KR20070026540A - 치료 화합물:스캐폴드로서의 피리딘 - Google Patents
치료 화합물:스캐폴드로서의 피리딘 Download PDFInfo
- Publication number
- KR20070026540A KR20070026540A KR1020067024936A KR20067024936A KR20070026540A KR 20070026540 A KR20070026540 A KR 20070026540A KR 1020067024936 A KR1020067024936 A KR 1020067024936A KR 20067024936 A KR20067024936 A KR 20067024936A KR 20070026540 A KR20070026540 A KR 20070026540A
- Authority
- KR
- South Korea
- Prior art keywords
- alkyl
- amino
- alkoxy
- carboxamide
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 306
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 title description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 title description 3
- 230000001225 therapeutic effect Effects 0.000 title description 3
- 238000011282 treatment Methods 0.000 claims abstract description 32
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 208000002193 Pain Diseases 0.000 claims abstract description 21
- 230000036407 pain Effects 0.000 claims abstract description 15
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 546
- -1 cyano, amino, acetylamino, hydroxyl Chemical group 0.000 claims description 502
- 125000000623 heterocyclic group Chemical group 0.000 claims description 242
- 125000003545 alkoxy group Chemical group 0.000 claims description 226
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 216
- 238000000034 method Methods 0.000 claims description 163
- 125000003118 aryl group Chemical group 0.000 claims description 134
- 125000001072 heteroaryl group Chemical group 0.000 claims description 118
- 229910052736 halogen Inorganic materials 0.000 claims description 114
- 150000002367 halogens Chemical class 0.000 claims description 114
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 110
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 87
- 229910052739 hydrogen Inorganic materials 0.000 claims description 77
- 239000001257 hydrogen Substances 0.000 claims description 74
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 68
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 68
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 65
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 64
- 125000005842 heteroatom Chemical group 0.000 claims description 62
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 55
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 54
- 125000003342 alkenyl group Chemical group 0.000 claims description 52
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 52
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 49
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 48
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 47
- 125000004171 alkoxy aryl group Chemical group 0.000 claims description 46
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 45
- 125000005343 heterocyclic alkyl group Chemical group 0.000 claims description 43
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 42
- 239000002904 solvent Substances 0.000 claims description 41
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 claims description 37
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 36
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 35
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 34
- 229910052757 nitrogen Inorganic materials 0.000 claims description 33
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 claims description 33
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 25
- 125000003282 alkyl amino group Chemical group 0.000 claims description 24
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 24
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 24
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims description 18
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 18
- 238000004519 manufacturing process Methods 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 16
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 15
- 125000005055 alkyl alkoxy group Chemical group 0.000 claims description 14
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 14
- 239000003814 drug Substances 0.000 claims description 14
- 125000002947 alkylene group Chemical group 0.000 claims description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 12
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- IPEHBUMCGVEMRF-UHFFFAOYSA-N pyrazinecarboxamide Chemical compound NC(=O)C1=CN=CC=N1 IPEHBUMCGVEMRF-UHFFFAOYSA-N 0.000 claims description 12
- 208000018522 Gastrointestinal disease Diseases 0.000 claims description 10
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 10
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 10
- 208000002551 irritable bowel syndrome Diseases 0.000 claims description 10
- 241001465754 Metazoa Species 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 8
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 8
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims description 8
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 claims description 8
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 7
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 claims description 7
- 125000004122 cyclic group Chemical group 0.000 claims description 6
- 208000035475 disorder Diseases 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 208000021302 gastroesophageal reflux disease Diseases 0.000 claims description 6
- SICXGWWUMIAMRS-UHFFFAOYSA-N 3-benzamido-2,6-dimethyl-n-phenylpyridine-4-carboxamide Chemical compound C=1C=CC=CC=1C(=O)NC=1C(C)=NC(C)=CC=1C(=O)NC1=CC=CC=C1 SICXGWWUMIAMRS-UHFFFAOYSA-N 0.000 claims description 5
- BNCWAGNRFLQKQR-UHFFFAOYSA-N 3-benzamido-n-benzylpyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C=CC=CC=2)C=1C(=O)NCC1=CC=CC=C1 BNCWAGNRFLQKQR-UHFFFAOYSA-N 0.000 claims description 5
- YRKMZPUFKOXPRF-UHFFFAOYSA-N 3-benzamido-n-phenylpyridine-2-carboxamide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CN=C1C(=O)NC1=CC=CC=C1 YRKMZPUFKOXPRF-UHFFFAOYSA-N 0.000 claims description 5
- UBECMWWEVLSFMW-UHFFFAOYSA-N 3-benzamido-n-pyridin-3-ylpyridine-2-carboxamide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CN=C1C(=O)NC1=CC=CN=C1 UBECMWWEVLSFMW-UHFFFAOYSA-N 0.000 claims description 5
- 208000019901 Anxiety disease Diseases 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 5
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 5
- ARHKCIXSCVAUKZ-UHFFFAOYSA-N 3-[(4-aminonaphthalene-1-carbonyl)amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(N)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 ARHKCIXSCVAUKZ-UHFFFAOYSA-N 0.000 claims description 4
- RWGTZNNPKDUWGX-UHFFFAOYSA-N 3-[[4-(methoxymethyl)naphthalene-1-carbonyl]amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(COC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 RWGTZNNPKDUWGX-UHFFFAOYSA-N 0.000 claims description 4
- 208000018737 Parkinson disease Diseases 0.000 claims description 4
- LMNOJPLGPUBZCA-UHFFFAOYSA-N n-[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]quinoline-4-carboxamide Chemical compound C=1C=NC2=CC=CC=C2C=1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 LMNOJPLGPUBZCA-UHFFFAOYSA-N 0.000 claims description 4
- 229960003966 nicotinamide Drugs 0.000 claims description 4
- 235000005152 nicotinamide Nutrition 0.000 claims description 4
- 239000011570 nicotinamide Substances 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- ZBDVLRMVASOXFS-UHFFFAOYSA-N 1-n-[2-(cyclohexylmethylcarbamoyl)pyridin-3-yl]-4-n,4-n-dimethylnaphthalene-1,4-dicarboxamide Chemical compound C12=CC=CC=C2C(C(=O)N(C)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 ZBDVLRMVASOXFS-UHFFFAOYSA-N 0.000 claims description 3
- FKRBDYNUBOVEMJ-UHFFFAOYSA-N 3-[(4-methylnaphthalene-1-carbonyl)amino]-n-pentylpyrazine-2-carboxamide Chemical compound CCCCCNC(=O)C1=NC=CN=C1NC(=O)C1=CC=C(C)C2=CC=CC=C12 FKRBDYNUBOVEMJ-UHFFFAOYSA-N 0.000 claims description 3
- VGSNSYDOPNZQRP-UHFFFAOYSA-N 3-[(4-tert-butylbenzoyl)amino]-n-(5-chloropyridin-2-yl)pyrazine-2-carboxamide Chemical compound C1=CC(C(C)(C)C)=CC=C1C(=O)NC1=NC=CN=C1C(=O)NC1=CC=C(Cl)C=N1 VGSNSYDOPNZQRP-UHFFFAOYSA-N 0.000 claims description 3
- YVITVABZYDPMHU-UHFFFAOYSA-N 6-methoxy-n-(oxan-4-ylmethyl)-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C1COCCC1CNC(=O)C1=NC(OC)=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1C=CN=N1 YVITVABZYDPMHU-UHFFFAOYSA-N 0.000 claims description 3
- 208000024827 Alzheimer disease Diseases 0.000 claims description 3
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 3
- 208000023105 Huntington disease Diseases 0.000 claims description 3
- 206010028980 Neoplasm Diseases 0.000 claims description 3
- 201000011510 cancer Diseases 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims description 3
- 201000006417 multiple sclerosis Diseases 0.000 claims description 3
- HWRILMRNNLNPPD-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-(2,3-dihydro-1,4-benzodioxine-5-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C=3OCCOC=3C=CC=2)C=1C(=O)NCC1CCC1 HWRILMRNNLNPPD-UHFFFAOYSA-N 0.000 claims description 3
- PIHTTXCYHKHTJB-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCC1 PIHTTXCYHKHTJB-UHFFFAOYSA-N 0.000 claims description 3
- QSQZXQBGYJJJGJ-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[(2-methoxybenzoyl)amino]pyridine-2-carboxamide Chemical compound COC1=CC=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 QSQZXQBGYJJJGJ-UHFFFAOYSA-N 0.000 claims description 3
