KR20150041647A - 치환된 헤테로-아제핀온 - Google Patents
치환된 헤테로-아제핀온 Download PDFInfo
- Publication number
- KR20150041647A KR20150041647A KR20157005929A KR20157005929A KR20150041647A KR 20150041647 A KR20150041647 A KR 20150041647A KR 20157005929 A KR20157005929 A KR 20157005929A KR 20157005929 A KR20157005929 A KR 20157005929A KR 20150041647 A KR20150041647 A KR 20150041647A
- Authority
- KR
- South Korea
- Prior art keywords
- alkyl
- methyl
- oxo
- methylamino
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 280
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 21
- 201000011510 cancer Diseases 0.000 claims abstract description 18
- 238000011282 treatment Methods 0.000 claims abstract description 17
- -1 C 1 -6 - alkyl Chemical group 0.000 claims description 875
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 213
- 125000003118 aryl group Chemical group 0.000 claims description 198
- 125000005605 benzo group Chemical group 0.000 claims description 174
- 229910052739 hydrogen Inorganic materials 0.000 claims description 157
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 126
- 229910052799 carbon Inorganic materials 0.000 claims description 105
- 238000000034 method Methods 0.000 claims description 95
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 75
- 125000000217 alkyl group Chemical group 0.000 claims description 73
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 58
- 229910052801 chlorine Inorganic materials 0.000 claims description 56
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 55
- 229910052794 bromium Inorganic materials 0.000 claims description 55
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 55
- 125000001072 heteroaryl group Chemical group 0.000 claims description 55
- 229910052731 fluorine Inorganic materials 0.000 claims description 54
- 125000002252 acyl group Chemical group 0.000 claims description 53
- 229910005965 SO 2 Inorganic materials 0.000 claims description 50
- 125000000623 heterocyclic group Chemical group 0.000 claims description 48
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 claims description 47
- 150000003839 salts Chemical class 0.000 claims description 40
- 125000003003 spiro group Chemical group 0.000 claims description 40
- SOWBFZRMHSNYGE-UHFFFAOYSA-N Monoamide-Oxalic acid Natural products NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 claims description 39
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 36
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 29
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 27
- 238000002360 preparation method Methods 0.000 claims description 26
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 25
- 229910052760 oxygen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 23
- 229910052717 sulfur Inorganic materials 0.000 claims description 23
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 21
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 12
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 10
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims description 10
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 claims description 8
- 229940080818 propionamide Drugs 0.000 claims description 8
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 7
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 claims description 7
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 6
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical group C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 claims description 6
- 125000004043 oxo group Chemical group O=* 0.000 claims description 6
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 5
- BMBANPOHPFKVTA-UHFFFAOYSA-N benzamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NC(=O)C1=CC=CC=C1 BMBANPOHPFKVTA-UHFFFAOYSA-N 0.000 claims description 5
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 230000002265 prevention Effects 0.000 claims description 5
- ZSZBVCQVYPCNIF-UHFFFAOYSA-N propanamide;2,2,2-trifluoroacetic acid Chemical compound CCC(N)=O.OC(=O)C(F)(F)F ZSZBVCQVYPCNIF-UHFFFAOYSA-N 0.000 claims description 5
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 claims description 5
- RWTGSAXSZXQBRM-MBSDFSHPSA-N (2s)-2-(methylamino)-n-[(3s)-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-4,5-dihydro-3h-1-benzazepin-3-yl]propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)CCC2=CC=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 RWTGSAXSZXQBRM-MBSDFSHPSA-N 0.000 claims description 4
- XQHYGDOJDYACHI-HBYWCBEISA-N (2s)-n-(5-benzyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl)-2-(methylamino)propanamide;hydrochloride Chemical compound Cl.O=C1C(NC(=O)[C@H](C)NC)CSC2=CC=CC=C2N1CC1=CC=CC=C1 XQHYGDOJDYACHI-HBYWCBEISA-N 0.000 claims description 4
- RRRZHUQUSBVQNZ-QNNMEKCMSA-N (2s)-n-[(3r)-9-amino-5-(naphthalen-1-ylmethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-2-(methylamino)propanamide;hydrochloride Chemical compound Cl.O=C1[C@@H](NC(=O)[C@H](C)NC)CSC2=C(N)C=CC=C2N1CC1=CC=CC2=CC=CC=C12 RRRZHUQUSBVQNZ-QNNMEKCMSA-N 0.000 claims description 4
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 claims description 4
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims description 4
- WAKRDDXHAXBEQA-UHFFFAOYSA-N benzoic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C1=CC=CC=C1 WAKRDDXHAXBEQA-UHFFFAOYSA-N 0.000 claims description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- NSIMSTVWDYAFBY-QDMMYLPHSA-N n-[(3r)-3-[[(2s)-2-(methylamino)propanoyl]amino]-5-(naphthalen-1-ylmethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-9-yl]benzamide;hydrochloride Chemical compound Cl.C([C@@H](C(N(CC=1C2=CC=CC=C2C=CC=1)C1=CC=C2)=O)NC(=O)[C@H](C)NC)SC1=C2NC(=O)C1=CC=CC=C1 NSIMSTVWDYAFBY-QDMMYLPHSA-N 0.000 claims description 4
- 229930192474 thiophene Natural products 0.000 claims description 4
- PYGNINGYNZYWBV-GUTACTQSSA-N (2s)-n-[(3s)-5-[(6-bromo-2-methoxynaphthalen-1-yl)methyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-(methylamino)butanamide;hydrochloride Chemical compound Cl.O=C1[C@@H](NC(=O)[C@@H](NC)CC)COC2=CC=CC=C2N1CC1=C(OC)C=CC2=CC(Br)=CC=C12 PYGNINGYNZYWBV-GUTACTQSSA-N 0.000 claims description 3
- HCSLWAKAKAIBTE-ZOEDVAEJSA-N (2s)-n-[(3s)-5-[(7-bromo-3-methoxynaphthalen-2-yl)methyl]-8-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-(methylamino)propanamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.O=C1[C@@H](NC(=O)[C@H](C)NC)COC2=CC(C)=CC=C2N1CC1=CC2=CC(Br)=CC=C2C=C1OC HCSLWAKAKAIBTE-ZOEDVAEJSA-N 0.000 claims description 3
- RCQFDAMHGMCSFG-UHFFFAOYSA-N 2-(4-methylindol-1-yl)benzonitrile Chemical compound C1=CC=2C(C)=CC=CC=2N1C1=CC=CC=C1C#N RCQFDAMHGMCSFG-UHFFFAOYSA-N 0.000 claims description 3
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000006431 methyl cyclopropyl group Chemical group 0.000 claims description 3
- 239000001294 propane Substances 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 33
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 10
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 8
