KR101100951B1 - 스택 장치의 제작에서 베이스 웨이퍼 관통 비아를 형성시키는 방법 - Google Patents
스택 장치의 제작에서 베이스 웨이퍼 관통 비아를 형성시키는 방법 Download PDFInfo
- Publication number
- KR101100951B1 KR101100951B1 KR1020090093329A KR20090093329A KR101100951B1 KR 101100951 B1 KR101100951 B1 KR 101100951B1 KR 1020090093329 A KR1020090093329 A KR 1020090093329A KR 20090093329 A KR20090093329 A KR 20090093329A KR 101100951 B1 KR101100951 B1 KR 101100951B1
- Authority
- KR
- South Korea
- Prior art keywords
- base wafer
- wafer
- slurry
- acid
- base
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 118
- 238000004519 manufacturing process Methods 0.000 title abstract description 12
- 239000010949 copper Substances 0.000 claims abstract description 135
- 229910052802 copper Inorganic materials 0.000 claims abstract description 91
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 90
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 67
- 239000010703 silicon Substances 0.000 claims abstract description 66
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 65
- 229910052751 metal Inorganic materials 0.000 claims abstract description 43
- 239000002184 metal Substances 0.000 claims abstract description 43
- 239000000463 material Substances 0.000 claims abstract description 27
- 235000012431 wafers Nutrition 0.000 claims description 187
- 239000002002 slurry Substances 0.000 claims description 121
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 63
- 238000005498 polishing Methods 0.000 claims description 56
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Natural products NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 38
- 239000002738 chelating agent Substances 0.000 claims description 32
- 239000003112 inhibitor Substances 0.000 claims description 32
- 230000007797 corrosion Effects 0.000 claims description 31
- 238000005260 corrosion Methods 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 26
- 239000000126 substance Substances 0.000 claims description 26
- 239000007800 oxidant agent Substances 0.000 claims description 24
- 230000004888 barrier function Effects 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 21
- 239000004471 Glycine Substances 0.000 claims description 21
- 239000000908 ammonium hydroxide Substances 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 claims description 18
- 230000001590 oxidative effect Effects 0.000 claims description 17
- 238000000227 grinding Methods 0.000 claims description 16
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 16
- 239000003082 abrasive agent Substances 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 11
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 10
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical group OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 claims description 10
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052721 tungsten Inorganic materials 0.000 claims description 6
- 239000010937 tungsten Substances 0.000 claims description 6
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 5
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 claims description 5
- 229910001923 silver oxide Inorganic materials 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 claims description 4
- 150000002989 phenols Chemical group 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 150000004968 peroxymonosulfuric acids Chemical class 0.000 claims description 2
- 150000001860 citric acid derivatives Chemical class 0.000 claims 1
- 238000005516 engineering process Methods 0.000 abstract description 4
- 239000002585 base Substances 0.000 description 92
- 239000000203 mixture Substances 0.000 description 74
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 71
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 49
- 230000008569 process Effects 0.000 description 40
- 239000010410 layer Substances 0.000 description 38
- 230000000694 effects Effects 0.000 description 24
- 235000011114 ammonium hydroxide Nutrition 0.000 description 20
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 20
- 239000012964 benzotriazole Substances 0.000 description 20
- 150000002894 organic compounds Chemical class 0.000 description 19
- 235000015165 citric acid Nutrition 0.000 description 18
- 239000004615 ingredient Substances 0.000 description 16
- 239000000377 silicon dioxide Substances 0.000 description 16
- 238000009472 formulation Methods 0.000 description 15
- 238000010979 pH adjustment Methods 0.000 description 15
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 14
- 239000008119 colloidal silica Substances 0.000 description 14
- 239000000758 substrate Substances 0.000 description 14
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 12
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 11
- 239000003002 pH adjusting agent Substances 0.000 description 11
- 239000004065 semiconductor Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- 239000004094 surface-active agent Substances 0.000 description 8
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 7
- 229910017604 nitric acid Inorganic materials 0.000 description 7
- 230000003068 static effect Effects 0.000 description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- MSMNVXKYCPHLLN-UHFFFAOYSA-N azane;oxalic acid;hydrate Chemical group N.N.O.OC(=O)C(O)=O MSMNVXKYCPHLLN-UHFFFAOYSA-N 0.000 description 6
- -1 density and hardness Chemical compound 0.000 description 6
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 5
