JPS636535B2 - - Google Patents
Info
- Publication number
- JPS636535B2 JPS636535B2 JP57204735A JP20473582A JPS636535B2 JP S636535 B2 JPS636535 B2 JP S636535B2 JP 57204735 A JP57204735 A JP 57204735A JP 20473582 A JP20473582 A JP 20473582A JP S636535 B2 JPS636535 B2 JP S636535B2
- Authority
- JP
- Japan
- Prior art keywords
- ruthenium
- nickel
- rhodium
- cobalt
- carbonyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 92
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 75
- 229910017052 cobalt Inorganic materials 0.000 claims description 49
- 239000010941 cobalt Substances 0.000 claims description 49
- 150000001875 compounds Chemical class 0.000 claims description 48
- -1 rhodium halides Chemical class 0.000 claims description 47
- 238000004519 manufacturing process Methods 0.000 claims description 41
- 229910052759 nickel Inorganic materials 0.000 claims description 39
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 35
- 239000010948 rhodium Substances 0.000 claims description 35
- 229910052703 rhodium Inorganic materials 0.000 claims description 34
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 32
- 150000001241 acetals Chemical class 0.000 claims description 31
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 29
- 239000003054 catalyst Substances 0.000 claims description 28
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 24
- 229910052707 ruthenium Inorganic materials 0.000 claims description 23
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 18
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 16
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 claims description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 12
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 claims description 11
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 10
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 9
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 9
- 239000011707 mineral Substances 0.000 claims description 9
- NQZFAUXPNWSLBI-UHFFFAOYSA-N carbon monoxide;ruthenium Chemical group [Ru].[Ru].[Ru].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] NQZFAUXPNWSLBI-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 150000001735 carboxylic acids Chemical class 0.000 claims description 5
- 239000003446 ligand Substances 0.000 claims description 5
- 239000000376 reactant Substances 0.000 claims description 5
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 claims description 5
- 150000003303 ruthenium Chemical class 0.000 claims description 5
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 4
- 150000002815 nickel Chemical class 0.000 claims description 4
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- GGRQQHADVSXBQN-FGSKAQBVSA-N carbon monoxide;(z)-4-hydroxypent-3-en-2-one;rhodium Chemical compound [Rh].[O+]#[C-].[O+]#[C-].C\C(O)=C\C(C)=O GGRQQHADVSXBQN-FGSKAQBVSA-N 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- WHWBTOCNUBAGRL-UHFFFAOYSA-N cobalt;formaldehyde Chemical compound [Co].O=C WHWBTOCNUBAGRL-UHFFFAOYSA-N 0.000 claims description 3
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 claims description 3
- 150000003283 rhodium Chemical class 0.000 claims description 3