- CNHCWOHOXAYULJ-UHFFFAOYSA-N n'-methylpropanehydrazide;hydrochloride Chemical compound Cl.CCC(=O)NNC CNHCWOHOXAYULJ-UHFFFAOYSA-N 0.000 claims 1
- 238000011321 prophylaxis Methods 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 6
- 201000010099 disease Diseases 0.000 abstract description 4
- 230000002062 proliferating effect Effects 0.000 abstract description 3
- 239000000203 mixture Substances 0.000 description 336
- 239000000243 solution Substances 0.000 description 220
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 214
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 111
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 107
- 235000019439 ethyl acetate Nutrition 0.000 description 107
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 105
- 239000011734 sodium Substances 0.000 description 100
- 239000007787 solid Substances 0.000 description 100
- 239000000284 extract Substances 0.000 description 81
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 71
- 239000012267 brine Substances 0.000 description 70
- 238000000746 purification Methods 0.000 description 63
- 125000005843 halogen group Chemical group 0.000 description 58
- 238000006243 chemical reaction Methods 0.000 description 57
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 50
- 238000010898 silica gel chromatography Methods 0.000 description 50
- 239000006260 foam Substances 0.000 description 48
- 229920006395 saturated elastomer Polymers 0.000 description 48
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- KNTZCGBYFGEMFR-UHFFFAOYSA-N (propan-2-ylazaniumyl)formate Chemical compound CC(C)NC(O)=O KNTZCGBYFGEMFR-UHFFFAOYSA-N 0.000 description 39
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 39
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 38
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 239000000706 filtrate Substances 0.000 description 35
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 31
- YTKNRNVTHYZZEE-UHFFFAOYSA-N oxazepin-3-ylcarbamic acid Chemical compound C1=CC(=NOC=C1)NC(=O)O YTKNRNVTHYZZEE-UHFFFAOYSA-N 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 29
- RUZLIIJDZBWWSA-INIZCTEOSA-N methyl 2-[[(1s)-1-(7-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)ethyl]amino]benzoate Chemical group COC(=O)C1=CC=CC=C1N[C@@H](C)C1=CC(C)=CN2C(=O)C=C(N3CCOCC3)N=C12 RUZLIIJDZBWWSA-INIZCTEOSA-N 0.000 description 27
- 125000006239 protecting group Chemical group 0.000 description 27
- 238000012746 preparative thin layer chromatography Methods 0.000 description 25
- 238000003756 stirring Methods 0.000 description 25
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 24
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 23
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 22
- 239000000463 material Substances 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 125000006633 tert-butoxycarbonylamino group Chemical group 0.000 description 21
- 230000002829 reductive effect Effects 0.000 description 20
- 238000003818 flash chromatography Methods 0.000 description 19
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 17
- 108091007065 BIRCs Proteins 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 17
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 16
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000012230 colorless oil Substances 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 102000055031 Inhibitor of Apoptosis Proteins Human genes 0.000 description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 14
- 239000003921 oil Substances 0.000 description 14
- 235000019260 propionic acid Nutrition 0.000 description 14
- TUMCWFMHZOUPDA-UHFFFAOYSA-N 2-ethylsulfanyl-1,3-benzothiazol-6-amine Chemical compound C1=C(N)C=C2SC(SCC)=NC2=C1 TUMCWFMHZOUPDA-UHFFFAOYSA-N 0.000 description 13
- 101100111638 Arabidopsis thaliana BIR2 gene Proteins 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- BWIOURVJVDKDOC-UHFFFAOYSA-N 6-bromo-1-(chloromethyl)-2-methoxynaphthalene Chemical compound C1=C(Br)C=CC2=C(CCl)C(OC)=CC=C21 BWIOURVJVDKDOC-UHFFFAOYSA-N 0.000 description 12
- 108700031544 X-Linked Inhibitor of Apoptosis Proteins 0.000 description 12
- 102000050257 X-Linked Inhibitor of Apoptosis Human genes 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 12
- 229910000104 sodium hydride Inorganic materials 0.000 description 12
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 12
- SFJGCXYXEFWEBK-UHFFFAOYSA-N oxazepine Chemical compound O1C=CC=CC=N1 SFJGCXYXEFWEBK-UHFFFAOYSA-N 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- VLHQXRIIQSTJCQ-LURJTMIESA-N (2s)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid Chemical compound OC(=O)[C@H](C)N(C)C(=O)OC(C)(C)C VLHQXRIIQSTJCQ-LURJTMIESA-N 0.000 description 10
- ULBSGKVZMMVYGE-UHFFFAOYSA-N FC(C(=O)O)(F)F.O1N=CC(CC=C1)=O Chemical compound FC(C(=O)O)(F)F.O1N=CC(CC=C1)=O ULBSGKVZMMVYGE-UHFFFAOYSA-N 0.000 description 10
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 10
- QCIGLPLDNRDLQQ-UHFFFAOYSA-N butan-2-ylcarbamic acid Chemical compound CCC(C)NC(O)=O QCIGLPLDNRDLQQ-UHFFFAOYSA-N 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 239000002480 mineral oil Substances 0.000 description 10
- 235000010446 mineral oil Nutrition 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 9
- 102000011727 Caspases Human genes 0.000 description 9
- 108010076667 Caspases Proteins 0.000 description 9
- 210000004027 cell Anatomy 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 229910052763 palladium Inorganic materials 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 108090000765 processed proteins & peptides Proteins 0.000 description 9
- 230000006907 apoptotic process Effects 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 7
- 125000003342 alkenyl group Chemical group 0.000 description 7
- 125000005997 bromomethyl group Chemical group 0.000 description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 7
- 238000000227 grinding Methods 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 6
- ZVAPWJGRRUHKGP-UHFFFAOYSA-N 1h-1,5-benzodiazepine Chemical compound N1C=CC=NC2=CC=CC=C12 ZVAPWJGRRUHKGP-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- JCTOICRXFIDMMR-UHFFFAOYSA-N oxazepin-3-yl carbamate Chemical compound C(N)(OC1=NOC=CC=C1)=O JCTOICRXFIDMMR-UHFFFAOYSA-N 0.000 description 6
- 230000037361 pathway Effects 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000002877 time resolved fluorescence resonance energy transfer Methods 0.000 description 6
- 239000011701 zinc Substances 0.000 description 6
- BXPNIFICXLSCDW-JTQLQIEISA-N (2s)-3-(2-aminophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)COC1=CC=CC=C1N BXPNIFICXLSCDW-JTQLQIEISA-N 0.000 description 5
- DCINZQYUYPIUCT-UHFFFAOYSA-N 2-[3-(bromomethyl)indazol-1-yl]benzonitrile Chemical compound C12=CC=CC=C2C(CBr)=NN1C1=CC=CC=C1C#N DCINZQYUYPIUCT-UHFFFAOYSA-N 0.000 description 5
- GDHXJNRAJRCGMX-UHFFFAOYSA-N 2-fluorobenzonitrile Chemical compound FC1=CC=CC=C1C#N GDHXJNRAJRCGMX-UHFFFAOYSA-N 0.000 description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 5
