도는 0.65 %일 수 있다. 상기 범위를 벗어나는 경우, 세포 확대가 원하는 만큼 이루어지지 않을 수 있다(도 1 참조).
상기 세포 필름 제조 방법에 이용될 수 있는 세포는 동물, 원생동물, 갑각류, 파충류, 식물, 곤충 유래 세포, 박테리아, 효모 및 곰팡이로 이루어진 군에서 선택되는 어느 1종으로부터 유래된 세포일 수 있으며, 본 명세서의 표 1에서 선택되는 어느 1종 이상으로부터 유래한 세포일 수 있다. 이외에도 가능한 세포에 대해서는 상기 세포 필름 제조용 조성물에서 전술한 바와 같으므로, 기재를 생략한다.
세포 필름 제조 방법에 이용되는 제1용액에 아자이드화나트륨을 추가로 포함할 수 있다. 이는 상기 세포 필름 제조용 조성물에서 전술한 바와 같으므로, 기재를 생략한다. 단기 및 장기 보관용 필름액으로 제작된 세포 필름을 비닐 지퍼백으로 밀봉하여 상온에서 간편하게 보관이 용이하며, 형광 항체 및 dye가 염색된 세포의 하이드로겔 세포 필름은 차광 비닐 지퍼백을 이용하여 보관이 가능하다.
상기 세포 필름 제조 방법에서 응고반응은 5분 내지 60분간 수행될 수 있으며, 바람직하게는 10분 내지 40분간 수행될 수 있고, 더욱 바람직하게는 15분 내지 30분간 수행될 수 있다.
상기 응고된 세포 필름을 파라필름으로 밀봉하는 단계를 추가로 포함할 수 있다. 구체적인 일실시예에서 커버슬립 내에서 하이드로겔 세포 필름의 정형화가 가능하였으며, 하이드로겔이 흡착되지 않는 파라필름을 부착하였고, 가위를 이용하여 사용자가 원하는 크기로 건조된 하이드로겔 세포 필름을 절단하여 사용 가능하도록 제조가능하다(도 2c). 이와 같은 방법으로 제조된 세포 필름은 세포 확대 이미징 분석이 필요한 사용자에게 번거러운 세포 배양 과정이 없이 일회성으로 사용이 가능하며 또한 세포 필름의 보관 또한 용이하다.
본 발명은 상기 세포 필름 제조 방법으로 제조된 세포 필름을 제공한다.
본 발명은 또한, (a) 전술한 세포 필름을 제1용액에서 배양하는 단계; 및
(b) 상기 (a) 단계에서 배양된 세포 필름에 제3용액을 도포하여 응고반응을 진행하는 단계; 를 포함하는 세포 확대 방법으로서, 상기 제1용액은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 조성물이고, 상기 제3용액은 증류수에 용해된 0.5 내지 2% APS인, 세포 확대 방법을 제공한다.
세포 확대 방법은 전술된 방법으로 제조된 세포 필름을 추가적으로 필름액 또는 응고액에서 하이드로겔화 및 재응고화를 진행하여 세포를 확대시키를 방법을 의미하며, 구체적인 과정은 도 4에 나타난 바와 같다.
본 명세서에 있어서 상기 "제3용액"은 실시예상 "응고액-2"와 같은 의미로 사용될 수 있고, 제1용액인 "필름액"과 혼합시 화학 반응으로 폴리-하이드로겔화 반응을 진행시킬 수 있다.
세포 필름을 제1용액에 배양 및 제3용액으로 하이드로겔화 및 재응고 과정(1~5 회)을 반복하여 확대되는 비율을 확인한 결과는 [표 3]과 같고, 이를 이미징화 한 결과는 도 5a 내지 도 5e와 같다.
상기 세포 확대 방법에서 (a) 단계의 제1용액의 아크릴아마이드의 농도는 30 내지 40 %이고, 비스아크릴아마이드는 0.01 내지 0.1 %, 소듐아크릴레이트의 농도는 5 내지 20%, TEMED의 농도는 0.5 내지 0.8 %일 수 있다. 더욱 바람직하게는, 아크릴아마이드의 농도는 30%, 비스아크릴아마이드의 농도는 0.02%, 소듐아크릴레이트의 농도는 10%일 수 있으며, TEMED의 농도는 0.65 %일 수 있다.