- HANPSVQLVKAJLN-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[(4-methoxynaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 HANPSVQLVKAJLN-UHFFFAOYSA-N 0.000 claims description 3
- ZMINVFQOJQGSHJ-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[(4-methylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxamide Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=NC=CN=C1C(=O)NCC1CCC1 ZMINVFQOJQGSHJ-UHFFFAOYSA-N 0.000 claims description 3
- YKMPVYZXXBLRIX-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[(4-methylnaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 YKMPVYZXXBLRIX-UHFFFAOYSA-N 0.000 claims description 3
- LPLJNZONBJJNMN-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(N(C)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 LPLJNZONBJJNMN-UHFFFAOYSA-N 0.000 claims description 3
- KTHAZMYKCWDELV-UHFFFAOYSA-N n-(cyclohexylmethyl)-3-[(4-iodonaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(I)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 KTHAZMYKCWDELV-UHFFFAOYSA-N 0.000 claims description 3
- LYYMDSUUZZBFPN-UHFFFAOYSA-N n-(cyclohexylmethyl)-6-methoxy-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=NC(OC)=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1C=CN=N1 LYYMDSUUZZBFPN-UHFFFAOYSA-N 0.000 claims description 3
- BADLVSFYSWGHDS-UHFFFAOYSA-N n-butyl-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound CCCCNC(=O)C1=NC=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 BADLVSFYSWGHDS-UHFFFAOYSA-N 0.000 claims description 3
- RFTKWHFDQUXJJL-UHFFFAOYSA-N n-cyclohexyloxy-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NOC1CCCCC1 RFTKWHFDQUXJJL-UHFFFAOYSA-N 0.000 claims description 3
- COGOZBAVIBWSIA-UHFFFAOYSA-N n-cyclohexyloxy-3-[(4-methylnaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NOC1CCCCC1 COGOZBAVIBWSIA-UHFFFAOYSA-N 0.000 claims description 3
- NZDNDBAMYOGQJC-UHFFFAOYSA-N n-cyclopentyloxy-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NOC1CCCC1 NZDNDBAMYOGQJC-UHFFFAOYSA-N 0.000 claims description 3
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 claims description 2
- AFCYJROVCWBNDH-UHFFFAOYSA-N 1-n-[2-(cyclobutylmethylcarbamoyl)pyridin-3-yl]-4-n,4-n-dimethylnaphthalene-1,4-dicarboxamide Chemical compound C12=CC=CC=C2C(C(=O)N(C)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 AFCYJROVCWBNDH-UHFFFAOYSA-N 0.000 claims description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- ZZFOZUWZXKJPEY-UHFFFAOYSA-N 2-hydroxyethyl 4-[[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]carbamoyl]naphthalene-1-carboxylate Chemical compound C12=CC=CC=C2C(C(=O)OCCO)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 ZZFOZUWZXKJPEY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 2
- CMHDGZIUTULGFI-UHFFFAOYSA-N 3-(naphthalene-1-carbonylamino)-n-(2-piperidin-1-ylethyl)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCN1CCCCC1 CMHDGZIUTULGFI-UHFFFAOYSA-N 0.000 claims description 2
- VUJZZCYIZJZDBJ-UHFFFAOYSA-N 3-(naphthalene-1-carbonylamino)-n-(2-pyrrolidin-1-ylethyl)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCN1CCCC1 VUJZZCYIZJZDBJ-UHFFFAOYSA-N 0.000 claims description 2
- RBHVESNGDMPRCZ-UHFFFAOYSA-N 3-(naphthalene-1-carbonylamino)-n-(oxan-4-yl)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1CCOCC1 RBHVESNGDMPRCZ-UHFFFAOYSA-N 0.000 claims description 2
- KQLKVUTUWJRUOQ-UHFFFAOYSA-N 3-(naphthalene-1-carbonylamino)-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 KQLKVUTUWJRUOQ-UHFFFAOYSA-N 0.000 claims description 2
- WUYVRYKGHYWEIU-UHFFFAOYSA-N 3-(naphthalene-1-carbonylamino)-n-(piperidin-2-ylmethyl)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCN1 WUYVRYKGHYWEIU-UHFFFAOYSA-N 0.000 claims description 2
- LQHXTNIRBNKMSH-UHFFFAOYSA-N 3-[(4-acetamidonaphthalene-1-carbonyl)amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(NC(=O)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 LQHXTNIRBNKMSH-UHFFFAOYSA-N 0.000 claims description 2
- KKMNBDMDAIVQLS-UHFFFAOYSA-N 3-[(4-aminonaphthalene-1-carbonyl)amino]-n-(cyclohexylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(N)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 KKMNBDMDAIVQLS-UHFFFAOYSA-N 0.000 claims description 2
- DANLUEKVPQFPIK-UHFFFAOYSA-N 3-[(4-ethoxynaphthalene-1-carbonyl)amino]-n-pentylpyridine-2-carboxamide Chemical compound CCCCCNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(OCC)C2=CC=CC=C12 DANLUEKVPQFPIK-UHFFFAOYSA-N 0.000 claims description 2
- AUYVUUVZZPZBPU-UHFFFAOYSA-N 3-[(4-ethylnaphthalene-1-carbonyl)amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(CC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 AUYVUUVZZPZBPU-UHFFFAOYSA-N 0.000 claims description 2
- IWKBXLMNASRWLY-UHFFFAOYSA-N 3-[(4-methoxynaphthalene-1-carbonyl)amino]-n-(oxolan-2-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCO1 IWKBXLMNASRWLY-UHFFFAOYSA-N 0.000 claims description 2
- UCBNKKXVXPJPMQ-UHFFFAOYSA-N 3-[(4-methylnaphthalene-1-carbonyl)amino]-n-[2-(oxan-4-yl)ethyl]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCCC1CCOCC1 UCBNKKXVXPJPMQ-UHFFFAOYSA-N 0.000 claims description 2
- HMTGVCTUYNLSEI-UHFFFAOYSA-N 3-[(4-tert-butylbenzoyl)amino]-n-[2-(1h-imidazol-2-yl)ethyl]pyrazine-2-carboxamide Chemical compound C1=CC(C(C)(C)C)=CC=C1C(=O)NC1=NC=CN=C1C(=O)NCCC1=NC=CN1 HMTGVCTUYNLSEI-UHFFFAOYSA-N 0.000 claims description 2
- TZMOLSGECSETTL-UHFFFAOYSA-N 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]-n-(2-ethylbutyl)pyridine-2-carboxamide Chemical compound CCC(CC)CNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 TZMOLSGECSETTL-UHFFFAOYSA-N 0.000 claims description 2
- MINUDTBJCJQJJF-UHFFFAOYSA-N 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]-n-[3-(dimethylamino)propyl]pyridine-2-carboxamide Chemical compound CN(C)CCCNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 MINUDTBJCJQJJF-UHFFFAOYSA-N 0.000 claims description 2
- SOJXPRBKIKHWKF-UHFFFAOYSA-N 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]-n-hexylpyridine-2-carboxamide Chemical compound CCCCCCNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 SOJXPRBKIKHWKF-UHFFFAOYSA-N 0.000 claims description 2
- HIKSPCQQKBCYJV-UHFFFAOYSA-N 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]-n-pentylpyridine-2-carboxamide Chemical compound CCCCCNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 HIKSPCQQKBCYJV-UHFFFAOYSA-N 0.000 claims description 2
- PIYPUGUVIWSELE-UHFFFAOYSA-N 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]-n-propylpyridine-2-carboxamide Chemical compound CCCNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 PIYPUGUVIWSELE-UHFFFAOYSA-N 0.000 claims description 2
- GPRFZPJQJHSGHC-UHFFFAOYSA-N 3-[[4-(furan-2-ylmethyl)naphthalene-1-carbonyl]amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical class N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CC=3OC=CC=3)=CC=2)C=1C(=O)NCC1CCOCC1 GPRFZPJQJHSGHC-UHFFFAOYSA-N 0.000 claims description 2
- VTZXPPPNAXBVAZ-UHFFFAOYSA-N 3-[[4-(furan-3-ylmethyl)naphthalene-1-carbonyl]amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical class N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CC3=COC=C3)=CC=2)C=1C(=O)NCC1CCOCC1 VTZXPPPNAXBVAZ-UHFFFAOYSA-N 0.000 claims description 2
- DZGSVZGJAXDUFF-UHFFFAOYSA-N 3-[[4-(methoxymethyl)naphthalene-1-carbonyl]amino]-n-(piperidin-2-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(COC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCN1 DZGSVZGJAXDUFF-UHFFFAOYSA-N 0.000 claims description 2
- PYYUZMAIHXCAOH-UHFFFAOYSA-N 3-[[4-(methylcarbamoylamino)naphthalene-1-carbonyl]amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(NC(=O)NC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 PYYUZMAIHXCAOH-UHFFFAOYSA-N 0.000 claims description 2
- 230000036506 anxiety Effects 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- YVIRVYMEHBTTNM-UHFFFAOYSA-N methyl 4-[[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]carbamoyl]naphthalene-1-carboxylate Chemical compound C12=CC=CC=C2C(C(=O)OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 YVIRVYMEHBTTNM-UHFFFAOYSA-N 0.000 claims description 2
- RHAHSVNEMOATCD-UHFFFAOYSA-N methyl n-[4-[[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]carbamoyl]naphthalen-1-yl]carbamate Chemical compound C12=CC=CC=C2C(NC(=O)OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 RHAHSVNEMOATCD-UHFFFAOYSA-N 0.000 claims description 2
- LARIXSJSSZHGON-UHFFFAOYSA-N n-(2-hydroxybutyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound CCC(O)CNC(=O)C1=NC=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 LARIXSJSSZHGON-UHFFFAOYSA-N 0.000 claims description 2
- JFHCHCDOJYXFKF-UHFFFAOYSA-N n-(2-hydroxypropyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound CC(O)CNC(=O)C1=NC=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 JFHCHCDOJYXFKF-UHFFFAOYSA-N 0.000 claims description 2
- PMIQFKNQCQUSQE-UHFFFAOYSA-N n-(2-methylcyclohexyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound CC1CCCCC1NC(=O)C1=NC=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 PMIQFKNQCQUSQE-UHFFFAOYSA-N 0.000 claims description 2
- KCJDUZSSGMLDHM-UHFFFAOYSA-N n-(2-morpholin-4-ylethyl)-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3N=NC=C3)=CC=2)C=1C(=O)NCCN1CCOCC1 KCJDUZSSGMLDHM-UHFFFAOYSA-N 0.000 claims description 2