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 239000002280 amphoteric surfactant Substances 0.000 description 5
- 239000003989 dielectric material Substances 0.000 description 5
- 238000009792 diffusion process Methods 0.000 description 5
- 238000004377 microelectronic Methods 0.000 description 5
- 230000000149 penetrating effect Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 239000003139 biocide Substances 0.000 description 4
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229910052715 tantalum Inorganic materials 0.000 description 4
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 4
- MZLGASXMSKOWSE-UHFFFAOYSA-N tantalum nitride Chemical compound [Ta]#N MZLGASXMSKOWSE-UHFFFAOYSA-N 0.000 description 4
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- NRTOMJZYCJJWKI-UHFFFAOYSA-N Titanium nitride Chemical compound [Ti]#N NRTOMJZYCJJWKI-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical compound O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 239000002086 nanomaterial Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920001451 polypropylene glycol Chemical group 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 2
- 239000005751 Copper oxide Substances 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- SEQKRHFRPICQDD-UHFFFAOYSA-N N-tris(hydroxymethyl)methylglycine Chemical compound OCC(CO)(CO)[NH2+]CC([O-])=O SEQKRHFRPICQDD-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N Valeric acid Natural products CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 229910000431 copper oxide Inorganic materials 0.000 description 2
- KCFYHBSOLOXZIF-UHFFFAOYSA-N dihydrochrysin Natural products COC1=C(O)C(OC)=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2)=C1 KCFYHBSOLOXZIF-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000004673 fluoride salts Chemical class 0.000 description 2
- LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 2
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium dioxide Chemical compound O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000002484 inorganic compounds Chemical class 0.000 description 2
- 239000011229 interlayer Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 238000002161 passivation Methods 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- KVOIJEARBNBHHP-UHFFFAOYSA-N potassium;oxido(oxo)alumane Chemical compound [K+].[O-][Al]=O KVOIJEARBNBHHP-UHFFFAOYSA-N 0.000 description 2
- 239000010970 precious metal Substances 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 229910001388 sodium aluminate Inorganic materials 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical class C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- SIQZJFKTROUNPI-UHFFFAOYSA-N 1-(hydroxymethyl)-5,5-dimethylhydantoin Chemical compound CC1(C)N(CO)C(=O)NC1=O SIQZJFKTROUNPI-UHFFFAOYSA-N 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- DOGCTUGYGZGSFX-UHFFFAOYSA-N 1-aminopropane-1,3-diol Chemical compound NC(O)CCO DOGCTUGYGZGSFX-UHFFFAOYSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- BRRSNXCXLSVPFC-UHFFFAOYSA-N 2,3,4-Trihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C(O)=C1O BRRSNXCXLSVPFC-UHFFFAOYSA-N 0.000 description 1
- GIAFURWZWWWBQT-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanol Chemical compound NCCOCCO GIAFURWZWWWBQT-UHFFFAOYSA-N 0.000 description 1
- RCTDIZASAFCTSA-UHFFFAOYSA-N 2-(benzotriazol-1-ylmethyl)butanedioic acid Chemical class C1=CC=C2N(CC(CC(=O)O)C(O)=O)N=NC2=C1 RCTDIZASAFCTSA-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 1
- XPTYFQIWAFDDML-UHFFFAOYSA-N 2-aminoacetic acid;ethanol Chemical compound CCO.NCC(O)=O.NCC(O)=O XPTYFQIWAFDDML-UHFFFAOYSA-N 0.000 description 1
- BRXKYDOLYRYHMP-UHFFFAOYSA-N 2-azaniumylethylazanium;difluoride Chemical compound F.F.NCCN BRXKYDOLYRYHMP-UHFFFAOYSA-N 0.000 description 1
- DHVLDKHFGIVEIP-UHFFFAOYSA-N 2-bromo-2-(bromomethyl)pentanedinitrile Chemical compound BrCC(Br)(C#N)CCC#N DHVLDKHFGIVEIP-UHFFFAOYSA-N 0.000 description 1
- 229940100555 2-methyl-4-isothiazolin-3-one Drugs 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- HRGUSFBJBOKSML-UHFFFAOYSA-N 3',5'-di-O-methyltricetin Chemical compound COC1=C(O)C(OC)=CC(C=2OC3=CC(O)=CC(O)=C3C(=O)C=2)=C1 HRGUSFBJBOKSML-UHFFFAOYSA-N 0.000 description 1
- 229940099451 3-iodo-2-propynylbutylcarbamate Drugs 0.000 description 1
- WYVVKGNFXHOCQV-UHFFFAOYSA-N 3-iodoprop-2-yn-1-yl butylcarbamate Chemical compound CCCCNC(=O)OCC#CI WYVVKGNFXHOCQV-UHFFFAOYSA-N 0.000 description 1
- GUUULVAMQJLDSY-UHFFFAOYSA-N 4,5-dihydro-1,2-thiazole Chemical class C1CC=NS1 GUUULVAMQJLDSY-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CMGDVUCDZOBDNL-UHFFFAOYSA-N 4-methyl-2h-benzotriazole Chemical class CC1=CC=CC2=NNN=C12 CMGDVUCDZOBDNL-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- AWQSAIIDOMEEOD-UHFFFAOYSA-N 5,5-Dimethyl-4-(3-oxobutyl)dihydro-2(3H)-furanone Chemical compound CC(=O)CCC1CC(=O)OC1(C)C AWQSAIIDOMEEOD-UHFFFAOYSA-N 0.000 description 1
- 229940100484 5-chloro-2-methyl-4-isothiazolin-3-one Drugs 0.000 description 1
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 1