구체적인 일 양태에서, 상기 (a) 단계의 배양은 2℃ 내지 10℃에서 4시간 내지 12시간 동안 진행될 수 있으며, 바람직하게는 5시간 내지 8시간동안 진행될 수 있고, 통상의 기술자가 적절히 조절할 수 있다.
구체적인 일 양태에서, 상기 (b) 단계의 응고반응은 5분 내지 60분간 수행될 수 있으며, 바람직하게는 5분 내지 30분간 수행될 수 있다.
일실시예에 있어서, 상기 (a) 단계 내지 (b) 단계를 1 내지 3회 반복할 수 있다. 상기 (a) 단계 내지 (b) 단계를 1 내지 3회 반복하여 제조된 세포 필름을 제1용액에서 2℃ 내지 10℃에서 6시간 내지 24시간 동안 배양하는 단계를 추가로 포함할 수 있다.
전술한 세포 확대 방법에서 (b) 단계 이후, (c) 상기 (b) 단계에서 응고된 세포 필름을 PBS에서 배양하는 단계; 및 (d) 상기 (c) 단계에서 배양된 세포 필름을 증류수에서 배양하는 단계;를 추가로 포함할 수 있다.
상기 하이드로겔 세포 필름을 PBS에서 배양하는 단계에서 PBS의 농도는 0.05 내지 0.2M 일 수 있으며, 바람직하게는 0.1M 일 수 있다.
일 양태에 있어서, 상기 (c) 단계 또는 (d) 단계에서 형광 이미징 분석을 위한 항체 또는 염색 물질을 처리하는 단계를 추가로 포함할 수 있다. 세포 이미징 분석 기술 분야에 있어서. 이용될 수 있는 항체 또는 염색 물질이라면 제한없이 사용가능하다. 항체 염색을 진행하여 초고해상도 이미징 분석이 가능하여여 최대 22~24배 확대가 가능하다. 본 발명에 의한 확대 방법을 이용하는 경우, 얇은 두께의 하이드로겔 세포 필름으로 최대 확장되어도 이미징 분석 가능한 두께이다. 0.17-mm (170-um)의 두께의 얇은 하이드로겔 세포 필름을 5-round의 반복적인 하이드로겔화를 진행시 최대 20배 확대가 되며, 확대된 하이드로겔 두께는 약 2.5-mm로서 현미경의 작동거리 (보통 2-mm)내에 하이드로겔 내의 확대된 세포 이미징 분석이 가능하다.
본 발명의 하이드로겔 세포 필름을 이용하는 경우, 최대 약 22~24배 확대가 가능하며, 세포가 포함된 시료가 커지더라도 두께가 얇아 초고해상도 이미징 분석에 이용될 수 있다. 또한, 단기 및 장기 보관이 가능하며, 추가적인 세포 배양 없이도 언제든지 사용이 가능하다.
도 1은 PBS 기반의 용액과 본 발명의 dH2O 기반 용액의 하이드로겔 조성을 달리하여 세포 확대를 비교한 결과이다.
도 2는 (a,b) 하이드로겔 세포 필름 제작 과정, (c)는 하이드로겔 세포 필름의 보관 방법을 나타낸다.
도 3은 하이드로겔 세포 필름을 이용한 세포 확대 결과를 나타낸다.
도 4는 하이드로겔화 및 재응고 과정을 반복하여 확대시키는 과정을 나타낸다.
도 5는 하이드로겔화 및 재응고과정을 반복하여 확대되는 비율을 확인하여 이미징화 한 결과이다.
도 2는 (a,b) 하이드로겔 세포 필름 제작 과정, (c)는 하이드로겔 세포 필름의 보관 방법을 나타낸다.
도 3은 하이드로겔 세포 필름을 이용한 세포 확대 결과를 나타낸다.