- XBBXDTCPEWHXKL-UHFFFAOYSA-N rhodium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Rh+3].[Rh+3] XBBXDTCPEWHXKL-UHFFFAOYSA-N 0.000 claims description 3
- OJLCQGGSMYKWEK-UHFFFAOYSA-K ruthenium(3+);triacetate Chemical compound [Ru+3].CC([O-])=O.CC([O-])=O.CC([O-])=O OJLCQGGSMYKWEK-UHFFFAOYSA-K 0.000 claims description 3
- MBVAQOHBPXKYMF-LNTINUHCSA-N (z)-4-hydroxypent-3-en-2-one;rhodium Chemical group [Rh].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O MBVAQOHBPXKYMF-LNTINUHCSA-N 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 2
- NTDQECXVEKMBFD-UHFFFAOYSA-K [Rh+3].CCC([O-])=O.CCC([O-])=O.CCC([O-])=O Chemical compound [Rh+3].CCC([O-])=O.CCC([O-])=O.CCC([O-])=O NTDQECXVEKMBFD-UHFFFAOYSA-K 0.000 claims description 2
- ROZSPJBPUVWBHW-UHFFFAOYSA-N [Ru]=O Chemical class [Ru]=O ROZSPJBPUVWBHW-UHFFFAOYSA-N 0.000 claims description 2
- 150000001869 cobalt compounds Chemical class 0.000 claims description 2
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 claims description 2
- SJLOMQIUPFZJAN-UHFFFAOYSA-N oxorhodium Chemical compound [Rh]=O SJLOMQIUPFZJAN-UHFFFAOYSA-N 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 229910003450 rhodium oxide Inorganic materials 0.000 claims description 2
- SVOOVMQUISJERI-UHFFFAOYSA-K rhodium(3+);triacetate Chemical compound [Rh+3].CC([O-])=O.CC([O-])=O.CC([O-])=O SVOOVMQUISJERI-UHFFFAOYSA-K 0.000 claims description 2
- 229910001927 ruthenium tetroxide Inorganic materials 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims 3
- 235000005985 organic acids Nutrition 0.000 claims 3
- 229910000480 nickel oxide Inorganic materials 0.000 claims 2
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 claims 2
- 150000005215 alkyl ethers Chemical class 0.000 claims 1
- 150000001868 cobalt Chemical class 0.000 claims 1
- 229910000428 cobalt oxide Inorganic materials 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- PCBNFFXBNCITIF-UHFFFAOYSA-N oxorhodium;hydrate Chemical compound O.[Rh]=O PCBNFFXBNCITIF-UHFFFAOYSA-N 0.000 claims 1
- LEIZJJNFNQIIKH-UHFFFAOYSA-K propanoate;ruthenium(3+) Chemical compound [Ru+3].CCC([O-])=O.CCC([O-])=O.CCC([O-])=O LEIZJJNFNQIIKH-UHFFFAOYSA-K 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 239000007789 gas Substances 0.000 description 22
- 239000012263 liquid product Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- CXKAZTSHVRMSRT-UHFFFAOYSA-N 1-ethoxypropan-2-one Chemical compound CCOCC(C)=O CXKAZTSHVRMSRT-UHFFFAOYSA-N 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- JOLQKTGDSGKSKJ-UHFFFAOYSA-N 1-ethoxypropan-2-ol Chemical compound CCOCC(C)O JOLQKTGDSGKSKJ-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 6
- 238000011084 recovery Methods 0.000 description 6
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 5
- 238000001030 gas--liquid chromatography Methods 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- 229940078494 nickel acetate Drugs 0.000 description 5
- XHMWPVBQGARKQM-UHFFFAOYSA-N 3-ethoxy-1-propanol Chemical compound CCOCCCO XHMWPVBQGARKQM-UHFFFAOYSA-N 0.000 description 4
