JPS6347729B2 - - Google Patents
Info
- Publication number
- JPS6347729B2 JPS6347729B2 JP55116020A JP11602080A JPS6347729B2 JP S6347729 B2 JPS6347729 B2 JP S6347729B2 JP 55116020 A JP55116020 A JP 55116020A JP 11602080 A JP11602080 A JP 11602080A JP S6347729 B2 JPS6347729 B2 JP S6347729B2
- Authority
- JP
- Japan
- Prior art keywords
- carbon atoms
- acid
- polyarylate
- diphenyl ether
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims abstract description 82
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims abstract description 73
- 229920001230 polyarylate Polymers 0.000 claims abstract description 61
- 238000006243 chemical reaction Methods 0.000 claims abstract description 35
- -1 diphenyl ether compound Chemical class 0.000 claims abstract description 31
- 125000003118 aryl group Chemical group 0.000 claims abstract description 23
- 238000004519 manufacturing process Methods 0.000 claims abstract description 23
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 22
- 150000005690 diesters Chemical class 0.000 claims abstract description 20
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 17
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 36
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 239000003054 catalyst Substances 0.000 claims description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical group CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 150000008065 acid anhydrides Chemical class 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000000859 sublimation Methods 0.000 abstract description 4
- 230000008022 sublimation Effects 0.000 abstract description 4
- 229920000642 polymer Polymers 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 239000002904 solvent Substances 0.000 description 15
- 238000006116 polymerization reaction Methods 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 150000002989 phenols Chemical class 0.000 description 12
- 229920000728 polyester Polymers 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 9
- 230000035484 reaction time Effects 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- AREMQPPGVQNRIE-UHFFFAOYSA-N acetic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound CC(O)=O.CC(O)=O.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 AREMQPPGVQNRIE-UHFFFAOYSA-N 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 230000032050 esterification Effects 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000008961 swelling Effects 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 229930185605 Bisphenol Natural products 0.000 description 3
- 229920001634 Copolyester Polymers 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- AKOGNYJNGMLDOA-UHFFFAOYSA-N (4-acetyloxyphenyl) acetate Chemical compound CC(=O)OC1=CC=C(OC(C)=O)C=C1 AKOGNYJNGMLDOA-UHFFFAOYSA-N 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- QNUWEXSGZVBMDV-UHFFFAOYSA-N 3-(carboxymethyl)benzoic acid Chemical compound OC(=O)CC1=CC=CC(C(O)=O)=C1 QNUWEXSGZVBMDV-UHFFFAOYSA-N 0.000 description 1
- MHQKOBUZECTWOL-UHFFFAOYSA-N 3-acetyloxycarbonylbenzoic acid Chemical compound CC(=O)OC(=O)C1=CC=CC(C(O)=O)=C1 MHQKOBUZECTWOL-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- ZZXOXJAAKGCFNH-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)-1,2-diphenylpropyl]phenol Chemical compound C=1C=CC=CC=1C(C=1C=CC(O)=CC=1)(C)C(C=1C=CC(O)=CC=1)C1=CC=CC=C1 ZZXOXJAAKGCFNH-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004953 Aliphatic polyamide Substances 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229920003231 aliphatic polyamide Polymers 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000008378 aryl ethers Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 150000004074 biphenyls Chemical class 0.000 description 1