도 4는 하이드로겔화 및 재응고 과정을 반복하여 확대시키는 과정을 나타낸다.
도 5는 하이드로겔화 및 재응고과정을 반복하여 확대되는 비율을 확인하여 이미징화 한 결과이다.
이하, 본 발명의 이해를 돕기 위하여 바람직한 실시예를 제시한다. 그러나 하기의 실시예는 본 발명을 보다 쉽게 이해하기 위하여 제공되는 것일 뿐, 하기 실시예에 의해 본 발명의 내용이 한정되는 것은 아니다.
[준비예]
필요 시약 및 용품
50 mL conical tube, 유리 커버슬립 (24 x 24-mm), 유리 커버슬립 (24 x 60-mm), PALAFILM, Gel Releasers, 아크릴아마이드(acrylamide), 2% 비스-아크릴아마이드 용액(bis-acrylamide solution), 소듐아크릴레이트(sodium acrylate), 소듐 아자이드(sodium azide), 2~4% 파라포름알데히드(paraformaldehyde, (PFA)), 암모늄 펄설페이트(ammonium persulfate (APS)), 테트라메틸에틸렌다이아민(tetramethylethylenediamine, (TEMED)), 10X PBS (phosphate-Buffered Saline).
사용된 하이드로겔 필름액 및 응고액 제조법은 다음과 같다.
(1) 필름액 : 증류수에 용해된 30% 아크릴아마이드(acrylamide), 0.02% 비스-아크릴아마이드(bis-acrylamide), 10% 소듐아크릴레이트, 0.01% 소듐아자이드, 0.65% TEMED
(2) 응고액-1 (초기 필름 제작용) : 증류수에 용해된 10% APS
(3) 응고액-2 (Round 응고용) : 증류수에 용해된 1% APS
조성의 아크릴아마이드(acrylamide)와 비스-아크릴아마이드(bis-acrylamide)는 cross-linking 구조를 이루어 하이드로겔화 하는 성분이고 소듐아크릴레이트(sodium acrylate)는 수분을 흡수하여 확장하는 특성을 지닌다. 하이드로겔 세포 필름은 보관 기간에 따라 단기 보관용 및 장기 보관용으로 나뉘며 장기보관용은 방부제 특성의 0.01% sodium azide (아자이드화나트륨)가 추가 첨가된다.
세포 필름 제조용 조성물의 최적화
다양한 필름 용액의 조성물에 의한 하이드로겔의 확장된 크기를 비교하였다.
하기 표 2에서는 아크릴아마이드의 농도, 비스-아크릴아마이드의 농도를 각각 다르게 하고, PBS 및 dH2O에 용해시켰을 때의 확대 배율을 나타냈다.
| Hydrogel 조성 | Gel | In 1X PBS | In dH 2 O | 배율 | |||
| 30% AA | 0.1% BA | 10% SA | 1X PBS | 8-mm | 18-mm | 30-mm | 3.8 X |
| 0.05% BA | 8-mm | 19-mm | 34-mm | 4.3 X | |||
| 0.02% BA | 8-mm | 20-mm | 38-mm | 4.8 X | |||
| 0.1% BA | dH 2 O | 8-mm | 18-mm | 34-mm | 4.3 X | ||
| 0.05% BA | 8-mm | 20-mm | 39-mm | 4.9 X | |||
| 0.02% BA | 8-mm | 22-mm | 42-mm | 5.3 X | |||
| 40% AA | 0.1% BA | 10% SA | 1X PBS | 8-mm | 18-mm | 30-mm | 3.8 X |
| 0.05% BA | 8-mm | 18-mm | 31-mm | 3.9 X | |||
| 0.02% BA | 8-mm | 19-mm | 36-mm | 4.5 X | |||
| 0.1% BA | dH 2 O | 8-mm | 18-mm | 31-mm | 3.9 X | ||
| 0.05% BA | 8-mm | 19-mm | 34-mm | 4.3 X | |||
| 0.02% BA | 8-mm | 20-mm | 38-mm | 4.8 X | |||
(AA : Acrylamide, BA : Bis-acrylamide, SA : Sodium Acrylate)도 1 및 표 2에 나타난 바와 같이, PBS 기반의 하이드로겔보다 본원발명의 dH2O 기반 하이드로겔이 더 큰 겔 확대를 이루는 것을 확인하였다. 또한, 30% 아크릴아마이드 및 0.02% 비스-아크릴아마이드가 첨가된 dH2O기반의 필름 용액은 0-round에서 5배 이상의 크기로 확장이 가능한 특징을 확인하였다.