- 238000003109 Karl Fischer titration Methods 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 238000004508 fractional distillation Methods 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- XUPYJHCZDLZNFP-UHFFFAOYSA-N butyl butanoate Chemical compound CCCCOC(=O)CCC XUPYJHCZDLZNFP-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- YMFAWOSEDSLYSZ-UHFFFAOYSA-N carbon monoxide;cobalt Chemical group [Co].[Co].[Co].[Co].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] YMFAWOSEDSLYSZ-UHFFFAOYSA-N 0.000 description 2
- 239000003426 co-catalyst Substances 0.000 description 2
- VBYYGKHCVKNVAZ-UHFFFAOYSA-N cobalt;ethoxyethane Chemical compound [Co].CCOCC VBYYGKHCVKNVAZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000001983 dialkylethers Chemical class 0.000 description 2
- 239000000539 dimer Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- NAVSKFYJNZQECG-UHFFFAOYSA-N nickel;propanoic acid Chemical compound [Ni].CCC(O)=O NAVSKFYJNZQECG-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- MISTZQJSHHTDCF-UHFFFAOYSA-N 1-(1-propoxyethoxy)propane Chemical compound CCCOC(C)OCCC MISTZQJSHHTDCF-UHFFFAOYSA-N 0.000 description 1
- RWNUSVWFHDHRCJ-UHFFFAOYSA-N 1-butoxypropan-2-ol Chemical compound CCCCOCC(C)O RWNUSVWFHDHRCJ-UHFFFAOYSA-N 0.000 description 1
- GNIJLZHYBVVHMA-UHFFFAOYSA-N 1-decoxypropan-2-ol Chemical compound CCCCCCCCCCOCC(C)O GNIJLZHYBVVHMA-UHFFFAOYSA-N 0.000 description 1
- IPSNMUXNVKYURH-UHFFFAOYSA-N 1-heptoxypropan-2-ol Chemical compound CCCCCCCOCC(C)O IPSNMUXNVKYURH-UHFFFAOYSA-N 0.000 description 1
- BWPAALSUQKGDBR-UHFFFAOYSA-N 1-hexoxypropan-2-ol Chemical compound CCCCCCOCC(C)O BWPAALSUQKGDBR-UHFFFAOYSA-N 0.000 description 1
- ARXJGSRGQADJSQ-UHFFFAOYSA-N 1-methoxypropan-2-ol Chemical compound COCC(C)O ARXJGSRGQADJSQ-UHFFFAOYSA-N 0.000 description 1
- IBLKWZIFZMJLFL-UHFFFAOYSA-N 1-phenoxypropan-2-ol Chemical compound CC(O)COC1=CC=CC=C1 IBLKWZIFZMJLFL-UHFFFAOYSA-N 0.000 description 1
- BWLBGMIXKSTLSX-UHFFFAOYSA-N 2-hydroxyisobutyric acid Chemical compound CC(C)(O)C(O)=O BWLBGMIXKSTLSX-UHFFFAOYSA-N 0.000 description 1
- LDMRLRNXHLPZJN-UHFFFAOYSA-N 3-propoxypropan-1-ol Chemical compound CCCOCCCO LDMRLRNXHLPZJN-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 229910021585 Nickel(II) bromide Inorganic materials 0.000 description 1
- CPPNKGYPKMJXCO-UHFFFAOYSA-N O=C=O.[Co] Chemical compound O=C=O.[Co] CPPNKGYPKMJXCO-UHFFFAOYSA-N 0.000 description 1
- JTVHIRUDQBMPCB-UHFFFAOYSA-M O=C=[Rh](Cl)=C=O Chemical compound O=C=[Rh](Cl)=C=O JTVHIRUDQBMPCB-UHFFFAOYSA-M 0.000 description 1
- 229910021603 Ruthenium iodide Inorganic materials 0.000 description 1
- SGDPVQRGBHPKIH-UHFFFAOYSA-L [Ni].Cl[Ni]Cl Chemical compound [Ni].Cl[Ni]Cl SGDPVQRGBHPKIH-UHFFFAOYSA-L 0.000 description 1
- PLEOQZSOHCPRJU-UHFFFAOYSA-L [Ru].[Ru].[Ru].Cl[Co]Cl Chemical compound [Ru].[Ru].[Ru].Cl[Co]Cl PLEOQZSOHCPRJU-UHFFFAOYSA-L 0.000 description 1
- RTRQQBHATOEIAF-UUOKFMHZSA-N acadesine Chemical compound NC1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 RTRQQBHATOEIAF-UUOKFMHZSA-N 0.000 description 1
- 229960003000 acadesine Drugs 0.000 description 1