- KKSAZXGYGLKVSV-UHFFFAOYSA-N butan-1-ol;titanium Chemical compound [Ti].CCCCO KKSAZXGYGLKVSV-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- XBZSBBLNHFMTEB-UHFFFAOYSA-N cyclohexane-1,3-dicarboxylic acid Chemical compound OC(=O)C1CCCC(C(O)=O)C1 XBZSBBLNHFMTEB-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000000374 eutectic mixture Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229920006258 high performance thermoplastic Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical class C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000012643 polycondensation polymerization Methods 0.000 description 1
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/12—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/16—Dicarboxylic acids and dihydroxy compounds
- C08G63/18—Dicarboxylic acids and dihydroxy compounds the acids or hydroxy compounds containing carbocyclic rings
- C08G63/19—Hydroxy compounds containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/81—Preparation processes using solvents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Polyethers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/069,818 US4294956A (en) | 1979-08-27 | 1979-08-27 | Process for preparing polyarylates in the presence of a diphenyl ether |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5632520A JPS5632520A (en) | 1981-04-02 |
| JPS6347729B2 true JPS6347729B2 (esLanguage) | 1988-09-26 |
Family
ID=22091406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP11602080A Granted JPS5632520A (en) | 1979-08-27 | 1980-08-25 | Manufacture of polyarylate under presence of diphenylether |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4294956A (esLanguage) |
| EP (1) | EP0026684B1 (esLanguage) |
| JP (1) | JPS5632520A (esLanguage) |
| AT (1) | ATE12396T1 (esLanguage) |
| CA (1) | CA1152692A (esLanguage) |
| DE (1) | DE3070383D1 (esLanguage) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4374239A (en) * | 1980-03-03 | 1983-02-15 | Union Carbide Corporation | Process for preparing polyarylates |
| US4314051A (en) * | 1980-05-05 | 1982-02-02 | Union Carbide Corporation | Process for preparing polyarylates |
| EP0156966B1 (en) * | 1981-07-20 | 1988-10-19 | Teijin Limited | Wholly aromatic polyester composition and process for producing it |
| CA1214588A (en) * | 1981-11-09 | 1986-11-25 | Union Carbide Corporation | Process for preparing polyesters or poly(estercarbonates) in the presence of a processing aid |
| US4386186A (en) * | 1982-03-29 | 1983-05-31 | Union Carbide Corporation | Process for preparing polyarylates |
| US4520168A (en) * | 1982-06-30 | 1985-05-28 | Union Carbide Corporation | Color improved polyarylate |
| US4439586A (en) * | 1982-06-30 | 1984-03-27 | Union Carbide Corporation | Process for preparing polyarylates |
| US4454308A (en) * | 1982-12-06 | 1984-06-12 | General Electric Company | Rubbery polyarylates |
| US4463160A (en) * | 1982-12-17 | 1984-07-31 | General Electric Company | Polyarylates exhibiting improved heat resistance |
| US4463161A (en) * | 1982-12-27 | 1984-07-31 | General Electric Company | Polyarylate compositions |
| US4438241A (en) | 1982-12-27 | 1984-03-20 | General Electric Company | Heat resistant polyarylates |
| US4533720A (en) * | 1983-09-13 | 1985-08-06 | Phillips Petroleum Company | Polyarylate formation by ester interchange reaction using γ- gamma lactones as diluent |
| US4485230A (en) * | 1983-09-13 | 1984-11-27 | Phillips Petroleum Company | Polyarylate formation by ester interchange reaction |
| JPH0739478B2 (ja) * | 1985-10-31 | 1995-05-01 | 住友化学工業株式会社 | 芳香族ポリエステルの製造方法 |
| US4853457A (en) * | 1987-10-26 | 1989-08-01 | General Electric Company | Preparation of spirobiindane polyarylates, and spirobiindane polyarylate-polyethylene terephthalate copolymers, via melt polymerization |
| US4958000A (en) * | 1989-05-22 | 1990-09-18 | Amoco Corporation | Process for preparing polyarylates |
| JP2608151B2 (ja) * | 1989-10-18 | 1997-05-07 | 川崎製鉄株式会社 | 耐加水分解性の改善されたポリアリレート樹脂およびその製造方法 |
| US5004796A (en) * | 1990-01-12 | 1991-04-02 | Hoechst Celanese Corporation | Preparation of poly(arylate) using a non-solvent |