따라서, 본 발명의 하이드로겔 세포 필름을 제작 및 최대 24배 확장을 위한 배양 용액은 (30% 아크릴아마이드, 0.02% 비스-아크릴아마이드, 10% 소듐 아크릴레이트 in dH2O) 조성으로 하여, 추후 실험을 진행하였다.
하이드로겔 세포 필름의 제작 과정
하이드로겔 세포 필름의 제작 과정은 다음과 같다(도 2a 및 도 2b)
1) 세포의 준비
6 웰 플레이트에 24 x 24-mm 커버슬립을 넣고 각 웰당 세포가 포함된 세포 배양 배지 (DMEM or DMEM/F12 + 10% FBS + 50 μg/ml penicillin/streptomycin)을 2~3 mL 넣어준 뒤 24시간 CO2 인큐베이터에서 배양한다. 배지를 제거하고 0.1M PBS로 세척한다. 각 웰에 2~4% 파라포름알데히드(paraformaldehyde, PFA)를 1 mL씩 넣어 20-30분간 고정한다. PFA를 제거해준 후, 0.1M PBS로 3회에 걸쳐 세척해준다.
2) 하이드로겔 세포 필름 제작을 위한 유리틀 준비
하이드로겔 필름은 두께 0.17-mm (170-μm)의 유리 커버슬립 8개 (24 x 60-mm)를 이용하여 틀에서 만들어지며, 하단부 받침 (3개), 기둥 (각 2개씩 2세트), 덮개 (1개)로 이루어져 있고, 중심부에 배양된 세포가 부착된 커버슬립 (22 x 22-mm 혹은 24 x 24-mm)을 배치한다.
3) 배양된 세포가 키워진 커버슬립을 유리틀 내에 배치
하나의 하이드로겔 세포 필름을 제작시 필름액은 APS와 혼합시 화학반응으로 폴리-하이드로겔화 진행이 되며, 각 세포 필름을 제작할 시에는 유리틀 안으로 세포가 포함된 커버슬립을 배치한다.
4) 필름액과 응고액의 혼합액 도포 후 하이드로겔화 진행
필름액 285 μL 및 응고액-1 (10% APS) 15 μL을 혼합 후 빠르게 세포를 도포하여 필름액이 하이드로겔화 응고되기 전에 덮개용 커버슬립으로 덮어준다. 20분간 하이드로겔화를 진행한다.
5) 유리틀 제거 후 세포 필름 분리
응고 반응 10~20분 후 틀에 사용된 커버슬립들을 조심스럽게 제거하여 하이드로겔 세포 필름을 파라핀 성분으로 이루어진 파라필름 (4 x 10-mm) 위에 올린다.
6) 파라필름에 배치
이후, 다른 파라필름 (4 x 10-mm)으로 덮어 2개의 파라필름 사이에 배치토록하여 추가 건조시킨다. 가위를 이용하여 하이드로겔 잔여물을 제거한다.
6) 보관
다듬어진 하이드로겔 세포 필름을 새로운 파라필름으로 옮기고, 파라필름 표면에 세포의 윗면 및 아랫면 위치를 라벨링해준 뒤, 지퍼백에 밀봉하여 실온에서 보관한다. 파라필름과 샌드위치된 하이드로겔 세포 필름은 가위를 이용하여 사용자의 원하는 사양에 따른 크기로 절단하여 사용이 가능하다.