- MIMUSZHMZBJBPO-UHFFFAOYSA-N 6-methoxy-8-nitroquinoline Chemical compound N1=CC=CC2=CC(OC)=CC([N+]([O-])=O)=C21 MIMUSZHMZBJBPO-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102100032919 Chromobox protein homolog 1 Human genes 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- 101000797584 Homo sapiens Chromobox protein homolog 1 Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- IDDMFNIRSJVBHE-UHFFFAOYSA-N Piscigenin Natural products COC1=C(O)C(OC)=CC(C=2C(C3=C(O)C=C(O)C=C3OC=2)=O)=C1 IDDMFNIRSJVBHE-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229910052581 Si3N4 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- UZMAPBJVXOGOFT-UHFFFAOYSA-N Syringetin Natural products COC1=C(O)C(OC)=CC(C2=C(C(=O)C3=C(O)C=C(O)C=C3O2)O)=C1 UZMAPBJVXOGOFT-UHFFFAOYSA-N 0.000 description 1
- 239000007997 Tricine buffer Substances 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- HDYRYUINDGQKMC-UHFFFAOYSA-M acetyloxyaluminum;dihydrate Chemical compound O.O.CC(=O)O[Al] HDYRYUINDGQKMC-UHFFFAOYSA-M 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 229910001618 alkaline earth metal fluoride Inorganic materials 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- MJWPFSQVORELDX-UHFFFAOYSA-K aluminium formate Chemical compound [Al+3].[O-]C=O.[O-]C=O.[O-]C=O MJWPFSQVORELDX-UHFFFAOYSA-K 0.000 description 1
- 229940009827 aluminum acetate Drugs 0.000 description 1
- DMGNPLVEZUUCBT-UHFFFAOYSA-K aluminum;propanoate Chemical compound [Al+3].CCC([O-])=O.CCC([O-])=O.CCC([O-])=O DMGNPLVEZUUCBT-UHFFFAOYSA-K 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical compound C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000003124 biologic agent Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 description 1
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- DHNRXBZYEKSXIM-UHFFFAOYSA-N chloromethylisothiazolinone Chemical compound CN1SC(Cl)=CC1=O DHNRXBZYEKSXIM-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- WSDISUOETYTPRL-UHFFFAOYSA-N dmdm hydantoin Chemical compound CC1(C)N(CO)C(=O)N(CO)C1=O WSDISUOETYTPRL-UHFFFAOYSA-N 0.000 description 1
- 238000001312 dry etching Methods 0.000 description 1
- 238000004070 electrodeposition Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 235000004515 gallic acid Nutrition 0.000 description 1
- 229940074391 gallic acid Drugs 0.000 description 1
- LRBQNJMCXXYXIU-QWKBTXIPSA-N gallotannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@H]2[C@@H]([C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-QWKBTXIPSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- MVFCKEFYUDZOCX-UHFFFAOYSA-N iron(2+);dinitrate Chemical compound [Fe+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MVFCKEFYUDZOCX-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- MOVBJUGHBJJKOW-UHFFFAOYSA-N methyl 2-amino-5-methoxybenzoate Chemical compound COC(=O)C1=CC(OC)=CC=C1N MOVBJUGHBJJKOW-UHFFFAOYSA-N 0.000 description 1
- BEGLCMHJXHIJLR-UHFFFAOYSA-N methylisothiazolinone Chemical compound CN1SC=CC1=O BEGLCMHJXHIJLR-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000003908 quality control method Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 1
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000011856 silicon-based particle Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- BMCJATLPEJCACU-UHFFFAOYSA-N tricin Natural products COc1cc(OC)c(O)c(c1)C2=CC(=O)c3c(O)cc(O)cc3O2 BMCJATLPEJCACU-UHFFFAOYSA-N 0.000 description 1
- BJAARRARQJZURR-UHFFFAOYSA-N trimethylazanium;hydroxide Chemical compound O.CN(C)C BJAARRARQJZURR-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L21/00—Processes or apparatus adapted for the manufacture or treatment of semiconductor or solid state devices or of parts thereof
- H01L21/02—Manufacture or treatment of semiconductor devices or of parts thereof
- H01L21/04—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer
- H01L21/18—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer the devices having semiconductor bodies comprising elements of Group IV of the Periodic Table or AIIIBV compounds with or without impurities, e.g. doping materials
- H01L21/30—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26
- H01L21/302—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26 to change their surface-physical characteristics or shape, e.g. etching, polishing, cutting
- H01L21/304—Mechanical treatment, e.g. grinding, polishing, cutting
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L21/00—Processes or apparatus adapted for the manufacture or treatment of semiconductor or solid state devices or of parts thereof
- H01L21/70—Manufacture or treatment of devices consisting of a plurality of solid state components formed in or on a common substrate or of parts thereof; Manufacture of integrated circuit devices or of parts thereof
- H01L21/71—Manufacture of specific parts of devices defined in group H01L21/70
- H01L21/768—Applying interconnections to be used for carrying current between separate components within a device comprising conductors and dielectrics
- H01L21/76898—Applying interconnections to be used for carrying current between separate components within a device comprising conductors and dielectrics formed through a semiconductor substrate
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09G—POLISHING COMPOSITIONS; SKI WAXES
- C09G1/00—Polishing compositions
- C09G1/02—Polishing compositions containing abrasives or grinding agents
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L21/00—Processes or apparatus adapted for the manufacture or treatment of semiconductor or solid state devices or of parts thereof
- H01L21/02—Manufacture or treatment of semiconductor devices or of parts thereof
- H01L21/04—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer
