JPS6317800B2 - - Google Patents
Info
- Publication number
- JPS6317800B2 JPS6317800B2 JP55121265A JP12126580A JPS6317800B2 JP S6317800 B2 JPS6317800 B2 JP S6317800B2 JP 55121265 A JP55121265 A JP 55121265A JP 12126580 A JP12126580 A JP 12126580A JP S6317800 B2 JPS6317800 B2 JP S6317800B2
- Authority
- JP
- Japan
- Prior art keywords
- weight
- fuse
- delay
- composition
- diameter
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 34
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 11
- 229910052721 tungsten Inorganic materials 0.000 claims description 11
- 239000010937 tungsten Substances 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 238000005253 cladding Methods 0.000 claims description 6
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 claims description 6
- 229910001487 potassium perchlorate Inorganic materials 0.000 claims description 6
- QFFVPLLCYGOFPU-UHFFFAOYSA-N barium chromate Chemical compound [Ba+2].[O-][Cr]([O-])(=O)=O QFFVPLLCYGOFPU-UHFFFAOYSA-N 0.000 claims description 5
- 229940083898 barium chromate Drugs 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 5
- 239000000956 alloy Substances 0.000 claims description 4
- 229910045601 alloy Inorganic materials 0.000 claims description 4
- 238000002485 combustion reaction Methods 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 229910052787 antimony Inorganic materials 0.000 description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 2
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910000978 Pb alloy Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- -1 oxides Chemical class 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229910000314 transition metal oxide Inorganic materials 0.000 description 1
- 239000013585 weight reducing agent Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C5/00—Fuses, e.g. fuse cords
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Fuses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7922278A FR2464932A1 (fr) | 1979-09-06 | 1979-09-06 | Cordeau-retard a vitesse de combustion lente et a faible diametre |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5641894A JPS5641894A (en) | 1981-04-18 |
| JPS6317800B2 true JPS6317800B2 (enExample) | 1988-04-15 |
Family
ID=9229401
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP12126580A Granted JPS5641894A (en) | 1979-09-06 | 1980-09-03 | Time delay fuse with small diameter |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4356768A (enExample) |
| EP (1) | EP0025732B2 (enExample) |
| JP (1) | JPS5641894A (enExample) |
| DE (1) | DE3065888D1 (enExample) |
| FR (1) | FR2464932A1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3808366A1 (de) * | 1988-03-12 | 1989-10-05 | Dynamit Nobel Ag | Verzoegerungssaetze mit langen verzoegerungszeiten |
| FR2706449B1 (fr) * | 1993-06-18 | 1995-08-11 | Giat Ind Sa | Composition pyrotechnique pour cordeaux retards. |
| US5333550A (en) * | 1993-07-06 | 1994-08-02 | Teledyne Mccormick Selph | Tin alloy sheath material for explosive-pyrotechnic linear products |
| US5501154A (en) * | 1993-07-06 | 1996-03-26 | Teledyne Industries, Inc. | Substantially lead-free tin alloy sheath material for explosive-pyrotechnic linear products |
| RU2154623C1 (ru) * | 1999-08-02 | 2000-08-20 | Российский Федеральный Ядерный Центр - Всероссийский Научно-Исследовательский Институт Экспериментальной Физики | Детонирующий шнур |
| RU2174503C1 (ru) * | 2000-04-17 | 2001-10-10 | Федеральное государственное унитарное предприятие "Научно-производственное предприятие "Краснознаменец" | Термопластичный пиротехнический состав для эластичного огнепроводного шнура, обладающего повышенной чувствительностью к лучу огня |
| CN100335859C (zh) * | 2001-11-24 | 2007-09-05 | 刘必坤 | 礼花弹定时引及其制作方法 |
| US20040055495A1 (en) * | 2002-04-23 | 2004-03-25 | Hannagan Harold W. | Tin alloy sheathed explosive device |