하이드로겔 세포 필름은 하이드로겔 특성상 접착력이 강하여 안전하게 도포하여 보관하기가 매우 어렵다. 파라필름은 하이드로겔 세포 필름을 도포시 밀봉 및 제거가 용이하며, 하이드로겔 세포 필름에 데미지를 주지 않는다. 또한, 파라필름은 하이드로겔 세포 필름을 밀봉 도포한 상태에서 가위를 이용하여 절단하기가 쉽다.
하이드로겔 세포 필름의 보관
[도 2c]에 나타난 바와 같이, 하이드로겔 세포 필름의 보관은 파라필름에 보존된 하이드로겔 세포 필름을 2가지의 지퍼백에 밀봉된 상태에서 별도의 보관함에 보관하며, 별도의 방부제와 함께 실온에서 장기간 보관이 용이하다.
- 일반적인 세포 필름 : 투명비닐 지퍼백 (예: 5 x 7-cm) 보관 및 스티커 라벨링
- 염색된 세포 필름 : 차광비닐 지퍼백 (예: 5 x 7-cm) 보관 및 스티커 라벨링
하이드로겔 세포 필름을 이용한 세포 확대
제작된 하이드로겔 세포 필름은 0.1M PBS에 옮겨 배양시 약 2.7~3배 커지고, 순차적으로 dH2O에 옮겨 배양하면 최종적으로 5~5.5배 커지며, 본 단계를 0-round라고 지칭한다. 이 때에, 0.1M PBS에서 배양 후 dH2O에 옮겨 배양하면 겔이 급격하게 커질 수 잇으므로, 겔을 안정적으로 커지게 하기 위해, PBS의 농도를 낮추어 0.01M PBS에서 배양하는 단계를 추가로 포함할 수 있다.
각각의 라운드 사이클을 반복할수록 확대 배율은 올라가고, 두께에는 큰 변화가 없음을 도 3a에서 확인할 수 있다.
5~5.5배 커진 하이드로겔을 0.1M PBS에 재배양시 하이드로겔은 크기가 작아져 이전 단계 약 2.7~3배의 크기로 되돌아간다. 이러한 하이드로겔의 팽창과 수축은 반복적으로 진행이 가능하며, 0.1M PBS에 배양 단계에서 형광 이미징 분석을 위한 항체 및 dye를 염색이 가능하다.
본 발명자는 사전에 배양된 세포를 DAPI dye를 이용하여 세포를 사전 염색하였고, 이를 이용하여 하이드로겔 세포 필름을 제작하였다. 하이드로겔 세포 필름을 가위로 이용화여 가로 세포 2.7-mm x 2.7-mm 혹은 3-mm x 3-mm 크기로 절단하여, 이후 세포 확대화를 진행하였다(도 3b).
도 3c에 나타난 바와 같이, 약 3-mm의 하이드로겔 세포 필름 및 세포는 순차적으로 0.1M PBS에서 2.7~3배 커지며, 최종적으로 dH2O에서 5~5.5배 커지는 것을 확인하였다.
구체적으로, 하이드로겔화 및 재응고 과정(1~5 회)을 반복하여 확대시키는 과정은 도 4와 같다.
또한, 세포 필름을 필름액에 배양 및 응고액-2로 하이드로겔화 및 재응고 과정(1~5 회)을 반복하여 확대되는 비율을 확인한 결과는 하기 [표 3]와 같고, 이를 이미징화 한 결과는 도 5a 내지 도 5e와 같다.