- RTCXPBXXQNKARH-UHFFFAOYSA-N n-(3-methylcyclohexyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound C1C(C)CCCC1NC(=O)C1=NC=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 RTCXPBXXQNKARH-UHFFFAOYSA-N 0.000 claims description 2
- IGIXZNJAGJYDSM-UHFFFAOYSA-N n-(4,4-difluorocyclohexyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound C1CC(F)(F)CCC1NC(=O)C1=NC=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 IGIXZNJAGJYDSM-UHFFFAOYSA-N 0.000 claims description 2
- SLJQPYMEJNSSMO-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-(2,3-dihydro-1-benzofuran-7-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C=3OCCC=3C=CC=2)C=1C(=O)NCC1CCC1 SLJQPYMEJNSSMO-UHFFFAOYSA-N 0.000 claims description 2
- BVUSERPNZRESAL-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[(2-morpholin-4-ylbenzoyl)amino]pyridine-2-carboxamide Chemical compound C=1C=CC=C(N2CCOCC2)C=1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 BVUSERPNZRESAL-UHFFFAOYSA-N 0.000 claims description 2
- CBCSPLKLZAGCJJ-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[(3-methoxy-2-methylbenzoyl)amino]pyridine-2-carboxamide Chemical compound COC1=CC=CC(C(=O)NC=2C(=NC=CC=2)C(=O)NCC2CCC2)=C1C CBCSPLKLZAGCJJ-UHFFFAOYSA-N 0.000 claims description 2
- UCEMSZVINWRLDG-UHFFFAOYSA-N n-(cyclohexylmethyl)-3-(2,2-dimethylbutanoylamino)pyridine-2-carboxamide Chemical compound CCC(C)(C)C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 UCEMSZVINWRLDG-UHFFFAOYSA-N 0.000 claims description 2
- PBTDQKYISORJJJ-UHFFFAOYSA-N n-(cyclohexylmethyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 PBTDQKYISORJJJ-UHFFFAOYSA-N 0.000 claims description 2
- OYFPPUSQEUQUJG-UHFFFAOYSA-N n-(cyclohexylmethyl)-3-[(4-piperidin-1-ylnaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(N3CCCCC3)=CC=2)C=1C(=O)NCC1CCCCC1 OYFPPUSQEUQUJG-UHFFFAOYSA-N 0.000 claims description 2
- LCBWYRHRBJZWMY-UHFFFAOYSA-N n-(cyclohexylmethyl)-6-oxo-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]-1h-pyridine-2-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=NC(O)=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1C=CN=N1 LCBWYRHRBJZWMY-UHFFFAOYSA-N 0.000 claims description 2
- ZOZRMNBLMILCFH-UHFFFAOYSA-N n-(cyclohexylmethyl)-6-propoxy-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=NC(OCCC)=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1C=CN=N1 ZOZRMNBLMILCFH-UHFFFAOYSA-N 0.000 claims description 2
- WHBOJVFKTIIVRU-UHFFFAOYSA-N n-(cyclopentylmethyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCC1 WHBOJVFKTIIVRU-UHFFFAOYSA-N 0.000 claims description 2
- ISWTXZPOIIIYED-UHFFFAOYSA-N n-(cyclopentylmethyl)-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical class N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3N=NC=C3)=CC=2)C=1C(=O)NCC1CCCC1 ISWTXZPOIIIYED-UHFFFAOYSA-N 0.000 claims description 2
- XSOXOZXVTFHJNU-UHFFFAOYSA-N n-(cyclopropylmethyl)-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical class N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3N=NC=C3)=CC=2)C=1C(=O)NCC1CC1 XSOXOZXVTFHJNU-UHFFFAOYSA-N 0.000 claims description 2
- NYTCFSSBHSKDDG-UHFFFAOYSA-N n-(oxan-4-yl)-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C=1C=C(CN2N=NC=C2)C2=CC=CC=C2C=1C(=O)NC1=CC=CN=C1C(=O)NC1CCOCC1 NYTCFSSBHSKDDG-UHFFFAOYSA-N 0.000 claims description 2
- TWXOGHMRZBYJPG-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[(4-propan-2-ylnaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(C(C)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 TWXOGHMRZBYJPG-UHFFFAOYSA-N 0.000 claims description 2
- HOJKUZOUAWHQAD-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(pyrazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3N=CC=C3)=CC=2)C=1C(=O)NCC1CCOCC1 HOJKUZOUAWHQAD-UHFFFAOYSA-N 0.000 claims description 2
- LYBJHGWZLOUVDV-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(tetrazol-2-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3N=NC=N3)=CC=2)C=1C(=O)NCC1CCOCC1 LYBJHGWZLOUVDV-UHFFFAOYSA-N 0.000 claims description 2
- YMGMNNWGQQLOSV-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(thiophen-2-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical class N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CC=3SC=CC=3)=CC=2)C=1C(=O)NCC1CCOCC1 YMGMNNWGQQLOSV-UHFFFAOYSA-N 0.000 claims description 2
- QKCQFGFHEGWTKJ-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(thiophen-3-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical class N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CC3=CSC=C3)=CC=2)C=1C(=O)NCC1CCOCC1 QKCQFGFHEGWTKJ-UHFFFAOYSA-N 0.000 claims description 2
- GGFVEQDPRPOPHA-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(triazolo[4,5-b]pyridin-3-yloxymethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CON3C4=NC=CC=C4N=N3)=CC=2)C=1C(=O)NCC1CCOCC1 GGFVEQDPRPOPHA-UHFFFAOYSA-N 0.000 claims description 2
- OYHBJFIHTWNNAT-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-6-oxo-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]-1h-pyridine-2-carboxamide Chemical compound C1COCCC1CNC(=O)C1=NC(O)=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1C=CN=N1 OYHBJFIHTWNNAT-UHFFFAOYSA-N 0.000 claims description 2
- GNFZKVZAALHECH-UHFFFAOYSA-N n-[(3,5-difluorophenyl)methyl]-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound FC1=CC(F)=CC(CNC(=O)C=2C(=CC=CN=2)NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1 GNFZKVZAALHECH-UHFFFAOYSA-N 0.000 claims description 2
- XDAVPJKKUQBJRX-UHFFFAOYSA-N n-[2-(cyclobutylmethylcarbamoyl)pyridin-3-yl]isoquinoline-5-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=NC=C3C=CC=2)C=1C(=O)NCC1CCC1 XDAVPJKKUQBJRX-UHFFFAOYSA-N 0.000 claims description 2
- NQPGPOHDYDEIQR-UHFFFAOYSA-N n-[2-(cyclobutylmethylcarbamoyl)pyridin-3-yl]quinoline-4-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3N=CC=2)C=1C(=O)NCC1CCC1 NQPGPOHDYDEIQR-UHFFFAOYSA-N 0.000 claims description 2
- VBPNWQKUNWZVKD-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)pyridin-3-yl]-5-phenyl-1,3-oxazole-4-carboxamide Chemical compound N1=COC(C=2C=CC=CC=2)=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 VBPNWQKUNWZVKD-UHFFFAOYSA-N 0.000 claims description 2
- KYPNCSJGUJSABJ-UHFFFAOYSA-N n-[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]-5-phenyl-1,3-oxazole-4-carboxamide Chemical compound N1=COC(C=2C=CC=CC=2)=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 KYPNCSJGUJSABJ-UHFFFAOYSA-N 0.000 claims description 2
- BKBVWILGJVXXOW-UHFFFAOYSA-N n-[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]quinoline-5-carboxamide Chemical compound C=1C=CC2=NC=CC=C2C=1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 BKBVWILGJVXXOW-UHFFFAOYSA-N 0.000 claims description 2
- HMBQBVHZXZQSDC-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound CN(C)CCCNC(=O)C1=NC=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 HMBQBVHZXZQSDC-UHFFFAOYSA-N 0.000 claims description 2
- OBTBGDMLHJNRNY-UHFFFAOYSA-N n-butyl-3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound CCCCNC(=O)C1=NC=CC=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 OBTBGDMLHJNRNY-UHFFFAOYSA-N 0.000 claims description 2
- XOTVMZDKMSBGTN-UHFFFAOYSA-N n-cyclobutyl-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1CCC1 XOTVMZDKMSBGTN-UHFFFAOYSA-N 0.000 claims description 2
- NMBRMOJOXGTBEK-UHFFFAOYSA-N n-cyclobutyloxy-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NOC1CCC1 NMBRMOJOXGTBEK-UHFFFAOYSA-N 0.000 claims description 2
- ABDIEAAIQZLQRN-UHFFFAOYSA-N n-cyclohexyl-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1CCCCC1 ABDIEAAIQZLQRN-UHFFFAOYSA-N 0.000 claims description 2
- UNUBAFYAUIJTPB-UHFFFAOYSA-N n-cyclohexyloxy-3-[(4-methoxynaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NOC1CCCCC1 UNUBAFYAUIJTPB-UHFFFAOYSA-N 0.000 claims description 2
- BFQGHLUCKSXDSL-UHFFFAOYSA-N n-cyclopentyl-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1CCCC1 BFQGHLUCKSXDSL-UHFFFAOYSA-N 0.000 claims description 2
- AQNMMCFHGOXKOW-UHFFFAOYSA-N n-hexyl-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound CCCCCCNC(=O)C1=NC=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 AQNMMCFHGOXKOW-UHFFFAOYSA-N 0.000 claims description 2
- WVAVRARATCNTCC-UHFFFAOYSA-N n-morpholin-4-yl-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NN1CCOCC1 WVAVRARATCNTCC-UHFFFAOYSA-N 0.000 claims description 2
- BJVRGBKOBQZKBD-UHFFFAOYSA-N naphthalene-1,4-dicarboxamide Chemical compound C1=CC=C2C(C(=O)N)=CC=C(C(N)=O)C2=C1 BJVRGBKOBQZKBD-UHFFFAOYSA-N 0.000 claims description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 22
- VAFYJJFBKRRXDW-UHFFFAOYSA-N 3-[(4-methoxynaphthalene-1-carbonyl)amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 VAFYJJFBKRRXDW-UHFFFAOYSA-N 0.000 claims 1
- GZJWVIHFFWCOPK-UHFFFAOYSA-N 3-[(4-methylnaphthalene-1-carbonyl)amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 GZJWVIHFFWCOPK-UHFFFAOYSA-N 0.000 claims 1
- CAZHXNNYYXIULX-UHFFFAOYSA-N 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(N(C)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 CAZHXNNYYXIULX-UHFFFAOYSA-N 0.000 claims 1
- 208000014540 Functional gastrointestinal disease Diseases 0.000 claims 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 claims 1
- NKYGPVHUUJNTHN-UHFFFAOYSA-N n-(2-morpholin-4-ylethyl)-3-(naphthalene-1-carbonylamino)pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCN1CCOCC1 NKYGPVHUUJNTHN-UHFFFAOYSA-N 0.000 claims 1
- CGKNXYLMHVZHGW-UHFFFAOYSA-N n-(cyclohexylmethyl)-3-[(4-methylnaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 CGKNXYLMHVZHGW-UHFFFAOYSA-N 0.000 claims 1