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 238000004896 high resolution mass spectrometry Methods 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- NINHUKPTKQBVFX-RGMNGODLSA-N (3s)-3-amino-3,5-dihydro-2h-1,5-benzoxazepin-4-one;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.N1C(=O)[C@@H](N)COC2=CC=CC=C21 NINHUKPTKQBVFX-RGMNGODLSA-N 0.000 description 4
- GELKGHVAFRCJNA-UHFFFAOYSA-N 2,2-Dimethyloxirane Chemical compound CC1(C)CO1 GELKGHVAFRCJNA-UHFFFAOYSA-N 0.000 description 4
- ZIRQIADEPUPCMK-UHFFFAOYSA-N 3-(bromomethyl)-1-(2-cyanophenyl)indole-2-carbonitrile Chemical compound C12=CC=CC=C2C(CBr)=C(C#N)N1C1=CC=CC=C1C#N ZIRQIADEPUPCMK-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 4
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 4
- 0 CC(*)N(C([C@](C(C)(C)C)NC(C(*)N*)=O)=O)c1c(C)c(*)c(*)c(*)c1 Chemical compound CC(*)N(C([C@](C(C)(C)C)NC(C(*)N*)=O)=O)c1c(C)c(*)c(*)c(*)c1 0.000 description 4
- 102000009058 Death Domain Receptors Human genes 0.000 description 4
- 108010049207 Death Domain Receptors Proteins 0.000 description 4
- 102100033189 Diablo IAP-binding mitochondrial protein Human genes 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 229960002685 biotin Drugs 0.000 description 4
- 239000011616 biotin Substances 0.000 description 4
- 235000015165 citric acid Nutrition 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 238000005897 peptide coupling reaction Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 229910052720 vanadium Inorganic materials 0.000 description 4
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 4
- AMRDXLNIOLBBGU-UHFFFAOYSA-N (2-methylsulfonyl-1,3-dihydroisoindol-4-yl)methanol Chemical compound C1=CC(CO)=C2CN(S(=O)(=O)C)CC2=C1 AMRDXLNIOLBBGU-UHFFFAOYSA-N 0.000 description 3
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 3
- FHOAKXBXYSJBGX-YFKPBYRVSA-N (2s)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](CO)C(O)=O FHOAKXBXYSJBGX-YFKPBYRVSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- STBYRSZXHDPASK-UHFFFAOYSA-N 1-(chloromethyl)-2-methylnaphthalene Chemical compound C1=CC=CC2=C(CCl)C(C)=CC=C21 STBYRSZXHDPASK-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 3
- AYFJBMBVXWNYLT-UHFFFAOYSA-N 2-bromo-6-methoxynaphthalene Chemical compound C1=C(Br)C=CC2=CC(OC)=CC=C21 AYFJBMBVXWNYLT-UHFFFAOYSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 3
- 108700003785 Baculoviral IAP Repeat-Containing 3 Proteins 0.000 description 3
- 102100021662 Baculoviral IAP repeat-containing protein 3 Human genes 0.000 description 3
- ATFVTAOSZBVGHC-UHFFFAOYSA-N Glycolaldehyde dimer Chemical compound OC1COC(O)CO1 ATFVTAOSZBVGHC-UHFFFAOYSA-N 0.000 description 3
- 102100024319 Intestinal-type alkaline phosphatase Human genes 0.000 description 3
- 241000713321 Intracisternal A-particles Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 3
- 102000004196 processed proteins & peptides Human genes 0.000 description 3
- 235000018102 proteins Nutrition 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- YACMOMZZUUDJMD-JTQLQIEISA-N (2r)-3-(2,6-diaminophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CSC1=C(N)C=CC=C1N YACMOMZZUUDJMD-JTQLQIEISA-N 0.000 description 2
- IMHOYNJWFKQCMW-MRXNPFEDSA-N (2r)-3-(2-aminophenyl)sulfanyl-3-methyl-2-(phenylmethoxycarbonylamino)butanoic acid Chemical compound CC(C)([C@H](NC(=O)OCC=1C=CC=CC=1)C(O)=O)SC1=CC=CC=C1N IMHOYNJWFKQCMW-MRXNPFEDSA-N 0.000 description 2
- PMDFZPHGVXNDOE-VIFPVBQESA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenoxy)propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)COC1=CC=CC=C1[N+]([O-])=O PMDFZPHGVXNDOE-VIFPVBQESA-N 0.000 description 2
- QIXDRLIEARGEQY-ZETCQYMHSA-N (2s)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid Chemical compound CC[C@@H](C(O)=O)N(C)C(=O)OC(C)(C)C QIXDRLIEARGEQY-ZETCQYMHSA-N 0.000 description 2
- WGZIDWLTJQGXIL-JTQLQIEISA-N (2s)-3-(2-amino-6-fluorophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)COC1=C(N)C=CC=C1F WGZIDWLTJQGXIL-JTQLQIEISA-N 0.000 description 2
- CUINSPJEWOLBEK-VIFPVBQESA-N (2s)-3-(2-fluoro-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)COC1=C(F)C=CC=C1[N+]([O-])=O CUINSPJEWOLBEK-VIFPVBQESA-N 0.000 description 2
- KXHNTGWTFQYXPO-JTQLQIEISA-N (2s)-3-(2-methyl-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC1=CC=CC([N+]([O-])=O)=C1OC[C@H](NC(=O)OC(C)(C)C)C(O)=O KXHNTGWTFQYXPO-JTQLQIEISA-N 0.000 description 2
- RSLGDBGHOPRGTN-JTQLQIEISA-N (2s)-3-(5-methyl-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC1=CC=C([N+]([O-])=O)C(OC[C@H](NC(=O)OC(C)(C)C)C(O)=O)=C1 RSLGDBGHOPRGTN-JTQLQIEISA-N 0.000 description 2
- WCGITGKCBHJAER-JTQLQIEISA-N (2s)-3-[2-amino-6-(trifluoromethyl)phenoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)COC1=C(N)C=CC=C1C(F)(F)F WCGITGKCBHJAER-JTQLQIEISA-N 0.000 description 2
- LLHOYOCAAURYRL-RITPCOANSA-N (2s,3r)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound C[C@@H](O)[C@@H](C(O)=O)NC(=O)OC(C)(C)C LLHOYOCAAURYRL-RITPCOANSA-N 0.000 description 2
- QORMGLBZBSZOKV-FJXQXJEOSA-N (3s)-3-amino-8-methyl-3,5-dihydro-2h-1,5-benzoxazepin-4-one;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.N1C(=O)[C@@H](N)COC2=CC(C)=CC=C21 QORMGLBZBSZOKV-FJXQXJEOSA-N 0.000 description 2
- IXIJRPBFPLESEI-UHFFFAOYSA-N 1,2-difluoro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(F)=C1F IXIJRPBFPLESEI-UHFFFAOYSA-N 0.000 description 2
- FGIDNBAQSZQYHY-UHFFFAOYSA-N 1-(benzenesulfonyl)-2-chloroindole-3-carbaldehyde Chemical compound ClC1=C(C=O)C2=CC=CC=C2N1S(=O)(=O)C1=CC=CC=C1 FGIDNBAQSZQYHY-UHFFFAOYSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- MWYFDHRLYOKUMH-UHFFFAOYSA-N 1-bromo-2-fluoro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(Br)=C1F MWYFDHRLYOKUMH-UHFFFAOYSA-N 0.000 description 2
- NQMUGNMMFTYOHK-UHFFFAOYSA-N 1-methoxynaphthalene Chemical compound C1=CC=C2C(OC)=CC=CC2=C1 NQMUGNMMFTYOHK-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- YVWHHEOYZODLLU-UHFFFAOYSA-N 2-(3-methylindazol-1-yl)benzonitrile Chemical compound C12=CC=CC=C2C(C)=NN1C1=CC=CC=C1C#N YVWHHEOYZODLLU-UHFFFAOYSA-N 0.000 description 2
- VHIBFSPYCOLGJE-UHFFFAOYSA-N 2-(4-formylindol-1-yl)benzonitrile Chemical compound C1=CC=2C(C=O)=CC=CC=2N1C1=CC=CC=C1C#N VHIBFSPYCOLGJE-UHFFFAOYSA-N 0.000 description 2
- IOZSDBSOEWFEFK-UHFFFAOYSA-N 2-(dibenzylamino)-2-(1-hydroxycyclohexyl)acetic acid Chemical compound C1CCCCC1(O)C(C(=O)O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 IOZSDBSOEWFEFK-UHFFFAOYSA-N 0.000 description 2
- OJOTZGUKJPCHKB-UHFFFAOYSA-N 2-[1-(2-aminophenoxy)cyclohexyl]-2-(dibenzylamino)acetic acid Chemical compound NC1=CC=CC=C1OC1(C(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)C(O)=O)CCCCC1 OJOTZGUKJPCHKB-UHFFFAOYSA-N 0.000 description 2
- XYSSNBNFOBVMAU-UHFFFAOYSA-N 2-chloro-1h-indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(Cl)NC2=C1 XYSSNBNFOBVMAU-UHFFFAOYSA-N 0.000 description 2
- SJSOFNCYXJUNBT-UHFFFAOYSA-N 3,4,5-trimethoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC(OC)=C1OC SJSOFNCYXJUNBT-UHFFFAOYSA-N 0.000 description 2