- TWWSMHPNERSWRN-UHFFFAOYSA-N acetaldehyde diisopropyl acetal Natural products CC(C)OC(C)OC(C)C TWWSMHPNERSWRN-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000074 antimony hydride Inorganic materials 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- SLFKPACCQUVAPG-UHFFFAOYSA-N carbon monoxide;nickel;triphenylphosphane Chemical group O=C=[Ni]=C=O.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 SLFKPACCQUVAPG-UHFFFAOYSA-N 0.000 description 1
- LVGLLYVYRZMJIN-UHFFFAOYSA-N carbon monoxide;rhodium Chemical group [Rh].[Rh].[Rh].[Rh].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] LVGLLYVYRZMJIN-UHFFFAOYSA-N 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt dinitrate Chemical compound [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 1
- 229910001981 cobalt nitrate Inorganic materials 0.000 description 1
- 229910000152 cobalt phosphate Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- GAYAMOAYBXKUII-UHFFFAOYSA-L cobalt(2+);dibenzoate Chemical compound [Co+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 GAYAMOAYBXKUII-UHFFFAOYSA-L 0.000 description 1
- ZBDSFTZNNQNSQM-UHFFFAOYSA-H cobalt(2+);diphosphate Chemical compound [Co+2].[Co+2].[Co+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O ZBDSFTZNNQNSQM-UHFFFAOYSA-H 0.000 description 1
- NMNZGKIKHBYUNG-UHFFFAOYSA-L cobalt(2+);hexanoate Chemical compound [Co+2].CCCCCC([O-])=O.CCCCCC([O-])=O NMNZGKIKHBYUNG-UHFFFAOYSA-L 0.000 description 1
- BXDNFAXUAQVKRQ-UHFFFAOYSA-L cobalt(2+);pentanoate Chemical compound [Co+2].CCCCC([O-])=O.CCCCC([O-])=O BXDNFAXUAQVKRQ-UHFFFAOYSA-L 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 1
- 238000011437 continuous method Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- OCDXZFSOHJRGIL-UHFFFAOYSA-N cyclohexyloxycyclohexane Chemical compound C1CCCCC1OC1CCCCC1 OCDXZFSOHJRGIL-UHFFFAOYSA-N 0.000 description 1
- LVYUTPCBOJGMBJ-UHFFFAOYSA-I dibromocobalt trichlororhodium Chemical compound [Rh](Cl)(Cl)Cl.[Co](Br)Br LVYUTPCBOJGMBJ-UHFFFAOYSA-I 0.000 description 1
- KZYDBKYFEURFNC-UHFFFAOYSA-N dioxorhodium Chemical compound O=[Rh]=O KZYDBKYFEURFNC-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- UIEKYBOPAVTZKW-UHFFFAOYSA-L naphthalene-2-carboxylate;nickel(2+) Chemical compound [Ni+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 UIEKYBOPAVTZKW-UHFFFAOYSA-L 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- IPLJNQFXJUCRNH-UHFFFAOYSA-L nickel(2+);dibromide Chemical compound [Ni+2].[Br-].[Br-] IPLJNQFXJUCRNH-UHFFFAOYSA-L 0.000 description 1
- HZPNKQREYVVATQ-UHFFFAOYSA-L nickel(2+);diformate Chemical compound [Ni+2].[O-]C=O.[O-]C=O HZPNKQREYVVATQ-UHFFFAOYSA-L 0.000 description 1
- DWAHIRJDCNGEDV-UHFFFAOYSA-N nickel(2+);dinitrate;hydrate Chemical compound O.[Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O DWAHIRJDCNGEDV-UHFFFAOYSA-N 0.000 description 1
- BFSQJYRFLQUZKX-UHFFFAOYSA-L nickel(ii) iodide Chemical compound I[Ni]I BFSQJYRFLQUZKX-UHFFFAOYSA-L 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- OZMOTUUZLXMHJR-UHFFFAOYSA-K pentanoate ruthenium(3+) Chemical compound C(CCCC)(=O)[O-].[Ru+3].C(CCCC)(=O)[O-].C(CCCC)(=O)[O-] OZMOTUUZLXMHJR-UHFFFAOYSA-K 0.000 description 1
- OZVHAYAOFBRGQV-UHFFFAOYSA-K pentanoate;rhodium(3+) Chemical compound [Rh+3].CCCCC([O-])=O.CCCCC([O-])=O.CCCCC([O-])=O OZVHAYAOFBRGQV-UHFFFAOYSA-K 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- MMRXYMKDBFSWJR-UHFFFAOYSA-K rhodium(3+);tribromide Chemical compound [Br-].[Br-].[Br-].[Rh+3] MMRXYMKDBFSWJR-UHFFFAOYSA-K 0.000 description 1