- PGLZEIQXGXEQQU-UHFFFAOYSA-N n-(cyclohexylmethyl)-3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(N(C)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 PGLZEIQXGXEQQU-UHFFFAOYSA-N 0.000 claims 1
- AAFFDQOFVABLEN-UHFFFAOYSA-N n-[2-(oxan-4-ylmethylcarbamoyl)pyridin-3-yl]isoquinoline-5-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=NC=C3C=CC=2)C=1C(=O)NCC1CCOCC1 AAFFDQOFVABLEN-UHFFFAOYSA-N 0.000 claims 1
- 229960005206 pyrazinamide Drugs 0.000 claims 1
- 238000004007 reversed phase HPLC Methods 0.000 description 127
- 238000000746 purification Methods 0.000 description 118
- 239000000243 solution Substances 0.000 description 61
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 58
- 230000008569 process Effects 0.000 description 57
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 56
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 33
- 235000019439 ethyl acetate Nutrition 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 26
- 102000005962 receptors Human genes 0.000 description 26
- 108020003175 receptors Proteins 0.000 description 26
- 239000000460 chlorine Substances 0.000 description 25
- 150000001412 amines Chemical class 0.000 description 22
- 239000007787 solid Substances 0.000 description 21
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 19
- OINCNOOVPFDMMQ-UHFFFAOYSA-N 2-naphthalen-1-ylpyrido[3,2-d][1,3]oxazin-4-one Chemical compound C1=CC=C2C(C=3OC(C4=NC=CC=C4N=3)=O)=CC=CC2=C1 OINCNOOVPFDMMQ-UHFFFAOYSA-N 0.000 description 18
- 238000002360 preparation method Methods 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- JANIAKSZFCVIDZ-UHFFFAOYSA-N methyl 3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxylate Chemical compound COC(=O)C1=NC=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 JANIAKSZFCVIDZ-UHFFFAOYSA-N 0.000 description 17
- 230000002265 prevention Effects 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 15
- 239000000843 powder Substances 0.000 description 15
- 239000011734 sodium Substances 0.000 description 15
- 239000004215 Carbon black (E152) Substances 0.000 description 14
- 229910052799 carbon Inorganic materials 0.000 description 14
- 229930195733 hydrocarbon Natural products 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 150000003254 radicals Chemical class 0.000 description 12
- 239000007821 HATU Substances 0.000 description 11
- 125000004429 atom Chemical group 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 10
- MTHHQLAEPQYLLL-UHFFFAOYSA-N 2-[4-(dimethylamino)naphthalen-1-yl]pyrido[3,2-d][1,3]oxazin-4-one Chemical compound C12=CC=CC=C2C(N(C)C)=CC=C1C1=NC2=CC=CN=C2C(=O)O1 MTHHQLAEPQYLLL-UHFFFAOYSA-N 0.000 description 9
- 0 CN(*)C(C(C(NC(*)=O)=C(*)*)=I)=O Chemical compound CN(*)C(C(C(NC(*)=O)=C(*)*)=I)=O 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- 239000000556 agonist Substances 0.000 description 9
- 150000001721 carbon Chemical class 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- OMRRNLMAFFRENT-UHFFFAOYSA-N 2-(4-methoxynaphthalen-1-yl)pyrido[3,2-d][1,3]oxazin-4-one Chemical compound C12=CC=CC=C2C(OC)=CC=C1C1=NC2=CC=CN=C2C(=O)O1 OMRRNLMAFFRENT-UHFFFAOYSA-N 0.000 description 8
- SKGNCOASCQEHNC-UHFFFAOYSA-N 3-amino-n-(cyclobutylmethyl)pyridine-2-carboxamide Chemical compound NC1=CC=CN=C1C(=O)NCC1CCC1 SKGNCOASCQEHNC-UHFFFAOYSA-N 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- 125000005997 bromomethyl group Chemical group 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 8
- 238000002953 preparative HPLC Methods 0.000 description 8
- 125000004076 pyridyl group Chemical group 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 7
- AVKNGPAMCBSNSO-UHFFFAOYSA-N cyclohexylmethanamine Chemical compound NCC1CCCCC1 AVKNGPAMCBSNSO-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 125000006413 ring segment Chemical group 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- SQDCHXNKRDXUSH-UHFFFAOYSA-N 2-(4-methylnaphthalen-1-yl)pyrido[3,2-d][1,3]oxazin-4-one Chemical compound C12=CC=CC=C2C(C)=CC=C1C1=NC2=CC=CN=C2C(=O)O1 SQDCHXNKRDXUSH-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 125000002883 imidazolyl group Chemical group 0.000 description 6
- 125000000842 isoxazolyl group Chemical group 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- IPBPLHNLRKRLPJ-UHFFFAOYSA-N oxan-4-ylmethanamine Chemical compound NCC1CCOCC1 IPBPLHNLRKRLPJ-UHFFFAOYSA-N 0.000 description 6
- 125000003373 pyrazinyl group Chemical group 0.000 description 6
- 125000003226 pyrazolyl group Chemical group 0.000 description 6
- 125000002098 pyridazinyl group Chemical group 0.000 description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 description 6
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 6
- 125000000168 pyrrolyl group Chemical group 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- HDHZAWXMHVHQID-UHFFFAOYSA-N 2-naphthalen-1-ylpyrido[4,3-d][1,3]oxazin-4-one Chemical compound C1=CC=C2C(C=3OC(C4=CN=CC=C4N=3)=O)=CC=CC2=C1 HDHZAWXMHVHQID-UHFFFAOYSA-N 0.000 description 5
- OVKKAXFZNAYLAC-UHFFFAOYSA-N 3-[[4-(bromomethyl)naphthalene-1-carbonyl]amino]-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(CBr)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCOCC1 OVKKAXFZNAYLAC-UHFFFAOYSA-N 0.000 description 5
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 5
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 5
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- 150000003857 carboxamides Chemical class 0.000 description 5
- 210000003169 central nervous system Anatomy 0.000 description 5
- LQNHRNOPWKZUSN-UHFFFAOYSA-N cyclobutylmethanamine Chemical compound NCC1CCC1 LQNHRNOPWKZUSN-UHFFFAOYSA-N 0.000 description 5
- UBLYEVLMRSPMOG-UHFFFAOYSA-N cyclopentylmethanamine Chemical compound NCC1CCCC1 UBLYEVLMRSPMOG-UHFFFAOYSA-N 0.000 description 5
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 5
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 125000001188 haloalkyl group Chemical group 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 125000001786 isothiazolyl group Chemical group 0.000 description 5
- HXDBXPXFGDGKCF-UHFFFAOYSA-N methyl 3-[(4-ethylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate Chemical compound C12=CC=CC=C2C(CC)=CC=C1C(=O)NC1=NC=CN=C1C(=O)OC HXDBXPXFGDGKCF-UHFFFAOYSA-N 0.000 description 5
- 230000002441 reversible effect Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 4
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 4
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 4
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 4
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 4
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 4
- FCFZSEISXMJVOL-UHFFFAOYSA-N 2-naphthalen-1-ylpyrazino[2,3-d][1,3]oxazin-4-one Chemical compound C1=CC=C2C(C=3OC(C4=NC=CN=C4N=3)=O)=CC=CC2=C1 FCFZSEISXMJVOL-UHFFFAOYSA-N 0.000 description 4
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000000641 acridinyl group Chemical class C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 4
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 description 4
- 230000027455 binding Effects 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- 125000000609 carbazolyl group Chemical class C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 4
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 4
- 125000003636 chemical group Chemical group 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 231100000673 dose–response relationship Toxicity 0.000 description 4
- 201000006549 dyspepsia Diseases 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 210000000111 lower esophageal sphincter Anatomy 0.000 description 4
- BMCANQUUVMKUHM-UHFFFAOYSA-N methyl 3-[(4-methylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=CN=C1NC(=O)C1=CC=C(C)C2=CC=CC=C12 BMCANQUUVMKUHM-UHFFFAOYSA-N 0.000 description 4
- ZPPZUHXOQWQCCR-UHFFFAOYSA-N methyl 3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=CN=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 ZPPZUHXOQWQCCR-UHFFFAOYSA-N 0.000 description 4
- 125000002757 morpholinyl group Chemical group 0.000 description 4
- 125000002971 oxazolyl group Chemical group 0.000 description 4
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 125000003386 piperidinyl group Chemical group 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 4
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 4
- 125000003831 tetrazolyl group Chemical group 0.000 description 4
- 125000001544 thienyl group Chemical group 0.000 description 4
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 description 3
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 3
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 3
- YOPWKFYATWRNOY-UHFFFAOYSA-N 3-amino-n-(cyclohexylmethyl)pyridine-2-carboxamide Chemical compound NC1=CC=CN=C1C(=O)NCC1CCCCC1 YOPWKFYATWRNOY-UHFFFAOYSA-N 0.000 description 3
- KVYOJAJKARXFFT-UHFFFAOYSA-N 3-amino-n-(oxan-4-ylmethyl)pyridine-2-carboxamide Chemical compound NC1=CC=CN=C1C(=O)NCC1CCOCC1 KVYOJAJKARXFFT-UHFFFAOYSA-N 0.000 description 3
- ZLXOZMMXMZHKHP-UHFFFAOYSA-N 4-[[2-(cyclobutylmethylcarbamoyl)pyridin-3-yl]carbamoyl]naphthalene-1-carboxylic acid Chemical compound C12=CC=CC=C2C(C(=O)O)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 ZLXOZMMXMZHKHP-UHFFFAOYSA-N 0.000 description 3