- GYLKKXHEIIFTJH-UHFFFAOYSA-M 3-cyanobenzoate Chemical compound [O-]C(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-M 0.000 description 2
- ALRHLSYJTWAHJZ-UHFFFAOYSA-N 3-hydroxypropionic acid Chemical compound OCCC(O)=O ALRHLSYJTWAHJZ-UHFFFAOYSA-N 0.000 description 2
- FWOPJXVQGMZKEP-UHFFFAOYSA-N 3-methyl-2h-indazole Chemical compound C1=CC=CC2=C(C)NN=C21 FWOPJXVQGMZKEP-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- BWIOURVJVDKDOC-FIBGUPNXSA-N 6-bromo-1-(chloromethyl)-2-(trideuteriomethoxy)naphthalene Chemical compound C1=C(Br)C=CC2=C(CCl)C(OC([2H])([2H])[2H])=CC=C21 BWIOURVJVDKDOC-FIBGUPNXSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 102000004039 Caspase-9 Human genes 0.000 description 2
- 108090000566 Caspase-9 Proteins 0.000 description 2
- 101710101225 Diablo IAP-binding mitochondrial protein Proteins 0.000 description 2
- 101710156605 Diablo homolog, mitochondrial Proteins 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 229910052693 Europium Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 238000006751 Mitsunobu reaction Methods 0.000 description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 2
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000006242 amine protecting group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 125000003636 chemical group Chemical group 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- XSYZCZPCBXYQTE-UHFFFAOYSA-N cyclodecylcyclodecane Chemical compound C1CCCCCCCCC1C1CCCCCCCCC1 XSYZCZPCBXYQTE-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 2
- 229910000071 diazene Inorganic materials 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 238000012377 drug delivery Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- AFMDCFOWHWNQBP-UHFFFAOYSA-N ethyl 2-(dibenzylamino)acetate Chemical compound C=1C=CC=CC=1CN(CC(=O)OCC)CC1=CC=CC=C1 AFMDCFOWHWNQBP-UHFFFAOYSA-N 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- VVHITECBVCREEP-UHFFFAOYSA-N methyl 2-methylsulfonyl-1,3-dihydroisoindole-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1CN(S(C)(=O)=O)C2 VVHITECBVCREEP-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000006299 oxetan-3-yl group Chemical group [H]C1([H])OC([H])([H])C1([H])* 0.000 description 2
- 108010091748 peptide A Proteins 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Chemical group O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 239000000018 receptor agonist Substances 0.000 description 2
- 229940044601 receptor agonist Drugs 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000004007 reversed phase HPLC Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- DOMTZTVJNZKUNX-UHFFFAOYSA-N tert-butyl 3-aminopropanoate;hydrochloride Chemical compound Cl.CC(C)(C)OC(=O)CCN DOMTZTVJNZKUNX-UHFFFAOYSA-N 0.000 description 2
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000005023 xylyl group Chemical group 0.000 description 2
- YICGYMHMOGVPNK-UHFFFAOYSA-N (1-ethylindol-4-yl)methanol Chemical compound C1=CC=C2N(CC)C=CC2=C1CO YICGYMHMOGVPNK-UHFFFAOYSA-N 0.000 description 1
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- UZMQOEZHBOUYIV-MRXNPFEDSA-N (2r)-3-methyl-3-(2-nitrophenyl)sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid Chemical compound CC(C)([C@H](NC(=O)OCC=1C=CC=CC=1)C(O)=O)SC1=CC=CC=C1[N+]([O-])=O UZMQOEZHBOUYIV-MRXNPFEDSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 1
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- FLFYQSCOWMHGTP-NSHDSACASA-N (2s)-3-(2-amino-5-methylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC1=CC=C(N)C(OC[C@H](NC(=O)OC(C)(C)C)C(O)=O)=C1 FLFYQSCOWMHGTP-NSHDSACASA-N 0.000 description 1
- FAABPBBCULGVSX-NSHDSACASA-N (2s)-3-(2-amino-6-methylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC1=CC=CC(N)=C1OC[C@H](NC(=O)OC(C)(C)C)C(O)=O FAABPBBCULGVSX-NSHDSACASA-N 0.000 description 1
- QPIFJEAPDQWUOH-VIFPVBQESA-N (2s)-3-(2-bromo-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)COC1=C(Br)C=CC=C1[N+]([O-])=O QPIFJEAPDQWUOH-VIFPVBQESA-N 0.000 description 1
- NAMVQVBBYSBSBO-JTQLQIEISA-N (2s)-3-(2-methoxycarbonyl-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound COC(=O)C1=CC=CC([N+]([O-])=O)=C1OC[C@H](NC(=O)OC(C)(C)C)C(O)=O NAMVQVBBYSBSBO-JTQLQIEISA-N 0.000 description 1
- UIBHSAZABGYEBL-MPQWVWBXSA-N (2s)-6-amino-2-[[(2s)-2-[[(2s)-2-[[(2s)-6-amino-2-[[(2s)-5-amino-2-[[(2s)-2-[[(2s,3s)-2-[[(2r)-1-[(2s)-2-[[(2s)-2-aminopropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]a Chemical group NCCCC[C@@H](C(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H]1CCCN1C(=O)[C@@H](NC(=O)[C@H](C)N)C(C)C UIBHSAZABGYEBL-MPQWVWBXSA-N 0.000 description 1
- JCAOAZHOFRRSMS-SKDRFNHKSA-N (2s,3r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenoxy)butanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)[C@@H](C)OC1=CC=CC=C1[N+]([O-])=O JCAOAZHOFRRSMS-SKDRFNHKSA-N 0.000 description 1
- ZCOCDSKXGMMFKS-GWCFXTLKSA-N (2s,3s)-3-(2-amino-5-methylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)[C@H](C)OC1=CC(C)=CC=C1N ZCOCDSKXGMMFKS-GWCFXTLKSA-N 0.000 description 1
- WSSNDUGFSJLNPQ-GWCFXTLKSA-N (2s,3s)-3-(5-methyl-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)[C@H](C)OC1=CC(C)=CC=C1[N+]([O-])=O WSSNDUGFSJLNPQ-GWCFXTLKSA-N 0.000 description 1
- AGDSHDHOPRCJHA-YUWZRIFDSA-N (2s,3s)-3-amino-2,8-dimethyl-3,5-dihydro-2h-1,5-benzoxazepin-4-one;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.N1C(=O)[C@@H](N)[C@H](C)OC2=CC(C)=CC=C21 AGDSHDHOPRCJHA-YUWZRIFDSA-N 0.000 description 1
- JAOQHCRANJMPCJ-WFZUHFMFSA-N (2s,3s)-3-amino-2-methyl-7-(trifluoromethyl)-3,5-dihydro-2h-1,5-benzoxazepin-4-one;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.N1C(=O)[C@@H](N)[C@H](C)OC2=CC=C(C(F)(F)F)C=C21 JAOQHCRANJMPCJ-WFZUHFMFSA-N 0.000 description 1
- BYJRHFWXRSQCSA-SBUREZEXSA-N (3S)-5-[(6-bromo-2-methoxynaphthalen-1-yl)methyl]-3-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepine-9-carboxylic acid Chemical compound COc1ccc2cc(Br)ccc2c1CN1c2cccc(C(O)=O)c2OC[C@H](NC(=O)[C@H](C)N(C)C(=O)OC(C)(C)C)C1=O BYJRHFWXRSQCSA-SBUREZEXSA-N 0.000 description 1
- CLOQACRSJOMPGQ-ILKKLZGPSA-N (3r)-3,9-diamino-3,5-dihydro-2h-1,5-benzothiazepin-4-one;dihydrochloride Chemical compound Cl.Cl.N1C(=O)[C@@H](N)CSC2=C(N)C=CC=C21 CLOQACRSJOMPGQ-ILKKLZGPSA-N 0.000 description 1
- OCZCIZMIBVATCD-SFHVURJKSA-N (3s)-3-amino-5-[(2-methylnaphthalen-1-yl)methyl]-2,3-dihydro-1,5-benzoxazepin-4-one Chemical compound CC1=CC=C2C=CC=CC2=C1CN1C2=CC=CC=C2OC[C@H](N)C1=O OCZCIZMIBVATCD-SFHVURJKSA-N 0.000 description 1
- VZQDNZQCQKJHNO-UHFFFAOYSA-N (4-methoxyphenyl)carbamic acid Chemical compound COC1=CC=C(NC(O)=O)C=C1 VZQDNZQCQKJHNO-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ARCACZWMYGILNI-UHFFFAOYSA-N 1,2,3-trifluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1F ARCACZWMYGILNI-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- QCGMEWVZBGQOFN-UHFFFAOYSA-N 1,3-oxazole-5-carboxylic acid Chemical compound OC(=O)C1=CN=CO1 QCGMEWVZBGQOFN-UHFFFAOYSA-N 0.000 description 1
- WXLCDTBTIVJDCE-UHFFFAOYSA-N 1,4-oxazepine Chemical compound O1C=CC=NC=C1 WXLCDTBTIVJDCE-UHFFFAOYSA-N 0.000 description 1