- H01L21/18—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer the devices having semiconductor bodies comprising elements of Group IV of the Periodic Table or AIIIBV compounds with or without impurities, e.g. doping materials
- H01L21/30—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26
- H01L21/302—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26 to change their surface-physical characteristics or shape, e.g. etching, polishing, cutting
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L21/00—Processes or apparatus adapted for the manufacture or treatment of semiconductor or solid state devices or of parts thereof
- H01L21/02—Manufacture or treatment of semiconductor devices or of parts thereof
- H01L21/04—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer
- H01L21/18—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer the devices having semiconductor bodies comprising elements of Group IV of the Periodic Table or AIIIBV compounds with or without impurities, e.g. doping materials
- H01L21/30—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26
- H01L21/302—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26 to change their surface-physical characteristics or shape, e.g. etching, polishing, cutting
- H01L21/306—Chemical or electrical treatment, e.g. electrolytic etching
- H01L21/30625—With simultaneous mechanical treatment, e.g. mechanico-chemical polishing
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L23/00—Details of semiconductor or other solid state devices
- H01L23/12—Mountings, e.g. non-detachable insulating substrates
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L21/00—Processes or apparatus adapted for the manufacture or treatment of semiconductor or solid state devices or of parts thereof
- H01L21/02—Manufacture or treatment of semiconductor devices or of parts thereof
- H01L21/04—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer
- H01L21/18—Manufacture or treatment of semiconductor devices or of parts thereof the devices having potential barriers, e.g. a PN junction, depletion layer or carrier concentration layer the devices having semiconductor bodies comprising elements of Group IV of the Periodic Table or AIIIBV compounds with or without impurities, e.g. doping materials
- H01L21/30—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26
- H01L21/31—Treatment of semiconductor bodies using processes or apparatus not provided for in groups H01L21/20 - H01L21/26 to form insulating layers thereon, e.g. for masking or by using photolithographic techniques; After treatment of these layers; Selection of materials for these layers
- H01L21/3205—Deposition of non-insulating-, e.g. conductive- or resistive-, layers on insulating layers; After-treatment of these layers
- H01L21/321—After treatment
- H01L21/32115—Planarisation
- H01L21/3212—Planarisation by chemical mechanical polishing [CMP]
Landscapes
- Engineering & Computer Science (AREA)
- Physics & Mathematics (AREA)
- Condensed Matter Physics & Semiconductors (AREA)
- General Physics & Mathematics (AREA)
- Computer Hardware Design (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Power Engineering (AREA)
- Manufacturing & Machinery (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Mechanical Treatment Of Semiconductor (AREA)
- Finish Polishing, Edge Sharpening, And Grinding By Specific Grinding Devices (AREA)
Abstract
Description
성분 | 실시예 1: 대조군 SR330 As-is | 실시예 2: 대조군 SR330 w/H2O2 pH 11 |
시톤® SR330(wt%, H2O2 첨가 전에 희석된 시중의 생성물) | 2.4 | 2.38 |
H2O(wt%) | 97.6 | 96.62 |
시트르산(wt%) | 0 | 0 |
카테콜(wt%) | 0 | 0 |
암모늄 히드록사이드(wt%) | 0 | 0 |
TMAH(wt%) | 0 | 0 |
콜로이드 실리카(wt%) | 0 | 0 |
H2O2(wt%) | 0 | 1 |
PIA(wt%) | 0 | 0 |
H2O2 첨가 전의 pH | ~11 | ~11 |
H2O2 첨가 후의 pH | - | ~10.8 |
7psi에서의 Cu의 제거속도(Å/min) | 60 | 32 |
7psi에서의 실리콘의 제거속도(Å/min) | 12000 | 0 |
Si:Cu 선택도 | 255 | 0 |
성분 | 실시예 3: 20675-38-2 w/1% H2O2 | 실시예 4: 20675-58-2 w/1% PIA | 실시예 5: 20675-58-3 w/3% PIA |
시톤® SR330(wt%, H2O2 첨가 전에 희석된 시중의 생성물) | 2.38 | 0 | 0 |
H2O | 96.62 | 100이 되게 하는 양 | 100이 되게 하는 양 |
HT 50 | 0 | 5 | 5 |
TMAH | 0 | 3 | 3 |
NH4OH | 0 | 0 | 0 |
구아니딘 카보네이트 | 0 | 5 | 5 |
카톤 | 0 | 0.0001 | 0.0001 |
H2O2 | 1 | 0 | 0 |
PIA | 0 | 1 | 3 |
PIA 첨가전의 pH | 10.31 | 13.34 | 13.16 |
PIA 또는 H2O2 첨가 후의 pH | 10.2 | 13.16 | 11.45 |
7psi에서의 Cu의 제거속도(Å/min) | 32 | 2476 | 4368 |
7psi에서의 실리콘의 제거속도(Å/min) | 0 | 15502 | 12466 |
Si:Cu 선택도 | 0 | 6.3 | 2.9 |
성분* | 실시예 6: pH 11 | 실시예 7: pH 7 |
콜로이드 실리카(wt%) | 5 | 5 |
PIA(wt%) | 1 | 1 |
PIA 첨가 전의 pH | 11.94 | 6.88 |
PIA 첨가 후의 pH | 10.92 | 1.77 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 5904 | 208 |
7psi, 600sec에서의 실리콘의 제거속도(Å/min) | 6317 | 4253 |
Si:Cu 선택도 | 1 | 20 |
성분 | 실시예 8: 2wt% DETA | 실시예 9: 5wt% DETA | 실시예 10 G.C. | 실시예 11: DETA | 실시예 12: TMAH |
디에틸렌트리아민 | 2 | 5 | 0 | 5 | 0 |
구아니딘 카보네이트(wt%) | 0 | 0 | 5 | 0 | 0 |
TMAH(wt%) | 0 | 0 | 3 | 3 | 3 |
EDTA 염 | 0 | 0 | 0 | 0 | 5 |
카톤(wt%) | 0 | 0 | 0.0001 | 0.0001 | 0.0001 |
콜로이드 실리카(wt%) | 5 | 5 | 0 | 5 | 5 |
HNO3 | 0 | 0 | 0 | 0 | 0 |
PIA(wt%) | 1 | 1 | 1 | 1 | 1 |
PIA 첨가 전의 pH | 11.57 | 11.74 | 13.34 | 10.98 | 13.65 |
PIA 첨가 후의 pH | 10.28 | 10.8 | 13.16 | 10.58 | 13.23 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 815 | 1092 | 2476 | 1394 | 1736 |
7psi, 600sec에서의 실리콘의 제거속도(Å/min) | 14138 | 13790 | 15502 | 13901 | 11820 |
Si:Cu 선택도 | 17 | 12.6 | 6 | 10 | 7 |
성분* | 실시예 13: | 실시예 14: | 실시예 15: | 실시예 16: |
시트르산(wt%) | 0.05 | 0 | 0 | 0.05 |
글리신(wt%) | 1 | 0 | 0 | 0 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) |
질산 | 0 | 0.05 | 0 | 0 |
아세트산 | 0 | 0 | 0.05 | 0 |
콜로이드 실리카(wt%) | 5 | 5 | 5 | 5 |
