KE2909A - Method of selectively combating weeds with 4-isopropylphenyl ureas - Google Patents
Method of selectively combating weeds with 4-isopropylphenyl ureasInfo
- Publication number
- KE2909A KE2909A KE290978A KE290978A KE2909A KE 2909 A KE2909 A KE 2909A KE 290978 A KE290978 A KE 290978A KE 290978 A KE290978 A KE 290978A KE 2909 A KE2909 A KE 2909A
- Authority
- KE
- Kenya
- Prior art keywords
- isopropylphenyl
- ureas
- combating weeds
- selectively combating
- selectively
- Prior art date
Links
- -1 4-isopropylphenyl ureas Chemical class 0.000 title 1
- 241000196324 Embryophyta Species 0.000 title 1
- 235000013877 carbamide Nutrition 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH294470A CH537148A (de) | 1970-02-27 | 1970-02-27 | Verwendung von Phenylharnstoffen als selektive Herbizide |
| CH1392370A CH558141A (de) | 1970-09-21 | 1970-09-21 | Verwendung von phenylharnstoffen zur unkrautbekaempfung in getreidekulturen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KE2909A true KE2909A (en) | 1979-01-19 |
Family
ID=25691782
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KE290978A KE2909A (en) | 1970-02-27 | 1978-12-07 | Method of selectively combating weeds with 4-isopropylphenyl ureas |
Country Status (11)
| Country | Link |
|---|---|
| AU (1) | AU2590371A (cs) |
| BE (3) | BE763515A (cs) |
| CA (1) | CA1028867A (cs) |
| CY (1) | CY979A (cs) |
| DE (3) | DE2107698A1 (cs) |
| FR (3) | FR2080809B1 (cs) |
| GB (3) | GB1293500A (cs) |
| IL (2) | IL36218A0 (cs) |
| KE (1) | KE2909A (cs) |
| NL (3) | NL7102616A (cs) |
| RO (2) | RO57207A (cs) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2039041A1 (de) * | 1970-08-06 | 1972-02-17 | Hoechst Ag | Herbizide Mittel |
| FR2180619B1 (cs) * | 1972-04-21 | 1975-06-13 | Pepro | |
| FR2183625A1 (en) * | 1972-05-09 | 1973-12-21 | Pepro | N-4-isopropylphenyl-N',N'-dimethylurea herbicide - having synergistic action with mixts of neburon or linuron, esp for cereals |
| FR2215898B1 (cs) * | 1973-02-02 | 1977-04-22 | Philagro Sa | |
| CH575208A5 (cs) * | 1973-07-30 | 1976-05-14 | Ciba Geigy Ag | |
| GB1473105A (cs) * | 1973-08-10 | 1977-05-11 | ||
| DE2638402A1 (de) | 1975-09-05 | 1977-03-17 | Sandoz Ag | Organische verbindungen, ihre herstellung und verwendung |
| IT1123643B (it) | 1976-12-14 | 1986-04-30 | Montedison Spa | Uree ad azione insetticida e nematocida |
| CA1160072A (en) * | 1980-03-11 | 1984-01-10 | Shell Canada Limited | Herbicidal composition and method of combating undesired plant growth |
| MA19170A1 (fr) * | 1980-06-19 | 1981-12-31 | May & Baker Ltd | Procede pour la lutte contre les adventices a l'aide de (isopropyl-4-phenyl)-3 dimethyl-i,i-uree en combinaison avec le "s"(trichloro 2,3,3,alkyl thiocarbamate d'osopropyle . |
| CH652391A5 (de) * | 1982-01-15 | 1985-11-15 | Sandoz Ag | Harnstoff-derivate. |
| DE3222622A1 (de) * | 1982-06-11 | 1983-12-15 | Schering AG, 1000 Berlin und 4709 Bergkamen | Mittel zur entblaetterung von pflanzen mit synergistischer wirkung |
| US4749812A (en) * | 1985-05-27 | 1988-06-07 | Mitsui Toatsu Chemicals, Inc. | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037621A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN105532697B (zh) * | 2015-12-28 | 2018-04-27 | 江苏傲伦达科技实业股份有限公司 | 一种含有苄草丹和异丙隆的稻田除草组合物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH242359A (fr) * | 1942-06-06 | 1946-05-15 | Bourdereau Alphonse Jacques | Film à réseau lenticulaire microscopique, procédé pour sa réalisation et mécanisme pour la mise en oeuvre dudit procédé. |
| US2655445A (en) * | 1949-12-06 | 1953-10-13 | Du Pont | 3-(halophenyl)-1-methyl-1-(methyl or ethyl) ureas and herbicidal compositions and methods employing same |
| US2655447A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Composition and method |
| NL236579A (cs) * | 1958-02-01 | |||
| FR1251281A (fr) * | 1959-11-06 | 1961-01-20 | Du Pont | Composés complexes d'acides chlorobenzoïques et d'urées |
| US3228762A (en) * | 1960-10-03 | 1966-01-11 | Du Pont | Method of killing weeds |
| US3297425A (en) * | 1962-08-28 | 1967-01-10 | Du Pont | Herbicidal composition |
| CH424359A (de) * | 1963-01-29 | 1966-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| FR1497868A (fr) * | 1965-10-28 | 1967-10-13 | Sandoz Sa | Procédé de lutte sélective contre les plantes adventices dans les cultures de céréales |
