JPS647068B2 - - Google Patents
Info
- Publication number
- JPS647068B2 JPS647068B2 JP56085813A JP8581381A JPS647068B2 JP S647068 B2 JPS647068 B2 JP S647068B2 JP 56085813 A JP56085813 A JP 56085813A JP 8581381 A JP8581381 A JP 8581381A JP S647068 B2 JPS647068 B2 JP S647068B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- isocyanates
- reaction
- isocyanate
- oxalic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012948 isocyanate Substances 0.000 claims description 25
- 150000002513 isocyanates Chemical class 0.000 claims description 19
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000002723 alicyclic group Chemical group 0.000 claims description 3
- -1 oxalic acid ester amides Chemical class 0.000 description 21
- 238000000034 method Methods 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000007858 starting material Substances 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 5
- 231100000331 toxic Toxicity 0.000 description 5
- 230000002588 toxic effect Effects 0.000 description 5
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- FMNLVGDFBCBTJZ-UHFFFAOYSA-N 2-(methylamino)-2-oxoacetic acid Chemical compound CNC(=O)C(O)=O FMNLVGDFBCBTJZ-UHFFFAOYSA-N 0.000 description 3
- FRMRRIAGHDTBGR-UHFFFAOYSA-N COC(C(O)=O)=O.NC1=CC=CC=C1 Chemical compound COC(C(O)=O)=O.NC1=CC=CC=C1 FRMRRIAGHDTBGR-UHFFFAOYSA-N 0.000 description 3
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910000510 noble metal Inorganic materials 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 239000013076 target substance Substances 0.000 description 3
- 150000003673 urethanes Chemical group 0.000 description 3
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical compound CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- XNRHTMDHGDWBGP-UHFFFAOYSA-N carbamic acid;hydrochloride Chemical compound Cl.NC(O)=O XNRHTMDHGDWBGP-UHFFFAOYSA-N 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-M carbonochloridate Chemical compound [O-]C(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-M 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229940065287 selenium compound Drugs 0.000 description 1
- 150000003343 selenium compounds Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000013077 target material Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/12—Preparation of derivatives of isocyanic acid from or via nitrogen analogues of carboxylic acids, e.g. from hydroxamic acids, involving a Hofmann, Curtius or Lossen-type rearrangement
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803021299 DE3021299A1 (de) | 1980-06-06 | 1980-06-06 | Verfahren zur herstellung von isocyanaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5731650A JPS5731650A (en) | 1982-02-20 |
| JPS647068B2 true JPS647068B2 (enExample) | 1989-02-07 |
Family
ID=6103995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8581381A Granted JPS5731650A (en) | 1980-06-06 | 1981-06-05 | Manufacture of isocyanate |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4322365A (enExample) |
| EP (1) | EP0042059B1 (enExample) |
| JP (1) | JPS5731650A (enExample) |
| DE (2) | DE3021299A1 (enExample) |
| HU (1) | HU185870B (enExample) |
| IL (1) | IL62909A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4430262A (en) | 1981-06-05 | 1984-02-07 | Shell Oil Company | Preparation of isocyanates and/or derivatives thereof |
| EP0100047B1 (de) * | 1982-07-24 | 1986-02-12 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hexamethylen-diisocyanat-1,6 und/oder isomeren Diisocyanaten mit 6 Kohlenstoffatomen im Alkylenrest |
