JPS6364419B2 - - Google Patents
Info
- Publication number
- JPS6364419B2 JPS6364419B2 JP54089186A JP8918679A JPS6364419B2 JP S6364419 B2 JPS6364419 B2 JP S6364419B2 JP 54089186 A JP54089186 A JP 54089186A JP 8918679 A JP8918679 A JP 8918679A JP S6364419 B2 JPS6364419 B2 JP S6364419B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- formula
- triiodo
- cyano
- hydrogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 24
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 239000002872 contrast media Substances 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- DAMMTPUDAGMEIL-UHFFFAOYSA-N 5-cyano-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I DAMMTPUDAGMEIL-UHFFFAOYSA-N 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- UGOFDMIBHFPSJF-UHFFFAOYSA-N 2,4,6-triiodobenzonitrile Chemical class IC1=CC(I)=C(C#N)C(I)=C1 UGOFDMIBHFPSJF-UHFFFAOYSA-N 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- DOOSUBKMJXCJNJ-UHFFFAOYSA-N 3-cyano-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid Chemical compound CNC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I DOOSUBKMJXCJNJ-UHFFFAOYSA-N 0.000 claims description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims 2
- CRVYPNHLIAWRNV-UHFFFAOYSA-N 2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C=C1I CRVYPNHLIAWRNV-UHFFFAOYSA-N 0.000 claims 1
- IDZLDUPVMGWZLD-UHFFFAOYSA-N 2-methyl-2-phenylbutanoic acid Chemical compound CCC(C)(C(O)=O)C1=CC=CC=C1 IDZLDUPVMGWZLD-UHFFFAOYSA-N 0.000 claims 1
- YSWWITLPDXXKGO-UHFFFAOYSA-N 3-[bis(2-hydroxyethyl)carbamoyl]-5-cyano-2,4,6-triiodobenzoic acid Chemical compound OCCN(CCO)C(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I YSWWITLPDXXKGO-UHFFFAOYSA-N 0.000 claims 1
- WRXPJJPJHDCFBH-UHFFFAOYSA-N 3-carbamoyl-5-cyano-2,4,6-triiodobenzoic acid Chemical compound NC(=O)C1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I WRXPJJPJHDCFBH-UHFFFAOYSA-N 0.000 claims 1
- JKVAHSYHFPASPQ-UHFFFAOYSA-N 3-cyano-2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C(C#N)=C1I JKVAHSYHFPASPQ-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 54
- 239000000243 solution Substances 0.000 description 47
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- 238000003756 stirring Methods 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 20
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 16
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 14
- 238000001816 cooling Methods 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 10
- 235000010288 sodium nitrite Nutrition 0.000 description 10
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 8
- 150000001989 diazonium salts Chemical class 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000012954 diazonium Substances 0.000 description 7
- 238000006193 diazotization reaction Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 150000001879 copper Chemical class 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- -1 lactyl group Chemical group 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- AQUHOLYGJVTFOD-UHFFFAOYSA-N 3-acetamido-5-cyano-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NC1=C(I)C(C#N)=C(I)C(C(O)=O)=C1I AQUHOLYGJVTFOD-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- ZMZGFLUUZLELNE-UHFFFAOYSA-N 2,3,5-triiodobenzoic acid Chemical compound OC(=O)C1=CC(I)=CC(I)=C1I ZMZGFLUUZLELNE-UHFFFAOYSA-N 0.000 description 1
- IPHVGAPABXWWLO-UHFFFAOYSA-N 2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C=C(I)C(C(O)=O)=C1I IPHVGAPABXWWLO-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- OMCHGDWBBLALDJ-UHFFFAOYSA-N 3-(acetamidomethyl)-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NCC1=C(I)C=C(I)C(C(O)=O)=C1I OMCHGDWBBLALDJ-UHFFFAOYSA-N 0.000 description 1
- KDEVSMFUAKNOJC-UHFFFAOYSA-N 3-acetamido-5-(aminomethyl)-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NC1=C(I)C(CN)=C(I)C(C(O)=O)=C1I KDEVSMFUAKNOJC-UHFFFAOYSA-N 0.000 description 1
- XCNHOBHCZBIGJP-UHFFFAOYSA-N 3-acetamido-5-amino-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NC1=C(I)C(N)=C(I)C(C(O)=O)=C1I XCNHOBHCZBIGJP-UHFFFAOYSA-N 0.000 description 1
- AKXKBAWZIVNNJR-UHFFFAOYSA-N 3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid Chemical compound CNC(=O)C1=C(I)C(N)=C(I)C(C(O)=O)=C1I AKXKBAWZIVNNJR-UHFFFAOYSA-N 0.000 description 1
- QMQFFHSJUJDRPG-UHFFFAOYSA-N 3-amino-2,4,6-triiodobenzoic acid Chemical compound NC1=C(I)C=C(I)C(C(O)=O)=C1I QMQFFHSJUJDRPG-UHFFFAOYSA-N 0.000 description 1