| US4994546A (en) * | 1990-02-09 | 1991-02-19 | Amoco Corporation | Process for preparing bisphenol polyarylates |
| US5274069A (en) * | 1992-09-29 | 1993-12-28 | Hoechst Celanese Corporation | Process for preparing improved polyarylates |
| US6126992A (en) * | 1998-04-23 | 2000-10-03 | E.I. Dupont De Nemours And Company | Optical articles comprising isosorbide polyesters and method for making same |
| US6063464A (en) * | 1998-04-23 | 2000-05-16 | Hna Holdings, Inc. | Isosorbide containing polyesters and methods for making same |
| US6063465A (en) * | 1998-04-23 | 2000-05-16 | Hna Holdings, Inc. | Polyester container and method for making same |
| US6025061A (en) * | 1998-04-23 | 2000-02-15 | Hna Holdings, Inc. | Sheets formed from polyesters including isosorbide |
| US6063495A (en) * | 1998-04-23 | 2000-05-16 | Hna Holdings, Inc. | Polyester fiber and methods for making same |
| US5959066A (en) * | 1998-04-23 | 1999-09-28 | Hna Holdings, Inc. | Polyesters including isosorbide as a comonomer and methods for making same |
| US5958581A (en) * | 1998-04-23 | 1999-09-28 | Hna Holdings, Inc. | Polyester film and methods for making same |
| US6140422A (en) | 1998-04-23 | 2000-10-31 | E.I. Dupont De Nemours And Company | Polyesters including isosorbide as a comonomer blended with other thermoplastic polymers |
| US6180756B1 (en) * | 1999-02-17 | 2001-01-30 | E. I. Du Pont De Nemours And Company | Addition of treatment agents to solid phase polymerization process |
| US20050075456A1 (en) * | 2003-10-01 | 2005-04-07 | Brunelle Daniel Joseph | Novel synthetic route for the preparation of hydroxy terminated polyarylates |
| DE102005050072A1 (de) | 2005-10-19 | 2007-04-26 | Bayer Materialscience Ag | Lichtstreuende Folien sowie deren Verwendung in Flachbildschirmen |
| DE102006051305A1 (de) | 2006-10-31 | 2008-05-08 | Bayer Materialscience Ag | Verfahren zur Filtration von Substratmaterialien |
| DE102007013273A1 (de) | 2007-03-16 | 2008-09-18 | Bayer Materialscience Ag | Verfahren zur Herstellung mehrschichtiger Behälter |
| DE102007015948A1 (de) | 2007-04-03 | 2008-10-09 | Bayer Materialscience Ag | Modifizierte Polycarbonate, Polyestercarbonate und Polyester mit verbessertem Dehnverhalten und Flammwidrigkeit |
| JP2008308578A (ja) * | 2007-06-14 | 2008-12-25 | Canon Inc | フラン環を含有するポリアリレート樹脂の製造方法 |
| EP2133202A1 (de) | 2008-06-11 | 2009-12-16 | Bayer MaterialScience AG | Mehrschichtige optische Folienaufbauten mit verbesserten Eigenschaften und deren Verwendung |
| DE102008036406A1 (de) | 2008-08-05 | 2010-02-11 | Bayer Materialscience Ag | Modifizierte Polycarbonate mit verbesserten Oberflächeneigenschaften |
| EP2157133A1 (de) | 2008-08-19 | 2010-02-24 | Bayer MaterialScience AG | Folien mit verbesserten Eigenschaften |
| DE102009025123A1 (de) | 2009-06-16 | 2010-12-23 | Osram Opto Semiconductors Gmbh | Strahlungsemittierende Vorrichtung |
| DE102009058099A1 (de) | 2009-12-12 | 2011-06-16 | Bayer Materialscience Ag | Polycarbonatblends mit hoher Wärmeformbeständigkeit und verbesserten Oberflächeneigenschaften |
| DE102009058462A1 (de) | 2009-12-16 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Polycarbonat mit erhöhter Transmission und bakterizider Wirksamkeit |
| EP2703092A1 (de) | 2012-08-30 | 2014-03-05 | Bayer MaterialScience AG | Verfahren zur Einstellung verschiedener Glanzgrade bei strahlengehärteten Lacken und deren Verwendung |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2595343A (en) * | 1946-05-20 | 1952-05-06 | Celanese Corp | Production of polyesters by reacting a dicarboxylic acid with a diphenol |
| DE1005729B (de) * | 1955-08-08 | 1957-04-04 | Glanzstoff Ag | Verfahren zur Polykondensation von Diolestern aromatischer Dicarbonsaeuren |
| BE563173A (esLanguage) * | 1956-12-14 | |||
| FR1342877A (fr) * | 1961-09-28 | 1963-11-15 | Rohm & Haas | Polymères de condensation et procédé pour leur fabrication |