| US4663473A (en) * | 1986-08-25 | 1987-05-05 | The United States Of America As Represented By The Secretary Of The Army | Isocyanates from oxalyl chloride and amines |
| FR2957596B1 (fr) * | 2010-03-18 | 2013-07-12 | Rhodia Operations | Nouveaux composes de type esteramide, leurs procedes de preparation et leurs utilisations |
| EP2727114B1 (en) | 2011-06-28 | 2020-04-22 | Hewlett-Packard Enterprise Development LP | Shiftable memory |
| WO2013062559A1 (en) * | 2011-10-27 | 2013-05-02 | Hewlett-Packard Development Company, L.P. | Shiftable memory employing ring registers |
| KR101660611B1 (ko) | 2012-01-30 | 2016-09-27 | 휴렛 팩커드 엔터프라이즈 디벨롭먼트 엘피 | 워드 시프트 정적 랜덤 액세스 메모리(ws-sram) |
| US9542307B2 (en) | 2012-03-02 | 2017-01-10 | Hewlett Packard Enterprise Development Lp | Shiftable memory defragmentation |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3734941A (en) * | 1968-09-06 | 1973-05-22 | American Cyanamid Co | Process for converting urethanes to isocyanates |
| US3870739A (en) * | 1973-03-05 | 1975-03-11 | Air Prod & Chem | Isocyanates from urethanes |
-
1980
- 1980-06-06 DE DE19803021299 patent/DE3021299A1/de not_active Withdrawn
-
1981
- 1981-05-11 EP EP81103577A patent/EP0042059B1/de not_active Expired
- 1981-05-11 DE DE8181103577T patent/DE3160811D1/de not_active Expired
- 1981-05-19 IL IL62909A patent/IL62909A/xx unknown
- 1981-05-19 US US06/265,156 patent/US4322365A/en not_active Expired - Fee Related
- 1981-06-05 JP JP8581381A patent/JPS5731650A/ja active Granted
- 1981-06-05 HU HU811693A patent/HU185870B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3021299A1 (de) | 1982-01-07 |
| DE3160811D1 (en) | 1983-10-06 |
| IL62909A (en) | 1984-12-31 |
| EP0042059A1 (de) | 1981-12-23 |
| HU185870B (en) | 1985-04-28 |
| JPS5731650A (en) | 1982-02-20 |
| US4322365A (en) | 1982-03-30 |
| IL62909A0 (en) | 1981-07-31 |
| EP0042059B1 (de) | 1983-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5091567A (en) | Process for the preparation of 1-aminomethyl-1-cyclohexaneacetic acid | |
| US5534649A (en) | Process for preparing dialkyl carbonates | |
| RU2029761C1 (ru) | Способ получения 1-(аминометил)циклогексануксусной кислоты | |
| JPS647068B2 (enExample) | ||
| JPS6125013B2 (enExample) | ||
| US4242286A (en) | Process for preparing benzotrifluoride and its derivatives | |
| US2480089A (en) | Method of producing isocyanates | |
| US5616799A (en) | Process for the preparation of glycoloylanilides | |
| US4764309A (en) | Preparation of chlorocarboxylic acid chlorides | |
| US3054819A (en) | Preparation of organic isocyanates | |
| JPH03275662A (ja) | カルバメートの製造法 | |
| US3076007A (en) | Organic isocyanate preparation | |
| EP0125726A1 (en) | Improved process for preparing alkyl isocyanates | |
| US5756824A (en) | Process for the preparation of carbazates | |
| US3636082A (en) | Carbonylation of organic halides with metallic alcoholates | |
| JPH0333697B2 (enExample) | ||
| US3480627A (en) | Preparation of trialkenyl isocyanurates | |
| US6087499A (en) | Process for producing 5-perfluoroalkyluracil derivatives | |
| JP5001151B2 (ja) | 1−ベンジル−4−[(5,6−ジメトキシ−1−インダノン)−2−イリデン]メチルピペリジンの製造法 | |
| US5210344A (en) | Dehydrohalogenation of 1,1,2-trichloroethane using cyclic amines | |
| RU2848366C1 (ru) | Бесфосгенный способ получения 4,4'-метилендифенилдиизоцианата | |
| US4287136A (en) | Process for the preparation of O,O-dialkylthionophosphoric acid chlorides | |
| US3423448A (en) | Process for preparing aliphatic monoisocyanates | |
| US3711532A (en) | Preparation of beta-halogenopropionitriles | |
| JP4024882B2 (ja) | ターシャリーブチルヒドラジン・ハロゲン化水素酸塩の製造方法 |