JPS6331498B2 - - Google Patents
Info
- Publication number
- JPS6331498B2 JPS6331498B2 JP54133668A JP13366879A JPS6331498B2 JP S6331498 B2 JPS6331498 B2 JP S6331498B2 JP 54133668 A JP54133668 A JP 54133668A JP 13366879 A JP13366879 A JP 13366879A JP S6331498 B2 JPS6331498 B2 JP S6331498B2
- Authority
- JP
- Japan
- Prior art keywords
- carbon atoms
- alkyl
- hydrogen
- formula
- cycloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 68
- 125000000217 alkyl group Chemical group 0.000 claims description 48
- 239000004952 Polyamide Substances 0.000 claims description 38
- 229920002647 polyamide Polymers 0.000 claims description 38
- 239000001257 hydrogen Substances 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 150000004985 diamines Chemical class 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 5
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims description 4
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 4
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229930003836 cresol Natural products 0.000 claims 1
- 238000009835 boiling Methods 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 18
- -1 aromatic aminocarboxylic acid nitrile Chemical group 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 150000003839 salts Chemical class 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- YWKCIGGXIPYBRT-UHFFFAOYSA-N 10,10-dimethyl-1-phenylundecane-1,11-diamine Chemical compound NCC(C)(C)CCCCCCCCC(N)C1=CC=CC=C1 YWKCIGGXIPYBRT-UHFFFAOYSA-N 0.000 description 4
- NLXRGHSNLCETNA-UHFFFAOYSA-N 2,2,12-trimethyltridecane-1,11-diamine Chemical compound CC(C)C(N)CCCCCCCCC(C)(C)CN NLXRGHSNLCETNA-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- UNNGUFMVYQJGTD-UHFFFAOYSA-N 2-Ethylbutanal Chemical compound CCC(CC)C=O UNNGUFMVYQJGTD-UHFFFAOYSA-N 0.000 description 3
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000009477 glass transition Effects 0.000 description 3
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexamethylene diamine Natural products NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052703 rhodium Inorganic materials 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- AIGZAVXZXZXTGY-UHFFFAOYSA-N 1-cyclohexyl-10,10-dimethylundecane-1,11-diamine Chemical compound NCC(C)(C)CCCCCCCCC(N)C1CCCCC1 AIGZAVXZXZXTGY-UHFFFAOYSA-N 0.000 description 2
- IZOLJROVHBOURY-UHFFFAOYSA-N 11,11-diethyl-2-pentan-3-yl-1-azacyclododec-12-ene Chemical compound CCC(CC)C1CCCCCCCCC(CC)(CC)C=N1 IZOLJROVHBOURY-UHFFFAOYSA-N 0.000 description 2
- MYZAWOWDJUQPAS-UHFFFAOYSA-N 11,11-dimethyl-2-phenyl-1-azacyclododeca-4,8,12-triene Chemical compound N1=CC(C)(C)CC=CCCC=CCC1C1=CC=CC=C1 MYZAWOWDJUQPAS-UHFFFAOYSA-N 0.000 description 2
- CUBYHOYPWBPMNS-UHFFFAOYSA-N 11,11-dimethyl-2-propan-2-yl-azacyclododecane Chemical compound CC(C)C1CCCCCCCCC(C)(C)CN1 CUBYHOYPWBPMNS-UHFFFAOYSA-N 0.000 description 2
- MICKYOBSRYQTBZ-UHFFFAOYSA-N 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene Chemical compound CC=CC(C)C1CC=CCCC=CCC(C)C=N1 MICKYOBSRYQTBZ-UHFFFAOYSA-N 0.000 description 2
- PTQSIWIKVXOBIQ-UHFFFAOYSA-N 12-ethyl-2-methyltetradecane-1,11-diamine Chemical compound CCC(CC)C(N)CCCCCCCCC(C)CN PTQSIWIKVXOBIQ-UHFFFAOYSA-N 0.000 description 2
- DPQHRXRAZHNGRU-UHFFFAOYSA-N 2,4,4-trimethylhexane-1,6-diamine Chemical compound NCC(C)CC(C)(C)CCN DPQHRXRAZHNGRU-UHFFFAOYSA-N 0.000 description 2
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 2