- ZYACZOBSYFUWOF-UHFFFAOYSA-N 3-amino-5-[bis(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid Chemical compound NC1=C(I)C(C(O)=O)=C(I)C(C(=O)N(CCO)CCO)=C1I ZYACZOBSYFUWOF-UHFFFAOYSA-N 0.000 description 1
- MYWMLEMKOKPNAP-UHFFFAOYSA-N 5-acetamido-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I MYWMLEMKOKPNAP-UHFFFAOYSA-N 0.000 description 1
- JEZJSNULLBSYHV-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I JEZJSNULLBSYHV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000003118 aryl group Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940039231 contrast media Drugs 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 235000019439 ethyl acetate Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- VVDGWALACJEJKG-UHFFFAOYSA-N iodamide Chemical compound CC(=O)NCC1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I VVDGWALACJEJKG-UHFFFAOYSA-N 0.000 description 1
- 229960004901 iodamide Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HXLVCCRPDYIRRX-UHFFFAOYSA-N iodoamine Chemical compound IN HXLVCCRPDYIRRX-UHFFFAOYSA-N 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/57—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and carboxyl groups, other than cyano groups, bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782831496 DE2831496A1 (de) | 1978-07-14 | 1978-07-14 | Neue roentgenkontrastmittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5519258A JPS5519258A (en) | 1980-02-09 |
| JPS6364419B2 true JPS6364419B2 (Direct) | 1988-12-12 |
Family
ID=6044674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8918679A Granted JPS5519258A (en) | 1978-07-14 | 1979-07-13 | Novel 2*4*66triiodoobenzonitrile derivative* its manufacture and x ray contrast agent containing it |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS5519258A (Direct) |
| BE (1) | BE877695A (Direct) |
| DE (1) | DE2831496A1 (Direct) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7166740B2 (en) | 2003-07-14 | 2007-01-23 | Schering Ag | Process for the production of triiodotrimesic acid |
| DE10332574B3 (de) * | 2003-07-14 | 2005-04-14 | Schering Ag | Verfahren zur Herstellung von Triiodtrimesinsäure |
| DE10332552B3 (de) * | 2003-07-14 | 2005-03-24 | Schering Ag | Verfahren zur Herstellung von Triiodtrimesinsäure |
-
1978
- 1978-07-14 DE DE19782831496 patent/DE2831496A1/de active Granted
-
1979
- 1979-07-13 BE BE0/196295A patent/BE877695A/fr not_active IP Right Cessation
- 1979-07-13 JP JP8918679A patent/JPS5519258A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2831496C2 (Direct) | 1987-06-19 |
| BE877695A (fr) | 1980-01-14 |
| JPS5519258A (en) | 1980-02-09 |
| DE2831496A1 (de) | 1980-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69531213T2 (de) | Neue heterocyclische verbindungen, verfahren zu deren herstellung sowie medizinische verwendung | |
| US4014986A (en) | X-ray contrast media | |
| CS221815B2 (en) | Method of making the diamide of the 2,4,6-triiode -5-carbomoylisoptale acid | |
| FR2794744A1 (fr) | Complexes metalliques de polyaminoacides bicycliques, leur procede de preparation et leur application en imagerie medicale | |
| US4005188A (en) | X-ray contrast media | |
| JPH02138262A (ja) | 新規医薬活性1,2,3,4,4a,5,10,10a‐オクタヒドロ‐ベンゾ〔g〕キノリン誘導体 | |
| US4062934A (en) | X-ray contrast media | |
| FR2673180A1 (fr) | Nouveaux composes non ioniques poly-iodes, procede de preparation, produit de contraste les contenant. | |
| US4065553A (en) | X-Ray contrast media | |
| US3883578A (en) | Radiopaque agents | |
| JPS6364419B2 (Direct) | ||
| US4269819A (en) | 2,4,6-Triiodobenzonitrile derivatives and X-ray contrast media comprising them | |
| JPS6121235B2 (Direct) | ||
| EP0032388B1 (de) | Ionische 5-C-substituierte 2,4,6-trijod-isophthalsäure-Derivate, deren Herstellung und diese enthaltende Röntgenkontrastmittel | |
| CS199744B2 (en) | Process for preparing derivatives of 2-hydrazonpropionic acid | |
| US4107286A (en) | Polyiods benzene derivatives and X-ray contrast media containing the same | |
| CH623053A5 (en) | Processes for the preparation of new imidazobenzoxazines | |
| HUT70943A (en) | Novel poly-iodated compounds, method of preparation and contrast product containing same | |
| US3772376A (en) | X-ray contrast agents | |
| FI67841B (fi) | Saosom roentgenkontrastmedel anvaendbara jodbensenderivat | |
| KR820000625B1 (ko) | 아실아닐리드의 제조방법 | |
| JPH0119382B2 (Direct) | ||
| DE2558117A1 (de) | 3-nitropyrazol-derivate | |
| PL111060B1 (en) | Preparation of novel isoindoline derivatives | |
| JPS5810586A (ja) | セフアロスポラン酸化合物の製造法 |