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 206010058019 Cancer Pain Diseases 0.000 description 3
- 208000000094 Chronic Pain Diseases 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- KYIKRXIYLAGAKQ-UHFFFAOYSA-N abcn Chemical compound C1CCCCC1(C#N)N=NC1(C#N)CCCCC1 KYIKRXIYLAGAKQ-UHFFFAOYSA-N 0.000 description 3
- 208000005298 acute pain Diseases 0.000 description 3
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 description 3
- 125000003725 azepanyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 description 3
- 125000002632 imidazolidinyl group Chemical group 0.000 description 3
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 208000004296 neuralgia Diseases 0.000 description 3
- 208000021722 neuropathic pain Diseases 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 125000004585 polycyclic heterocycle group Chemical group 0.000 description 3
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 3
- 125000002755 pyrazolinyl group Chemical group 0.000 description 3
- 125000001422 pyrrolinyl group Chemical group 0.000 description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 208000011117 substance-related disease Diseases 0.000 description 3
- 125000006223 tetrahydrofuranylmethyl group Chemical group 0.000 description 3
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 3
- 125000006173 tetrahydropyranylmethyl group Chemical group 0.000 description 3
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 3
- 230000001052 transient effect Effects 0.000 description 3
- 125000004306 triazinyl group Chemical group 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 2
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 2
- OFFSPAZVIVZPHU-UHFFFAOYSA-N 1-benzofuran-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)=CC2=C1 OFFSPAZVIVZPHU-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 2
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- IKGWMVDEMORLCD-UHFFFAOYSA-N 2-(4-ethylnaphthalen-1-yl)pyrido[3,2-d][1,3]oxazin-4-one Chemical compound C12=CC=CC=C2C(CC)=CC=C1C1=NC2=CC=CN=C2C(=O)O1 IKGWMVDEMORLCD-UHFFFAOYSA-N 0.000 description 2
- ZLSFNVQEIBAIGW-UHFFFAOYSA-N 2-(4-propan-2-ylnaphthalen-1-yl)pyrido[3,2-d][1,3]oxazin-4-one Chemical compound C12=CC=CC=C2C(C(C)C)=CC=C1C1=NC2=CC=CN=C2C(=O)O1 ZLSFNVQEIBAIGW-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- KDHWOCLBMVSZPG-UHFFFAOYSA-N 3-imidazol-1-ylpropan-1-amine Chemical compound NCCCN1C=CN=C1 KDHWOCLBMVSZPG-UHFFFAOYSA-N 0.000 description 2
- QTCZGSHBZMKWKZ-UHFFFAOYSA-N 4-[[2-(cyclohexylmethylcarbamoyl)pyridin-3-yl]carbamoyl]naphthalene-1-carboxylic acid Chemical compound C12=CC=CC=C2C(C(=O)O)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCCCC1 QTCZGSHBZMKWKZ-UHFFFAOYSA-N 0.000 description 2
- IXGMHYHWSPDNNS-UHFFFAOYSA-N 4-methylnaphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C)=CC=C(C(Cl)=O)C2=C1 IXGMHYHWSPDNNS-UHFFFAOYSA-N 0.000 description 2
- DCQCLRDFDRZOHZ-UHFFFAOYSA-N 5-(dimethylamino)naphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1C(O)=O DCQCLRDFDRZOHZ-UHFFFAOYSA-N 0.000 description 2
- BYLADISDYODORG-UHFFFAOYSA-N 5-phenyl-1,3-oxazole-4-carbonyl chloride Chemical compound N1=COC(C=2C=CC=CC=2)=C1C(=O)Cl BYLADISDYODORG-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- 208000008035 Back Pain Diseases 0.000 description 2
- 102000018208 Cannabinoid Receptor Human genes 0.000 description 2
- 108050007331 Cannabinoid receptor Proteins 0.000 description 2
- 206010010774 Constipation Diseases 0.000 description 2
- 206010012735 Diarrhoea Diseases 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 201000008197 Laryngitis Diseases 0.000 description 2
- 208000019693 Lung disease Diseases 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical compound COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 2
- BIICSDGTLAHWES-UHFFFAOYSA-N OC(c1ccc(C(Nc2cccnc2C(NCC2CCOCC2)=O)=O)c2c1cccc2)=O Chemical compound OC(c1ccc(C(Nc2cccnc2C(NCC2CCOCC2)=O)=O)c2c1cccc2)=O BIICSDGTLAHWES-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 238000005273 aeration Methods 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000005189 alkyl hydroxy group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 238000004774 atomic orbital Methods 0.000 description 2
- 239000012148 binding buffer Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000004623 carbolinyl group Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 2
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 2
- CYQFCXCEBYINGO-IAGOWNOFSA-N delta1-THC Chemical compound C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@@H]21 CYQFCXCEBYINGO-IAGOWNOFSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 206010013663 drug dependence Diseases 0.000 description 2
- 230000004064 dysfunction Effects 0.000 description 2
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 208000037824 growth disorder Diseases 0.000 description 2
- 125000000262 haloalkenyl group Chemical group 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000009396 hybridization Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- MMPGZEQOKLPLBB-UHFFFAOYSA-N methyl 3-[(4-methoxynaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=CN=C1NC(=O)C1=CC=C(OC)C2=CC=CC=C12 MMPGZEQOKLPLBB-UHFFFAOYSA-N 0.000 description 2
- INCSQLZZXBPATR-UHFFFAOYSA-N methyl 3-aminopyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=CN=C1N INCSQLZZXBPATR-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- PGRFPLNDTHKBPI-UHFFFAOYSA-N n-(cyclobutylmethyl)-3-[[4-(hydroxymethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(CO)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 PGRFPLNDTHKBPI-UHFFFAOYSA-N 0.000 description 2
- JDPBBYGVRGQALE-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(1,2,4-triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3N=CN=C3)=CC=2)C=1C(=O)NCC1CCOCC1 JDPBBYGVRGQALE-UHFFFAOYSA-N 0.000 description 2
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- KYKNGOPXRHUCHC-UHFFFAOYSA-N o-cyclohexylhydroxylamine Chemical compound NOC1CCCCC1 KYKNGOPXRHUCHC-UHFFFAOYSA-N 0.000 description 2
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 2
- 229940005483 opioid analgesics Drugs 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- AHVQYHFYQWKUKB-UHFFFAOYSA-N oxan-4-amine Chemical compound NC1CCOCC1 AHVQYHFYQWKUKB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- NIPZZXUFJPQHNH-UHFFFAOYSA-M pyrazine-2-carboxylate Chemical compound [O-]C(=O)C1=CN=CC=N1 NIPZZXUFJPQHNH-UHFFFAOYSA-M 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- RWPLUWYTWPBLER-UHFFFAOYSA-N pyridine-2-carboxamide;hydrochloride Chemical compound Cl.NC(=O)C1=CC=CC=N1 RWPLUWYTWPBLER-UHFFFAOYSA-N 0.000 description 2
- VQMSRUREDGBWKT-UHFFFAOYSA-N quinoline-4-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=NC2=C1 VQMSRUREDGBWKT-UHFFFAOYSA-N 0.000 description 2
- 239000002287 radioligand Substances 0.000 description 2
- 230000001373 regressive effect Effects 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- IRSSIQNSBCQILH-UHFFFAOYSA-N tert-butyl 3-(aminomethyl)morpholine-4-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCOCC1CN IRSSIQNSBCQILH-UHFFFAOYSA-N 0.000 description 2
- XIWIPGRANSDNOI-UHFFFAOYSA-N tert-butyl 3-[[[3-[(4-methylnaphthalene-1-carbonyl)amino]pyridine-2-carbonyl]amino]methyl]morpholine-4-carboxylate Chemical compound C12=CC=CC=C2C(C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1COCCN1C(=O)OC(C)(C)C XIWIPGRANSDNOI-UHFFFAOYSA-N 0.000 description 2
- 150000003536 tetrazoles Chemical class 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- ARYHTUPFQTUBBG-UHFFFAOYSA-N thiophen-2-ylboronic acid Chemical compound OB(O)C1=CC=CS1 ARYHTUPFQTUBBG-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 208000009935 visceral pain Diseases 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- XOFLBQFBSOEHOG-UUOKFMHZSA-N γS-GTP Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=S)[C@@H](O)[C@H]1O XOFLBQFBSOEHOG-UUOKFMHZSA-N 0.000 description 2
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- VJNGGOMRUHYAMC-UHFFFAOYSA-N (3,5-difluorophenyl)methanamine Chemical compound NCC1=CC(F)=CC(F)=C1 VJNGGOMRUHYAMC-UHFFFAOYSA-N 0.000 description 1
- LTILPSKZXNIITC-UHFFFAOYSA-N (4-morpholin-4-ylphenyl)methanamine Chemical compound C1=CC(CN)=CC=C1N1CCOCC1 LTILPSKZXNIITC-UHFFFAOYSA-N 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 description 1
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- 150000005071 1,2,4-oxadiazoles Chemical class 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical class C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- AVGHIQUXSVAJBC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.1]heptane Chemical compound C1C2CCN1NC2 AVGHIQUXSVAJBC-UHFFFAOYSA-N 0.000 description 1
- 150000005072 1,3,4-oxadiazoles Chemical class 0.000 description 1
- 150000004869 1,3,4-thiadiazoles Chemical class 0.000 description 1
- 125000000355 1,3-benzoxazolyl group Chemical class O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- CZLMRJZAHXYRIX-UHFFFAOYSA-N 1,3-dioxepane Chemical compound C1CCOCOC1 CZLMRJZAHXYRIX-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- PREOONMJIVUPMI-UHFFFAOYSA-N 1,4-dioxan-2-ylmethanamine Chemical compound NCC1COCCO1 PREOONMJIVUPMI-UHFFFAOYSA-N 0.000 description 1