| 횟수 | 세포 필름 크기 | 필름액에 배양 후 크기 | 0.1M PBS에 배양 후 크기 | dH 2 O에 배양 후 크기 | |
| 0-round | 2.7 x 2.7-mm or3 x 3-mm (1배) | - | 8 x 8-mm (2.7~3배) |
15 x 15-mm (5~5.5배) | |
| 1-round | 2.7 x 2.7-mm or 3 x 3-mm (1배) |
1회 | 7 x 7-mm (2.3~2.6배) |
11.5 x 11.5-mm (3.8~4.2배) | 18.5 x 18.5-mm (6.2~6.8배) |
| 2-round | 2.7 x 2.7-mm or 3 x 3-mm (1배) |
1회 | 7 x 7-mm (2.3~2.6배) |
- | |
| 2회 | 9.5 x 9.5-mm (3.2~3.5배) |
18 x 18-mm (6~6.7배) | 24.5 x 24.5-mm (8.2~9배) | ||
| 3-round | 2.7 x 2.7-mm or 3 x 3-mm (1배) |
1회 | 7 x 7-mm (2.3~2.6배) |
- | |
| 2회 | 9.5 x 9.5-mm (3.2~3.5배) |
||||
| 3회 | 16.5 x 16.5-mm (5.5~6.1배) |
28 x 28-mm (9.3~10.4배) | 32 x 32-mm (10.6~11.8배) | ||
| 4-round | 2.7 x 2.7-mm or 3 x 3-mm (1배) |
1회 | 7 x 7-mm (2.3~2.6배) |
- | |
| 2회 | 9.5 x 9.5-mm (3.2~3.5배) |
||||
| 3회 | 16.5 x 16.5-mm (5.5~6.1배) | ||||
| 4회 | 22.5 x 22.5-mm (7.5~8.3배) |
33.5 x 33.5-mm (11.2~12.4배) | 50 x 50-mm (16.7~18.5배) | ||
| 5-round | 2.7 x 2.7-mm or 3 x 3-mm (1배) |
1회 | 7 x 7-mm (2.3~2.6배) |
- | |
| 2회 | 9.5 x 9.5-mm (3.2~3.5배) |
||||
| 3회 | 16.5 x 16.5-mm (5.5~6.1배) | ||||
| 4회 | 22.5 x 22.5-mm (7.5~8.3배) | ||||
| 5회 | 28.5 x 28.5-mm (9.5~10.5배) | 42 x 42-mm (14~15.5배) | 66 x 66-mm (22~24배) | ||
[표 3]에 나타난 바와 같이, 최종적으로 dH2O에서 세포를 6.2~24배까지 확대시켜 줄 수 있다. 추가적으로 6-round 이상의 과정을 반복하여 세포를 더 크게 확장할 수 있으나, 현재의 보편적인 이미지 분석용 현미경 시스템에서는 작동거리 (Working distance)의 한계로 불가능하다. 하지만, 향후 작동거리의 한계가 극복되고 미세 형광 신호를 감지하는 현미경의 경우 시각적인 이미징 분석이 가능할 수 있다. 따라서, 이미징 분석 시스템의 한계로 인해 본 발명의 일반적인 현미경을 통한 관찰시 최대 적용 세포 크기는 4-5 round의 16.7배~22배 (18.5~24배)까지 가능하다.
이상, 본 발명의 내용의 특정한 부분을 상세히 기술하였지만, 이러한 구체적인 기술은 단지 바람직한 실시 양태일 뿐이며, 이에 의해 본 발명의 범위가 제한되는 것이 아닌 점은 명백할 것이다. 따라서 본 발명의 실질적인 범위는 첨부된 청구항들과 그것들의 등가물에 의하여 정의된다고 할 것이다.
Claims (20)
- 증류수에 용해된 아크릴아마이드(acrylamide), 비스-아크릴아마이드(bis-acrylamide), 소듐아크릴레이트(sodium acrylate) 및 TEMED를 포함하는 세포 필름 제조용 조성물.
- 제1항에 있어서,
제1항에 있어서, 상기 아크릴아마이드의 농도는 20 내지 40 % (w/v)이고, 비스아크릴아마이드는 0.01 내지 0.1 % (v/v), 소듐아크릴레이트의 농도는 5 내지 20% (w/v), TEMED의 농도는 0.5 내지 0.8 % (v/v)인, 세포 필름 제조용 조성물.
- 제1항에 있어서,
상기 세포는 명세서 내 표 1에서 선택되는 어느 1종 이상인, 세포 필름 제조용 조성물.
- 제1항에 있어서,
상기 조성물에 아자이드화나트륨(sodium azide)을 추가로 포함하는, 세포 필름 제조용 조성물.