- QRRFFHBDASQYFJ-UHFFFAOYSA-K rhodium(3+);triformate Chemical compound [Rh+3].[O-]C=O.[O-]C=O.[O-]C=O QRRFFHBDASQYFJ-UHFFFAOYSA-K 0.000 description 1
- KXAHUXSHRWNTOD-UHFFFAOYSA-K rhodium(3+);triiodide Chemical compound [Rh+3].[I-].[I-].[I-] KXAHUXSHRWNTOD-UHFFFAOYSA-K 0.000 description 1
- VXNYVYJABGOSBX-UHFFFAOYSA-N rhodium(3+);trinitrate Chemical compound [Rh+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VXNYVYJABGOSBX-UHFFFAOYSA-N 0.000 description 1
- WYRXRHOISWEUST-UHFFFAOYSA-K ruthenium(3+);tribromide Chemical compound [Br-].[Br-].[Br-].[Ru+3] WYRXRHOISWEUST-UHFFFAOYSA-K 0.000 description 1
- LJZVDOUZSMHXJH-UHFFFAOYSA-K ruthenium(3+);triiodide Chemical compound [Ru+3].[I-].[I-].[I-] LJZVDOUZSMHXJH-UHFFFAOYSA-K 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical compound [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US339234 | 1982-01-13 | ||
| US06/339,234 US4390734A (en) | 1982-01-13 | 1982-01-13 | Process for producing propylene glycol monoalkyl ethers from acetaldehyde, an alkanol and syngas using a new catalyst system |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS58121232A JPS58121232A (ja) | 1983-07-19 |
| JPS636535B2 true JPS636535B2 (esLanguage) | 1988-02-10 |
Family
ID=23328094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP57204735A Granted JPS58121232A (ja) | 1982-01-13 | 1982-11-24 | グリコ−ルモノアルキルエ−テルの製造方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4390734A (esLanguage) |
| JP (1) | JPS58121232A (esLanguage) |
| CA (1) | CA1186341A (esLanguage) |
| DE (1) | DE3243593A1 (esLanguage) |
| GB (1) | GB2113209B (esLanguage) |
| ZA (1) | ZA829391B (esLanguage) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58134044A (ja) * | 1982-02-03 | 1983-08-10 | Mitsubishi Gas Chem Co Inc | 2−メトキシ−1−プロパノ−ルの製造方法 |
| FR2564090B1 (fr) * | 1984-05-11 | 1986-10-03 | Inst Francais Du Petrole | Procede de carbonylation reductrice d'aldehydes par l'intermediaire d'hemiacetal-esters, catalysee par les complexes carbonyles du cobalt |
| US4652542A (en) * | 1984-06-21 | 1987-03-24 | Sun Refining And Marketing Company | Ruthenium-cobalt carbonyl catalysts for the dealkoxyhydroxymethylation of acetals to form glycol ethers |
| US4692426A (en) * | 1984-06-21 | 1987-09-08 | Sun Refining And Marketing Company | Phosphite-promoted ruthenium-cobalt catalysts for the dealkoxyhydroxymethylation of acetals to form glycol ethers |
| US4618729A (en) * | 1984-06-21 | 1986-10-21 | Sun Refining And Marketing Company | Ruthenium-cobalt carbonyl metal cluster catalysts for the dealkoxyhydroxymethylation of acetals to form glycol ethers |
| EP0168989A1 (en) * | 1984-06-21 | 1986-01-22 | Sun Refining and Marketing Company | Rutheniumpromoted cobalt catalysts for the dealkoxyhydroxymethylation of formaldehyde acetals to form glycol ethers |
| US4617287A (en) * | 1984-06-21 | 1986-10-14 | Sun Refining And Marketing Company | Ruthenium-cobalt carbonyl catalysts for the dealkoxyhydroxymethylation of aldehyde acetals to form glycol ethers |
| DE3561508D1 (en) * | 1984-06-21 | 1988-03-03 | Sun Refining & Marketing | Catalysts and process for the dealkoxyhydroxymethylation of acetals to form glycol ethers |