- VGBAYGFELCUXBS-UHFFFAOYSA-N 1,4-dioxane-2-carboxylic acid Chemical compound OC(=O)C1COCCO1 VGBAYGFELCUXBS-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- XUSXTHMTOSFZII-UHFFFAOYSA-N 1-(aminomethyl)cyclohexan-1-ol Chemical compound NCC1(O)CCCCC1 XUSXTHMTOSFZII-UHFFFAOYSA-N 0.000 description 1
- DXIAEURKHWGAFH-UHFFFAOYSA-N 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride Chemical compound Cl.NCC1(O)CCCCC1 DXIAEURKHWGAFH-UHFFFAOYSA-N 0.000 description 1
- KODLUXHSIZOKTG-UHFFFAOYSA-N 1-aminobutan-2-ol Chemical compound CCC(O)CN KODLUXHSIZOKTG-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 1
- WHKWMTXTYKVFLK-UHFFFAOYSA-N 1-propan-2-ylpiperazine Chemical compound CC(C)N1CCNCC1 WHKWMTXTYKVFLK-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- AAQTWLBJPNLKHT-UHFFFAOYSA-N 1H-perimidine Chemical compound N1C=NC2=CC=CC3=CC=CC1=C32 AAQTWLBJPNLKHT-UHFFFAOYSA-N 0.000 description 1
- LDJUYMIFFNTKOI-UHFFFAOYSA-N 2,2-dimethylbutanoyl chloride Chemical compound CCC(C)(C)C(Cl)=O LDJUYMIFFNTKOI-UHFFFAOYSA-N 0.000 description 1
- XDIAMRVROCPPBK-UHFFFAOYSA-N 2,2-dimethylpropan-1-amine Chemical compound CC(C)(C)CN XDIAMRVROCPPBK-UHFFFAOYSA-N 0.000 description 1
- YHCUZRJTNSWYCY-UHFFFAOYSA-N 2,3,4,7-tetrahydro-1h-azepine Chemical compound C1CNCC=CC1 YHCUZRJTNSWYCY-UHFFFAOYSA-N 0.000 description 1
- OZIJESHLNXSUNE-UHFFFAOYSA-N 2,3-dihydrofuran;thiolane 1,1-dioxide Chemical compound C1CC=CO1.O=S1(=O)CCCC1 OZIJESHLNXSUNE-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- GSUPYHWEFVSXBA-UHFFFAOYSA-N 2,5-dihydrofuran;oxolane Chemical compound C1CCOC1.C1OCC=C1 GSUPYHWEFVSXBA-UHFFFAOYSA-N 0.000 description 1
- IDWZESHNJMMWTR-UHFFFAOYSA-N 2-(1,2,4-triazol-1-yl)ethanamine Chemical compound NCCN1C=NC=N1 IDWZESHNJMMWTR-UHFFFAOYSA-N 0.000 description 1
- ZEMZPXWZVTUONV-UHFFFAOYSA-N 2-(2-dicyclohexylphosphanylphenyl)-n,n-dimethylaniline Chemical group CN(C)C1=CC=CC=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 ZEMZPXWZVTUONV-UHFFFAOYSA-N 0.000 description 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 description 1
- DPGBCDSYFWJMEN-UHFFFAOYSA-N 2-(4-methylnaphthalen-1-yl)pyrido[4,3-d][1,3]oxazin-4-one Chemical compound C12=CC=CC=C2C(C)=CC=C1C1=NC2=CC=NC=C2C(=O)O1 DPGBCDSYFWJMEN-UHFFFAOYSA-N 0.000 description 1
- BZMADPOGYCRPAI-UHFFFAOYSA-N 2-(oxan-4-yl)ethanamine Chemical compound NCCC1CCOCC1 BZMADPOGYCRPAI-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- HFACYWDPMNWMIW-UHFFFAOYSA-N 2-cyclohexylethanamine Chemical compound NCCC1CCCCC1 HFACYWDPMNWMIW-UHFFFAOYSA-N 0.000 description 1
- BPGIOCZAQDIBPI-UHFFFAOYSA-N 2-ethoxyethanamine Chemical compound CCOCCN BPGIOCZAQDIBPI-UHFFFAOYSA-N 0.000 description 1
- MGWAGIQQTULHGU-UHFFFAOYSA-N 2-ethylbutan-1-amine Chemical compound CCC(CC)CN MGWAGIQQTULHGU-UHFFFAOYSA-N 0.000 description 1
- YCIRHAGYEUJTFH-UHFFFAOYSA-N 2-imidazol-1-ylethanamine Chemical compound NCCN1C=CN=C1 YCIRHAGYEUJTFH-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- FEUISMYEFPANSS-UHFFFAOYSA-N 2-methylcyclohexan-1-amine Chemical compound CC1CCCCC1N FEUISMYEFPANSS-UHFFFAOYSA-N 0.000 description 1
- XUBUJTVBAXQIKG-UHFFFAOYSA-N 2-morpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1N1CCOCC1 XUBUJTVBAXQIKG-UHFFFAOYSA-N 0.000 description 1
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 1
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- VMUXSMXIQBNMGZ-UHFFFAOYSA-N 3,4-dihydrocoumarin Chemical compound C1=CC=C2OC(=O)CCC2=C1 VMUXSMXIQBNMGZ-UHFFFAOYSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- ROBYXRZPMONYQT-UHFFFAOYSA-N 3-[[4-(bromomethyl)naphthalene-1-carbonyl]amino]-n-(oxan-4-yl)pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(CBr)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NC1CCOCC1 ROBYXRZPMONYQT-UHFFFAOYSA-N 0.000 description 1
- OMHRFOFXMPLRNY-UHFFFAOYSA-N 3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 OMHRFOFXMPLRNY-UHFFFAOYSA-N 0.000 description 1
- IPPQBRCEMVFWEZ-UHFFFAOYSA-N 3-amino-n-cyclohexyloxypyridine-2-carboxamide Chemical compound NC1=CC=CN=C1C(=O)NOC1CCCCC1 IPPQBRCEMVFWEZ-UHFFFAOYSA-N 0.000 description 1
- BOOMHTFCWOJWFO-UHFFFAOYSA-N 3-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=CN=C1C(O)=O BOOMHTFCWOJWFO-UHFFFAOYSA-N 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- JYDYHSHPBDZRPU-UHFFFAOYSA-N 3-methylcyclohexan-1-amine Chemical compound CC1CCCC(N)C1 JYDYHSHPBDZRPU-UHFFFAOYSA-N 0.000 description 1
- VQPHZDDLWFHRHR-UHFFFAOYSA-N 3-methylpyrazin-2-amine Chemical compound CC1=NC=CN=C1N VQPHZDDLWFHRHR-UHFFFAOYSA-N 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- MQOFXVWAFFJFJH-UHFFFAOYSA-N 4,4-difluorocyclohexan-1-amine Chemical compound NC1CCC(F)(F)CC1 MQOFXVWAFFJFJH-UHFFFAOYSA-N 0.000 description 1
- BAKUAUDFCNFLBX-UHFFFAOYSA-N 4,7-dihydro-1,3-dioxepine Chemical compound C1OCC=CCO1 BAKUAUDFCNFLBX-UHFFFAOYSA-N 0.000 description 1
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- OHMSYGKSTBKFJP-UHFFFAOYSA-N 4-ethoxynaphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(OCC)=CC=C(C(Cl)=O)C2=C1 OHMSYGKSTBKFJP-UHFFFAOYSA-N 0.000 description 1
- AOKDTARDWHVNDE-UHFFFAOYSA-N 4-ethoxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(OCC)=CC=C(C(O)=O)C2=C1 AOKDTARDWHVNDE-UHFFFAOYSA-N 0.000 description 1
- NQGJOARSKPSTSF-UHFFFAOYSA-N 4-ethylnaphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(CC)=CC=C(C(Cl)=O)C2=C1 NQGJOARSKPSTSF-UHFFFAOYSA-N 0.000 description 1
- IKUGXOILLMFCRF-UHFFFAOYSA-N 4-iodonaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=C(I)C2=C1 IKUGXOILLMFCRF-UHFFFAOYSA-N 0.000 description 1
- DCHGODSBSWBLPE-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(OC)=CC=C(C(Cl)=O)C2=C1 DCHGODSBSWBLPE-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- XOUKDQBDXPQJJI-UHFFFAOYSA-N 5-nitronaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1[N+]([O-])=O XOUKDQBDXPQJJI-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- XRDCFMLGWYHONN-UHFFFAOYSA-N 6-methoxy-3-[[4-(triazol-1-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC(OC)=CC=C1NC(=O)C(C1=CC=CC=C11)=CC=C1CN1N=NC=C1 XRDCFMLGWYHONN-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- 125000005941 7-oxabicyclo[2.2.1]heptyl group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 208000004998 Abdominal Pain Diseases 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 208000000044 Amnesia Diseases 0.000 description 1
- 208000031091 Amnestic disease Diseases 0.000 description 1
- 108010087765 Antipain Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- MGNZXYYWBUKAII-UHFFFAOYSA-N C1C=CC=CC1 Chemical compound C1C=CC=CC1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 1
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- BZKWOAPYCCWHRW-UHFFFAOYSA-N CC(C1C(Cl)=O)C=C(C(Cl)=O)c2c1cccc2 Chemical compound CC(C1C(Cl)=O)C=C(C(Cl)=O)c2c1cccc2 BZKWOAPYCCWHRW-UHFFFAOYSA-N 0.000 description 1
- YAOOVHKBAVXJAJ-UHFFFAOYSA-N CC(CC=C1)c2c1c(C(OC1=O)=Nc3c1nccc3)ccc2C Chemical compound CC(CC=C1)c2c1c(C(OC1=O)=Nc3c1nccc3)ccc2C YAOOVHKBAVXJAJ-UHFFFAOYSA-N 0.000 description 1
- BHWGGCILSSSJQU-BFZVGAFZSA-N CC/C=C1/C(C(Nc2nccnc2C(NCC2CCOCC2)=O)=O)=CC=C/C1=C/C Chemical compound CC/C=C1/C(C(Nc2nccnc2C(NCC2CCOCC2)=O)=O)=CC=C/C1=C/C BHWGGCILSSSJQU-BFZVGAFZSA-N 0.000 description 1
- SLMUQKWDSSEUMH-UHFFFAOYSA-N CC1(C(C(NC2CCOCC2)=O)=NC=CC1)NC(c1ccc(C)c2c1cccc2)=O Chemical compound CC1(C(C(NC2CCOCC2)=O)=NC=CC1)NC(c1ccc(C)c2c1cccc2)=O SLMUQKWDSSEUMH-UHFFFAOYSA-N 0.000 description 1
- BKMKPFGXODUKNG-UHFFFAOYSA-N CCCC(CCO)NC(c1ncccc1NC(c1ccc(CBr)c2c1cccc2)=O)=O Chemical compound CCCC(CCO)NC(c1ncccc1NC(c1ccc(CBr)c2c1cccc2)=O)=O BKMKPFGXODUKNG-UHFFFAOYSA-N 0.000 description 1
- DRUKSXOWKJHZGO-UHFFFAOYSA-O CCCOCCNC(c1ncccc1NC(c1ccc(CN2[NH2+]NC=C2)c2c1cccc2)=O)=O Chemical compound CCCOCCNC(c1ncccc1NC(c1ccc(CN2[NH2+]NC=C2)c2c1cccc2)=O)=O DRUKSXOWKJHZGO-UHFFFAOYSA-O 0.000 description 1
- IPQZRDMZWJOIKA-KBEYTLSJSA-N CCO/C(/C(/C=C\CC(Nc1cccnc1C(NCC1CCCCC1)=O)O)=C)=C/C=C Chemical compound CCO/C(/C(/C=C\CC(Nc1cccnc1C(NCC1CCCCC1)=O)O)=C)=C/C=C IPQZRDMZWJOIKA-KBEYTLSJSA-N 0.000 description 1
- OMGQTVNGKKTAJM-UHFFFAOYSA-O CCc1c(C(C)(CN(C=CN)[NH3+])OCNc2c(C(OC)=O)nccc2)cccc1 Chemical compound CCc1c(C(C)(CN(C=CN)[NH3+])OCNc2c(C(OC)=O)nccc2)cccc1 OMGQTVNGKKTAJM-UHFFFAOYSA-O 0.000 description 1
- ACGVGTIWOIJXBN-UHFFFAOYSA-N CN(C)c1cccc2c1nccc2 Chemical compound CN(C)c1cccc2c1nccc2 ACGVGTIWOIJXBN-UHFFFAOYSA-N 0.000 description 1
- SGGOADALCAVYDH-XFXZXTDPSA-N CNN(Cc1ccc(C(Nc2nccnc2C(OC)=O)=O)c2c1cccc2)/C=C\N Chemical compound CNN(Cc1ccc(C(Nc2nccnc2C(OC)=O)=O)c2c1cccc2)/C=C\N SGGOADALCAVYDH-XFXZXTDPSA-N 0.000 description 1
- KOQUWEBRGTUYNL-UHFFFAOYSA-N CNc1c(C(OC)=O)nccc1 Chemical compound CNc1c(C(OC)=O)nccc1 KOQUWEBRGTUYNL-UHFFFAOYSA-N 0.000 description 1
- JADDVXWEEXKAQM-UHFFFAOYSA-N COC(c1nc(OC)ccc1NC(c1ccc(CN2NNC=C2)c2c1cccc2)=O)=O Chemical compound COC(c1nc(OC)ccc1NC(c1ccc(CN2NNC=C2)c2c1cccc2)=O)=O JADDVXWEEXKAQM-UHFFFAOYSA-N 0.000 description 1
- BMBSRIYCRSXAMV-BENRWUELSA-N COC(c1ncccc1NC(c1c(cccc2)c2c(CN(/C=C\N)N)cc1)=O)=O Chemical compound COC(c1ncccc1NC(c1c(cccc2)c2c(CN(/C=C\N)N)cc1)=O)=O BMBSRIYCRSXAMV-BENRWUELSA-N 0.000 description 1
- BMBSRIYCRSXAMV-UHFFFAOYSA-O COC(c1ncccc1NC(c1ccc(CN(C=CN)[NH3+])c2c1cccc2)=O)=O Chemical compound COC(c1ncccc1NC(c1ccc(CN(C=CN)[NH3+])c2c1cccc2)=O)=O BMBSRIYCRSXAMV-UHFFFAOYSA-O 0.000 description 1
- OIGPMRGCIQFMHH-UHFFFAOYSA-M COCCCNC(c(nccc1)c1NC(c1ccc(CN2[N-]NC=C2)c2c1cccc2)=O)=O Chemical compound COCCCNC(c(nccc1)c1NC(c1ccc(CN2[N-]NC=C2)c2c1cccc2)=O)=O OIGPMRGCIQFMHH-UHFFFAOYSA-M 0.000 description 1