PIA(wt%) | 1 | 1 | 1 | 1 |
PIA 첨가 전 pH | 10.91 | 10.99 | 10.99 | 11 |
PIA 첨가 후 pH | 10.76 | 9.83 | 9.98 | 9.95 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | (>24000)# | 15656 | (>28000)# | 14026 |
7psi, 600sec에서의 실리콘의 제거속도(Å/min) | 16424 | 9630 | 16701 | 9781 |
Si:Cu 선택도 | 0.69 | 0.62 | 0.59 | 0.70 |
성분 | 실시예 17 | 실시예 18 | 실시예 19 |
패드 | 토마스 웨스트 711 | IC1000 | IC1010 |
시트르산(wt%) | 0.05 | 0.05 | 0.05 |
글리신(wt%) | 0.01 | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) |
콜로이드 실리카(wt%) | 5 | 5 | 5 |
PIA(wt%) | 1 | 1 | 1 |
PIA 첨가 전 pH | 10.91 | 10.91 | 10.91 |
PIA 첨가 후 pH | 10.2 | 10.2 | 10.2 |
7psi, 60sec에서의 Cu의 제거속도(Å/min) | 15260 | 14064 | 14678 |
7psi, 10min에서의 실리콘의 제거속도(Å/min) | 11590 | 12816 | 15921 |
Si:Cu 선택도 | 0.76 | 0.91 | 1.08 |
성분 | 실시예 20: 100ppm 다에텍 | 실시예 21: 100ppm DP512 | 실시예 22: 100ppm BTA | 실시예 23: 100ppm MAFO13 MOD1 | 실시예 24: 100ppm CDI4302D |
시트르산(wt%) | 0.05 | 0.05 | 0.05 | 0.05 | 0.05 |
글리신(wt%) | 0.01 | 0.01 | 0.01 | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) |
BTA(wt%) | 0 | 0 | 0.01 | 0.002 | 0.002 |
DP512 | 0 | 0.01 | 0 | 0 | 0 |
다에텍 | 0.01 | 0 | 0 | 0 | 0 |
Mafo 13MOD1 | 0 | 0 | 0 | 0.01 | 0 |
CDI4302D | 0 | 0 | 0 | 0 | 0.01 |
콜로이드 실리카(wt%) | 5 | 5 | 5 | 5 | 5 |
PIA(wt%) | 1 | 1 | 1 | 1 | 1 |
PIA 첨가 전 pH | 10.99 | 10.98 | 10.98 | 10.9 | 10.9 |
PIA 첨가 후 pH | 10.5 | 10.4 | 10.3 | 10.7 | 10.2 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 7298 | 8638 | 6874 | 9280 | 8778 |
7psi, 300sec에서의 실리콘의 제거속도(Å/min) | 13807 | 13797 | 14584 | 12484 | 15631 |
7psi, 30sec에서의 TiN의 제거속도(Å/min) | NA | NA | NA | 1768 | 1560 |
Si:Cu 선택도 | 0.53 | 0.63 | 0.47 | 0.74 | 0.56 |
성분* | 실시예 25: 10ppm MAFO | 실시예 26:25ppm MAFO | 실시예 27:50ppm MAFO | 실시예 28: 100ppm MAFO |
시트르산(wt%) | 0.05 | 0.05 | 0.05 | 0.05 |
글리신(wt%) |
0.01 | 0.01 | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) |
MAFO13MOD1 | 0.001 | 0.0025 | 0.005 | 0.01 |
콜로이드 실리카 (wt%) |
5 | 5 | 5 | 5 |
PIA(wt%) | 1 | 1 | 1 | 1 |
PIA 첨가 전 pH | 10.97 | 10.96 | 10.85 | 10.9 |
PIA 첨가 후 pH | 10.4 | 10.5 | 10.6 | 10.7 |
7psi, 30sec에서의 Cu의 제거속도(Å /min) |
10884 | 10598 | 9384 | 9280 |
7psi,300sec에서의 실리콘의 제거속도 (Å/min) |
13085 | 12847 | 11856 | 12484 |
7psi, 30sec에서의 TiN의 제거속도(Å/min) | 1042 | 1016 | 898 | 1768 |
7psi, 30sec에서의 TEOS의 제거속도(Å/min) | 1134 | 1088 | 1015 | NA |
Si:Cu 선택도 | 0.83 | 0.82 | 0.79 | 0.74 |
성분 | 실시예 29: 20ppm BTA | 실시예 30: 100ppm BTA |
시트르산(wt%) | 0.05 | 0.05 |
글리신(wt%) | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절에 충분한 양(<1.5 wt%) | pH 조절에 충분한 양(<1.5 wt%) |
BTA(wt%) | 0.002 | 0.01 |
콜로이드 실리카(wt%) | 5 | 5 |
PIA(wt%) | 1 | 1 |
PIA 첨가 전 pH | 10.97 | 10.98 |
PIA 첨가 후 pH | 10.5 | 10.3 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 10980 | 6874 |
7psi,300sec에서의 실리콘의 제거속도(Å/min) | 14081 | 14584 |
Si:Cu 선택도 | 0.78 | 0.47 |
성분 | 실시예 31: | 실시예 32: | 실시예 33: | 실시예 34: |
시트르산(wt%) | 0.05 | 0.05 | 0.05 | 0.05 |
글리신(wt%) | 0.01 | 0.01 | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) | pH 조절을 위해(<1.5 wt%) |
MAFO13MOD1 | 0.005 | 0.005 | 0.005 | 0.005 |
콜로이드 실리카 (wt%) |
5 | 5 | 5 | 5 |
PIA(wt%) | 0.1 | 0.5 | 1 | 1.25 |
PIA 첨가 전 pH | 10.98 | 10.96 | 10.85 | 10.93 |
PIA 첨가 후 pH | 10.92 | 10.8 | 10.3 | 10.5 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 2610 | 6322 | 9384 | 12082 |
7psi, 300sec에서의 실리콘의 제거속도(Å/min) | 9924 | 12078 | 11856 | 12482 |
7psi, 30sec에서의 TiN의 제거속도(Å/min) | 882 | 642 | 898 | 770 |
7psi, 30sec에서의 TEOS의 제거속도(Å/min) | 778 | 1025 | 1015 | 1245 |
Si:Cu 선택도 | 0.26 | 0.52 | 0.79 | 0.97 |
성분 | 실시예 35: | 실시예 36: | 실시예 37: |
시트르산(wt%) | 0.05 | 0.05 | 0.05 |
글리신(wt%) | 0.01 | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절을 위 해(<1.5 wt%) |
pH 조절을 위 해(<1.5 wt%) |
pH 조절을 위 해(<1.5 wt%) |
다에텍 부식 억제제(wt%) | 0.005 | 0.005 | 0.005 |
콜로이드 실리카(wt%) | 5 | 5 | 5 |
PIA(wt%) | 0.25 | 1 | 2 |
PIA 첨가 전 pH | 10.97 | 10.98 | 10.98 |
PIA 첨가 후 pH | 10.9 | 9.8 | 10.8 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 3380 | 15104 | 4790 |
7psi,300sec에서의 실리콘의 제거속도(Å/min) | 12714 | 14712 | 11281 |
7psi, 30sec에서의 TiN의 제거속도(Å/min) | 1270 | 1126 | 856 |
7psi, 30sec에서의 TEOS의 제거속도(Å/min) | 717 | 1145 | 596 |
Si:Cu 선택도 | 0.27 | 1.02 | 0.42 |
성분* | 실시예 38 |
시트르산(wt%) | 0.05 |
글리신(wt%) | 0.01 |
암모늄 옥살레이트 일수화물 | 0.05 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절을 위해(<1.5 wt%) |
BTA(wt%) | 0.002 |
콜로이드 실리카(wt%) | 5 |
PIA(wt%) | 1 |
PIA 첨가 전 pH | 10.93 |
PIA 첨가 후 pH | 9.88 |
7psi, 60sec에서의 Cu의 제거속도(Å/min) | 14486 |
7psi, 10min에서의 실리콘의 제거속도(Å/min) | 15953 |
Si:Cu 선택도 | 0.91 |
성분* | 실시예 39 | 실시예 40 | 실시예 41 | 실시예 42 |
시트르산(wt%) | 0.05 | 0.05 | 0.05 | 0.05 |
글리신(wt%) | 0.01 | 0.01 | 0.01 | 0.01 |
PIA 첨가 전 암모늄 히드록사이드(wt%) pH 조절제 | pH 조절을 위 해(<1.5 wt%) |
pH 조절을 위해(<1.5 wt%) | pH 조절을 위 해(<1.5 wt%) |
pH 조절을 위해(<1.5 wt%) |
BTA(wt%) | 0.002 | 0.002 | 0.002 | 0.002 |
콜로이드 실리카(wt%) | 1 | 3 | 7 | 9 |
PIA(wt%) | 1 | 1 | 1 | 1 |
PIA 첨가 전 pH | ~10.9 | ~10.9 | ~10.9 | ~10.9 |
PIA 첨가 후 pH | 10.5 | 10.4 | 10.5 | 10.6 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | 10716 | 11636 | 11438 | 10006 |
7psi,300sec에서의 실리콘의 제거속도(Å/min) | 15138 | 16350 | 16151 | 15638 |
7psi, 30sec에서의 TiN의 제거속도(Å/min) | 708 | 1076 | 1510 | 1788 |
Si:Cu 선택도 | 0.71 | 0.71 | 0.71 | 0.64 |
성분* | 실시예 43 | 실시예 44 |
시트르산(wt%) | 0 | 0 |
글리신(wt%) | 0 | 0 |
암모늄 히드록사이드(wt%) | 0 | 0 |
BTA(wt%) | 0 | 0 |
콜로이드 실리카(wt%) | 10 | 10 |
PIA(wt%) | 0 | 1 |
PIA 첨가 전 pH | 10.88 | 11.01 |
PIA 첨가 후 pH | NA | 9.1 |
7psi, 30sec에서의 Cu의 제거속도(Å/min) | <1 | 9760 |
7psi, 300sec에서의 실리콘의 제거속도(Å/min) | 3622 | 13051 |