- CNVQUMHQXXHYTF-UHFFFAOYSA-N 1-(2-cyanophenyl)-3-methylindole-2-carbonitrile Chemical compound C12=CC=CC=C2C(C)=C(C#N)N1C1=CC=CC=C1C#N CNVQUMHQXXHYTF-UHFFFAOYSA-N 0.000 description 1
- RTFPTPXBTIUISM-UHFFFAOYSA-N 1-(bromomethyl)-3-phenylbenzene Chemical group BrCC1=CC=CC(C=2C=CC=CC=2)=C1 RTFPTPXBTIUISM-UHFFFAOYSA-N 0.000 description 1
- RZJGKPNCYQZFGR-UHFFFAOYSA-N 1-(bromomethyl)naphthalene Chemical compound C1=CC=C2C(CBr)=CC=CC2=C1 RZJGKPNCYQZFGR-UHFFFAOYSA-N 0.000 description 1
- CGSYKRJQLUCLOR-UHFFFAOYSA-N 1-(chloromethyl)-2-methoxynaphthalene Chemical compound C1=CC=CC2=C(CCl)C(OC)=CC=C21 CGSYKRJQLUCLOR-UHFFFAOYSA-N 0.000 description 1
- NULZPAMTVBJETD-UHFFFAOYSA-N 1-(chloromethyl)-3-methoxynaphthalene Chemical compound C1=CC=CC2=CC(OC)=CC(CCl)=C21 NULZPAMTVBJETD-UHFFFAOYSA-N 0.000 description 1
- WFCLWJHOKCQYOQ-UHFFFAOYSA-N 1-acetylpiperidine-4-carboxylic acid Chemical compound CC(=O)N1CCC(C(O)=O)CC1 WFCLWJHOKCQYOQ-UHFFFAOYSA-N 0.000 description 1
- QUTILIHOEOJSCD-UHFFFAOYSA-N 1-benzyl-2-fluoro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(CC=2C=CC=CC=2)=C1F QUTILIHOEOJSCD-UHFFFAOYSA-N 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- HLDFCCHSOZWKAA-UHFFFAOYSA-N 1-fluoro-2-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1F HLDFCCHSOZWKAA-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- WHNAMGUAXHGCHH-UHFFFAOYSA-N 1-nitro-3-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=CC(C(F)(F)F)=C1 WHNAMGUAXHGCHH-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- XSLBWZNMWUEVMS-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1,5-benzothiazepine Chemical compound S1CCCNC2=CC=CC=C21 XSLBWZNMWUEVMS-UHFFFAOYSA-N 0.000 description 1
- RJXOVESYJFXCGI-UHFFFAOYSA-N 2,4-difluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1F RJXOVESYJFXCGI-UHFFFAOYSA-N 0.000 description 1
- GHUSZSIDIPXEHG-UHFFFAOYSA-N 2-(2-chloro-3-formylindol-1-yl)benzonitrile Chemical compound ClC1=C(C=O)C2=CC=CC=C2N1C1=CC=CC=C1C#N GHUSZSIDIPXEHG-UHFFFAOYSA-N 0.000 description 1
- OZJZCCMIOZPPIT-UHFFFAOYSA-N 2-(2-methoxyethoxy)acetyl chloride Chemical compound COCCOCC(Cl)=O OZJZCCMIOZPPIT-UHFFFAOYSA-N 0.000 description 1
- NSJPPSMKDMQXHQ-UHFFFAOYSA-N 2-(dibenzylamino)-2-[4-(2,3-difluoro-6-nitrophenoxy)oxan-4-yl]acetic acid Chemical compound C1COCCC1(OC=1C(=CC=C(F)C=1F)[N+]([O-])=O)C(C(=O)O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 NSJPPSMKDMQXHQ-UHFFFAOYSA-N 0.000 description 1
- PHRDBYLNQKVKBB-UHFFFAOYSA-N 2-(difluoromethoxy)naphthalene Chemical compound C1=CC=CC2=CC(OC(F)F)=CC=C21 PHRDBYLNQKVKBB-UHFFFAOYSA-N 0.000 description 1
- KHYFVIYUNAEOHW-UHFFFAOYSA-N 2-(difluoromethoxy)naphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(OC(F)F)=CC=C21 KHYFVIYUNAEOHW-UHFFFAOYSA-N 0.000 description 1
- IDDYNNYMUPHFMO-UHFFFAOYSA-N 2-Keto-n-heptylic acid Chemical compound CCCCCC(=O)C(O)=O IDDYNNYMUPHFMO-UHFFFAOYSA-N 0.000 description 1
- KUKHCQVNXXQCLV-UHFFFAOYSA-N 2-[2-chloro-3-(hydroxymethyl)indol-1-yl]benzonitrile Chemical compound C12=CC=CC=C2C(CO)=C(Cl)N1C1=CC=CC=C1C#N KUKHCQVNXXQCLV-UHFFFAOYSA-N 0.000 description 1
- VTYMNTXOGCDIEB-UHFFFAOYSA-N 2-[3-(bromomethyl)-6-fluoroindazol-1-yl]benzonitrile Chemical compound C12=CC(F)=CC=C2C(CBr)=NN1C1=CC=CC=C1C#N VTYMNTXOGCDIEB-UHFFFAOYSA-N 0.000 description 1
- VXKQWHKCJLLNHX-SFHVURJKSA-N 2-[3-[[(3s)-3-amino-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]methyl]indazol-1-yl]benzonitrile Chemical compound C([C@@H](C1=O)N)OC2=CC=CC=C2N1CC(C1=CC=CC=C11)=NN1C1=CC=CC=C1C#N VXKQWHKCJLLNHX-SFHVURJKSA-N 0.000 description 1
- SWPUFUUWZKLIJZ-UHFFFAOYSA-N 2-[4-(6-amino-2,3-difluorophenoxy)oxan-4-yl]-2-(dibenzylamino)acetic acid Chemical compound NC1=CC=C(F)C(F)=C1OC1(C(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)C(O)=O)CCOCC1 SWPUFUUWZKLIJZ-UHFFFAOYSA-N 0.000 description 1
- PDAFDQRABBWREL-UHFFFAOYSA-N 2-[4-(hydroxymethyl)indol-1-yl]benzonitrile Chemical compound C1=CC=2C(CO)=CC=CC=2N1C1=CC=CC=C1C#N PDAFDQRABBWREL-UHFFFAOYSA-N 0.000 description 1
- CJRPLIJLZHQETK-UHFFFAOYSA-N 2-[6-bromo-3-(bromomethyl)indazol-1-yl]benzonitrile Chemical compound C12=CC(Br)=CC=C2C(CBr)=NN1C1=CC=CC=C1C#N CJRPLIJLZHQETK-UHFFFAOYSA-N 0.000 description 1
- JZPGURKWXUBQLP-UHFFFAOYSA-N 2-[[2-(2-methylpropylsulfanyl)-1,3-benzothiazol-6-yl]iminomethyl]phenol Chemical compound CC(C)CSC1=NC2=C(S1)C=C(C=C2)N=CC3=CC=CC=C3O JZPGURKWXUBQLP-UHFFFAOYSA-N 0.000 description 1
- VLHQXRIIQSTJCQ-UHFFFAOYSA-N 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid Chemical compound OC(=O)C(C)N(C)C(=O)OC(C)(C)C VLHQXRIIQSTJCQ-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- UMCGAUJIMZIPRH-UHFFFAOYSA-N 2-cyclopropyl-6-methoxynaphthalene Chemical compound C1=CC2=CC(OC)=CC=C2C=C1C1CC1 UMCGAUJIMZIPRH-UHFFFAOYSA-N 0.000 description 1
- NBCNUIXYBLFJMI-UHFFFAOYSA-N 2-fluoro-1-methyl-3-nitrobenzene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1F NBCNUIXYBLFJMI-UHFFFAOYSA-N 0.000 description 1
- PGKWPKDZNHZBQK-UHFFFAOYSA-N 2-fluoro-1-nitro-3-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=CC(C(F)(F)F)=C1F PGKWPKDZNHZBQK-UHFFFAOYSA-N 0.000 description 1
- OBWDPLOCTVOTMA-UHFFFAOYSA-N 2-fluoro-1-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(C(F)(F)F)C=C1F OBWDPLOCTVOTMA-UHFFFAOYSA-N 0.000 description 1
- WZMOWQCNPFDWPA-UHFFFAOYSA-N 2-fluoro-4-methyl-1-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C(F)=C1 WZMOWQCNPFDWPA-UHFFFAOYSA-N 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- QSNYWVMRUYPJPA-UHFFFAOYSA-N 2-indazol-1-ylbenzonitrile Chemical compound N#CC1=CC=CC=C1N1C2=CC=CC=C2C=N1 QSNYWVMRUYPJPA-UHFFFAOYSA-N 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical compound CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 1
- XNIHZNNZJHYHLC-UHFFFAOYSA-N 2-oxohexanoic acid Chemical compound CCCCC(=O)C(O)=O XNIHZNNZJHYHLC-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- IWPZKOJSYQZABD-UHFFFAOYSA-N 3,4,5-trimethoxybenzoic acid Natural products COC1=CC(OC)=CC(C(O)=O)=C1 IWPZKOJSYQZABD-UHFFFAOYSA-N 0.000 description 1
- MAIKTETULSZRED-UHFFFAOYSA-N 3-(bromomethyl)-1,2-benzoxazole Chemical compound C1=CC=C2C(CBr)=NOC2=C1 MAIKTETULSZRED-UHFFFAOYSA-N 0.000 description 1
- KETTZLXYQNBUKX-UHFFFAOYSA-N 3-(dibenzylamino)-8,9-difluorospiro[3,5-dihydro-1,5-benzoxazepine-2,4'-oxane]-4-one Chemical compound C1COCCC21OC1=C(F)C(F)=CC=C1NC(=O)C2N(CC=1C=CC=CC=1)CC1=CC=CC=C1 KETTZLXYQNBUKX-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MNEQNRRRVMOVQL-UHFFFAOYSA-N 3-bromo-1-(chloromethyl)-2-methoxynaphthalene Chemical compound BrC=1C(=C(C2=CC=CC=C2C1)CCl)OC MNEQNRRRVMOVQL-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- GYLKKXHEIIFTJH-UHFFFAOYSA-N 3-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- XOILSNZVQVLOED-UHFFFAOYSA-N 3-methyl-1h-indole-2-carbonitrile Chemical compound C1=CC=C2C(C)=C(C#N)NC2=C1 XOILSNZVQVLOED-UHFFFAOYSA-N 0.000 description 1
- ROADCYAOHVSOLQ-UHFFFAOYSA-N 3-oxetanone Chemical compound O=C1COC1 ROADCYAOHVSOLQ-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 description 1