| IL31574A0 (en) * | 1968-02-13 | 1969-04-30 | Ciba Ltd | Use of certain ureas for combating weeds |
| FR2263590B1 (cs) * | 1974-03-08 | 1976-12-10 | Alsthom Cgee |
-
1971
- 1971-02-17 IL IL36218A patent/IL36218A0/xx unknown
- 1971-02-17 IL IL36220A patent/IL36220A0/xx unknown
- 1971-02-18 DE DE19712107698 patent/DE2107698A1/de active Pending
- 1971-02-18 DE DE19712107774 patent/DE2107774C2/de not_active Expired
- 1971-02-18 DE DE19712107699 patent/DE2107699A1/de active Pending
- 1971-02-19 CA CA105,751A patent/CA1028867A/en not_active Expired
- 1971-02-25 FR FR7106517A patent/FR2080809B1/fr not_active Expired
- 1971-02-25 FR FR7106519A patent/FR2080810B1/fr not_active Expired
- 1971-02-25 RO RO6606571A patent/RO57207A/ro unknown
- 1971-02-25 FR FR7106518A patent/FR2079082A5/fr not_active Expired
- 1971-02-26 RO RO6608371A patent/RO57592A/ro unknown
- 1971-02-26 AU AU25903/71A patent/AU2590371A/en not_active Expired
- 1971-02-26 BE BE763515A patent/BE763515A/xx not_active IP Right Cessation
- 1971-02-26 BE BE763516A patent/BE763516A/xx unknown
- 1971-02-26 NL NL7102616A patent/NL7102616A/xx unknown
- 1971-02-26 NL NL7102617A patent/NL7102617A/xx unknown
- 1971-02-26 BE BE763514A patent/BE763514A/xx unknown
- 1971-02-26 NL NL7102615A patent/NL7102615A/xx unknown
- 1971-04-19 CY CY97971A patent/CY979A/xx unknown
- 1971-04-19 GB GB22623/71A patent/GB1293500A/en not_active Expired
- 1971-04-19 GB GB2262471A patent/GB1407586A/en not_active Expired
- 1971-04-19 GB GB5974873A patent/GB1407587A/en not_active Expired
-
1978
- 1978-12-07 KE KE290978A patent/KE2909A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2080810B1 (cs) | 1974-03-01 |
| FR2080810A1 (cs) | 1971-11-19 |
| CY979A (en) | 1979-03-23 |
| IL36220A0 (en) | 1971-04-28 |
| GB1407587A (en) | 1975-09-24 |
| AU2590371A (en) | 1972-08-31 |
| NL7102617A (cs) | 1971-08-31 |
| FR2080809B1 (cs) | 1974-03-01 |
| DE2107774A1 (de) | 1971-09-16 |
| FR2080809A1 (cs) | 1971-11-19 |
| DE2107699A1 (de) | 1971-09-16 |
| FR2079082A5 (cs) | 1971-11-05 |
| IL36218A0 (en) | 1971-04-28 |
| BE763515A (fr) | 1971-08-26 |
| DE2107774C2 (de) | 1990-03-29 |
| NL7102615A (cs) | 1971-08-31 |
| BE763514A (fr) | 1971-08-26 |
| RO57592A (cs) | 1975-02-15 |
| GB1293500A (en) | 1972-10-18 |
| DE2107698A1 (de) | 1971-09-16 |
| GB1407586A (en) | 1975-09-24 |
| RO57207A (cs) | 1975-01-15 |
| BE763516A (fr) | 1971-08-26 |
| CA1028867A (en) | 1978-04-04 |
| NL7102616A (cs) | 1971-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH526308A (de) | Abseilgerät | |
| CY979A (en) | Method of selectively combating weeds with 4-isopropylphenyl ureas | |
| FI55502B (fi) | Foerfarande foer framstaellning av trombos foerhindrande 4-amino-6-arylpyrimidiner | |
| KR780000220B1 (en) | Method of interconneting thermoplstic meterial | |
| BG20582A3 (bg) | Метод за получаване на р-халоген-фенил-2-пиромидинони | |
| ZA718447B (en) | Isomer of dihydromethyl-jasmonate | |
| IT944258B (it) | Procedimento per produrre polibutadiene | |
| CA1003855B (en) | 1-hydrocarbyldithio-3-aryl ureas | |
| IT946159B (it) | Azocoloranti e procedimento per la loro preparazione | |
| BG19133A3 (bg) | Метод за получаване на 1-фенил-2-хидрокси-3-хидроксилалкиламинопропани | |
| CS190356B2 (en) | Method of making the erythromycylamines | |
| IT1004009B (it) | Mangimi melassati e procedimento per prepararli | |
| SU439963A3 (ru) | Способ получения фениламиноалканов | |
| CS193012B2 (en) | Method of preparing 3-halogene-6-hydroxy-2-pyridones | |
| IT941461B (it) | Ossadiazoli e procedimento per la loro preparazione | |
| BG20585A3 (bg) | Метод за получаване на заместени n-хидрокси-алкил-2-ариламино-имидазолини | |
| BG21034A3 (bg) | Метод за получаване на антибиотика хетацефалексин | |
| IT938951B (it) | Poliisocianati procedimento per la loro preparazione e loro impiego | |
| SU438178A3 (ru) | Способ получения -изопропиланилина | |
| CS179963B2 (en) | Method of preparing 3-isoxazolylcarbonylureides | |
| ZA71546B (en) | Use of trichloroimidazole as herbicide | |
| EG11105A (en) | Method of preventing mosquito by using thioalkyl | |
| IT1056017B (it) | Procedimento per preparare 4 5 ciandimidazol 5 4 garbossiammide | |
| ZA711165B (en) | Method for selectively combating weeds | |
| IT994010B (it) | Composizioni aromatizzanti e procedimento per prepararle |