7psi, 30sec에서의 TiN의 제거속도(Å/min) | NA | 884 |
7psi, 30sec에서의 TEOS의 제거속도(Å/min) | NA | 2387 |
Si:Cu 선택도 | 0.049 | 0.75 |
샘플 | 온도(℃) | 정적 식각률(Å/min), 2개 해독값의 평균 |
대조군: SR330 | 실온 | 2.6 |
부식억제제 비첨가 | 실온 | 102.05 |
500ppm 암모늄 옥살레이트 | 실온 | 74.7 |
100ppm BTA | 실온 | 너무 부식되어 해독 불가능 |
100ppm DP512 | 실온 | 74.7 |
100ppm 다에텍 | 실온 | 67.25 |
대조군:SR330 | 40 | 0 |
부식 억제제 비첨가 | 40 | 228.2 |
500ppm 암모늄 옥살레이트 | 40 | 너무 부식되어 해독 불가능 |
100ppm BTA | 40 | 너무 부식되어 해독 불가능 |
100ppm DP512 | 40 | 286.7 |
100ppm 다에텍 | 40 | 177.25 |
샘플 | 온도(℃) | 정적 식각률(Å/min), |
대조군 SR330 | 실온 | 0 |
50ppm MAFO, 0.1% PIA | 실온 | 50 |
50ppm MAFO, 0.5% PIA | 실온 | 116 |
50ppm MAFO, 1.25% PIA | 실온 | 512 |
대조군 SR330 | 40 | 0 |
50ppm MAFO, 0.1% PIA | 40 | 262 |
50ppm MAFO, 0.5% PIA | 40 | 277 |
50ppm MAFO, 1.25% PIA | 40 | 너무 부식되어 해독 불가능 |
슬러리 유속 | ||||
250mL/min | 200mL/min | 150mL/min | 100mL/min | |
Si | 13654 | 13656 | 14031 | 14993 |
Cu | 10144 | 9434 | 8202 | 7096 |
선택도(Cu/Si) | 0.74 | 0.69 | 0.58 | 0.47 |
Claims (31)
- 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법으로서,a) 전면 및 후면을 구비한 제 1 베이스 웨이퍼를 제공하는 단계로서, 전면이 이 위에 배치된 집적 회로를 포함하고, 베이스 웨이퍼가, 전도성 금속을 포함하며 베이스 웨이퍼의 전방으로부터 베이스 웨이퍼를 통해 부분적으로 또는 전체적으로 연장되는 하나 이상의 전도성 비아(via)를 포함하는 단계;b) 위에 집적회로를 구비한 베이스 웨이퍼의 전면을 캐리어에 고정시키는 단계;c) 베이스 웨이퍼의 후면을 연마 패드 및 제 1 CMP 슬러리와 접촉시키는 단계로서, 제 1 CMP 슬러리가1) 액체 캐리어,2) 과요오드산 또는 이의 염, 과염소산 또는 이의 염, 과황산 또는 이의 염, 과망간산 또는 이의 염, 오존, 산화은 및 불소 원소로 구성되는 군으로부터 선택된, 0.1 내지 20중량%의 산화제,3) 연마제, 및4) 하나 이상의 금속 킬레이트제를 포함하는 단계; 및d) 하나 이상의 전도성 비아가 노출될 때까지 베이스 웨이퍼의 후면을 연마시키는 단계로서, 제 1 베이스 웨이퍼가 7 psi 또는 그 미만의 하향력(down force)에서 분당 5,000 옹스트롬 이상의 속도로 제 1 CMP 슬러리를 이용하여 연마되는 단계를 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 제 1 베이스 웨이퍼가 실리콘 웨이퍼인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 전도성 금속이 구리 및 텅스텐으로 구성되는 군으로부터 선택되는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 산화제가 과요오드산 또는 이의 염, 과염소산 또는 이의 염, 및 과황산 또는 이의 염으로 구성되는 군으로부터 선택되는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 산화제가 과요오드산인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 금속 킬레이트제가 구조식 H2N-R-COOH(상기 식에서, R은 탄소수 1 내지 6개의 선형 또는 분지형 알킬 기이다)의 아미노카르복실산을 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 6항에 있어서, 금속 킬레이트제가 히드록시-카르복실산을 추가로 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 6항에 있어서, 금속 킬레이트제가 글리신인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 8항에 있어서, 금속 킬레이트제가 시트르산과 조합된 글리신인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 제 1 베이스 웨이퍼가 7 psi 또는 그 미만의 하향력으로 분당 10,000 옹스트롬 이상의 속도로 슬러리를 이용하여 연마되는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 슬러리가 0.0005 내지 0.1중량%의 부식 억제제를 추가로 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 슬러리가 0.01 내지 5중량%의 시트레이트 염을 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 슬러리가 0.01 내지 5중량%의 과요오드산, 0.3 내지 1.5중량%의 암모늄 히드록사이드를 포함하고 pH가 8 내지 14인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 액체 캐리어가 물을 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 11항에 있어서, 부식 억제제가 페놀 화합물인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 15항에 있어서, 제 1 CMP 슬러리 내의 페놀 화합물이 0.001 내지 5중량% 수준에서 존재하는 카테콜인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 전도성 금속에 대한 제 1 베이스 웨이퍼의 선택도가 0.5 내지 2.0의 범위 내인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 베이스 웨이퍼가 7 psi 또는 그 미만의 하향력으로 분당 7,500 옹스트롬 이상의 속도로 제 1 CMP 슬러리를 이용하여 연마되는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 제 1 CMP 슬러리의 pH가 염기성인, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 베이스 웨이퍼의 후면을 화학 기계적으로 연마시키기 전에 베이스 웨이퍼의 후면에 그라인딩(grinding) 단계가 실시되지 않는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 베이스 웨이퍼의 후면을 화학 기계적으로 연마시키기 전에 베이스 웨이퍼의 후면에 그라인딩 단계가 실시되는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 베이스 웨이퍼의 후면을 제 1 CMP 슬러리를 이용하여 연마시키기 전에 베이스 웨이퍼의 후면을 사전 처리 슬러리로 CMP시키는 단계를 추가로 포함하며, 상기 사전 처리 슬러리는 7 psi의 하향력으로 분당 5,000 옹스트롬 이상의 속도로 베이스 웨이퍼를 연마시키는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 전도성 금속을 포함하며 베이스 웨이퍼의 전면으로부터 연장되는 하나 이상의 전도성 비아가, 전도성 금속이 실리콘을 통해 이동하지 않도록 구성된 배리어 물질을 추가로 포함하고,상기 방법은 베이스 웨이퍼의 후면을 제 1 CMP 슬러리로 연마시킨 후에 베이스 웨이퍼의 후면을 제 2 CMP 슬러리로 연마시키는 단계로서, 상기 제 2 CMP 슬러리가 0.6 내지 1.5의, 배리어 물질에 대한 전도성 금속의 선택도를 갖는 단계를 추가로 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 하나 이상의 노출된 비아를 포함하는 제 2 베이스 웨이퍼를, 제 1 베이스 웨이퍼의 후면 상의 하나 이상의 전도성 비아로 전기적으로 접속시키는 것을 추가로 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 1항에 있어서, 제 1 베이스 웨이퍼를 연마시킨 후에 제 1 베이스 웨이퍼의 후면 상에 회로를 형성시키는 단계로서, 상기 회로의 일부 또는 전부를 제 1 베이스 웨이퍼의 후면 상의 하나 이상의 노출된 전도성 비아로 전기적으로 접속시키는 단계를 추가로 포함하는, 두 개 이상의 베이스 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법으로서,a) 전면 및 후면을 구비한 실리콘 베이스 웨이퍼를 제공하는 단계로서, 전면이 이 위에 배치된 집적 회로를 포함하고, 실리콘 베이스 웨이퍼가, 전도성 금속을 포함하며 실리콘 베이스 웨이퍼의 전방으로부터 실리콘 베이스 웨이퍼를 통해 부분적으로 또는 전체적으로 연장되는 하나 이상의 전도성 비아를 포함하는 단계;b) 실리콘 베이스 웨이퍼의 전면을 캐리어에 고정시키는 단계;c) 실리콘 베이스 웨이퍼의 후면을 연마 패드 및 제 1 CMP 슬러리와 접촉시키는 단계로서, 제 1 CMP 슬러리가1) 물,2) 0.05 내지 10중량%의 과요오드산,3) 연마제, 및4) 하나 이상의 유기 산 또는 아미노-카르복실산을 포함하는 단계; 및d) 하나 이상의 전도성 비아가 노출될 때까지 웨이퍼 후면을 연마시키는 단계로서, 제 1 CMP 슬러리가 7 psi 또는 그 미만의 하향력으로 분당 10,000 옹스트롬 이상의 속도로 실리콘을 연마시키는 단계를 포함하는, 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 26항에 있어서, 실리콘 베이스 웨이퍼의 후면을 화학 기계적으로 연마시키기 전에 실리콘 베이스 웨이퍼의 후면에 그라인딩 단계가 실시되지 않는, 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 26항에 있어서, 제 1 CMP 슬러리가 시트르산 및 글리신을 포함하는, 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 26항에 있어서, 구리에 대한 실리콘의 선택도가 0.5 내지 1.5의 범위 내인, 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 26항에 있어서, 하나 이상의 노출된 비아를 포함하는 제 2 실리콘 웨이퍼를, 제 1 베이스 웨이퍼의 후면 상의 하나 이상의 전도성 비아로 전기적으로 접속시키는 것을 추가로 포함하는, 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법.