- SESASPRCAIMYLA-UHFFFAOYSA-N 4-bromonaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(Br)=CC=C(C=O)C2=C1 SESASPRCAIMYLA-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- IZOQMUVIDMLRDC-UHFFFAOYSA-N 5-aceto valeric acid Chemical compound CC(=O)CCCCC(O)=O IZOQMUVIDMLRDC-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- CRUWGMMAJMCGJX-UHFFFAOYSA-N 5h-thiazepin-4-one Chemical compound O=C1CC=CSN=C1 CRUWGMMAJMCGJX-UHFFFAOYSA-N 0.000 description 1
- YLDFTMJPQJXGSS-UHFFFAOYSA-N 6-bromo-2-naphthol Chemical compound C1=C(Br)C=CC2=CC(O)=CC=C21 YLDFTMJPQJXGSS-UHFFFAOYSA-N 0.000 description 1
- PUVRYFUBGFMXMW-UHFFFAOYSA-N 6-bromo-3-methyl-2h-indazole Chemical compound BrC1=CC=C2C(C)=NNC2=C1 PUVRYFUBGFMXMW-UHFFFAOYSA-N 0.000 description 1
- BOLWPPDABDAOEN-UHFFFAOYSA-N 6-fluoro-1,4-dimethylquinolin-2-one Chemical compound C1=C(F)C=C2C(C)=CC(=O)N(C)C2=C1 BOLWPPDABDAOEN-UHFFFAOYSA-N 0.000 description 1
- BGTFVZDPIQRVRY-UHFFFAOYSA-N 6-fluoro-4-methylquinoline Chemical compound C1=C(F)C=C2C(C)=CC=NC2=C1 BGTFVZDPIQRVRY-UHFFFAOYSA-N 0.000 description 1
- JRKLRIAIMIKGHT-UHFFFAOYSA-N 8-bromoquinoline-4-carbaldehyde Chemical compound C1=CN=C2C(Br)=CC=CC2=C1C=O JRKLRIAIMIKGHT-UHFFFAOYSA-N 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 102000010565 Apoptosis Regulatory Proteins Human genes 0.000 description 1
- 108010063104 Apoptosis Regulatory Proteins Proteins 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- YDTQDBOFCALADT-UHFFFAOYSA-N BrC1=C(C=CC=C1)C(C(=O)OC(C)(C)C)C Chemical compound BrC1=C(C=CC=C1)C(C(=O)OC(C)(C)C)C YDTQDBOFCALADT-UHFFFAOYSA-N 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- CHAUHJGVQLFHMS-NIIDSAIPSA-N C([2H])([2H])[2H].[I] Chemical compound C([2H])([2H])[2H].[I] CHAUHJGVQLFHMS-NIIDSAIPSA-N 0.000 description 1
- GPALGKYHHUINLI-NSHDSACASA-N CC(C)(C)OC(N[C@@H](COc(c(C(OC)=O)ccc1)c1N1)C1=O)=O Chemical compound CC(C)(C)OC(N[C@@H](COc(c(C(OC)=O)ccc1)c1N1)C1=O)=O GPALGKYHHUINLI-NSHDSACASA-N 0.000 description 1
- HMVPFYXQYROUBV-UHFFFAOYSA-N CCNC(c(cc1)cc(C#N)c1-[n](c1c2cccc1)nc2N)=O Chemical compound CCNC(c(cc1)cc(C#N)c1-[n](c1c2cccc1)nc2N)=O HMVPFYXQYROUBV-UHFFFAOYSA-N 0.000 description 1
- XGAFAULUGFKPHN-HOFKKMOUSA-N CC[C@@H](C(N[C@H](C1(CCOCC1)Oc(c(F)ccc1)c1N1Cc(c(c(cc2)c3)ccc3Br)c2OC)C1=O)=O)NC Chemical compound CC[C@@H](C(N[C@H](C1(CCOCC1)Oc(c(F)ccc1)c1N1Cc(c(c(cc2)c3)ccc3Br)c2OC)C1=O)=O)NC XGAFAULUGFKPHN-HOFKKMOUSA-N 0.000 description 1
- RVYZVHZENJHUGW-KKFHFHRHSA-N C[C@@H](C(NC(CS(c1ccccc1N1CCCCc2ccccc2)(=O)=O)C1=O)=O)NC Chemical compound C[C@@H](C(NC(CS(c1ccccc1N1CCCCc2ccccc2)(=O)=O)C1=O)=O)NC RVYZVHZENJHUGW-KKFHFHRHSA-N 0.000 description 1
- QDDYFDFXEKHXAM-AMGKYWFPSA-N C[C@@H](C(NC(CSc1ccccc1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O Chemical compound C[C@@H](C(NC(CSc1ccccc1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O QDDYFDFXEKHXAM-AMGKYWFPSA-N 0.000 description 1
- DECOJDQHNHTGTL-AFJIDDCJSA-N C[C@@H](C(N[C@@H](C(C)(C)Sc(cccc1)c1N1Cc2c(cc(C#N)[n]3-c(cccc4)c4C#N)c3ccc2)C1=O)=O)NC Chemical compound C[C@@H](C(N[C@@H](C(C)(C)Sc(cccc1)c1N1Cc2c(cc(C#N)[n]3-c(cccc4)c4C#N)c3ccc2)C1=O)=O)NC DECOJDQHNHTGTL-AFJIDDCJSA-N 0.000 description 1
- ROSWAAWPGNRTAN-SUMWQHHRSA-N C[C@@H](C(N[C@@H](C1(CCOCC1)Oc(c(F)ccc1)c1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O Chemical compound C[C@@H](C(N[C@@H](C1(CCOCC1)Oc(c(F)ccc1)c1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O ROSWAAWPGNRTAN-SUMWQHHRSA-N 0.000 description 1
- TWMNYKOLSDMFBC-MRDQGFSESA-N C[C@@H](C(N[C@@H](C1(CCOCC1)Oc(cc(cc1)F)c1N1Cc(c(c(cc2)c3)ccc3Br)c2OC)C1=O)=O)NC Chemical compound C[C@@H](C(N[C@@H](C1(CCOCC1)Oc(cc(cc1)F)c1N1Cc(c(c(cc2)c3)ccc3Br)c2OC)C1=O)=O)NC TWMNYKOLSDMFBC-MRDQGFSESA-N 0.000 description 1
- KZUUTKNHIHFFEC-KCWXNJEJSA-N C[C@@H](C(N[C@@H](C1(CCOCC1)Oc(cccc1)c1N1Cc2c(cn[n]3-c(cccc4)c4C#N)c3ccc2)C1=O)=O)NC Chemical compound C[C@@H](C(N[C@@H](C1(CCOCC1)Oc(cccc1)c1N1Cc2c(cn[n]3-c(cccc4)c4C#N)c3ccc2)C1=O)=O)NC KZUUTKNHIHFFEC-KCWXNJEJSA-N 0.000 description 1
- YXLHTDGYDRCZED-AAEUAGOBSA-N C[C@@H](C(N[C@@H](COc(cccc1)c1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O Chemical compound C[C@@H](C(N[C@@H](COc(cccc1)c1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O YXLHTDGYDRCZED-AAEUAGOBSA-N 0.000 description 1
- PMTGJZLNFRQBBN-UWJYYQICSA-N C[C@@H](C(N[C@@H](COc(cccc1)c1N1Cc2c(C)ccc3ccccc23)C1=O)=O)NC Chemical compound C[C@@H](C(N[C@@H](COc(cccc1)c1N1Cc2c(C)ccc3ccccc23)C1=O)=O)NC PMTGJZLNFRQBBN-UWJYYQICSA-N 0.000 description 1
- OULGXBSFUJVITE-YWZLYKJASA-N C[C@@H](C(N[C@@H](CSc(c(N)ccc1)c1N1Cc2cccc3c2cccc3)C1=O)=O)NC Chemical compound C[C@@H](C(N[C@@H](CSc(c(N)ccc1)c1N1Cc2cccc3c2cccc3)C1=O)=O)NC OULGXBSFUJVITE-YWZLYKJASA-N 0.000 description 1
- ROSWAAWPGNRTAN-GUYCJALGSA-N C[C@@H](C(N[C@H](C1(CCOCC1)Oc(c(F)ccc1)c1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O Chemical compound C[C@@H](C(N[C@H](C1(CCOCC1)Oc(c(F)ccc1)c1N1)C1=O)=O)N(C)C(OC(C)(C)C)=O ROSWAAWPGNRTAN-GUYCJALGSA-N 0.000 description 1
- QTAWNOXGLQMROR-QMTYFTJSSA-N C[C@@H](C(N[C@H](C1(CCOCC1)Oc(c(N1Cc(c(c(cc2)c3)ccc3Br)c2OC)ccc2F)c2F)C1=O)=O)NC Chemical compound C[C@@H](C(N[C@H](C1(CCOCC1)Oc(c(N1Cc(c(c(cc2)c3)ccc3Br)c2OC)ccc2F)c2F)C1=O)=O)NC QTAWNOXGLQMROR-QMTYFTJSSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102000003952 Caspase 3 Human genes 0.000 description 1
- 108090000397 Caspase 3 Proteins 0.000 description 1
- 102000004041 Caspase 7 Human genes 0.000 description 1
- 108090000567 Caspase 7 Proteins 0.000 description 1
- 102000019034 Chemokines Human genes 0.000 description 1
- 108010012236 Chemokines Proteins 0.000 description 1
- 101150082208 DIABLO gene Proteins 0.000 description 1
- 230000005778 DNA damage Effects 0.000 description 1
- 231100000277 DNA damage Toxicity 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-VVKOMZTBSA-N Dideuterium Chemical compound [2H][2H] UFHFLCQGNIYNRP-VVKOMZTBSA-N 0.000 description 1
- 102000007989 Effector Caspases Human genes 0.000 description 1
- 108010089510 Effector Caspases Proteins 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 102100021239 G protein-activated inward rectifier potassium channel 2 Human genes 0.000 description 1
- 101710158550 G protein-activated inward rectifier potassium channel 2 Proteins 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 101000871228 Homo sapiens Diablo IAP-binding mitochondrial protein Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910013684 LiClO 4 Inorganic materials 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- GDFAOVXKHJXLEI-VKHMYHEASA-N N-methyl-L-alanine Chemical compound C[NH2+][C@@H](C)C([O-])=O GDFAOVXKHJXLEI-VKHMYHEASA-N 0.000 description 1
- 108010006696 Neuronal Apoptosis-Inhibitory Protein Proteins 0.000 description 1
- 102000005445 Neuronal Apoptosis-Inhibitory Protein Human genes 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 108010027206 Nucleopolyhedrovirus inhibitor of apoptosis Proteins 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QORPRHGDRSEOQH-UHFFFAOYSA-N [1-(benzenesulfonyl)-2-chloroindol-3-yl]methanol Chemical compound C12=CC=CC=C2C(CO)=C(Cl)N1S(=O)(=O)C1=CC=CC=C1 QORPRHGDRSEOQH-UHFFFAOYSA-N 0.000 description 1