- 세포에 제1용액과 제2용액을 도포하여 응고반응을 진행하는 단계를 포함하는 세포 필름 제조 방법으로서,
상기 제1용액은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 조성물이고,
상기 제2용액은 증류수에 용해된 5 내지 20% APS인, 세포 필름 제조 방법.
- 제5항에 있어서,
상기 아크릴아마이드의 농도는 30 내지 40 %이고, 비스아크릴아마이드는 0.01 내지 0.1 %, 소듐아크릴레이트의 농도는 5 내지 20%, TEMED의 농도는 0.5 내지 0.8 %인, 세포 필름 제조용 조성물.
- 제5항에 있어서,
상기 세포는 명세서 내 표 1에서 선택되는 어느 1종 이상인, 세포 필름 제조 방법.
- 제5항에 있어서,
상기 제1용액에 아자이드화나트륨을 추가로 포함하는, 세포 필름 제조 방법.
- 제5항에 있어서,
상기 응고반응은 5분 내지 60분간 수행되는, 세포 필름 제조 방법.
- 제5항에 있어서,
상기 응고된 세포 필름을 파라필름으로 밀봉하는 단계를 추가로 포함하는, 세포 필름 제조 방법.
- 제5항 내지 제10항 중 어느 한 항의 세포 필름 제조 방법으로 제조된 세포 필름.
- (a) 제11항의 세포 필름을 제1용액에서 배양하는 단계; 및
(b) 상기 (a) 단계에서 배양된 세포 필름에 제3용액을 도포하여 응고반응을 진행하는 단계;
를 포함하는 세포 확대 방법으로서,
상기 제1용액은 증류수에 용해된 아크릴아마이드, 비스-아크릴아마이드, 소듐아크릴레이트 및 TEMED를 포함하는 조성물이고,
상기 제3용액은 증류수에 용해된 0.5 내지 2% APS인, 세포 확대 방법.
- 제12항에 있어서,
상기 (a) 단계의 제1용액의 아크릴아마이드의 농도는 30 내지 40 %이고, 비스아크릴아마이드는 0.01 내지 0.1 %, 소듐아크릴레이트의 농도는 5 내지 20%, TEMED의 농도는 0.5 내지 0.8 %인, 세포 확대 방법.
- 제12항에 있어서,
상기 (a) 단계의 배양은 2℃ 내지 10℃에서 4시간 내지 12시간 동안 배양되는, 세포 확대 방법.
- 제12항에 있어서,
상기 (b) 단계의 응고반응은 5분 내지 60분간 수행되는, 세포 확대 방법.
- 제12항에 있어서,
상기 (a) 단계 내지 (b) 단계를 1 내지 3회 반복하는, 세포 확대 방법.
- 제12항에 있어서,
상기 (a) 단계 내지 (b) 단계를 1 내지 3회 반복하여 제조된 세포 필름을 제1용액에서 2℃ 내지 10℃에서 6시간 내지 24시간 동안 배양하는 단계를 추가로 포함하는, 세포 확대 방법.
- 제12항 내지 제17항 중 어느 한 항의 (b) 단계 이후,
(c) 상기 (b) 단계에서 응고된 세포 필름을 PBS에서 배양하는 단계; 및
(d) 상기 (c) 단계에서 배양된 세포 필름을 증류수에서 배양하는 단계;
를 추가로 포함하는, 세포 확대 방법.
- 제18항에 있어서,
상기 PBS의 농도는 0.05 내지 0.2M 인, 세포 확대 방법.
- 제18항에 있어서,
상기 (c) 단계 또는 (d) 단계에서 형광 이미징 분석을 위한 항체 또는 염색 물질을 처리하는 단계를 추가로 포함하는, 세포 확대 방법.