| RU2306306C2 (ru) * | 2005-10-10 | 2007-09-20 | Российская Федерация, от имени которой выступает государственный заказчик-Федеральное агентство по атомной энергии | Состав для изготовления пиротехнического эластичного материала (варианты) |
| RU2386608C1 (ru) * | 2009-02-24 | 2010-04-20 | Российская Федерация, от имени которой выступает государственный заказчик - Государственная корпорация по атомной энергии "Росатом" | Состав для изготовления пиротехнического эластичного материала |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3173367A (en) * | 1963-05-17 | 1965-03-16 | Commerical Solvents Corp | Composition comprising barium chromate, boron and lead dioxide |
| US3528864A (en) * | 1965-09-21 | 1970-09-15 | Us Navy | High impulse explosives containing tungsten |
| US3664898A (en) * | 1969-08-04 | 1972-05-23 | Us Navy | Pyrotechnic composition |
| US3684594A (en) * | 1970-05-15 | 1972-08-15 | Hercules Inc | Aqueous explosive compositions having reversible fluent-nonfluent properties |
| FR2166732A5 (en) * | 1972-01-06 | 1973-08-17 | Poudres & Explosifs Ste Nale | Lead sheathed detonating fuse - with stainless steel outer sheath |
| US3901747A (en) * | 1973-09-10 | 1975-08-26 | Allied Chem | Pyrotechnic composition with combined binder-coolant |
| US4144814A (en) * | 1976-07-08 | 1979-03-20 | Systems, Science And Software | Delay detonator device |
-
1979
- 1979-09-06 FR FR7922278A patent/FR2464932A1/fr active Granted
-
1980
- 1980-08-20 DE DE8080401194T patent/DE3065888D1/de not_active Expired
- 1980-08-20 EP EP80401194A patent/EP0025732B2/fr not_active Expired
- 1980-08-21 US US06/179,973 patent/US4356768A/en not_active Expired - Lifetime
- 1980-09-03 JP JP12126580A patent/JPS5641894A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2464932B1 (enExample) | 1982-06-04 |
| EP0025732B2 (fr) | 1986-09-24 |
| DE3065888D1 (en) | 1984-01-19 |
| EP0025732A3 (en) | 1982-02-10 |
| US4356768A (en) | 1982-11-02 |
| JPS5641894A (en) | 1981-04-18 |
| EP0025732A2 (fr) | 1981-03-25 |
| FR2464932A1 (fr) | 1981-03-20 |
| EP0025732B1 (fr) | 1983-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69612300T2 (de) | Pyrotechnische ladung für zünder | |
| DE2946422C2 (enExample) | ||
| US3503814A (en) | Pyrotechnic composition containing nickel and aluminum | |
| US4080902A (en) | High speed igniter device | |
| CA1335040C (en) | Initiating element for non-primary explosive detonators | |
| US3134329A (en) | Exploding bridgewire coating | |
| US3753811A (en) | Igniter composition | |
| US2974596A (en) | Propellant grain igniter | |
| JPS6317800B2 (enExample) | ||
| US3376174A (en) | Powder containing nitrocellulose, metal or metal hydride and a superficial layer of moderating agent | |
| US4419153A (en) | Pyrotechnical delay charge | |
| US5351618A (en) | Shock tube initiator | |
| US5959235A (en) | Fire mitigation device | |
| US3617405A (en) | Incendiary composition containing a metal, metal alloy, oxidizer salt, and nitrated organic compound | |
| US3390029A (en) | Inorganic oxidizer salt explosive composition containing organic fuel solvent for said salt | |
| US4570540A (en) | LOVA Type black powder propellant surrogate | |
| US1890112A (en) | Igniter charge for blasting caps | |
| CA1326137C (en) | Nitrocellulose propellant composition | |
| US3015275A (en) | Explosive initiators | |
| EP0323828B1 (de) | Sprengstoff für Gefechtsköpfe und Raketenfesttreibstoff | |
| US3228338A (en) | Jpn+pb | |
| US3180770A (en) | Propellant fuel containing magnesium aluminum alloy | |
| US5348597A (en) | Propellant formulation and process containing bi-metallic metal mixture | |
| US6143101A (en) | Chlorate-free autoignition compositions and methods | |
| US3963544A (en) | Priming formulation for rim fire ammunition |