| JPS61112038A (ja) * | 1984-11-07 | 1986-05-30 | Canon Inc | 液晶性化合物の製造方法 |
| US4590298A (en) * | 1985-03-05 | 1986-05-20 | Celanese Corporation | Production of hydroxyketones from formaldehyde |
| US4895987A (en) * | 1986-06-06 | 1990-01-23 | Sun Refining And Marketing Company | Phosphonite-and phosphonite-promoted ruthenium - cobalt catalysts for the dealkoxyhydroxymethylation of acetals to form glycol ethers |
| DE68926501T2 (de) | 1988-12-28 | 1996-09-12 | Den Norske Stats Oljeselskap A/S, Stavanger | Verfahren zur kohlenwasserstoffsynthese mit einem gestützen katalysator |
| US5102851A (en) * | 1988-12-28 | 1992-04-07 | Den Norske Stats Oljeselskap A.S. | Supported catalyst for hydrocarbon synthesis |
| US5116879A (en) * | 1988-12-28 | 1992-05-26 | Den Norske Stats Oljeselskap A.S. | Process using a supported catalyst for hydrocarbon synthesis |
| FR2677194A1 (fr) * | 1991-05-29 | 1992-12-04 | Cit Alcatel | Dispositif de comptage des impulsions d'un signal logique. |
| CN1035992C (zh) * | 1992-09-18 | 1997-10-01 | 天津石油化工公司研究所 | 一种丙二醇乙醚生产方法 |
| FR2795719B1 (fr) * | 1999-06-29 | 2003-05-30 | Inst Francais Du Petrole | Procede de production de composes oxygenes contenant au moins un atome d'oxygene lie a deux atomes de carbone distincts, non lies entre eux et ne comportant pas de liaison multiple |
| US7420093B2 (en) * | 2006-09-29 | 2008-09-02 | Eastman Chemical Company | Process for the preparation of glycolaldehyde |
| US7301054B1 (en) | 2006-09-29 | 2007-11-27 | Eastman Chemical Company | Process for the preparation of glycolaldehyde |
| US8785697B2 (en) | 2011-06-24 | 2014-07-22 | Eastman Chemical Company | Nickel modified catalyst for the production of hydroxy ether hydrocarbons by vapor phase hydrogenolysis of cyclic acetals and ketals |
| US9000229B2 (en) | 2011-06-24 | 2015-04-07 | Eastman Chemical Company | Production of hydroxy ether hydrocarbons by vapor phase hydrogenolysis of cyclic acetals and ketals |
| US8969598B2 (en) | 2011-06-24 | 2015-03-03 | Eastman Chemical Company | Production of cyclic acetals or ketals using liquid-phase acid catalysts |
| US8829206B2 (en) | 2011-06-24 | 2014-09-09 | Eastman Chemical Company | Production of cyclic acetals or ketals using solid acid catalysts |
| US9056313B2 (en) | 2011-06-24 | 2015-06-16 | Eastman Chemical Company | Catalysts for the production of hydroxy ether hydrocarbons by vapor phase hydrogenolysis of cyclic acetals and ketals |
| US8829207B2 (en) | 2011-06-24 | 2014-09-09 | Eastman Chemical Company | Production of cyclic acetals by reactive distillation |
| US9388105B2 (en) | 2011-06-24 | 2016-07-12 | Eastman Chemical Company | Production of hydroxy ether hydrocarbons by liquid phase hydrogenolysis of cyclic acetals or cyclic ketals |
| CN104211584B (zh) * | 2014-09-10 | 2016-06-29 | 百川化工(如皋)有限公司 | 一种制备二丙二醇甲醚的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE875802C (de) * | 1941-03-07 | 1953-05-07 | Basf Ag | Verfahren zur Herstellung organischer sauerstoffhaltiger Verbindungen |
| US2429878A (en) * | 1946-05-17 | 1947-10-28 | Du Pont | Synthesis of glycol ethers |