| US3225003A (en) * | 1962-01-29 | 1965-12-21 | Du Pont | Linear copolyester of hydroquinone with a mixture of hexahydroisophthalic and hexahydroterephthalic acids |
| NL296856A (esLanguage) * | 1962-11-12 | |||
| US3684766A (en) * | 1970-02-16 | 1972-08-15 | Eastman Kodak Co | Process for enhancing the inherent viscosity of bisphenol polyesters |
| US3780148A (en) * | 1970-02-16 | 1973-12-18 | Eastman Kodak Co | Process for enhancing the inherent viscosity of bisphenol polyesters |
| JPS4911985A (esLanguage) * | 1972-04-14 | 1974-02-01 | ||
| DE2232877B2 (de) * | 1972-07-05 | 1980-04-10 | Werner & Pfleiderer, 7000 Stuttgart | Verfahren zur Herstellung von Polyestern |
| US3824213A (en) * | 1973-04-16 | 1974-07-16 | Celanese Corp | Acid-interchange reaction for forming halogenated aromatic polyesters |
| US3948856A (en) * | 1973-09-26 | 1976-04-06 | Celanese Corporation | Acid interchange polymerization process for producing an aromatic polyester |
| JPS5292295A (en) * | 1976-01-29 | 1977-08-03 | Sumitomo Chem Co Ltd | Preparation of aromatic polyester |
| US4127560A (en) * | 1977-08-08 | 1978-11-28 | Celanese Corporation | Melt polymerization process for preparing a melt processable resorcinol phthalate polyester utilizing a metal acetate catalyst |
-
1979
- 1979-08-27 US US06/069,818 patent/US4294956A/en not_active Expired - Lifetime
-
1980
- 1980-07-25 CA CA000357027A patent/CA1152692A/en not_active Expired
- 1980-08-25 JP JP11602080A patent/JPS5632520A/ja active Granted
- 1980-08-26 EP EP80401218A patent/EP0026684B1/en not_active Expired
- 1980-08-26 DE DE8080401218T patent/DE3070383D1/de not_active Expired
- 1980-08-26 AT AT80401218T patent/ATE12396T1/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5632520A (en) | 1981-04-02 |
| CA1152692A (en) | 1983-08-23 |
| ATE12396T1 (de) | 1985-04-15 |
| DE3070383D1 (en) | 1985-05-02 |
| US4294956A (en) | 1981-10-13 |
| EP0026684B1 (en) | 1985-03-27 |
| EP0026684A1 (en) | 1981-04-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6347729B2 (esLanguage) | ||
| US4296232A (en) | Process for preparing polyarylates in the presence of a diphenyl ether compound and a catalyst | |
| EP0026120B1 (en) | Process for preparing polyarylates in the presence of a cycloaliphatic compound | |
| US4374239A (en) | Process for preparing polyarylates | |
| EP0028030B1 (en) | Process for stabilizing polyarylates with an aromatic phenol | |
| US3972852A (en) | Process for preparing aromatic polyesters from diphenols | |
| EP0807655A1 (en) | Preparation of aromatic polyesters | |
| US4123454A (en) | Thermoplastic copolyesters | |
| US5807962A (en) | Aromatic sulfonated diester monomer, process to synthesize, polymer derived therefrom and method to prepare said polymer | |
| KR950009483B1 (ko) | 용융시 높은 열안정성을 가지는 성형용 폴리알킬렌 테레프탈레이트수지 및 그 성형품 | |
| EP0035269B1 (en) | Process for preparing polyarylates | |
| CA2014746A1 (en) | Process for preparing low color polyarylates | |
| EP0073492B1 (en) | Process for preparing polyesters in the presence of a processing aid | |
| US5237040A (en) | Process for preparing aromatic polyesters | |
| US5274069A (en) | Process for preparing improved polyarylates | |
| US5004796A (en) | Preparation of poly(arylate) using a non-solvent | |
| US4853457A (en) | Preparation of spirobiindane polyarylates, and spirobiindane polyarylate-polyethylene terephthalate copolymers, via melt polymerization | |
| JP2831543B2 (ja) | 芳香族ポリエステルの製造方法 | |
| US4937311A (en) | Aromatic polyesters and polyester carbonates containing terminal aralkylphenyl groups, their production and use | |
| US5001215A (en) | Aromatic polyester from 1,3-bis(p-carboxyphenoxy)propane | |
| JPH05331267A (ja) | 全芳香族ポリエステル | |
| Tijsma et al. | Pivalolactone, 2. Copolyester synthesis via interchange reactions with polypivalolactone | |
| JPH02284914A (ja) | ポリアリーレートの製造方法 | |
| JPH0372526A (ja) | ポリアリーレート類の製法 | |
| Mahajan | Idage et al. |