- QKKFOIJXDDMAIM-UHFFFAOYSA-N [2-(difluoromethoxy)naphthalen-1-yl]methanol Chemical compound C1=CC=C2C(CO)=C(OC(F)F)C=CC2=C1 QKKFOIJXDDMAIM-UHFFFAOYSA-N 0.000 description 1
- HZUZPZGZRQEPIX-UHFFFAOYSA-N [2-(difluoromethoxy)naphthalen-1-yl]methyl methanesulfonate Chemical compound C1=CC=C2C(COS(=O)(=O)C)=C(OC(F)F)C=CC2=C1 HZUZPZGZRQEPIX-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 125000005038 alkynylalkyl group Chemical group 0.000 description 1
- 108010004469 allophycocyanin Proteins 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000001640 apoptogenic effect Effects 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 230000005775 apoptotic pathway Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- AKGJVXOZMARREK-UHFFFAOYSA-N benzyl n-(2,2-dimethyl-4-oxo-3,5-dihydro-1,5-benzothiazepin-3-yl)carbamate Chemical compound CC1(C)SC2=CC=CC=C2NC(=O)C1NC(=O)OCC1=CC=CC=C1 AKGJVXOZMARREK-UHFFFAOYSA-N 0.000 description 1
- 150000001602 bicycloalkyls Chemical group 0.000 description 1
- 102000023732 binding proteins Human genes 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 238000012742 biochemical analysis Methods 0.000 description 1
- 235000020958 biotin Nutrition 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- ARUJJNVNLJPSDO-UHFFFAOYSA-N butanamide;hydrochloride Chemical compound Cl.CCCC(N)=O ARUJJNVNLJPSDO-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000006244 carboxylic acid protecting group Chemical group 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 1
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000009462 endogenous apoptosis Effects 0.000 description 1
- MACRQDMYSIVXQC-UHFFFAOYSA-N ethyl 2-(dibenzylamino)-2-(1-hydroxycyclohexyl)acetate Chemical compound C1CCCCC1(O)C(C(=O)OCC)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 MACRQDMYSIVXQC-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 1
- 238000002875 fluorescence polarization Methods 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 201000005787 hematologic cancer Diseases 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000004536 indazol-1-yl group Chemical group N1(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 230000002601 intratumoral effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 208000037841 lung tumor Diseases 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- FSKIFEBBHBMCPU-UHFFFAOYSA-N methyl 2,3-dihydro-1h-isoindole-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1CNC2 FSKIFEBBHBMCPU-UHFFFAOYSA-N 0.000 description 1
- VEKYKLDXYNUERO-UHFFFAOYSA-N methyl 2-fluoro-3-nitrobenzoate Chemical compound COC(=O)C1=CC=CC([N+]([O-])=O)=C1F VEKYKLDXYNUERO-UHFFFAOYSA-N 0.000 description 1
- UCOJKDQJOVWXRE-UHFFFAOYSA-N methyl 3-cyano-4-fluorobenzoate Chemical compound COC(=O)C1=CC=C(F)C(C#N)=C1 UCOJKDQJOVWXRE-UHFFFAOYSA-N 0.000 description 1
- GIZCKBSSWNIUMZ-UHFFFAOYSA-N methyl 4-(aminomethyl)benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=C(CN)C=C1 GIZCKBSSWNIUMZ-UHFFFAOYSA-N 0.000 description 1
- FXUYSPQLGFJQME-UHFFFAOYSA-N methyl 4-[3-(bromomethyl)indazol-1-yl]-3-cyanobenzoate Chemical compound N#CC1=CC(C(=O)OC)=CC=C1N1C2=CC=CC=C2C(CBr)=N1 FXUYSPQLGFJQME-UHFFFAOYSA-N 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 1
- TYRGLVWXHJRKMT-QMMMGPOBSA-N n-benzyloxycarbonyl-l-serine-betalactone Chemical compound OC(=O)[C@H](C)NC(=O)OCC1=CC=CC=C1 TYRGLVWXHJRKMT-QMMMGPOBSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 230000000771 oncological effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical group C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003002 pH adjusting agent Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- UUMZDXBZTGNJDF-UHFFFAOYSA-N propanamide;dihydrochloride Chemical compound Cl.Cl.CCC(N)=O UUMZDXBZTGNJDF-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 208000023958 prostate neoplasm Diseases 0.000 description 1
- PNNRZXFUPQQZSO-UHFFFAOYSA-N pyran Chemical compound [CH]1OC=CC=C1 PNNRZXFUPQQZSO-UHFFFAOYSA-N 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 150000003413 spiro compounds Chemical class 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000011301 standard therapy Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JSPCVEKDCLELSF-GWCFXTLKSA-N tert-butyl n-[(2s)-1-[[(3r)-9-amino-4-oxo-3,5-dihydro-2h-1,5-benzothiazepin-3-yl]amino]-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound N1C(=O)[C@@H](NC(=O)[C@@H](N(C)C(=O)OC(C)(C)C)C)CSC2=C(N)C=CC=C21 JSPCVEKDCLELSF-GWCFXTLKSA-N 0.000 description 1
- PCZZHNGZJVNDNQ-MBSDFSHPSA-N tert-butyl n-[(2s)-1-[[(3r)-9-amino-5-(naphthalen-1-ylmethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound O=C1[C@@H](NC(=O)[C@@H](N(C)C(=O)OC(C)(C)C)C)CSC2=C(N)C=CC=C2N1CC1=CC=CC2=CC=CC=C12 PCZZHNGZJVNDNQ-MBSDFSHPSA-N 0.000 description 1
- ARHCRZNQNQMTCH-JTQLQIEISA-N tert-butyl n-[(3r)-9-amino-4-oxo-3,5-dihydro-2h-1,5-benzothiazepin-3-yl]carbamate Chemical compound N1C(=O)[C@@H](NC(=O)OC(C)(C)C)CSC2=C(N)C=CC=C21 ARHCRZNQNQMTCH-JTQLQIEISA-N 0.000 description 1
- BMVSXSWSIZDDQE-NSHDSACASA-N tert-butyl n-[(3s)-8-methyl-4-oxo-3,5-dihydro-2h-1,5-benzoxazepin-3-yl]carbamate Chemical compound N1C(=O)[C@@H](NC(=O)OC(C)(C)C)COC2=CC(C)=CC=C21 BMVSXSWSIZDDQE-NSHDSACASA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ABZLKHKQJHEPAX-UHFFFAOYSA-N tetramethylrhodamine Chemical compound C=12C=CC(N(C)C)=CC2=[O+]C2=CC(N(C)C)=CC=C2C=1C1=CC=CC=C1C([O-])=O ABZLKHKQJHEPAX-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- INQOMBQAUSQDDS-FIBGUPNXSA-N trideuterio(iodo)methane Chemical compound [2H]C([2H])([2H])I INQOMBQAUSQDDS-FIBGUPNXSA-N 0.000 description 1
- GTCAXTIRRLKXRU-FIBGUPNXSA-N trideuteriomethyl carbamate Chemical compound C(N)(OC([2H])([2H])[2H])=O GTCAXTIRRLKXRU-FIBGUPNXSA-N 0.000 description 1
- 238000009489 vacuum treatment Methods 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/02—Seven-membered rings
- C07D267/08—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D267/12—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D267/14—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
- A61K31/553—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole having at least one nitrogen and one oxygen as ring hetero atoms, e.g. loxapine, staurosporine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
- A61K31/554—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole having at least one nitrogen and one sulfur as ring hetero atoms, e.g. clothiapine, diltiazem
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/02—Seven-membered rings
- C07D267/08—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D267/12—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D281/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D281/02—Seven-membered rings
- C07D281/04—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D281/08—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D281/10—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201261681337P | 2012-08-09 | 2012-08-09 | |
| US61/681,337 | 2012-08-09 | ||