- DMNABJVIHKPTNU-SIZDVMSESA-N C[C@H](Cc1c(C(Nc2cccnc2C(NCC(CCCC2)N2C(OC(C)(C)C)=O)=O)=O)c(cccc2)c2c(C[n]2nccn2)c1)C(C1NCCCC1)NC(c(nccc1)c1NC(c1ccc(C[n]2[n]ccn2)c2c1cccc2)=O)=O Chemical compound C[C@H](Cc1c(C(Nc2cccnc2C(NCC(CCCC2)N2C(OC(C)(C)C)=O)=O)=O)c(cccc2)c2c(C[n]2nccn2)c1)C(C1NCCCC1)NC(c(nccc1)c1NC(c1ccc(C[n]2[n]ccn2)c2c1cccc2)=O)=O DMNABJVIHKPTNU-SIZDVMSESA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 208000027932 Collagen disease Diseases 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 206010013654 Drug abuse Diseases 0.000 description 1
- 206010052804 Drug tolerance Diseases 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 206010021639 Incontinence Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102000018697 Membrane Proteins Human genes 0.000 description 1
- 108010052285 Membrane Proteins Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 208000016285 Movement disease Diseases 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- WFWSPQXWUCVUPX-QINSGFPZSA-N N/C=C\N(Cc1ccc(C(Nc2c(C(NCCC3CCOCC3)=O)nccc2)=O)c2c1cccc2)N Chemical compound N/C=C\N(Cc1ccc(C(Nc2c(C(NCCC3CCOCC3)=O)nccc2)=O)c2c1cccc2)N WFWSPQXWUCVUPX-QINSGFPZSA-N 0.000 description 1
- HIMCOTOLPYEKCV-LCYFTJDESA-N N/C=C\N(Cc1ccc(C(Nc2cccnc2C(NCC[n]2cncc2)=O)=O)c2c1cccc2)N Chemical compound N/C=C\N(Cc1ccc(C(Nc2cccnc2C(NCC[n]2cncc2)=O)=O)c2c1cccc2)N HIMCOTOLPYEKCV-LCYFTJDESA-N 0.000 description 1
- XIMBESZRBTVIOD-RXMQYKEDSA-N NC([C@@H]1NCCCC1)=O Chemical compound NC([C@@H]1NCCCC1)=O XIMBESZRBTVIOD-RXMQYKEDSA-N 0.000 description 1
- NSLHCBKKQVZMDZ-MWLSYYOVSA-N O=C(c1ccc(CN2NNC=C2)c2c1cccc2)Nc1nccnc1C(/N=C\C1CCCCC1)=O Chemical compound O=C(c1ccc(CN2NNC=C2)c2c1cccc2)Nc1nccnc1C(/N=C\C1CCCCC1)=O NSLHCBKKQVZMDZ-MWLSYYOVSA-N 0.000 description 1
- WGKMIYCSXDHAGN-UHFFFAOYSA-N O=C(c1ccc(C[n]2nccn2)c2c1cccc2)Nc1cccnc1C(NCC1CCCCC1)=O Chemical compound O=C(c1ccc(C[n]2nccn2)c2c1cccc2)Nc1cccnc1C(NCC1CCCCC1)=O WGKMIYCSXDHAGN-UHFFFAOYSA-N 0.000 description 1
- ICFOSPXNXKHTMW-UHFFFAOYSA-N O=C(c1ccc(C[n]2nncc2)c2c1cccc2)Nc1c(C(NCC2CCCCC2)=O)nccc1 Chemical compound O=C(c1ccc(C[n]2nncc2)c2c1cccc2)Nc1c(C(NCC2CCCCC2)=O)nccc1 ICFOSPXNXKHTMW-UHFFFAOYSA-N 0.000 description 1
- CLCXQPCDWVYKSP-UHFFFAOYSA-N OC(c1ccc(C(Nc2c(C(NCC3=CCCCC3)=O)nccc2)=O)c2c1cccc2)=O Chemical compound OC(c1ccc(C(Nc2c(C(NCC3=CCCCC3)=O)nccc2)=O)c2c1cccc2)=O CLCXQPCDWVYKSP-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- QEPDEHDSMBHMPU-UHFFFAOYSA-N OCc1ccc(C(Nc2cccnc2C(NCC2CCOCC2)=O)=O)c2c1cccc2 Chemical compound OCc1ccc(C(Nc2cccnc2C(NCC2CCOCC2)=O)=O)c2c1cccc2 QEPDEHDSMBHMPU-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- CXOFVDLJLONNDW-UHFFFAOYSA-N Phenytoin Chemical group N1C(=O)NC(=O)C1(C=1C=CC=CC=1)C1=CC=CC=C1 CXOFVDLJLONNDW-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000023146 Pre-existing disease Diseases 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- 206010037423 Pulmonary oedema Diseases 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 206010067171 Regurgitation Diseases 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- 206010041247 Social fear Diseases 0.000 description 1
- 206010041349 Somnolence Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 208000030886 Traumatic Brain injury Diseases 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- IWHCPILWYLCDFI-UHFFFAOYSA-N [4-[[2-(cyclobutylmethylcarbamoyl)pyridin-3-yl]carbamoyl]naphthalen-1-yl]methyl methanesulfonate Chemical compound C12=CC=CC=C2C(COS(=O)(=O)C)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1CCC1 IWHCPILWYLCDFI-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 230000006986 amnesia Effects 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- SDNYTAYICBFYFH-TUFLPTIASA-N antipain Chemical compound NC(N)=NCCC[C@@H](C=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 SDNYTAYICBFYFH-TUFLPTIASA-N 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical class C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- 229930003827 cannabinoid Natural products 0.000 description 1
- 239000003557 cannabinoid Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 238000002059 diagnostic imaging Methods 0.000 description 1
- 238000012631 diagnostic technique Methods 0.000 description 1
- DMSHWWDRAYHEBS-UHFFFAOYSA-N dihydrocoumarin Natural products C1CC(=O)OC2=C1C=C(OC)C(OC)=C2 DMSHWWDRAYHEBS-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- PZJSZBJLOWMDRG-UHFFFAOYSA-N furan-2-ylboronic acid Chemical compound OB(O)C1=CC=CO1 PZJSZBJLOWMDRG-UHFFFAOYSA-N 0.000 description 1
- CYEFKCRAAGLNHW-UHFFFAOYSA-N furan-3-ylboronic acid Chemical compound OB(O)C=1C=COC=1 CYEFKCRAAGLNHW-UHFFFAOYSA-N 0.000 description 1
- 150000002244 furazanes Chemical class 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 238000002695 general anesthesia Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 1
- 125000006588 heterocycloalkylene group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000003983 inhalation anesthetic agent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- HEBMCVBCEDMUOF-UHFFFAOYSA-N isochromane Chemical compound C1=CC=C2COCCC2=C1 HEBMCVBCEDMUOF-UHFFFAOYSA-N 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 150000004704 methoxides Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UEWMRWKHPCJFSZ-UHFFFAOYSA-N methyl 3-[[4-(dimethylamino)naphthalene-1-carbonyl]amino]pyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=CN=C1NC(=O)C1=CC=C(N(C)C)C2=CC=CC=C12 UEWMRWKHPCJFSZ-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- XHOADYKJSBCVBJ-UHFFFAOYSA-N n,n-diethylpyrrolidin-3-amine Chemical compound CCN(CC)C1CCNC1 XHOADYKJSBCVBJ-UHFFFAOYSA-N 0.000 description 1
- PZFLPELYIKTRKR-UHFFFAOYSA-N n-(1,4-dioxan-2-ylmethyl)-3-[(4-methoxynaphthalene-1-carbonyl)amino]pyridine-2-carboxamide Chemical compound C12=CC=CC=C2C(OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1COCCO1 PZFLPELYIKTRKR-UHFFFAOYSA-N 0.000 description 1
- KJLUQFFSVMEEKH-UHFFFAOYSA-N n-(oxan-4-ylmethyl)-3-[[4-(1,2,4-triazol-4-ylmethyl)naphthalene-1-carbonyl]amino]pyridine-2-carboxamide Chemical compound N=1C=CC=C(NC(=O)C=2C3=CC=CC=C3C(CN3C=NN=C3)=CC=2)C=1C(=O)NCC1CCOCC1 KJLUQFFSVMEEKH-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000000842 neuromuscular blocking agent Substances 0.000 description 1
- 229960002715 nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- WHFMUIWBJFYAGJ-UHFFFAOYSA-N o-cyclobutylhydroxylamine Chemical compound NOC1CCC1 WHFMUIWBJFYAGJ-UHFFFAOYSA-N 0.000 description 1
- KBYLNXKSGMLDDM-UHFFFAOYSA-N o-cyclopentylhydroxylamine;hydrochloride Chemical compound Cl.NOC1CCCC1 KBYLNXKSGMLDDM-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- UHHKSVZZTYJVEG-UHFFFAOYSA-N oxepane Chemical compound C1CCCOCC1 UHHKSVZZTYJVEG-UHFFFAOYSA-N 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 125000005646 oximino group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- YNOGYQAEJGADFJ-UHFFFAOYSA-N oxolan-2-ylmethanamine Chemical compound NCC1CCCO1 YNOGYQAEJGADFJ-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 208000019906 panic disease Diseases 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000004031 partial agonist Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000005327 perimidinyl group Chemical group N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- RHPBLLCTOLJFPH-UHFFFAOYSA-N piperidin-2-ylmethanamine Chemical compound NCC1CCCCN1 RHPBLLCTOLJFPH-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000002600 positron emission tomography Methods 0.000 description 1
- 208000028173 post-traumatic stress disease Diseases 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- ALDITMKAAPLVJK-UHFFFAOYSA-N prop-1-ene;hydrate Chemical group O.CC=C ALDITMKAAPLVJK-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- RAYMXZBXQCGRGX-UHFFFAOYSA-N quinoline-5-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=N1 RAYMXZBXQCGRGX-UHFFFAOYSA-N 0.000 description 1
- LJPZHJUSICYOIX-UHFFFAOYSA-N quinolizidine Chemical class C1CCCC2CCCCN21 LJPZHJUSICYOIX-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 229910001958 silver carbonate Inorganic materials 0.000 description 1
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 208000020431 spinal cord injury Diseases 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 230000009747 swallowing Effects 0.000 description 1
- 208000016702 sympathetic nervous system disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- ROCJBBUZNKIJIK-UHFFFAOYSA-N tert-butyl 3-[[[3-[(4-methoxynaphthalene-1-carbonyl)amino]pyridine-2-carbonyl]amino]methyl]morpholine-4-carboxylate Chemical compound C12=CC=CC=C2C(OC)=CC=C1C(=O)NC1=CC=CN=C1C(=O)NCC1COCCN1C(=O)OC(C)(C)C ROCJBBUZNKIJIK-UHFFFAOYSA-N 0.000 description 1
- MFEXYOFNEVLNAE-UHFFFAOYSA-N tert-butyl n-cyclopentyloxycarbamate Chemical compound CC(C)(C)OC(=O)NOC1CCCC1 MFEXYOFNEVLNAE-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000009529 traumatic brain injury Effects 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 230000009278 visceral effect Effects 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- HQVHOQAKMCMIIM-UHFFFAOYSA-N win 55,212-2 Chemical compound C=12N3C(C)=C(C(=O)C=4C5=CC=CC=C5C=CC=4)C2=CC=CC=1OCC3CN1CCOCC1 HQVHOQAKMCMIIM-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/4965—Non-condensed pyrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/22—Anxiolytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D241/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with nitrogen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Epidemiology (AREA)