- 제 26항에 있어서, 제 1 CMP 슬러리가 10.5 내지 11.5의 pH를 갖는, 두 개의 웨이퍼를 포함하는 조립체를 구성하는 방법.
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US12/242,002 US20100081279A1 (en) | 2008-09-30 | 2008-09-30 | Method for Forming Through-base Wafer Vias in Fabrication of Stacked Devices |
US12/242,002 | 2008-09-30 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20100037013A KR20100037013A (ko) | 2010-04-08 |
KR101100951B1 true KR101100951B1 (ko) | 2011-12-29 |
Family
ID=42057920
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020090093329A KR101100951B1 (ko) | 2008-09-30 | 2009-09-30 | 스택 장치의 제작에서 베이스 웨이퍼 관통 비아를 형성시키는 방법 |
Country Status (3)
Country | Link |
---|---|
US (1) | US20100081279A1 (ko) |
KR (1) | KR101100951B1 (ko) |
TW (1) | TW201013771A (ko) |
Families Citing this family (20)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR100829594B1 (ko) * | 2006-10-10 | 2008-05-14 | 삼성전자주식회사 | 화학 기계적 연마용 슬러리 조성물 및 이를 이용한 반도체메모리 소자의 제조 방법 |
US8506831B2 (en) * | 2008-12-23 | 2013-08-13 | Air Products And Chemicals, Inc. | Combination, method, and composition for chemical mechanical planarization of a tungsten-containing substrate |
US20110237079A1 (en) * | 2009-09-30 | 2011-09-29 | Dupont Air Products Nanomaterials Llc | Method for exposing through-base wafer vias for fabrication of stacked devices |
US10103331B2 (en) * | 2010-02-05 | 2018-10-16 | Industry-University Cooperation Foundation Hanyang University | Slurry for polishing phase-change materials and method for producing a phase-change device using same |
KR101396232B1 (ko) * | 2010-02-05 | 2014-05-19 | 한양대학교 산학협력단 | 상변화 물질 연마용 슬러리 및 이를 이용한 상변화 소자 제조 방법 |
CN102399494B (zh) * | 2010-09-10 | 2014-12-31 | 安集微电子(上海)有限公司 | 一种化学机械抛光液 |
CN102443351B (zh) * | 2010-10-14 | 2015-07-29 | 安集微电子(上海)有限公司 | 一种化学机械平坦化浆料 |
KR101243331B1 (ko) * | 2010-12-17 | 2013-03-13 | 솔브레인 주식회사 | 화학 기계적 연마 슬러리 조성물 및 이를 이용하는 반도체 소자의 제조 방법 |
KR20140012660A (ko) * | 2011-03-11 | 2014-02-03 | 바스프 에스이 | 베이스 웨이퍼 관통 비아들을 형성하는 방법 |
TWI575040B (zh) * | 2011-03-18 | 2017-03-21 | 長興開發科技股份有限公司 | 可用於拋光矽通孔晶圓之拋光組成物及其用途 |
EP3928715A1 (en) | 2011-06-19 | 2021-12-29 | DNA Genotek, Inc. | Devices, solutions and methods for sample collection |
US9121101B2 (en) * | 2011-06-30 | 2015-09-01 | Asahi Kasei E-Materials Corporation | Etchant and etching method using the same |
US20140327132A1 (en) * | 2013-05-03 | 2014-11-06 | National Center For Advanced Packaging (Ncap China) | TSV Backside Reveal Structure and Exposing Process |
US8974692B2 (en) | 2013-06-27 | 2015-03-10 | Air Products And Chemicals, Inc. | Chemical mechanical polishing slurry compositions and method using the same for copper and through-silicon via applications |
KR102261638B1 (ko) * | 2013-11-15 | 2021-06-08 | 삼성디스플레이 주식회사 | 세정제 조성물 및 이를 이용한 금속배선 제조방법 |
US9728415B2 (en) * | 2013-12-19 | 2017-08-08 | STATS ChipPAC Pte. Ltd. | Semiconductor device and method of wafer thinning involving edge trimming and CMP |
RU2016141811A (ru) * | 2014-04-10 | 2018-05-10 | ДиЭнЭй ГЕНОТЕК ИНК. | Способ и система для лизиса микроорганизмов с применением периодатов |
CN107541735B (zh) * | 2016-06-24 | 2022-01-21 | 三星显示有限公司 | 用于去除氧化物的清洗组合物及使用该清洗组合物的清洗方法 |
TW202311461A (zh) * | 2020-07-20 | 2023-03-16 | 美商Cmc材料股份有限公司 | 矽晶圓拋光組合物及方法 |
US20240096636A1 (en) * | 2022-09-21 | 2024-03-21 | Qorvo Us, Inc. | Methods for polishing bulk silicon devices |
Family Cites Families (27)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5792709A (en) * | 1995-12-19 | 1998-08-11 | Micron Technology, Inc. | High-speed planarizing apparatus and method for chemical mechanical planarization of semiconductor wafers |
AU3661997A (en) * | 1996-07-25 | 1998-02-20 | Ekc Technology, Inc. | Chemical mechanical polishing composition and process |
US6083838A (en) * | 1998-05-20 | 2000-07-04 | Lucent Technologies Inc. | Method of planarizing a surface on a semiconductor wafer |
CN100335580C (zh) * | 1999-08-13 | 2007-09-05 | 卡伯特微电子公司 | 含有阻化化合物的抛光系统及其使用方法 |
US6855266B1 (en) * | 1999-08-13 | 2005-02-15 | Cabot Microelectronics Corporation | Polishing system with stopping compound and method of its use |
US6720264B2 (en) * | 1999-11-04 | 2004-04-13 | Advanced Micro Devices, Inc. | Prevention of precipitation defects on copper interconnects during CMP by use of solutions containing organic compounds with silica adsorption and copper corrosion inhibiting properties |
US6866792B2 (en) * | 2001-12-12 | 2005-03-15 | Ekc Technology, Inc. | Compositions for chemical mechanical planarization of copper |
US6527622B1 (en) * | 2002-01-22 | 2003-03-04 | Cabot Microelectronics Corporation | CMP method for noble metals |
US7524346B2 (en) * | 2002-01-25 | 2009-04-28 | Dupont Air Products Nanomaterials Llc | Compositions of chemical mechanical planarization slurries contacting noble-metal-featured substrates |
US20030162399A1 (en) * | 2002-02-22 | 2003-08-28 | University Of Florida | Method, composition and apparatus for tunable selectivity during chemical mechanical polishing of metallic structures |
US6936543B2 (en) * | 2002-06-07 | 2005-08-30 | Cabot Microelectronics Corporation | CMP method utilizing amphiphilic nonionic surfactants |
US6974777B2 (en) * | 2002-06-07 | 2005-12-13 | Cabot Microelectronics Corporation | CMP compositions for low-k dielectric materials |
