KE2718A - Cinchonidine and cinchonine derivatives - Google Patents
Cinchonidine and cinchonine derivativesInfo
- Publication number
- KE2718A KE2718A KE2718A KE271877A KE2718A KE 2718 A KE2718 A KE 2718A KE 2718 A KE2718 A KE 2718A KE 271877 A KE271877 A KE 271877A KE 2718 A KE2718 A KE 2718A
- Authority
- KE
- Kenya
- Prior art keywords
- cinchonidine
- cinchonine
- derivatives
- cinchonine derivatives
- Prior art date
Links
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 title 2
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
- C07D453/04—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems having a quinolyl-4, a substituted quinolyl-4 or a alkylenedioxy-quinolyl-4 radical linked through only one carbon atom, attached in position 2, e.g. quinine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42264573A | 1973-12-07 | 1973-12-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KE2718A true KE2718A (en) | 1977-07-15 |
Family
ID=23675777
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KE2718A KE2718A (en) | 1973-12-07 | 1977-03-30 | Cinchonidine and cinchonine derivatives |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5088076A (2) |
| AT (2) | AT339310B (2) |
| BE (1) | BE823023A (2) |
| BR (1) | BR7410249A (2) |
| CA (1) | CA1039283A (2) |
| CH (1) | CH605916A5 (2) |
| DE (1) | DE2458146A1 (2) |
| DK (1) | DK141700B (2) |
| FR (1) | FR2292476A1 (2) |
| GB (1) | GB1441519A (2) |
| IL (1) | IL46181A (2) |
| KE (1) | KE2718A (2) |
| MY (1) | MY7700239A (2) |
| NL (1) | NL7415931A (2) |
| PH (1) | PH10837A (2) |
| SE (1) | SE415100B (2) |
| ZA (1) | ZA747664B (2) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2381044A1 (fr) * | 1977-02-17 | 1978-09-15 | Hoffmann La Roche | Procede pour la preparation de mefloquine |
| HU191508B (en) * | 1982-12-02 | 1987-02-27 | Alkaloida Vegyeszeti Gyar,Hu | Process for preparing new chloromethyl-quinoline derivatives |
| AU9740998A (en) * | 1997-09-08 | 1999-03-29 | F. Hoffmann-La Roche Ag | Piperidine derivatives against malaria |
| JP2002360830A (ja) * | 2001-06-04 | 2002-12-17 | Heiwa Corp | 球貯蔵入賞装置 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1217427A (en) * | 1967-12-21 | 1970-12-31 | America Home Products Corp | Cinchona alkaloid derivatives |
| CH590274A5 (2) * | 1970-03-16 | 1977-07-29 | Hoffmann La Roche | |
| CH565792A5 (2) * | 1971-01-07 | 1975-08-29 | Hoffmann La Roche |
-
1974
- 1974-11-30 CH CH1586274A patent/CH605916A5/xx not_active IP Right Cessation
- 1974-12-02 PH PH16586A patent/PH10837A/en unknown
- 1974-12-02 ZA ZA00747664A patent/ZA747664B/xx unknown
- 1974-12-03 SE SE7415160A patent/SE415100B/xx unknown
- 1974-12-04 IL IL46181A patent/IL46181A/xx unknown
- 1974-12-05 FR FR7439824A patent/FR2292476A1/fr active Granted
- 1974-12-05 CA CA215,292A patent/CA1039283A/en not_active Expired
- 1974-12-06 JP JP49140423A patent/JPS5088076A/ja active Pending
- 1974-12-06 BR BR10249/74A patent/BR7410249A/pt unknown
- 1974-12-06 GB GB5284374A patent/GB1441519A/en not_active Expired
- 1974-12-06 AT AT977974A patent/AT339310B/de not_active IP Right Cessation
- 1974-12-06 BE BE151217A patent/BE823023A/xx unknown
- 1974-12-06 NL NL7415931A patent/NL7415931A/xx not_active Application Discontinuation
- 1974-12-06 DK DK637674AA patent/DK141700B/da unknown
- 1974-12-09 DE DE19742458146 patent/DE2458146A1/de not_active Withdrawn
-
1977
- 1977-01-18 AT AT24577A patent/AT353792B/de not_active IP Right Cessation
- 1977-03-30 KE KE2718A patent/KE2718A/xx unknown
- 1977-12-30 MY MY239/77A patent/MY7700239A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2292476B1 (2) | 1979-05-18 |
| DE2458146A1 (de) | 1975-06-12 |
| JPS5088076A (2) | 1975-07-15 |
| IL46181A (en) | 1978-03-10 |
| ATA977974A (de) | 1977-02-15 |
| BE823023A (fr) | 1975-06-06 |
| MY7700239A (en) | 1977-12-31 |
| PH10837A (en) | 1977-09-09 |
| CA1039283A (en) | 1978-09-26 |
| GB1441519A (en) | 1976-07-07 |
| AU7559274A (en) | 1976-05-27 |
| CH605916A5 (2) | 1978-10-13 |
| ZA747664B (en) | 1976-01-28 |
| DK637674A (2) | 1975-07-28 |
| SE7415160L (2) | 1975-06-09 |
| IL46181A0 (en) | 1975-03-13 |
| SE415100B (sv) | 1980-09-08 |
| BR7410249A (pt) | 1976-06-29 |
| FR2292476A1 (fr) | 1976-06-25 |
| DK141700B (da) | 1980-05-27 |
| DK141700C (2) | 1980-12-08 |
| ATA24577A (de) | 1979-05-15 |
| NL7415931A (nl) | 1975-06-10 |
| AT353792B (de) | 1979-12-10 |
| AT339310B (de) | 1977-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KE2946A (en) | Pyrazino-isoquinoline derivatives | |
| ZA744331B (en) | 1-hydroxyphenyl-2-amidoalkylaminoesthanol derivatives | |
| PH14530A (en) | 7-methoxycephalosporin derivatives | |
| PH12617A (en) | Aminobenzyl-amides and salts thereof | |
| ZA745530B (en) | Trans-7-cis-9-dodecadien-1-yl acetate | |
| AU7375074A (en) | Resistor | |
| PH12927A (en) | Vingamine derivatives | |
| ZA743706B (en) | Azapurinone derivatives | |
| GB1483352A (en) | Phenyl-alkenol and-alkanol derivatives | |
| CY969A (en) | 2-anilino-nicotinic and derivatives | |
| ZA744240B (en) | Clycoluril derivatives and preparation thereof | |
| IL43704A0 (en) | Lactamimide derivatives | |
| HK54080A (en) | Dihydroergopeptine derivatives | |
| PH12303A (en) | Thienotriazolodiazepine derivatives | |
| HK181A (en) | Benzylpyrimidine derivatives | |
| KE2718A (en) | Cinchonidine and cinchonine derivatives | |
| IL44842A (en) | 3 alkylamino-2-hydroxy-propoxy-phthalide and isochromanone derivatives | |
| IL44831A0 (en) | Pyrazinoisoquinoline derivatives | |
| ZA741229B (en) | Nuceleoside derivatives | |
| AU7333774A (en) | Arylchalcogeno-hydrocarbon derivatives | |
| AU7333674A (en) | Arylchalcogeno-hydrocarbon derivatives | |
| GB1408550A (en) | Gitoxigenin-digitoxoside derivatives | |
| AU7077474A (en) | Tonearm | |
| ZA741439B (en) | Benzenesulfonylurea derivatives | |
| IL44958A (en) | Mercaptoalkylpyridines and derivatives |