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020220121707A KR20240042887A (ko) | 2022-09-26 | 2022-09-26 | 고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 |
| PCT/KR2023/014689 WO2024071918A1 (ko) | 2022-09-26 | 2023-09-25 | 고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020220121707A KR20240042887A (ko) | 2022-09-26 | 2022-09-26 | 고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20240042887A true KR20240042887A (ko) | 2024-04-02 |
Family
ID=90478674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020220121707A KR20240042887A (ko) | 2022-09-26 | 2022-09-26 | 고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 |
Country Status (2)
| Country | Link |
|---|---|
| KR (1) | KR20240042887A (ko) |
| WO (1) | WO2024071918A1 (ko) |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104350372B (zh) * | 2012-08-09 | 2018-03-02 | 斯坦福大学托管董事会 | 用于制备供显微镜分析的生物样本的方法和组合物 |
| EP3108218A4 (en) * | 2014-02-21 | 2017-11-15 | Massachusetts Institute Of Technology | Expansion microscopy |
| CN109072285A (zh) * | 2016-02-25 | 2018-12-21 | 麻省理工学院 | 扩展临床组织样本的方法 |
| KR102368585B1 (ko) * | 2018-09-28 | 2022-03-03 | 서울대학교산학협력단 | 온도에 따라 가역적 팽창/초기화가 가능한 하이드로젤을 이용한 생체조직 이미징 |
| WO2021183956A1 (en) * | 2020-03-13 | 2021-09-16 | Yale University | Methods and systems for physical expansion and imaging of biological samples |
-
2022
- 2022-09-26 KR KR1020220121707A patent/KR20240042887A/ko unknown
-
2023
- 2023-09-25 WO PCT/KR2023/014689 patent/WO2024071918A1/ko unknown
Also Published As
| Publication number | Publication date |
|---|---|
| WO2024071918A1 (ko) | 2024-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Osborn et al. | The display of microtubules in transformed cells | |
| Bénard et al. | Characterization of a human ovarian adenocarcinoma line, IGROV1, in tissue culture and in nude mice | |
| Fidler et al. | Biological and experimental consequences of the zonal composition of solid tumors | |
| Truong et al. | Novel characterization and live imaging of Schlemm's canal expressing Prox-1 | |
| Creasey et al. | Biological properties of human melanoma cells in culture | |
| Hilders et al. | The expression of histocompatibility-related leukocyte antigens in the pathway to cervical carcinoma | |
| Parfitt et al. | Immunofluorescence tomography of mouse ocular surface epithelial stem cells and their niche microenvironment | |
| KR20240042887A (ko) | 고배율의 세포 확대 분석을 위한 세포 필름, 이의 제조용 조성물 및 제조 방법 | |
| US8911727B2 (en) | Monoclonal antibody against human non-small cell lung carcinoma and use thereof | |
| CN102690784A (zh) | 肝癌细胞系hcc-ly10的建立及应用 | |
| Hiti et al. | Expression of the MyoD1 muscle determination gene defines differentiation capability but not tumorigenicity of human rhabdomyosarcomas | |
| Atkins et al. | Asynchronous DNA synthesis of sex chromatin in human interphase nuclei | |
| Peebo et al. | Cellular-level characterization of lymph vessels in live, unlabeled corneas by in vivo confocal microscopy | |
| Tuffery et al. | Alterations of mouse embryo cells during in vitro aging | |
| Hoehn et al. | Nonrandom arrangement of human chromatin: topography of disomic markers X, Y, and 1h+ | |
| Shahen et al. | A simple and efficient toolset for analysing mitochondrial trafficking in neuronal cells | |
| CN104597016A (zh) | 倒置激光共聚焦显微镜动植物活体观测装置及方法 | |
| CN111968174A (zh) | 一种菌落面积的测量方法及其应用 | |
| CN111944757A (zh) | 一种工程化卵巢癌体外模型及其应用 | |
| Matsumoto et al. | Neural crest cell differentiation and carcinogenesis: capability of goldfish erythrophoroma cells for multiple differentiation and clonal polymorphism in their melanogenic variants | |
| Selman | Cell cleavage in polar body formation | |
| CN109370990A (zh) | 人中低分化结肠癌细胞株、其建立方法及应用 | |
| De Velasco et al. | GFP image analysis in the mouse orthotopic bladder cancer model | |
| Meyer | Characterization Of Pirfenidone Effects In Human Cardiac Fibroblasts | |
| Hay et al. | MO064: Expression Studies on Magi2 in Different FSGS Models |