| US4071568A (en) * | 1975-12-12 | 1978-01-31 | Mitsubishi Chemical Industries Limited | Process for producing glycol monoether |
| US4200765A (en) * | 1976-09-17 | 1980-04-29 | National Distillers And Chemical Corporation | Glycol aldehyde and ethylene glycol processes |
| GB1568427A (en) * | 1976-10-21 | 1980-05-29 | Chevron Res | Process for preparing glycol and methanol |
-
1982
- 1982-01-13 US US06/339,234 patent/US4390734A/en not_active Expired - Fee Related
- 1982-11-24 JP JP57204735A patent/JPS58121232A/ja active Granted
- 1982-11-25 DE DE19823243593 patent/DE3243593A1/de not_active Withdrawn
- 1982-12-10 GB GB08235281A patent/GB2113209B/en not_active Expired
- 1982-12-21 ZA ZA829391A patent/ZA829391B/xx unknown
-
1983
- 1983-01-12 CA CA000419368A patent/CA1186341A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB2113209B (en) | 1985-11-20 |
| JPS58121232A (ja) | 1983-07-19 |
| US4390734A (en) | 1983-06-28 |
| CA1186341A (en) | 1985-04-30 |
| DE3243593A1 (de) | 1983-07-21 |
| GB2113209A (en) | 1983-08-03 |
| ZA829391B (en) | 1984-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4390734A (en) | Process for producing propylene glycol monoalkyl ethers from acetaldehyde, an alkanol and syngas using a new catalyst system | |
| US4476326A (en) | Process for the synthesis of ethanol and acetaldehyde using cobalt compounds with novel promoters | |
| US4362821A (en) | Process for preparing alkanols from synthesis gas | |
| GB2083466A (en) | Process for preparing glycol ethers | |
| Knifton et al. | Syngas reactions. 6. Aliphatic alcohols and esters from synthesis gas | |
| GB2029409A (en) | Production of Carboxylic Acids and Their Esters | |
| US4484002A (en) | Process for producing methyl acetate from methanol and carbon monoxide using a novel catalyst system | |
| US4315994A (en) | Preparation of glycols and ethers | |
| KR860000448B1 (ko) | 합성가스로부터 알칸올을 제조하는 방법 | |
| US4332915A (en) | Production of alkanols from synthesis gas | |
| US4332914A (en) | Manufacture of alkanols from synthesis gas | |
| US4315993A (en) | Preparation of ethylene glycol | |
| EP0078615B1 (en) | Process for preparing glycol ethers | |
| CA1192226A (en) | Process for preparing ethylene glycol and lower monohydric alcohols from syngas using a novel catalyst system | |
| US4794199A (en) | Process for synthesis of primary amines from olefins, syngas and ammonia | |
| EP0013464A1 (en) | Selective formation of ethanol from methanol, hydrogen and carbon monoxide | |
| US4433178A (en) | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition | |
| US4433176A (en) | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition | |
| US4399233A (en) | Process for preparing low molecular weight oxygenated compounds from syngas using novel catalyst system | |
| US4436837A (en) | Preparation of alkanols from synthesis gas | |
| CA1219001A (en) | Process for making aldehydes from acetals and ketals | |
| US4351907A (en) | Preparation of ethylene glycol | |
| US4434248A (en) | Process for preparing alkanols from synthesis gas | |
| US4433177A (en) | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition | |
| US4511740A (en) | Process for hydroformylation of terminal olefins to predominantly linear aldehydes |