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- TUVFMMNANXKTRP-UHFFFAOYSA-N Ethenamine, N-methylene- Chemical compound C=CN=C TUVFMMNANXKTRP-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000005263 alkylenediamine group Chemical group 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- HPGJOUYGWKFYQW-UHFFFAOYSA-N diphenyl benzene-1,4-dicarboxylate Chemical compound C=1C=C(C(=O)OC=2C=CC=CC=2)C=CC=1C(=O)OC1=CC=CC=C1 HPGJOUYGWKFYQW-UHFFFAOYSA-N 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- DIFJYPRAXNPQSM-UHFFFAOYSA-N n-(11-amino-2,2,12-trimethyltridecylidene)hydroxylamine Chemical compound CC(C)C(N)CCCCCCCCC(C)(C)C=NO DIFJYPRAXNPQSM-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- KLNPWTHGTVSSEU-UHFFFAOYSA-N undecane-1,11-diamine Chemical compound NCCCCCCCCCCCN KLNPWTHGTVSSEU-UHFFFAOYSA-N 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- XLRULVHCDYONHI-UHFFFAOYSA-N 11,11-diethyl-2-pentan-3-yl-1-azacyclododeca-4,8,12-triene Chemical compound CCC(CC)C1CC=CCCC=CCC(CC)(CC)C=N1 XLRULVHCDYONHI-UHFFFAOYSA-N 0.000 description 1
- BUAVBORLHRCLMY-UHFFFAOYSA-N 11,11-dimethyl-2-propan-2-yl-1-azacyclododeca-4,8,12-triene Chemical compound CC(C)C1CC=CCCC=CCC(C)(C)C=N1 BUAVBORLHRCLMY-UHFFFAOYSA-N 0.000 description 1
- ORQORZZIDRCLDN-UHFFFAOYSA-N 2,2,12-triethyltetradecane-1,11-diamine Chemical compound CCC(CC)C(N)CCCCCCCCC(CC)(CC)CN ORQORZZIDRCLDN-UHFFFAOYSA-N 0.000 description 1
- VXDHQYLFEYUMFY-UHFFFAOYSA-N 2-methylprop-2-en-1-amine Chemical compound CC(=C)CN VXDHQYLFEYUMFY-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 238000012696 Interfacial polycondensation Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- ZOLLIQAKMYWTBR-RYMQXAEESA-N cyclododecatriene Chemical compound C/1C\C=C\CC\C=C/CC\C=C\1 ZOLLIQAKMYWTBR-RYMQXAEESA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004427 diamine group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- CBLAIDIBZHTGLV-UHFFFAOYSA-N dodecane-2,11-diamine Chemical compound CC(N)CCCCCCCCC(C)N CBLAIDIBZHTGLV-UHFFFAOYSA-N 0.000 description 1
- GCPCLEKQVMKXJM-UHFFFAOYSA-N ethoxy(diethyl)alumane Chemical compound CCO[Al](CC)CC GCPCLEKQVMKXJM-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- HZCVMHDBECNRTL-UHFFFAOYSA-N n-(11-amino-2,12-dimethylpentadeca-4,8,13-trienylidene)hydroxylamine Chemical compound CC=CC(C)C(N)CC=CCCC=CCC(C)C=NO HZCVMHDBECNRTL-UHFFFAOYSA-N 0.000 description 1
- XKBQSUGDDYFSTO-UHFFFAOYSA-N n-(11-amino-2,2,12-trimethyltrideca-4,8-dienylidene)hydroxylamine Chemical compound CC(C)C(N)CC=CCCC=CCC(C)(C)C=NO XKBQSUGDDYFSTO-UHFFFAOYSA-N 0.000 description 1
- ULVISLMXHHFXFN-UHFFFAOYSA-N n-(11-amino-2,2-dimethyl-11-phenylundeca-4,8-dienylidene)hydroxylamine Chemical compound ON=CC(C)(C)CC=CCCC=CCC(N)C1=CC=CC=C1 ULVISLMXHHFXFN-UHFFFAOYSA-N 0.000 description 1
- OFXMDJDTJXMBQT-UHFFFAOYSA-N n-(11-aminododecan-2-yl)-n-formylformamide Chemical compound CC(N)CCCCCCCCC(C)N(C=O)C=O OFXMDJDTJXMBQT-UHFFFAOYSA-N 0.000 description 1
- GTUGTQZAVJESCS-UHFFFAOYSA-N n-(2-methylprop-1-enyl)cyclohexanimine Chemical compound CC(C)=CN=C1CCCCC1 GTUGTQZAVJESCS-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1077178 | 1978-10-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5556125A JPS5556125A (en) | 1980-04-24 |
| JPS6331498B2 true JPS6331498B2 (esLanguage) | 1988-06-24 |
Family
ID=4366690
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13366879A Granted JPS5556125A (en) | 1978-10-18 | 1979-10-18 | Transparent copolyamide*its manufacture and molded body made thereof |
| JP62295418A Granted JPS63146926A (ja) | 1978-10-18 | 1987-11-25 | 透明ポリアミドおよびその製造方法 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP62295418A Granted JPS63146926A (ja) | 1978-10-18 | 1987-11-25 | 透明ポリアミドおよびその製造方法 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4297480A (esLanguage) |
| EP (1) | EP0012712B1 (esLanguage) |
| JP (2) | JPS5556125A (esLanguage) |
| CA (1) | CA1129588A (esLanguage) |
| DE (1) | DE2963644D1 (esLanguage) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3360070D1 (en) * | 1982-01-29 | 1985-04-18 | Ciba Geigy Ag | 1,10-substituted 10-amino-deca-3,7-diene-nitriles and method for their preparation |