US7005382B2 (en) * | 2002-10-31 | 2006-02-28 | Jsr Corporation | Aqueous dispersion for chemical mechanical polishing, chemical mechanical polishing process, production process of semiconductor device and material for preparing an aqueous dispersion for chemical mechanical polishing |
US20040150096A1 (en) * | 2003-02-03 | 2004-08-05 | International Business Machines Corporation | Capping coating for 3D integration applications |
WO2005019364A1 (en) * | 2003-08-14 | 2005-03-03 | Ekc Technology, Inc. | Periodic acid compositions for polishing ruthenium/high k substrates |
US6869336B1 (en) * | 2003-09-18 | 2005-03-22 | Novellus Systems, Inc. | Methods and compositions for chemical mechanical planarization of ruthenium |
US20050070109A1 (en) * | 2003-09-30 | 2005-03-31 | Feller A. Daniel | Novel slurry for chemical mechanical polishing of metals |
US7153335B2 (en) * | 2003-10-10 | 2006-12-26 | Dupont Air Products Nanomaterials Llc | Tunable composition and method for chemical-mechanical planarization with aspartic acid/tolyltriazole |
US7247566B2 (en) * | 2003-10-23 | 2007-07-24 | Dupont Air Products Nanomaterials Llc | CMP method for copper, tungsten, titanium, polysilicon, and other substrates using organosulfonic acids as oxidizers |
US20050090104A1 (en) * | 2003-10-27 | 2005-04-28 | Kai Yang | Slurry compositions for chemical mechanical polishing of copper and barrier films |
US7419911B2 (en) * | 2003-11-10 | 2008-09-02 | Ekc Technology, Inc. | Compositions and methods for rapidly removing overfilled substrates |
US7316976B2 (en) * | 2004-05-19 | 2008-01-08 | Dupont Air Products Nanomaterials Llc | Polishing method to reduce dishing of tungsten on a dielectric |
US7040958B2 (en) * | 2004-05-21 | 2006-05-09 | Mosel Vitelic, Inc. | Torque-based end point detection methods for chemical mechanical polishing tool which uses ceria-based CMP slurry to polish to protective pad layer |
KR100648264B1 (ko) * | 2004-08-17 | 2006-11-23 | 삼성전자주식회사 | 루테늄을 위한 화학적기계적 연마 슬러리, 상기 슬러리를이용한 루테늄에 대한 화학적기계적 연마 방법, 그리고상기 화학적기계적 연마 방법을 이용한 루테늄 전극 형성방법 |
JP4528100B2 (ja) * | 2004-11-25 | 2010-08-18 | 新光電気工業株式会社 | 半導体装置及びその製造方法 |
US8163049B2 (en) * | 2006-04-18 | 2012-04-24 | Dupont Air Products Nanomaterials Llc | Fluoride-modified silica sols for chemical mechanical planarization |
US8853830B2 (en) * | 2008-05-14 | 2014-10-07 | Taiwan Semiconductor Manufacturing Company, Ltd. | System, structure, and method of manufacturing a semiconductor substrate stack |
-
2008
- 2008-09-30 US US12/242,002 patent/US20100081279A1/en not_active Abandoned
-
2009
- 2009-09-28 TW TW098132764A patent/TW201013771A/zh unknown
- 2009-09-30 KR KR1020090093329A patent/KR101100951B1/ko active IP Right Grant
Also Published As
Publication number | Publication date |
---|---|
US20100081279A1 (en) | 2010-04-01 |
TW201013771A (en) | 2010-04-01 |
KR20100037013A (ko) | 2010-04-08 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR101100951B1 (ko) | 스택 장치의 제작에서 베이스 웨이퍼 관통 비아를 형성시키는 방법 | |
US9305806B2 (en) | Chemical mechanical polishing slurry compositions and method using the same for copper and through-silicon via applications | |
JP4081064B2 (ja) | アスパラギン酸/トリルトリアゾールを用いる化学的機械的平坦化のための調整可能な組成物および方法 | |
US7022255B2 (en) | Chemical-mechanical planarization composition with nitrogen containing polymer and method for use | |
JP5563465B2 (ja) | 金属cmpスラリー組成物及びこれを用いる研磨方法 | |
US20050194563A1 (en) | Bicine/tricine containing composition and method for chemical-mechanical planarization | |
US20050215183A1 (en) | Chemical-mechanical planarization composition having PVNO and associated method for use | |
KR101144419B1 (ko) | 금속-함유 기판의 화학 기계적 평탄화를 위한 방법 및 조성물 | |
US7316977B2 (en) | Chemical-mechanical planarization composition having ketooxime compounds and associated method for use | |
US7678702B2 (en) | CMP composition of boron surface-modified abrasive and nitro-substituted sulfonic acid and method of use | |
EP1090083A1 (en) | Chemical mechanical polishing slurry useful for copper/tantalum substrates | |
EP1209731A1 (en) | Polishing composition and polishing method employing it | |
US20060213868A1 (en) | Low-dishing composition and method for chemical-mechanical planarization with branched-alkylphenol-substituted benzotriazole | |
KR101186955B1 (ko) | 적층 디바이스를 제작하기 위해 베이스 웨이퍼 관통 비아를 형성하는 방법 | |
WO2009056491A1 (en) | Cmp slurry composition and process for planarizing copper containing surfaces provided with a diffusion barrier layer | |
US8697577B2 (en) | Method and composition for chemical mechanical planarization of a metal or a metal alloy | |
US20090061630A1 (en) | Method for Chemical Mechanical Planarization of A Metal-containing Substrate |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
E902 | Notification of reason for refusal | ||
E701 | Decision to grant or registration of patent right | ||
GRNT | Written decision to grant | ||
FPAY | Annual fee payment |
Payment date: 20141128 Year of fee payment: 4 |
|
FPAY | Annual fee payment |
Payment date: 20150930 Year of fee payment: 5 |
|
FPAY | Annual fee payment |
Payment date: 20161125 Year of fee payment: 6 |
|
FPAY | Annual fee payment |
Payment date: 20171117 Year of fee payment: 7 |
|
FPAY | Annual fee payment |
Payment date: 20181129 Year of fee payment: 8 |
|
FPAY | Annual fee payment |
Payment date: 20191127 Year of fee payment: 9 |