- Psychology (AREA)
- Hospice & Palliative Care (AREA)
- Cardiology (AREA)
- Psychiatry (AREA)
- Pain & Pain Management (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE0401345-4 | 2004-05-25 | ||
| SE0401345A SE0401345D0 (sv) | 2004-05-25 | 2004-05-25 | Therapeutic compounds: Pyridine as scaffold |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20070026540A true KR20070026540A (ko) | 2007-03-08 |
Family
ID=32589804
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020067024936A Withdrawn KR20070026540A (ko) | 2004-05-25 | 2005-05-20 | 치료 화합물:스캐폴드로서의 피리딘 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US20070225292A1 (enExample) |
| EP (1) | EP1756060A1 (enExample) |
| JP (1) | JP2008500336A (enExample) |
| KR (1) | KR20070026540A (enExample) |
| CN (1) | CN101001840A (enExample) |
| AR (1) | AR049110A1 (enExample) |
| AU (1) | AU2005247834A1 (enExample) |
| BR (1) | BRPI0511531A (enExample) |
| CA (1) | CA2565065A1 (enExample) |
| IL (1) | IL179149A0 (enExample) |
| MX (1) | MXPA06013538A (enExample) |
| NO (1) | NO20065878L (enExample) |
| RU (1) | RU2006145205A (enExample) |
| SE (1) | SE0401345D0 (enExample) |
| TW (1) | TW200607799A (enExample) |
| UY (1) | UY28923A1 (enExample) |
| WO (1) | WO2005115986A1 (enExample) |
| ZA (1) | ZA200609765B (enExample) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0611907D0 (en) | 2006-06-15 | 2006-07-26 | Glaxo Group Ltd | Compounds |
| EP1907374B1 (en) | 2005-07-26 | 2012-08-22 | Glaxo Group Limited | Benzylpiperazine derivatives useful for the treatment of gastrointestinal disorders |
| TW200804338A (en) * | 2005-11-24 | 2008-01-16 | Astrazeneca Ab | New compounds |
| GB0524814D0 (en) | 2005-12-05 | 2006-01-11 | Glaxo Group Ltd | Compounds |
| JP5306986B2 (ja) | 2006-03-16 | 2013-10-02 | エボテック (ユーエス) インコーポレイテッド | P2x7調節因子としてのビシクロへテロアリール化合物およびその使用 |
| US8841334B2 (en) | 2006-05-31 | 2014-09-23 | Abbvie Inc. | Compounds as cannabinoid receptor ligands and uses thereof |
| MX2008015214A (es) | 2006-05-31 | 2008-12-12 | Abbott Lab | Compuestos como ligandos de receptor canabinoide y sus usos. |
| HRP20100284T1 (hr) | 2006-06-28 | 2010-06-30 | Glaxo Group Limited | Derivati piperazinila korisni u liječenju bolesti posredovanih receptorom gpr38 |
| CN101765594A (zh) | 2007-03-28 | 2010-06-30 | 雅培制药有限公司 | 作为大麻素受体配体的1,3-噻唑-2(3h)-亚基化合物 |
| US7872033B2 (en) | 2007-04-17 | 2011-01-18 | Abbott Laboratories | Compounds as cannabinoid receptor ligands |
| MX2009012374A (es) | 2007-05-18 | 2009-12-01 | Abbott Lab | Compuestos novedosos como ligandos del receptor de canabinoides. |
| US8338623B2 (en) | 2007-07-09 | 2012-12-25 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| US9193713B2 (en) | 2007-10-12 | 2015-11-24 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| EP2070924A1 (de) | 2007-12-10 | 2009-06-17 | Bayer Schering Pharma Aktiengesellschaft | Neue 2-Hetarylthiazol-4-carbonsäureamid-Derivative, deren Herstellung und Verwendung als Arzneimittel |
| EP2070916A1 (de) | 2007-12-10 | 2009-06-17 | Bayer Schering Pharma Aktiengesellschaft | 2-Aryl-thiazol-4-carbonsäureamid-Derivate, deren Herstellung und Verwendung als Arzneimittel |
| EP2070925A1 (de) | 2007-12-10 | 2009-06-17 | Bayer Schering Pharma Aktiengesellschaft | Neue 2-substituierte Tiazol-4-carbonsäureamid-Derivative deren Herstellung und Verwendung als Arzneimittel |
| KR101257158B1 (ko) | 2008-05-23 | 2013-04-23 | 노파르티스 아게 | 단백질 티로신 키나제 억제제로서의 퀴놀린 및 퀴녹살린의 유도체 |
| US8846730B2 (en) | 2008-09-08 | 2014-09-30 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| US8859596B2 (en) | 2008-09-16 | 2014-10-14 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| PA8854001A1 (es) | 2008-12-16 | 2010-07-27 | Abbott Lab | Compuestos novedosos como ligandos de receptores de canabinoides |
| CN102665718B (zh) * | 2009-10-06 | 2016-03-09 | 米伦纽姆医药公司 | 可用作pdk1抑制剂的杂环化合物 |
| KR20140011780A (ko) * | 2012-07-19 | 2014-01-29 | 한미약품 주식회사 | 단백질 키나아제 저해활성을 갖는 이소퀴놀린-5-카복스아미드 유도체 |
| JPWO2014013951A1 (ja) * | 2012-07-19 | 2016-06-30 | 日本曹達株式会社 | ピリジン化合物および農園芸用殺菌剤 |
| AU2014347027A1 (en) | 2013-11-06 | 2016-06-23 | Bristol-Myers Squibb Company | GSK -3 inhibitors |
| KR102292433B1 (ko) | 2013-11-06 | 2021-08-20 | 브리스톨-마이어스 스큅 컴퍼니 | Gsk-3 억제제로서 유용한 치환된 피리딘 유도체 |
| JP2019131470A (ja) * | 2016-05-20 | 2019-08-08 | 石原産業株式会社 | N−(4−ピリジル)ベンズアミド化合物又はその塩を有効成分として含有する有害生物防除剤 |
| PE20191788A1 (es) | 2017-04-27 | 2019-12-24 | Ishihara Sangyo Kaisha | Compuesto de n-(4-piridil)nicotinamida o sal del mismo |
| CN107880024A (zh) * | 2017-12-11 | 2018-04-06 | 张玉玲 | 一种用于治疗炎症的大麻素受体激动剂及其合成方法 |
| US20230058312A1 (en) * | 2019-11-25 | 2023-02-23 | Gain Therapeutics Sa | Aryl and heteroaryl compounds, and therapeutic uses thereof in conditions associated with the alteration of the activity of galactocerebrosidase |
| WO2021220178A1 (en) | 2020-04-29 | 2021-11-04 | Cominnex Zrt. | Iap antagonists and their therapeutic applications |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3166627D1 (en) * | 1980-12-12 | 1984-11-15 | Thomae Gmbh Dr K | Pyrimidones, their preparation and medicines containing them |
| DE3046871A1 (de) * | 1980-12-12 | 1982-07-22 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue chinazolinone, ihre herstellung und ihre verwendung als arzneimittel |
| GB9717576D0 (en) * | 1997-08-19 | 1997-10-22 | Xenova Ltd | Pharmaceutical compounds |
| ATE509913T1 (de) * | 2001-03-05 | 2011-06-15 | Du Pont | Heterozyklische diamide zur bekämpfung wirbelloser schädlinge |
| GB0222493D0 (en) * | 2002-09-27 | 2002-11-06 | Glaxo Group Ltd | Compounds |
-
2004
- 2004-05-25 SE SE0401345A patent/SE0401345D0/xx unknown
-
2005
- 2005-05-12 TW TW094115320A patent/TW200607799A/zh unknown
- 2005-05-20 CN CNA2005800246960A patent/CN101001840A/zh active Pending
- 2005-05-20 RU RU2006145205/04A patent/RU2006145205A/ru unknown
- 2005-05-20 WO PCT/SE2005/000753 patent/WO2005115986A1/en not_active Ceased
- 2005-05-20 JP JP2007514980A patent/JP2008500336A/ja active Pending
- 2005-05-20 US US11/569,315 patent/US20070225292A1/en not_active Abandoned
- 2005-05-20 AU AU2005247834A patent/AU2005247834A1/en not_active Abandoned
- 2005-05-20 BR BRPI0511531-0A patent/BRPI0511531A/pt not_active Application Discontinuation
- 2005-05-20 MX MXPA06013538A patent/MXPA06013538A/es unknown
- 2005-05-20 KR KR1020067024936A patent/KR20070026540A/ko not_active Withdrawn
- 2005-05-20 EP EP05745177A patent/EP1756060A1/en not_active Withdrawn
- 2005-05-20 CA CA002565065A patent/CA2565065A1/en not_active Abandoned
- 2005-05-23 AR ARP050102119A patent/AR049110A1/es not_active Application Discontinuation
- 2005-05-25 UY UY28923A patent/UY28923A1/es not_active Application Discontinuation
-
2006
- 2006-11-09 IL IL179149A patent/IL179149A0/en unknown
- 2006-11-23 ZA ZA200609765A patent/ZA200609765B/xx unknown
- 2006-12-18 NO NO20065878A patent/NO20065878L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| WO2005115986A1 (en) | 2005-12-08 |
| EP1756060A1 (en) | 2007-02-28 |
| MXPA06013538A (es) | 2007-01-26 |
| UY28923A1 (es) | 2005-12-30 |
| NO20065878L (no) | 2007-02-21 |
| TW200607799A (en) | 2006-03-01 |
| ZA200609765B (en) | 2008-08-27 |
| CA2565065A1 (en) | 2005-12-08 |
| IL179149A0 (en) | 2007-03-08 |
| US20070225292A1 (en) | 2007-09-27 |
| JP2008500336A (ja) | 2008-01-10 |
| AR049110A1 (es) | 2006-06-28 |
| BRPI0511531A (pt) | 2008-01-02 |
| CN101001840A (zh) | 2007-07-18 |
| SE0401345D0 (sv) | 2004-05-25 |
| AU2005247834A1 (en) | 2005-12-08 |
| RU2006145205A (ru) | 2008-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20070026540A (ko) | 치료 화합물:스캐폴드로서의 피리딘 | |
| AU2005247835A1 (en) | Therapeutic compounds | |
| KR101170184B1 (ko) | 벤즈이미다졸 유도체, 그를 포함하는 조성물, 및 그의 제조방법 및 그의 용도 | |
| US20090111865A1 (en) | Benzimidazole Derivatives, Compositions Containing Them, Preparation Thereof and Uses Thereof | |
| AU2007244002A1 (en) | Compounds that are agonists of muscarinic receptors and that may be effective in treating pain, Alzheimer's disease and/or Schizophrenia | |
| US20080004288A1 (en) | Indazole Sulphonamide Derivatives | |
| KR20080109936A (ko) | 칸나비노이드 1 (cb1) 수용체 리간드로서의 벤즈이미다졸5-술폰아미드 유도체 | |
| US7517898B2 (en) | Benzimidazole derivatives, compositions containing them, preparation thereof and uses thereof | |
| KR20050049551A (ko) | 신규 화합물 | |
| US20070161619A1 (en) | Pyrroloquinoline and piperidoquinoline derivatives, preparation thereof, compositions containing them and uses thereof | |
| WO2007145563A1 (en) | Benzimidazole derivatives which are to be used as antagonist for the cb1-receptor | |
| JP2006514617A (ja) | 疼痛または胃腸障害の治療のためのフェニル−ピペリジン−4−イリデン−メチル−ベンズアミド誘導体 | |
| EP1797074A1 (en) | Compounds, compositions containing them, preparation thereof and uses thereof iiii | |
| US20070219254A1 (en) | Therapeutic Compounds: Pyridine N-Oxide Scaffold | |
| MXPA06008941A (en) | Pyrroloquinoline and piperidoquinoline derivatives, preparation thereof, compositions containing them and uses thereof | |
| KR20070022705A (ko) | 치료 화합물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20061127 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PC1203 | Withdrawal of no request for examination | ||
| WITN | Application deemed withdrawn, e.g. because no request for examination was filed or no examination fee was paid |