| DE3366159D1 (en) * | 1982-01-29 | 1986-10-23 | Ciba Geigy Ag | Transparent, cross-linkable polyamides |
| JP2562863Y2 (ja) * | 1991-06-11 | 1998-02-16 | 株式会社ケーヒン | 定流量弁 |
| WO2009068242A2 (en) * | 2007-11-26 | 2009-06-04 | Cognis Ip Management Gmbh | Polyamides prepared from long-chain dicarboxylic acids and methods for making the polyamides |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2277125A (en) * | 1939-10-05 | 1942-03-24 | Du Pont | Preparation of polyamides |
| NL264738A (esLanguage) * | 1959-10-29 | |||
| US3145193A (en) * | 1959-10-29 | 1964-08-18 | Grace W R & Co | Polyamides from a mixture of isophthalic acid, terephthalic acid and branched chain aliphatic diamine |
| NL264673A (esLanguage) * | 1961-05-08 | |||
| NL126760C (esLanguage) * | 1961-05-08 | |||
| US3563959A (en) * | 1966-06-25 | 1971-02-16 | Dynamit Nobel Ag | Process for the production of transparent polyamides which are resistant to boiling |
| GB1251520A (esLanguage) | 1968-11-04 | 1971-10-27 | ||
| US3706802A (en) * | 1969-09-26 | 1972-12-19 | Universal Oil Prod Co | N-(2,2-di-substituted-vinyl)-arylimines |
| CH570389A5 (esLanguage) * | 1972-06-16 | 1975-12-15 | Ciba Geigy Ag | |
| CH630932A5 (de) * | 1977-10-28 | 1982-07-15 | Ciba Geigy Ag | Verfahren zur herstellung von neuen transparenten polyamiden. |
-
1979
- 1979-10-09 US US06/083,142 patent/US4297480A/en not_active Expired - Lifetime
- 1979-10-12 EP EP79810124A patent/EP0012712B1/de not_active Expired
- 1979-10-12 DE DE7979810124T patent/DE2963644D1/de not_active Expired
- 1979-10-16 CA CA337,676A patent/CA1129588A/en not_active Expired
- 1979-10-18 JP JP13366879A patent/JPS5556125A/ja active Granted
-
1987
- 1987-11-25 JP JP62295418A patent/JPS63146926A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0144247B2 (esLanguage) | 1989-09-26 |
| JPS63146926A (ja) | 1988-06-18 |
| CA1129588A (en) | 1982-08-10 |
| DE2963644D1 (en) | 1982-10-28 |
| US4297480A (en) | 1981-10-27 |
| EP0012712B1 (de) | 1982-09-08 |
| EP0012712A1 (de) | 1980-06-25 |
| JPS5556125A (en) | 1980-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Carothers | Polymerization. | |
| US2891088A (en) | Di(cyanoalkyl) and di(cyanoalkenyl) polyhydrocarbylxylylenes | |
| JPS6331498B2 (esLanguage) | ||
| US4258176A (en) | Transparent copolyamide from 1,10-disubstituted C11 diamine | |
| US4277621A (en) | Substituted 11-amino-undeca-4,8-dienal and 11-amino-undecanal derivatives and processes for their preparation | |
| US4210742A (en) | Transparent polyamides from branched chain diamine | |
| US4195165A (en) | Aliphatic polyamide from disubstituted decane diamine | |
| US4210743A (en) | Transparent polyamides from branched chain diamines | |
| JPS582329A (ja) | 透明なポリアミド類、その製造方法およびそれからなる成型品 | |
| US3396151A (en) | Polyamides from methylene dibenzoic acid characterized by relatively high softening and melting points | |
| JPH0132850B2 (esLanguage) | ||
| US2790788A (en) | Linear polyamide polymers of 4-aminocyclohexyl-acetic acid | |
| CA1120190A (en) | Crystalline polyamides | |
| EP0069067B1 (de) | Transparente Polyamide, Verfahren zu deren Herstellung und deren Verwendung zur Herstellung von Formkörpern | |
| US4258177A (en) | Transparent copolyamide from 1,10-disubstituted C10 diamine | |
| CA1120192A (en) | Aliphatic polyamides | |
| US4506099A (en) | Process for producing substituted 1,11-diaminoundecanes | |
| US4460790A (en) | Substituted 1,11-diaminoundecanes, processes for producing them, and their use | |
| US4202961A (en) | Transparent polyamide from aromatic dicarboxylic acid and disubstituted decane diamine | |
| US4716248A (en) | Aminocyclohexyl-substituted, branch alkylamines |