| PCT/EP2013/066431 WO2014023708A1 (en) | 2012-08-09 | 2013-08-06 | Substituted hetero-azepinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20150041647A true KR20150041647A (ko) | 2015-04-16 |
Family
ID=48951449
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR20157005929A Withdrawn KR20150041647A (ko) | 2012-08-09 | 2013-08-06 | 치환된 헤테로-아제핀온 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US9394263B2 (https=) |
| EP (1) | EP2882725A1 (https=) |
| JP (1) | JP6266617B2 (https=) |
| KR (1) | KR20150041647A (https=) |
| CN (1) | CN104470905B (https=) |
| BR (1) | BR112015001830A2 (https=) |
| CA (1) | CA2877048A1 (https=) |
| MX (1) | MX2015001720A (https=) |
| RU (1) | RU2015105561A (https=) |
| WO (1) | WO2014023708A1 (https=) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2014044622A1 (en) * | 2012-09-19 | 2014-03-27 | F. Hoffmann-La Roche Ag | 2-oxo-2,3,4,5-tetrahydro-1 h-benzo[b]diazepines and their use in the treatment of cancer |
| WO2016079527A1 (en) | 2014-11-19 | 2016-05-26 | Tetralogic Birinapant Uk Ltd | Combination therapy |
| WO2016097773A1 (en) | 2014-12-19 | 2016-06-23 | Children's Cancer Institute | Therapeutic iap antagonists for treating proliferative disorders |
| EP3317269B1 (en) | 2015-07-02 | 2022-09-21 | F. Hoffmann-La Roche AG | Bicyclic lactams as receptor-interacting protein-1 (rip1) kinase inhibitors for treating e.g. inflammatory diseases |
| CN106467521A (zh) * | 2015-08-14 | 2017-03-01 | 陈志龙 | 一类双苯并咪唑吲哚衍生物的两种制备方法 |
| CN106467515B (zh) * | 2015-08-18 | 2019-09-24 | 宁波洞密生物科技有限公司 | 一类6-吡啶苯并咪唑吲哚衍生物及其制备方法与医药领域的应用 |
| IL287136B2 (en) | 2016-02-05 | 2023-09-01 | Denali Therapeutics Inc | Receptor inhibitors - interacting with protein kinase 1 |
| WO2018073193A1 (en) | 2016-10-17 | 2018-04-26 | F. Hoffmann-La Roche Ag | Bicyclic pyridone lactams and methods of use thereof |
| JP7208137B2 (ja) | 2016-12-09 | 2023-01-18 | デナリ セラピューティクス インコーポレイテッド | 化合物、組成物および方法 |
| US11072607B2 (en) | 2016-12-16 | 2021-07-27 | Genentech, Inc. | Inhibitors of RIP1 kinase and methods of use thereof |
| WO2019204537A1 (en) | 2018-04-20 | 2019-10-24 | Genentech, Inc. | N-[4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-5,6-dihydro-4h-pyrrolo[1,2-b]pyrazol e-2-carboxamide derivatives and related compounds as rip1 kinase inhibitors for treating e.g. irritable bowel syndrome (ibs) |
| WO2020027225A1 (ja) | 2018-07-31 | 2020-02-06 | ファイメクス株式会社 | 複素環化合物 |
| JP7764027B2 (ja) | 2019-07-31 | 2025-11-05 | ファイメクス株式会社 | 複素環化合物 |
| MX2023007133A (es) | 2020-12-17 | 2023-06-27 | Hoffmann La Roche | Anticuerpos anti-hla-g y uso de estos. |
| AU2022221124A1 (en) * | 2021-02-12 | 2023-08-03 | F. Hoffmann-La Roche Ag | Bicyclic tetrahydroazepine derivatives for the treatment of cancer |
| CN117980294A (zh) * | 2021-09-01 | 2024-05-03 | 海南先声再明医药股份有限公司 | 泛素特异性蛋白酶1(usp1)抑制剂 |
| TW202334164A (zh) | 2022-01-12 | 2023-09-01 | 美商戴納立製藥公司 | (S)-5-苄基-N-(5-甲基-4-側氧基-2,3,4,5-四氫吡啶並[3,2-b][1,4]氧氮呯-3-基)-4H-1,2,4-三唑-3-甲醯胺的晶型 |
| WO2023150790A2 (en) * | 2022-02-07 | 2023-08-10 | The Wistar Institute Of Anatomy And Biology | Novel and highly selective sars-cov-2 mpro inhibitors |
| AU2023322637A1 (en) * | 2022-08-11 | 2024-11-14 | F. Hoffmann-La Roche Ag | Bicyclic tetrahydrothiazepine derivatives |
| WO2024033457A1 (en) * | 2022-08-11 | 2024-02-15 | F. Hoffmann-La Roche Ag | Bicyclic tetrahydrothiazepine derivatives |
| JP2025526726A (ja) * | 2022-08-11 | 2025-08-15 | エフ・ホフマン-ラ・ロシュ・アクチェンゲゼルシャフト | 二環式テトラヒドロアゼピン誘導体 |
| AU2023322638A1 (en) * | 2022-08-11 | 2024-11-28 | F. Hoffmann-La Roche Ag | Bicyclic tetrahydrothiazepine derivatives |
| CN119930413B (zh) * | 2025-04-10 | 2025-07-22 | 山东辉璟生物医药科技有限公司 | 一种萘丁美酮-d3的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9420763D0 (en) | 1994-10-14 | 1994-11-30 | Glaxo Inc | Acetamide derivatives |
| TW200502221A (en) * | 2002-10-03 | 2005-01-16 | Astrazeneca Ab | Novel lactams and uses thereof |
| JP2008523141A (ja) * | 2004-12-14 | 2008-07-03 | アストラゼネカ・アクチエボラーグ | 新規の分子プローブ |
| US7989441B2 (en) | 2005-06-08 | 2011-08-02 | Novartis Ag | Organic compounds |
| WO2007101347A1 (en) * | 2006-03-07 | 2007-09-13 | Aegera Therapeutics Inc. | Bir domain binding compounds |
| WO2007104933A1 (en) * | 2006-03-10 | 2007-09-20 | Astrazeneca Ab | Chemical compounds |
| EP2131657A1 (en) * | 2007-02-28 | 2009-12-16 | Merck & Co., Inc. | Substituted benzodiazepinones, benzoxazepinones and benzothiazepinones as sodium channel blockers |
-
2013
- 2013-08-06 BR BR112015001830A patent/BR112015001830A2/pt not_active IP Right Cessation
- 2013-08-06 US US14/418,383 patent/US9394263B2/en not_active Expired - Fee Related
- 2013-08-06 CN CN201380035993.XA patent/CN104470905B/zh not_active Expired - Fee Related
- 2013-08-06 WO PCT/EP2013/066431 patent/WO2014023708A1/en not_active Ceased
- 2013-08-06 JP JP2015525858A patent/JP6266617B2/ja not_active Expired - Fee Related
- 2013-08-06 RU RU2015105561A patent/RU2015105561A/ru not_active Application Discontinuation
- 2013-08-06 CA CA2877048A patent/CA2877048A1/en not_active Abandoned
- 2013-08-06 KR KR20157005929A patent/KR20150041647A/ko not_active Withdrawn
- 2013-08-06 MX MX2015001720A patent/MX2015001720A/es unknown
- 2013-08-06 EP EP13747659.4A patent/EP2882725A1/en not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| CN104470905B (zh) | 2017-09-12 |
| JP2015528821A (ja) | 2015-10-01 |
| JP6266617B2 (ja) | 2018-01-24 |
| WO2014023708A1 (en) | 2014-02-13 |
| US9394263B2 (en) | 2016-07-19 |
| CA2877048A1 (en) | 2014-02-13 |
| HK1206740A1 (en) | 2016-01-15 |
| US20150361059A1 (en) | 2015-12-17 |
| RU2015105561A (ru) | 2016-09-27 |
| EP2882725A1 (en) | 2015-06-17 |
| MX2015001720A (es) | 2015-04-14 |
| BR112015001830A2 (pt) | 2017-07-04 |
| CN104470905A (zh) | 2015-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20150041647A (ko) | 치환된 헤테로-아제핀온 | |
| KR101704307B1 (ko) | 항증식성 벤조[b]아제핀-2-온 | |
| EP2882740B1 (en) | Iap antagonists | |
| JP6302912B2 (ja) | 2−オキソ−2,3,4,5−テトラヒドロ−1h−ベンゾ[b]ジアゼピン及びがんの治療におけるその使用 | |
| US20030232832A1 (en) | Pyrrolotriazinone compounds and their use to teat diseases | |
| SK286568B6 (sk) | Inhibítory farnezyl proteín transferázy | |
| EP3071562A1 (en) | Tetrahydro-benzodiazepinones | |
| EP2897949A1 (en) | Iap antagonists | |
| EP0514133A1 (en) | Benzodiazepine derivatives, compositions containing them and their use in therapy | |
| EP2931719A1 (en) | Dimeric compounds | |
| US5302591A (en) | Benzodiazepine derivatives | |
| WO2011061318A1 (en) | Heterocylic compounds as antagonists of the orexin receptors | |
| PL209411B1 (pl) | Związki liniowe, zasadowe będące antagonistami NK-2, kompozycje zawierające te związki i ich zastosowanie | |
| KR20110085036A (ko) | 세포사멸 유도 활성을 갖는 이미다조피라진온 유도체 | |
| HK1206740B (en) | Substituted hetero-azepinones | |
| JPWO1995032964A1 (ja) | チエニルアゾール化合物およびチエノトリアゾロジアゼピン化合物 | |
| GB2266528A (en) | Benzodiazepine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20150306 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PC1203 | Withdrawal of no request for examination | ||
| WITN | Application deemed withdrawn, e.g. because no request for examination was filed or no examination fee was paid |